Removed rpms
============

 - QGnomePlatform
 - QGnomePlatform-32bit
 - akonadi-plugin-kalarmcal
 - auto-factory
 - compiz-branding-SLED
 - docker-kubic
 - docker-kubic-bash-completion
 - docker-kubic-fish-completion
 - docker-kubic-kubeadm-criconfig
 - docker-kubic-zsh-completion
 - dracula-gtk-theme
 - eclipse-contributor-tools-bootstrap
 - eclipse-tests
 - eclipse-tests-bootstrap
 - falkon-gnome-keyring
 - gconf2-branding-SLED
 - gconf2-branding-SLES
 - gfxboot-branding-SLED
 - gfxboot-branding-SLES
 - gpars-bootstrap
 - gradle-bootstrap
 - groovy-bootstrap
 - grub2-arm64-efi-debug
 - ColPack-devel-32bit
 - FAudio-devel-32bit
 - Mesa-32bit
 - Mesa-dri-32bit
 - Mesa-gallium-32bit
 - Mesa-libEGL-devel-32bit
 - Mesa-libEGL1-32bit
 - Mesa-libGL-devel-32bit
 - Mesa-libGL1-32bit
 - Mesa-libGLESv1_CM-devel-32bit
 - Mesa-libd3d-32bit
 - Mesa-libd3d-devel-32bit
 - Mesa-libglapi-devel-32bit
 - Mesa-libglapi0-32bit
 - NetworkManager-devel-32bit
 - aalib-devel-32bit
 - adolc-devel-32bit
 - alsa-plugins-maemo-32bit
 - alsa-plugins-pulse-32bit
 - alsa-plugins-samplerate-32bit
 - at-spi2-core-devel-32bit
 - atk-devel-32bit
 - augeas-devel-32bit
 - binutils-devel-32bit
 - blas-devel-32bit
 - cairomm1_0-devel-32bit
 - clang5-devel-32bit
 - cups-devel-32bit
 - cyrus-sasl-gssapi-32bit
 - cyrus-sasl-ldap-auxprop-32bit
 - cyrus-sasl-plain-32bit
 - dbus-1-glib-32bit
 - dirac-devel-32bit
 - ecryptfs-utils-32bit
 - ecryptfs-utils-devel-32bit
 - evolution-data-server-32bit
 - fcitx-gtk2-32bit
 - fcitx-gtk3-32bit
 - file-devel-32bit
 - flac-devel-32bit
 - fltk-devel-32bit
 - fontconfig-32bit
 - fontconfig-devel-32bit
 - freeglut-devel-32bit
 - gconf2-32bit
 - gdk-pixbuf-devel-32bit
 - gdk-pixbuf-loader-rsvg-32bit
 - gdk-pixbuf-query-loaders-32bit
 - giflib-devel-32bit
 - glib-networking-32bit
 - glib2-devel-32bit
 - glib2-tools-32bit
 - glibc-locale-base-32bit
 - glibc-utils-32bit
 - glu-devel-32bit
 - gmp-devel-32bit
 - gnome-keyring-pam-32bit
 - google-compute-engine-oslogin-32bit
 - gstreamer-32bit
 - gstreamer-plugins-bad-32bit
 - gstreamer-plugins-bad-fluidsynth-32bit
 - gstreamer-plugins-base-32bit
 - gstreamer-plugins-farstream-32bit
 - gstreamer-plugins-good-jack-32bit
 - gtk2-devel-32bit
 - gtk2-engine-clearlooks-32bit
 - gtk2-engine-crux-32bit
 - gtk2-engine-industrial-32bit
 - gtk2-immodule-amharic-32bit
 - gtk2-immodule-tigrigna-32bit
 - gtk2-immodule-vietnamese-32bit
 - gtk2-immodule-xim-32bit
 - gtk2-theming-engine-adwaita-32bit
 - gtk3-immodule-inuktitut-32bit
 - gtk3-immodule-multipress-32bit
 - gtk3-immodule-wayland-32bit
 - gtk3-tools-32bit
 - gvfs-32bit
 - hdf5-devel-32bit
 - hdf5-mvapich2-devel-32bit
 - hdf5-openmpi2-devel-32bit
 - hdf5-openmpi3-devel-32bit
 - ibus-gtk-32bit
 - jack-32bit
 - jitterentropy-devel-32bit
 - kauth-devel-32bit
 - kbookmarks-devel-32bit
 - kcodecs-devel-32bit
 - kcompletion-devel-32bit
 - kconfig-devel-32bit
 - kconfigwidgets-devel-32bit
 - kcoreaddons-devel-32bit
 - kdbusaddons-devel-32bit
 - kglobalaccel-devel-32bit
 - kguiaddons-devel-32bit
 - kiconthemes-devel-32bit
 - kio-core-32bit
 - kio-devel-32bit
 - krb5-devel-32bit
 - kservice-32bit
 - ktextwidgets-devel-32bit
 - ladspa-32bit
 - libColPack0-32bit
 - libFLAC8-32bit
 - libGLU1-32bit
 - libGLw1-32bit
 - libGLwM1-32bit
 - libGeoIP-devel-32bit
 - libGeoIP1-32bit
 - libHX-devel-32bit
 - libHX28-32bit
 - libHalf23-32bit
 - libICE-devel-32bit
 - libICE6-32bit
 - libIlmImfUtil-2_2-23-32bit
 - libIlmThread-2_2-23-32bit
 - libKF5Archive5-32bit
 - libKF5Auth5-32bit
 - libKF5AuthCore5-32bit
 - libKF5Bookmarks5-32bit
 - libKF5ConfigCore5-32bit
 - libKF5ConfigGui5-32bit
 - libKF5ConfigWidgets5-32bit
 - libKF5DocTools5-32bit
 - libKF5GlobalAccel5-32bit
 - libKF5GuiAddons5-32bit
 - libKF5ItemViews5-32bit
 - libKF5JobWidgets5-32bit
 - libKF5Notifications5-32bit
 - libKF5Solid5-32bit
 - libKF5SonnetCore5-32bit
 - libKF5Wallet5-32bit
 - libKF5XmlGui5-32bit
 - libLLVM13-32bit
 - libLLVM15-32bit
 - libLLVM5-32bit
 - libLLVM7-32bit
 - libLTO5-32bit
 - libLTO7-32bit
 - libLTO9-32bit
 - libMagick++-devel-32bit
 - libMagickCore-7_Q16HDRI10-32bit
 - libMagickWand-7_Q16HDRI10-32bit
 - libOSMesa8-32bit
 - libQt53DCore5-32bit
 - libQt53DInput5-32bit
 - libQt53DLogic5-32bit
 - libQt53DRender5-32bit
 - libQt5Bluetooth5-32bit
 - libQt5Bootstrap-devel-static-32bit
 - libQt5Core-devel-32bit
 - libQt5Core5-32bit
 - libQt5DBus-devel-32bit
 - libQt5Designer5-32bit
 - libQt5Help5-32bit
 - libQt5Multimedia5-32bit
 - libQt5Network-devel-32bit
 - libQt5Network5-32bit
 - libQt5Positioning5-32bit
 - libQt5PrintSupport5-32bit
 - libQt5RemoteObjects5-32bit
 - libQt5SerialPort5-32bit
 - libQt5Sql5-postgresql-32bit
 - libQt5Sql5-unixODBC-32bit
 - libQt5Svg5-32bit
 - libQt5WaylandClient5-32bit
 - libQt5WaylandCompositor5-32bit
 - libQt5WebSockets5-32bit
 - libQt5Widgets-devel-32bit
 - libQt5Xml5-32bit
 - libQtQuick5-32bit
 - libSDL-devel-32bit
 - libSDL2_gfx-1_0-0-32bit
 - libSDL2_image-2_0-0-32bit
 - libSDL2_net-2_0-0-32bit
 - libSDL2_net-devel-32bit
 - libSDL_gfx15-32bit
 - libSDL_image-1_2-0-32bit
 - libSDL_mixer-1_2-0-32bit
 - libSDL_mixer-devel-32bit
 - libSDL_net-1_2-0-32bit
 - libSDL_net-devel-32bit
 - libSDL_ttf-devel-32bit
 - libSDLmm-devel-32bit
 - libX11-6-32bit
 - libXau-devel-32bit
 - libXaw-devel-32bit
 - libXaw3d-devel-32bit
 - libXaw3d6-32bit
 - libXaw3d8-32bit
 - libXaw7-32bit
 - libXcomposite-devel-32bit
 - libXdamage-devel-32bit
 - libXdmcp-devel-32bit
 - libXdmcp6-32bit
 - libXext-devel-32bit
 - libXfont-devel-32bit
 - libXfont1-32bit
 - libXfont2-2-32bit
 - libXfont2-devel-32bit
 - libXfontcache1-32bit
 - libXft-devel-32bit
 - libXi6-32bit
 - libXinerama-devel-32bit
 - libXinerama1-32bit
 - libXmu-devel-32bit
 - libXmu6-32bit
 - libXprintAppUtil-devel-32bit
 - libXrandr-devel-32bit
 - libXres-devel-32bit
 - libXss1-32bit
 - libXtst6-32bit
 - libXvMC-devel-32bit
 - libXvMC1-32bit
 - libXxf86vm1-32bit
 - libZXing1-32bit
 - liba52-0-32bit
 - libaa1-32bit
 - libacl-devel-32bit
 - libacl1-32bit
 - libaom3-32bit
 - libapparmor1-32bit
 - libarchive13-32bit
 - libart_lgpl_2-2-32bit
 - libasound2-32bit
 - libassuan0-32bit
 - libatk-1_0-0-32bit
 - libatkmm-1_6-1-32bit
 - libatspi0-32bit
 - libattr-devel-32bit
 - libaugeas0-32bit
 - libauparse0-32bit
 - libavahi-client3-32bit
 - libavc1394-devel-32bit
 - libavcodec57-32bit
 - libavcodec58_134-32bit
 - libavfilter6-32bit
 - libavfilter7_110-32bit
 - libavresample4_0-32bit
 - libavtp0-32bit
 - libbabl-0_1-0-32bit
 - libbasicobjects-devel-32bit
 - libblas3-32bit
 - libblkid1-32bit
 - libbonoboui-32bit
 - libboost_atomic1_75_0-32bit
 - libboost_container_legacy-32bit
 - libboost_context_legacy-32bit
 - libboost_coroutine_legacy-32bit
 - libboost_date_time1_75_0-32bit
 - libboost_date_time_legacy-32bit
 - libboost_fiber1_75_0-32bit
 - libboost_filesystem1_75_0-32bit
 - libboost_filesystem_legacy-32bit
 - libboost_graph_legacy-32bit
 - libboost_graph_parallel1_66_0-32bit
 - libboost_graph_parallel1_75_0-32bit
 - libboost_iostreams1_66_0-32bit
 - libboost_iostreams1_75_0-32bit
 - libboost_locale_legacy-32bit
 - libboost_mpi1_66_0-32bit
 - libboost_nowide1_75_0-32bit
 - libboost_program_options_legacy-32bit
 - libboost_python-py2_7-1_66_0-32bit
 - libboost_random_legacy-32bit
 - libboost_regex1_66_0-32bit
 - libboost_serialization1_75_0-32bit
 - libboost_serialization_legacy-32bit
 - libboost_stacktrace1_66_0-32bit
 - libboost_stacktrace_legacy-32bit
 - libboost_system_legacy-32bit
 - libboost_test1_66_0-32bit
 - libboost_test1_75_0-32bit
 - libboost_test_legacy-32bit
 - libboost_thread1_75_0-32bit
 - libboost_type_erasure1_66_0-32bit
 - libboost_type_erasure1_75_0-32bit
 - libboost_type_erasure_legacy-32bit
 - libboost_wave1_75_0-32bit
 - libbox2d-devel-32bit
 - libbrotlidec1-32bit
 - libbrotlienc1-32bit
 - libbs2b0-32bit
 - libbz2-1-32bit
 - libcairo-gobject2-32bit
 - libcairo-script-interpreter2-32bit
 - libcairomm-1_0-1-32bit
 - libcanberra-gtk3-0-32bit
 - libcanberra-gtk3-module-32bit
 - libcanberra0-32bit
 - libcap1-32bit
 - libcblas3-32bit
 - libcdda_interface0-32bit
 - libcdda_paranoia0-32bit
 - libcddb2-32bit
 - libcdio++0-32bit
 - libcdio16-32bit
 - libcdio19-32bit
 - libcdio_cdda2-32bit
 - libchewing3-32bit
 - libclang-cpp13-32bit
 - libclang11-32bit
 - libclang5-32bit
 - libclang9-32bit
 - libclucene-core1-32bit
 - libcollection-devel-32bit
 - libconfig11-32bit
 - libcppunit-1_14-0-32bit
 - libcrack2-32bit
 - libcroco-0_6-3-32bit
 - libcryptmount0-32bit
 - libcryptsetup12-32bit
 - libcupscgi1-32bit
 - libcupsppdc1-32bit
 - libcurl-devel-32bit
 - libdav1d5-32bit
 - libdb-4_8-32bit
 - libdbi3-32bit
 - libdbus-1-3-32bit
 - libdbus-c++-glib-1-1-32bit
 - libdc1394-22-32bit
 - libdevmapper-event1_03-32bit
 - libdirac_encoder0-32bit
 - libdmapsharing-3_0-2-32bit
 - libdns_sd-32bit
 - libdouble-conversion3-32bit
 - libdrm-devel-32bit
 - libdrm_intel1-32bit
 - libdrm_nouveau2-32bit
 - libdvbv5-0-32bit
 - libdw1-32bit
 - libdwarves-devel-32bit
 - libebackend-1_2-10-32bit
 - libebl-plugins-32bit
 - libebook-contacts-1_2-3-32bit
 - libecpg6-32bit
 - libedata-book-1_2-26-32bit
 - libedata-cal-2_0-1-32bit
 - libedit0-32bit
 - libelf-devel-32bit
 - libelf1-32bit
 - libenchant-2-2-32bit
 - libev4-32bit
 - libevdev2-32bit
 - libexempi3-32bit
 - libexif12-32bit
 - libexiv2-26-32bit
 - libexpat-devel-32bit
 - libext2fs-devel-32bit
 - libfabric-devel-32bit
 - libfarstream-0_2-5-32bit
 - libfdisk1-32bit
 - libfdt-devel-32bit
 - libfdt1-32bit
 - libffado2-32bit
 - libffi8-32bit
 - libffi_3_4-devel-32bit
 - libfftw3-3-32bit
 - libfftw3_mpi3-32bit
 - libfipscheck1-32bit
 - libfl-devel-32bit
 - libfl2-32bit
 - libfltk1-32bit
 - libfluidsynth3-32bit
 - libfmt8-32bit
 - libfontconfig1-32bit
 - libfontenc1-32bit
 - libfreetype6-32bit
 - libfuse2-32bit
 - libgamin-1-0-32bit
 - libgbm-devel-32bit
 - libgck-1-0-32bit
 - libgck-devel-32bit
 - libgcr-3-1-32bit
 - libgdata22-32bit
 - libgdbm4-32bit
 - libgegl-0_4-0-32bit
 - libgexiv2-2-32bit
 - libgimp-2_0-0-32bit
 - libgimpui-2_0-0-32bit
 - libgio-2_0-0-32bit
 - libgiomm-2_68-1-32bit
 - libgirepository-1_0-1-32bit
 - libglib-2_0-0-32bit
 - libglut3-32bit
 - libglvnd-devel-32bit
 - libgmp10-32bit
 - libgnome-desktop-3-18-32bit
 - libgnome-keyring0-32bit
 - libgnomeui-32bit
 - libgnt0-32bit
 - libgnutls30-32bit
 - libgnutls30-hmac-32bit
 - libgoa-1_0-0-32bit
 - libgoa-backend-1_0-1-32bit
 - libgpg-error0-32bit
 - libgphoto2-devel-32bit
 - libgraphene-1_0-0-32bit
 - libgraphite2-3-32bit
 - libgsf-1-114-32bit
 - libgsm-devel-32bit
 - libgsm1-32bit
 - libgssdp-1_2-0-32bit
 - libgstadaptivedemux-1_0-0-32bit
 - libgstallocators-1_0-0-32bit
 - libgstapp-1_0-0-32bit
 - libgstaudio-1_0-0-32bit
 - libgstbadaudio-1_0-0-32bit
 - libgstcodecs-1_0-0-32bit
 - libgstpbutils-1_0-0-32bit
 - libgstphotography-1_0-0-32bit
 - libgstreamer-1_0-0-32bit
 - libgstrtp-1_0-0-32bit
 - libgstrtsp-1_0-0-32bit
 - libgstsctp-1_0-0-32bit
 - libgsturidownloader-1_0-0-32bit
 - libgstva-1_0-0-32bit
 - libgstwayland-1_0-0-32bit
 - libgstwebrtc-1_0-0-32bit
 - libgstwebrtcnice-1_0-0-32bit
 - libgthread-2_0-0-32bit
 - libgtk-2_0-0-32bit
 - libgtk-3-0-32bit
 - libgtkmm-2_4-1-32bit
 - libgtop-2_0-11-32bit
 - libguess1-32bit
 - libgusb2-32bit
 - libgypsy0-32bit
 - libhangul1-32bit
 - libharfbuzz-gobject0-32bit
 - libharfbuzz-subset0-32bit
 - libharfbuzz0-32bit
 - libhdf5-103-mvapich2-32bit
 - libhdf5-103-openmpi2-32bit
 - libhdf5-103-openmpi3-32bit
 - libhdf5_cpp103-mvapich2-32bit
 - libhdf5_cpp103-openmpi2-32bit
 - libhdf5_cpp103-openmpi4-32bit
 - libhdf5_fortran102-openmpi2-32bit
 - libhdf5_hl100-mvapich2-32bit
 - libhdf5_hl100-openmpi2-32bit
 - libhdf5_hl100-openmpi3-32bit
 - libhdf5_hl100-openmpi4-32bit
 - libhdf5_hl_cpp100-32bit
 - libhdf5_hl_cpp100-mvapich2-32bit
 - libhdf5_hl_cpp100-openmpi2-32bit
 - libhdf5hl_fortran100-openmpi2-32bit
 - libhdf5hl_fortran100-openmpi3-32bit
 - libhdf5hl_fortran100-openmpi4-32bit
 - libhogweed6-32bit
 - libhttp_parser2_7_1-32bit
 - libhugetlbfs-32bit
 - libhunspell-1_6-0-32bit
 - libhyphen0-32bit
 - libibmad5-32bit
 - libibumad3-32bit
 - libibus-1_0-5-32bit
 - libibverbs-32bit
 - libibverbs1-32bit
 - libicu-devel-32bit
 - libicu60_2-32bit
 - libid3tag0-32bit
 - libiec61883-0-32bit
 - libigfxcmrt7-32bit
 - libimobiledevice-1_0-6-32bit
 - libimobiledevice-glue-1_0-0-32bit
 - libini_config-devel-32bit
 - libiniparser1-32bit
 - libjack-devel-32bit
 - libjacknet0-32bit
 - libjavascriptcoregtk-4_1-0-32bit
 - libjbig-devel-32bit
 - libjpeg62-devel-32bit
 - libjson-c3-32bit
 - libkate1-32bit
 - libkeyutils1-32bit
 - libkkc2-32bit
 - libkyotocabinet16-32bit
 - liblbxutil1-32bit
 - libldb2-32bit
 - liblmdb-0_9_17-32bit
 - liblqr-1-0-32bit
 - libltdl7-32bit
 - liblua5_3-5-32bit
 - libluajit-5_1-2-32bit
 - liblz4-1-32bit
 - liblzo2-2-32bit
 - libm17n0-32bit
 - libmanette-0_2-0-32bit
 - libmariadb3-32bit
 - libmikmod3-32bit
 - libminizip1-32bit
 - libmjpegutils-2_0-0-32bit
 - libmms0-32bit
 - libmnl0-32bit
 - libmodman1-32bit
 - libmodplug1-32bit
 - libmount-devel-32bit
 - libmount1-32bit
 - libmpc3-32bit
 - libmpcdec5-32bit
 - libmpeg2encpp-2_0-0-32bit
 - libmpg123-0-32bit
 - libmspack0-32bit
 - libmtdev1-32bit
 - libncurses6-32bit
 - libnetcdf18-32bit
 - libnetcdf18-openmpi4-32bit
 - libnetfilter_cthelper0-32bit
 - libnewt0_52-32bit
 - libnice10-32bit
 - libnotify-devel-32bit
 - libnotify4-32bit
 - libnss_usrfiles2-32bit
 - libnsssharedhelper0-32bit
 - libnuma1-32bit
 - libogg0-32bit
 - libopenal1-32bit
 - libopenblas_openmp-devel-32bit
 - libopenblas_pthreads-devel-32bit
 - libopenblas_pthreads0-32bit
 - libopenjp2-7-32bit
 - libopenjpeg1-32bit
 - libopensm9-32bit
 - libopenssl1_0_0-32bit
 - libopenssl1_0_0-hmac-32bit
 - libopenssl1_0_0-steam-32bit
 - libopenssl1_1-32bit
 - liboping-devel-32bit
 - libosmcomp5-32bit
 - libotf-devel-32bit
 - libpackagekit-glib2-18-32bit
 - libpackagekit-glib2-devel-32bit
 - libpango-1_0-0-32bit
 - libpangomm-1_4-1-32bit
 - libpapi-32bit
 - libpath_utils-devel-32bit
 - libpcap-devel-32bit
 - libpcre2-16-0-32bit
 - libpcsclite1-32bit
 - libpfm4-32bit
 - libpixman-1-0-32bit
 - libplist++-2_0-3-32bit
 - libplist-2_0-3-32bit
 - libpng16-compat-devel-32bit
 - libpng16-devel-32bit
 - libpolkit-agent-1-0-32bit
 - libpoppler-glib8-32bit
 - libpoppler-qt5-1-32bit
 - libpoppler117-32bit
 - libpoppler126-32bit
 - libportaudio2-32bit
 - libpostproc55_9-32bit
 - libpq5-32bit
 - libpspell15-32bit
 - libpulse-devel-32bit
 - libpulse-mainloop-glib0-32bit
 - libpulse0-32bit
 - libpython3_11-1_0-32bit
 - libqb-devel-32bit
 - libqb100-32bit
 - libqgpgme7-32bit
 - libqrencode4-32bit
 - libqt5-qtbase-examples-32bit
 - libqt5-qtconnectivity-devel-32bit
 - libqt5-qtdeclarative-devel-32bit
 - libqt5-qtlocation-devel-32bit
 - libqt5-qtmultimedia-devel-32bit
 - libqt5-qtscript-devel-32bit
 - libqt5-qtspeech-devel-32bit
 - libqt5-qtsvg-devel-32bit
 - libqt5-qttools-32bit
 - libqt5-qtwayland-devel-32bit
 - libqt5-qtwebchannel-devel-32bit
 - libqt5-qtxmlpatterns-devel-32bit
 - libraptor2-0-32bit
 - librav1e0-32bit
 - librdmacm1-32bit
 - libreadline7-32bit
 - libref_array1-32bit
 - librest-0_7-0-32bit
 - librsvg-2-2-32bit
 - libsamba-policy0-python3-32bit
 - libsbc1-32bit
 - libscalapack2-mvapich2-32bit
 - libschroedinger-1_0-0-32bit
 - libseccomp2-32bit
 - libsensors4-32bit
 - libserd-0-0-32bit
 - libshout3-32bit
 - libsigc-3_0-0-32bit
 - libslang2-32bit
 - libsmartcols1-32bit
 - libsnappy1-32bit
 - libsnmp30-32bit
 - libsoftokn3-32bit
 - libsord-0-0-32bit
 - libsoup-3_0-0-32bit
 - libsoup-devel-32bit
 - libspandsp2-32bit
 - libspeechd2-32bit
 - libspeex1-32bit
 - libspeexdsp1-32bit
 - libsrt1-32bit
 - libsrtp1-32bit
 - libsrtp2-1-32bit
 - libssh4-32bit
 - libswresample3_9-32bit
 - libswscale5_9-32bit
 - libsyn123-0-32bit
 - libtag_c0-32bit
 - libtasn1-6-32bit
 - libtasn1-devel-32bit
 - libtelepathy-glib0-32bit
 - libtevent0-32bit
 - libtiff-devel-32bit
 - libtool-32bit
 - libts0-32bit
 - libtspi1-32bit
 - libtss2-rc0-32bit
 - libtss2-tcti-cmd0-32bit
 - libtss2-tcti-mssim0-32bit
 - libtss2-tcti-swtpm0-32bit
 - libtss2-tctildr0-32bit
 - libuchardet0-32bit
 - libudev1-32bit
 - libudf0-32bit
 - libunistring2-32bit
 - liburcu6-32bit
 - liburiparser1-32bit
 - libusb-1_0-0-32bit
 - libusb-1_0-devel-32bit
 - libutempter0-32bit
 - libuuid1-32bit
 - libuv1-32bit
 - libv4l-32bit
 - libv4l-devel-32bit
 - libv4l2-0-32bit
 - libv4l2rds0-32bit
 - libv4lconvert0-32bit
 - libva-drm2-32bit
 - libva-gl-devel-32bit
 - libva-x11-2-32bit
 - libvdpau-devel-32bit
 - libvdpau1-32bit
 - libvdpau_nouveau-32bit
 - libvdpau_r300-32bit
 - libvdpau_virtio_gpu-32bit
 - libverto-glib1-32bit
 - libverto-tevent1-32bit
 - libvirt-devel-32bit
 - libvisual-32bit
 - libvmaf1-32bit
 - libvoikko1-32bit
 - libvorbis-devel-32bit
 - libvorbis0-32bit
 - libvotequorum8-32bit
 - libvpx7-32bit
 - libwacom9-32bit
 - libwayland-cursor0-32bit
 - libwayland-egl1-32bit
 - libwebkit2gtk-4_1-0-32bit
 - libwebp6-32bit
 - libwebp7-32bit
 - libwebpdecoder2-32bit
 - libwebpdemux2-32bit
 - libwebpmux2-32bit
 - libwnck-3-0-32bit
 - libwx_baseu-suse3-32bit
 - libwx_baseu_net-suse3_0_5-32bit
 - libwx_baseu_xml-suse3-32bit
 - libwx_gtk2u_adv-suse3_0_5-32bit
 - libwx_gtk2u_core-suse3-32bit
 - libwx_gtk2u_html-suse3-32bit
 - libwx_gtk2u_propgrid-suse3-32bit
 - libwx_gtk2u_propgrid-suse3_0_5-32bit
 - libwx_gtk2u_qa-suse3_0_5-32bit
 - libwx_gtk2u_richtext-suse3-32bit
 - libwx_gtk2u_richtext-suse3_0_5-32bit
 - libwx_gtk2u_stc-suse3_0_5-32bit
 - libwx_gtk2u_xrc-suse3_0_5-32bit
 - libxapian30-32bit
 - libxcb-composite0-32bit
 - libxcb-devel-32bit
 - libxcb-dpms0-32bit
 - libxcb-image0-32bit
 - libxcb-record0-32bit
 - libxcb-render-util0-32bit
 - libxcb-util1-32bit
 - libxcb-xfixes0-32bit
 - libxcb-xkb1-32bit
 - libxcb-xtest0-32bit
 - libxcb-xvmc0-32bit
 - libxcb1-32bit
 - libxcrypt-devel-32bit
 - libxkbcommon-devel-32bit
 - libxkbcommon0-32bit
 - libxkbfile-devel-32bit
 - libxkbfile1-32bit
 - libxkbui1-32bit
 - libxklavier16-32bit
 - libxml++-3_0-1-32bit
 - libxml2-devel-32bit
 - libxslt1-32bit
 - libyajl-devel-32bit
 - libyajl2-32bit
 - libzbarqt0-32bit
 - libzen0-32bit
 - libzmq5-32bit
 - libzstd1-32bit
 - libzvbi-chains0-32bit
 - libzvbi0-32bit
 - libzzip-0-13-32bit
 - llvm11-LTO-devel-32bit
 - llvm5-LTO-devel-32bit
 - llvm5-devel-32bit
 - llvm7-devel-32bit
 - llvm9-LTO-devel-32bit
 - ltrace-32bit
 - motif-devel-32bit
 - mozilla-nss-32bit
 - mpfr-devel-32bit
 - mpg123-devel-32bit
 - mpg123-jack-32bit
 - mpg123-openal-32bit
 - mpg123-portaudio-32bit
 - mpg123-pulse-32bit
 - munge-devel-32bit
 - ocl-icd-devel-32bit
 - openjpeg-devel-32bit
 - openmpi4-libs-32bit
 - openslp-32bit
 - opie-32bit
 - orbit2-32bit
 - p11-kit-32bit
 - pam-extra-32bit
 - pam_kwallet-32bit
 - pam_ldap-32bit
 - pam_ssh-32bit
 - perl-32bit
 - perl-base-32bit
 - perl-core-DB_File-32bit
 - pipewire-modules-0_3-32bit
 - pipewire-spa-plugins-0_2-32bit
 - python3-32bit
 - python3-base-32bit
 - python3-ldb-32bit
 - python3-tdb-32bit
 - python311-32bit
 - python311-base-32bit
 - rdma-core-devel-32bit
 - readline-devel-32bit
 - readline5-devel-32bit
 - rsocket-32bit
 - samba-ad-dc-32bit
 - samba-ad-dc-libs-32bit
 - samba-client-libs-32bit
 - samba-libs-32bit
 - samba-winbind-libs-32bit
 - sane-backends-32bit
 - solid-devel-32bit
 - sssd-common-32bit
 - sysfsutils-32bit
 - termcap-32bit
 - tk-32bit
 - tslib-devel-32bit
 - typelib-1_0-Gst-1_0-32bit
 - unixODBC-devel-32bit
 - vulkan-devel-32bit
 - wine-staging-devel-32bit
 - xcb-util-devel-32bit
 - xcb-util-keysyms-devel-32bit
 - xen-libs-32bit
 - xz-devel-32bit
 - zvbi-devel-32bit
 - grub2-powerpc-ieee1275
 - grub2-powerpc-ieee1275-debug
 - grub2-powerpc-ieee1275-extras
 - glibc-32bit
 - glibc-devel-32bit
 - glibc-devel-static-32bit
 - glibc-profile-32bit
 - kernel-obs-build
 - qemu-SLOF
 - qemu-seabios
 - qemu-sgabios
 - qemu-skiboot
 - syslinux-debuginfo-x86_64
 - java-11-openjdk-accessibility
 - java-cup-bootstrap
 - jctools-parent
 - jflex-bootstrap
 - jflex-doc
 - jgit-bootstrap
 - kalarmcal
 - kalarmcal-devel
 - kalarmcal-lang
 - kpkpass
 - libAnalitza5
 - libKF5AkonadiSearch
 - libKF5AlarmCalendar5
 - libKF5Screen7
 - libQgpsmm29
 - libantlr4-runtime4_7_2
 - libfm-qt10
 - libgps29
 - libgumbo-devel
 - libgumbo1
 - libhiredis1_0_0
 - libkdecorations2private9
 - libkdevplatform57
 - libkerfuffle21
 - libkpmcore11
 - libopencascade7_6
 - libqtermwidget5-0
 - librssguard-4_2_5
 - libslurm36
 - ltrace
 - lucene-facet
 - lucene-spatial
 - maven-plugin-plugin-bootstrap
 - mobipocket
 - nodejs16
 - nodejs16-devel
 - nodejs16-docs
 - npm16
 - ocaml-jsonm
 - ocaml-jsonm-devel
 - oxygen5-sounds
 - plasma-nm5-openswan
 - python3-qt3d-qt5-api
 - python3-qt3d-qt5-sip
 - python3-qtdatavis3d-qt5-api
 - python3-qtdatavis3d-qt5-sip
 - qt5-creator
 - qt5-creator-plugin-devel
 - qt6-qmlcompiler-devel-static
 - qt6-qmldevtools-devel-static
 - slf4j-log4j12
 - systemd-default-settings-branding-SLE
 - systemd-default-settings-branding-SLE-Micro
 - tealdeer
 - tesseract-ocr-traineddata-afrikaans
 - tesseract-ocr-traineddata-albanian
 - tesseract-ocr-traineddata-amharic
 - tesseract-ocr-traineddata-arabic
 - tesseract-ocr-traineddata-assamese
 - tesseract-ocr-traineddata-azerbaijani
 - tesseract-ocr-traineddata-azerbaijani_cyrillic
 - tesseract-ocr-traineddata-basque
 - tesseract-ocr-traineddata-belarusian
 - tesseract-ocr-traineddata-bengali
 - tesseract-ocr-traineddata-bosnian
 - tesseract-ocr-traineddata-bulgarian
 - tesseract-ocr-traineddata-burmese
 - tesseract-ocr-traineddata-catalan
 - tesseract-ocr-traineddata-cebuano
 - tesseract-ocr-traineddata-cherokee
 - tesseract-ocr-traineddata-chinese_simplified
 - tesseract-ocr-traineddata-chinese_traditional
 - tesseract-ocr-traineddata-croatian
 - tesseract-ocr-traineddata-czech
 - tesseract-ocr-traineddata-danish
 - tesseract-ocr-traineddata-dutch
 - tesseract-ocr-traineddata-dzongkha
 - tesseract-ocr-traineddata-english
 - tesseract-ocr-traineddata-english_middle
 - tesseract-ocr-traineddata-esperanto
 - tesseract-ocr-traineddata-estonian
 - tesseract-ocr-traineddata-finnish
 - tesseract-ocr-traineddata-frankish
 - tesseract-ocr-traineddata-french
 - tesseract-ocr-traineddata-french_middle
 - tesseract-ocr-traineddata-galician
 - tesseract-ocr-traineddata-georgian
 - tesseract-ocr-traineddata-georgian_old
 - tesseract-ocr-traineddata-german
 - tesseract-ocr-traineddata-greek
 - tesseract-ocr-traineddata-greek_ancient
 - tesseract-ocr-traineddata-gujarati
 - tesseract-ocr-traineddata-haitian
 - tesseract-ocr-traineddata-hebrew
 - tesseract-ocr-traineddata-hindi
 - tesseract-ocr-traineddata-hungarian
 - tesseract-ocr-traineddata-icelandic
 - tesseract-ocr-traineddata-indonese
 - tesseract-ocr-traineddata-inuktitut
 - tesseract-ocr-traineddata-irish
 - tesseract-ocr-traineddata-italian
 - tesseract-ocr-traineddata-italian_old
 - tesseract-ocr-traineddata-japanese
 - tesseract-ocr-traineddata-javanese
 - tesseract-ocr-traineddata-kannada
 - tesseract-ocr-traineddata-kazakh
 - tesseract-ocr-traineddata-khmer
 - tesseract-ocr-traineddata-korean
 - tesseract-ocr-traineddata-kurdish
 - tesseract-ocr-traineddata-kyrgyz
 - tesseract-ocr-traineddata-latin
 - tesseract-ocr-traineddata-latvian
 - tesseract-ocr-traineddata-lithuanian
 - tesseract-ocr-traineddata-macedonian
 - tesseract-ocr-traineddata-malay
 - tesseract-ocr-traineddata-malayalam
 - tesseract-ocr-traineddata-maltese
 - tesseract-ocr-traineddata-marathi
 - tesseract-ocr-traineddata-math_equation
 - tesseract-ocr-traineddata-nepali
 - tesseract-ocr-traineddata-norwegian
 - tesseract-ocr-traineddata-orientation_and_script_detection
 - tesseract-ocr-traineddata-oriya
 - tesseract-ocr-traineddata-pashto
 - tesseract-ocr-traineddata-persian
 - tesseract-ocr-traineddata-polish
 - tesseract-ocr-traineddata-portuguese
 - tesseract-ocr-traineddata-punjabi
 - tesseract-ocr-traineddata-romanian
 - tesseract-ocr-traineddata-russian
 - tesseract-ocr-traineddata-sanskrit
 - tesseract-ocr-traineddata-serbian
 - tesseract-ocr-traineddata-serbian_latin
 - tesseract-ocr-traineddata-sinhala
 - tesseract-ocr-traineddata-slovak
 - tesseract-ocr-traineddata-slovenian
 - tesseract-ocr-traineddata-spanish
 - tesseract-ocr-traineddata-spanish_old
 - tesseract-ocr-traineddata-swahili
 - tesseract-ocr-traineddata-swedish
 - tesseract-ocr-traineddata-syriac
 - tesseract-ocr-traineddata-tagalog
 - tesseract-ocr-traineddata-tajik
 - tesseract-ocr-traineddata-tamil
 - tesseract-ocr-traineddata-telugu
 - tesseract-ocr-traineddata-thai
 - tesseract-ocr-traineddata-tibetan_standard
 - tesseract-ocr-traineddata-tigrinya
 - tesseract-ocr-traineddata-turkish
 - tesseract-ocr-traineddata-ukrainian
 - tesseract-ocr-traineddata-urdu
 - tesseract-ocr-traineddata-uyghur
 - tesseract-ocr-traineddata-uzbek
 - tesseract-ocr-traineddata-uzbek_cyrillic
 - tesseract-ocr-traineddata-vietnamese
 - tesseract-ocr-traineddata-welsh
 - tesseract-ocr-traineddata-yiddish
 - xmvn-bisect

Added rpms
==========

 - ColPack-devel-32bit
 - FAudio-devel-32bit
 - Mesa-32bit
 - Mesa-dri-32bit
 - Mesa-gallium-32bit
 - Mesa-libEGL-devel-32bit
 - Mesa-libEGL1-32bit
 - Mesa-libGL-devel-32bit
 - Mesa-libGL1-32bit
 - Mesa-libGLESv1_CM-devel-32bit
 - Mesa-libd3d-32bit
 - Mesa-libd3d-devel-32bit
 - Mesa-libglapi-devel-32bit
 - Mesa-libglapi0-32bit
 - NetworkManager-devel-32bit
 - QGnomePlatform-qt5
 - QGnomePlatform-qt6
 - aalib-devel-32bit
 - adolc-devel-32bit
 - adwaita-qt6
 - alsa-plugins-maemo-32bit
 - alsa-plugins-pulse-32bit
 - alsa-plugins-samplerate-32bit
 - apache-commons-csv
 - apache-commons-csv-javadoc
 - apache-commons-ognl
 - apache-commons-ognl-javadoc
 - apache-commons-text
 - apache-commons-text-javadoc
 - apache-resource-bundles
 - apache-sshd
 - apache-sshd-javadoc
 - at-spi2-core-devel-32bit
 - atk-devel-32bit
 - augeas-devel-32bit
 - auto-service-aggregator
 - auto-service-annotations
 - auto-value-annotations
 - auto-value-parent
 - binutils-devel-32bit
 - blas-devel-32bit
 - bouncycastle-jmail
 - bouncycastle-util
 - cairomm1_0-devel-32bit
 - checker-qual
 - checker-qual-javadoc
 - cinnamon-theme-dracula
 - clang5-devel-32bit
 - classmate
 - classmate-javadoc
 - codemodel
 - codemodel-javadoc
 - commons-compiler
 - commons-compiler-jdk
 - concurrentlinkedhashmap-lru
 - concurrentlinkedhashmap-lru-javadoc
 - cups-devel-32bit
 - cyrus-sasl-gssapi-32bit
 - cyrus-sasl-ldap-auxprop-32bit
 - cyrus-sasl-plain-32bit
 - dbus-1-glib-32bit
 - dirac-devel-32bit
 - ecryptfs-utils-32bit
 - ecryptfs-utils-devel-32bit
 - ed25519-java
 - ed25519-java-javadoc
 - ee4j
 - evolution-data-server-32bit
 - fcitx-gtk2-32bit
 - fcitx-gtk3-32bit
 - felix-bundlerepository
 - felix-bundlerepository-javadoc
 - felix-osgi-obr
 - felix-osgi-obr-javadoc
 - file-devel-32bit
 - flac-devel-32bit
 - fltk-devel-32bit
 - fontconfig-32bit
 - fontconfig-devel-32bit
 - freeglut-devel-32bit
 - gconf2-32bit
 - gdk-pixbuf-devel-32bit
 - gdk-pixbuf-loader-rsvg-32bit
 - gdk-pixbuf-query-loaders-32bit
 - giflib-devel-32bit
 - glassfish-activation
 - glassfish-activation-api
 - glassfish-activation-javadoc
 - glassfish-fastinfoset
 - glassfish-fastinfoset-javadoc
 - glassfish-jaxb
 - glassfish-jaxb-api
 - glassfish-jaxb-api-javadoc
 - glassfish-jaxb-bom
 - glassfish-jaxb-bom-ext
 - glassfish-jaxb-codemodel
 - glassfish-jaxb-codemodel-annotation-compiler
 - glassfish-jaxb-codemodel-parent
 - glassfish-jaxb-external-parent
 - glassfish-jaxb-jxc
 - glassfish-jaxb-parent
 - glassfish-jaxb-relaxng-datatype
 - glassfish-jaxb-rngom
 - glassfish-jaxb-runtime
 - glassfish-jaxb-runtime-parent
 - glassfish-jaxb-txw-parent
 - glassfish-jaxb-txw2
 - glassfish-jaxb-txwc2
 - glassfish-jaxb-xjc
 - glassfish-jaxb-xsom
 - glib-networking-32bit
 - glib2-devel-32bit
 - glib2-tools-32bit
 - glibc-locale-base-32bit
 - glibc-utils-32bit
 - glu-devel-32bit
 - gmp-devel-32bit
 - gnome-keyring-pam-32bit
 - gnome-shell-theme-dracula
 - go1.20
 - go1.20-doc
 - go1.20-race
 - google-compute-engine-oslogin-32bit
 - google-errorprone-annotation
 - google-errorprone-annotations
 - google-errorprone-annotations-javadoc
 - google-errorprone-docgen_processor
 - google-errorprone-javadoc
 - google-errorprone-parent
 - google-errorprone-type_annotations
 - grub2-arm64-efi-debug
 - grub2-powerpc-ieee1275
 - grub2-powerpc-ieee1275-debug
 - grub2-powerpc-ieee1275-extras
 - gstreamer-32bit
 - gstreamer-plugins-bad-32bit
 - gstreamer-plugins-bad-fluidsynth-32bit
 - gstreamer-plugins-base-32bit
 - gstreamer-plugins-farstream-32bit
 - gstreamer-plugins-good-jack-32bit
 - gstreamer-plugins-vaapi-devel
 - gtk2-devel-32bit
 - gtk2-engine-clearlooks-32bit
 - gtk2-engine-crux-32bit
 - gtk2-engine-industrial-32bit
 - gtk2-immodule-amharic-32bit
 - gtk2-immodule-tigrigna-32bit
 - gtk2-immodule-vietnamese-32bit
 - gtk2-immodule-xim-32bit
 - gtk2-metatheme-dracula
 - gtk2-theming-engine-adwaita-32bit
 - gtk3-immodule-inuktitut-32bit
 - gtk3-immodule-multipress-32bit
 - gtk3-immodule-wayland-32bit
 - gtk3-metatheme-dracula
 - gtk3-tools-32bit
 - gtk4-metatheme-breeze
 - gtk4-metatheme-dracula
 - gvfs-32bit
 - hdf5-devel-32bit
 - hdf5-mvapich2-devel-32bit
 - hdf5-openmpi2-devel-32bit
 - hdf5-openmpi3-devel-32bit
 - ibus-gtk-32bit
 - import-properties-plugin
 - indi
 - indi-devel
 - indi-plugins
 - istack-commons
 - istack-commons-buildtools
 - istack-commons-maven-plugin
 - istack-commons-runtime
 - istack-commons-soimp
 - istack-commons-test
 - istack-commons-tools
 - j2objc-annotations
 - j2objc-annotations-javadoc
 - jack-32bit
 - jackson-module-afterburner
 - jackson-module-blackbird
 - jackson-module-guice
 - jackson-module-jaxb-annotations
 - jackson-module-mrbean
 - jackson-module-no-ctor-deser
 - jackson-module-osgi
 - jackson-module-paranamer
 - jackson-modules-base
 - jackson-modules-base-javadoc
 - jakarta-activation
 - jakarta-activation-javadoc
 - jakarta-mail
 - jakarta-mail-javadoc
 - jandex
 - jandex-javadoc
 - jcache
 - jcache-javadoc
 - jflex-javadoc
 - jitterentropy-devel-32bit
 - junit5-bom
 - kalendarac
 - kauth-devel-32bit
 - kbookmarks-devel-32bit
 - kcmutils-imports
 - kcodecs-devel-32bit
 - kcompletion-devel-32bit
 - kconfig-devel-32bit
 - kconfigwidgets-devel-32bit
 - kcoreaddons-devel-32bit
 - kdbusaddons-devel-32bit
 - kde-theme-dracula
 - kglobalaccel-devel-32bit
 - kguiaddons-devel-32bit
 - kiconthemes-devel-32bit
 - kio-core-32bit
 - kio-devel-32bit
 - kpipewire-devel
 - kpipewire-imports
 - krb5-devel-32bit
 - ksanecore-devel
 - ksanecore-lang
 - kservice-32bit
 - ktextwidgets-devel-32bit
 - kvantum-qt6
 - ladspa-32bit
 - libAnalitza8
 - libColPack0-32bit
 - libFLAC8-32bit
 - libGLU1-32bit
 - libGLw1-32bit
 - libGLwM1-32bit
 - libGeoIP-devel-32bit
 - libGeoIP1-32bit
 - libHX-devel-32bit
 - libHX28-32bit
 - libHalf23-32bit
 - libICE-devel-32bit
 - libICE6-32bit
 - libIlmImfUtil-2_2-23-32bit
 - libIlmThread-2_2-23-32bit
 - libKF5AkonadiSearch5
 - libKF5Archive5-32bit
 - libKF5Auth5-32bit
 - libKF5AuthCore5-32bit
 - libKF5Bookmarks5-32bit
 - libKF5ConfigCore5-32bit
 - libKF5ConfigGui5-32bit
 - libKF5ConfigWidgets5-32bit
 - libKF5DocTools5-32bit
 - libKF5GlobalAccel5-32bit
 - libKF5GuiAddons5-32bit
 - libKF5IdentityManagementWidgets5
 - libKF5ItemViews5-32bit
 - libKF5JobWidgets5-32bit
 - libKF5KCMUtilsCore5
 - libKF5Notifications5-32bit
 - libKF5PimCommonAutoCorrection5
 - libKF5Screen8
 - libKF5Screen8-lang
 - libKF5ScreenDpms8
 - libKF5Solid5-32bit
 - libKF5SonnetCore5-32bit
 - libKF5Wallet5-32bit
 - libKF5XmlGui5-32bit
 - libKPipeWire5
 - libKPipeWire5-lang
 - libKPipeWireDmaBuf5
 - libKPipeWireRecord5
 - libKSaneCore1
 - libLLVM13-32bit
 - libLLVM15-32bit
 - libLLVM5-32bit
 - libLLVM7-32bit
 - libLTO5-32bit
 - libLTO7-32bit
 - libLTO9-32bit
 - libMagick++-devel-32bit
 - libMagickCore-7_Q16HDRI10-32bit
 - libMagickWand-7_Q16HDRI10-32bit
 - libOSMesa8-32bit
 - libQgpsmm30
 - libQt53DCore5-32bit
 - libQt53DInput5-32bit
 - libQt53DLogic5-32bit
 - libQt53DRender5-32bit
 - libQt5Bluetooth5-32bit
 - libQt5Bootstrap-devel-static-32bit
 - libQt5Core-devel-32bit
 - libQt5Core5-32bit
 - libQt5DBus-devel-32bit
 - libQt5Designer5-32bit
 - libQt5Help5-32bit
 - libQt5Multimedia5-32bit
 - libQt5Network-devel-32bit
 - libQt5Network5-32bit
 - libQt5Positioning5-32bit
 - libQt5PrintSupport5-32bit
 - libQt5RemoteObjects5-32bit
 - libQt5SerialPort5-32bit
 - libQt5Sql5-postgresql-32bit
 - libQt5Sql5-unixODBC-32bit
 - libQt5Svg5-32bit
 - libQt5WaylandClient5-32bit
 - libQt5WaylandCompositor5-32bit
 - libQt5WebSockets5-32bit
 - libQt5Widgets-devel-32bit
 - libQt5Xml5-32bit
 - libQt6DataVisualizationQml6
 - libQt6DeclarativeOpcua6
 - libQt6HttpServer6
 - libQt6JsonRpc6
 - libQt6LanguageServer6
 - libQt6QmlCompiler6
 - libQt6Quick3D6
 - libQt6Quick3DAssetImport6
 - libQt6Quick3DAssetUtils6
 - libQt6Quick3DEffects6
 - libQt6Quick3DGlslParser6
 - libQt6Quick3DHelpers6
 - libQt6Quick3DIblBaker6
 - libQt6Quick3DParticleEffects6
 - libQt6Quick3DParticles6
 - libQt6Quick3DPhysics6
 - libQt6Quick3DPhysicsHelpers6
 - libQt6Quick3DRuntimeRender6
 - libQt6Quick3DSpatialAudio6
 - libQt6Quick3DUtils6
 - libQt6SpatialAudio6
 - libQt6TextToSpeech6
 - libQt6WebView6
 - libQt6WebViewQuick6
 - libQtQuick5-32bit
 - libSDL-devel-32bit
 - libSDL2_gfx-1_0-0-32bit
 - libSDL2_image-2_0-0-32bit
 - libSDL2_net-2_0-0-32bit
 - libSDL2_net-devel-32bit
 - libSDL_gfx15-32bit
 - libSDL_image-1_2-0-32bit
 - libSDL_mixer-1_2-0-32bit
 - libSDL_mixer-devel-32bit
 - libSDL_net-1_2-0-32bit
 - libSDL_net-devel-32bit
 - libSDL_ttf-devel-32bit
 - libSDLmm-devel-32bit
 - libX11-6-32bit
 - libXau-devel-32bit
 - libXaw-devel-32bit
 - libXaw3d-devel-32bit
 - libXaw3d6-32bit
 - libXaw3d8-32bit
 - libXaw7-32bit
 - libXcomposite-devel-32bit
 - libXdamage-devel-32bit
 - libXdmcp-devel-32bit
 - libXdmcp6-32bit
 - libXext-devel-32bit
 - libXfont-devel-32bit
 - libXfont1-32bit
 - libXfont2-2-32bit
 - libXfont2-devel-32bit
 - libXfontcache1-32bit
 - libXft-devel-32bit
 - libXi6-32bit
 - libXinerama-devel-32bit
 - libXinerama1-32bit
 - libXmu-devel-32bit
 - libXmu6-32bit
 - libXprintAppUtil-devel-32bit
 - libXrandr-devel-32bit
 - libXres-devel-32bit
 - libXss1-32bit
 - libXtst6-32bit
 - libXvMC-devel-32bit
 - libXvMC1-32bit
 - libXxf86vm1-32bit
 - libZXing1-32bit
 - liba52-0-32bit
 - libaa1-32bit
 - libacl-devel-32bit
 - libacl1-32bit
 - libadwaita-qt5-devel
 - libadwaita-qt6-devel
 - libadwaitaqt5-1
 - libadwaitaqt6-1
 - libantlr4-runtime4_9_3
 - libaom3-32bit
 - libapparmor1-32bit
 - libarchive13-32bit
 - libart_lgpl_2-2-32bit
 - libasound2-32bit
 - libassuan0-32bit
 - libatk-1_0-0-32bit
 - libatkmm-1_6-1-32bit
 - libatspi0-32bit
 - libattr-devel-32bit
 - libaugeas0-32bit
 - libauparse0-32bit
 - libavahi-client3-32bit
 - libavc1394-devel-32bit
 - libavcodec57-32bit
 - libavcodec58_134-32bit
 - libavfilter6-32bit
 - libavfilter7_110-32bit
 - libavresample4_0-32bit
 - libavtp0-32bit
 - libbabl-0_1-0-32bit
 - libbasicobjects-devel-32bit
 - libblas3-32bit
 - libblkid1-32bit
 - libbonoboui-32bit
 - libboost_atomic1_75_0-32bit
 - libboost_container_legacy-32bit
 - libboost_context_legacy-32bit
 - libboost_coroutine_legacy-32bit
 - libboost_date_time1_75_0-32bit
 - libboost_date_time_legacy-32bit
 - libboost_fiber1_75_0-32bit
 - libboost_filesystem1_75_0-32bit
 - libboost_filesystem_legacy-32bit
 - libboost_graph_legacy-32bit
 - libboost_graph_parallel1_66_0-32bit
 - libboost_graph_parallel1_75_0-32bit
 - libboost_iostreams1_66_0-32bit
 - libboost_iostreams1_75_0-32bit
 - libboost_locale_legacy-32bit
 - libboost_mpi1_66_0-32bit
 - libboost_nowide1_75_0-32bit
 - libboost_program_options_legacy-32bit
 - libboost_python-py2_7-1_66_0-32bit
 - libboost_random_legacy-32bit
 - libboost_regex1_66_0-32bit
 - libboost_serialization1_75_0-32bit
 - libboost_serialization_legacy-32bit
 - libboost_stacktrace1_66_0-32bit
 - libboost_stacktrace_legacy-32bit
 - libboost_system_legacy-32bit
 - libboost_test1_66_0-32bit
 - libboost_test1_75_0-32bit
 - libboost_test_legacy-32bit
 - libboost_thread1_75_0-32bit
 - libboost_type_erasure1_66_0-32bit
 - libboost_type_erasure1_75_0-32bit
 - libboost_type_erasure_legacy-32bit
 - libboost_wave1_75_0-32bit
 - libbox2d-devel-32bit
 - libbrotlidec1-32bit
 - libbrotlienc1-32bit
 - libbs2b0-32bit
 - libbz2-1-32bit
 - libcairo-gobject2-32bit
 - libcairo-script-interpreter2-32bit
 - libcairomm-1_0-1-32bit
 - libcanberra-gtk3-0-32bit
 - libcanberra-gtk3-module-32bit
 - libcanberra0-32bit
 - libcap1-32bit
 - libcblas3-32bit
 - libcdda_interface0-32bit
 - libcdda_paranoia0-32bit
 - libcddb2-32bit
 - libcdio++0-32bit
 - libcdio16-32bit
 - libcdio19-32bit
 - libcdio_cdda2-32bit
 - libchewing3-32bit
 - libclang-cpp13-32bit
 - libclang11-32bit
 - libclang5-32bit
 - libclang9-32bit
 - libclucene-core1-32bit
 - libcollection-devel-32bit
 - libconfig11-32bit
 - libcppunit-1_14-0-32bit
 - libcrack2-32bit
 - libcroco-0_6-3-32bit
 - libcryptmount0-32bit
 - libcryptsetup12-32bit
 - libcupscgi1-32bit
 - libcupsppdc1-32bit
 - libcurl-devel-32bit
 - libdav1d5-32bit
 - libdb-4_8-32bit
 - libdbi3-32bit
 - libdbus-1-3-32bit
 - libdbus-c++-glib-1-1-32bit
 - libdc1394-22-32bit
 - libdevmapper-event1_03-32bit
 - libdirac_encoder0-32bit
 - libdmapsharing-3_0-2-32bit
 - libdns_sd-32bit
 - libdouble-conversion3-32bit
 - libdrm-devel-32bit
 - libdrm_intel1-32bit
 - libdrm_nouveau2-32bit
 - libdvbv5-0-32bit
 - libdw1-32bit
 - libdwarves-devel-32bit
 - libebackend-1_2-10-32bit
 - libebl-plugins-32bit
 - libebook-contacts-1_2-3-32bit
 - libecpg6-32bit
 - libedata-book-1_2-26-32bit
 - libedata-cal-2_0-1-32bit
 - libedit0-32bit
 - libelf-devel-32bit
 - libelf1-32bit
 - libenchant-2-2-32bit
 - libev4-32bit
 - libevdev2-32bit
 - libexempi3-32bit
 - libexif12-32bit
 - libexiv2-26-32bit
 - libexpat-devel-32bit
 - libext2fs-devel-32bit
 - libfabric-devel-32bit
 - libfarstream-0_2-5-32bit
 - libfdisk1-32bit
 - libfdt-devel-32bit
 - libfdt1-32bit
 - libffado2-32bit
 - libffi8-32bit
 - libffi_3_4-devel-32bit
 - libfftw3-3-32bit
 - libfftw3_mpi3-32bit
 - libfipscheck1-32bit
 - libfl-devel-32bit
 - libfl2-32bit
 - libfltk1-32bit
 - libfluidsynth3-32bit
 - libfm-qt12
 - libfmt8-32bit
 - libfontconfig1-32bit
 - libfontenc1-32bit
 - libfreetype6-32bit
 - libfuse2-32bit
 - libgamin-1-0-32bit
 - libgbm-devel-32bit
 - libgck-1-0-32bit
 - libgck-devel-32bit
 - libgcr-3-1-32bit
 - libgdata22-32bit
 - libgdbm4-32bit
 - libgegl-0_4-0-32bit
 - libgexiv2-2-32bit
 - libgimp-2_0-0-32bit
 - libgimpui-2_0-0-32bit
 - libgio-2_0-0-32bit
 - libgiomm-2_68-1-32bit
 - libgirepository-1_0-1-32bit
 - libglib-2_0-0-32bit
 - libglut3-32bit
 - libglvnd-devel-32bit
 - libgmp10-32bit
 - libgnome-desktop-3-18-32bit
 - libgnome-keyring0-32bit
 - libgnomeui-32bit
 - libgnt0-32bit
 - libgnutls30-32bit
 - libgnutls30-hmac-32bit
 - libgoa-1_0-0-32bit
 - libgoa-backend-1_0-1-32bit
 - libgpg-error0-32bit
 - libgphoto2-devel-32bit
 - libgps30
 - libgraphene-1_0-0-32bit
 - libgraphite2-3-32bit
 - libgsf-1-114-32bit
 - libgsm-devel-32bit
 - libgsm1-32bit
 - libgssdp-1_2-0-32bit
 - libgstadaptivedemux-1_0-0-32bit
 - libgstallocators-1_0-0-32bit
 - libgstapp-1_0-0-32bit
 - libgstaudio-1_0-0-32bit
 - libgstbadaudio-1_0-0-32bit
 - libgstcodecs-1_0-0-32bit
 - libgstpbutils-1_0-0-32bit
 - libgstphotography-1_0-0-32bit
 - libgstreamer-1_0-0-32bit
 - libgstrtp-1_0-0-32bit
 - libgstrtsp-1_0-0-32bit
 - libgstsctp-1_0-0-32bit
 - libgsturidownloader-1_0-0-32bit
 - libgstva-1_0-0-32bit
 - libgstwayland-1_0-0-32bit
 - libgstwebrtc-1_0-0-32bit
 - libgstwebrtcnice-1_0-0-32bit
 - libgthread-2_0-0-32bit
 - libgtk-2_0-0-32bit
 - libgtk-3-0-32bit
 - libgtkmm-2_4-1-32bit
 - libgtop-2_0-11-32bit
 - libguess1-32bit
 - libgusb2-32bit
 - libgypsy0-32bit
 - libhangul1-32bit
 - libharfbuzz-gobject0-32bit
 - libharfbuzz-subset0-32bit
 - libharfbuzz0-32bit
 - libhdf5-103-mvapich2-32bit
 - libhdf5-103-openmpi2-32bit
 - libhdf5-103-openmpi3-32bit
 - libhdf5_cpp103-mvapich2-32bit
 - libhdf5_cpp103-openmpi2-32bit
 - libhdf5_cpp103-openmpi4-32bit
 - libhdf5_fortran102-openmpi2-32bit
 - libhdf5_hl100-mvapich2-32bit
 - libhdf5_hl100-openmpi2-32bit
 - libhdf5_hl100-openmpi3-32bit
 - libhdf5_hl100-openmpi4-32bit
 - libhdf5_hl_cpp100-32bit
 - libhdf5_hl_cpp100-mvapich2-32bit
 - libhdf5_hl_cpp100-openmpi2-32bit
 - libhdf5hl_fortran100-openmpi2-32bit
 - libhdf5hl_fortran100-openmpi3-32bit
 - libhdf5hl_fortran100-openmpi4-32bit
 - libhiredis1_1_0
 - libhogweed6-32bit
 - libhttp_parser2_7_1-32bit
 - libhugetlbfs-32bit
 - libhunspell-1_6-0-32bit
 - libhyphen0-32bit
 - libibmad5-32bit
 - libibumad3-32bit
 - libibus-1_0-5-32bit
 - libibverbs-32bit
 - libibverbs1-32bit
 - libicu-devel-32bit
 - libicu60_2-32bit
 - libid3tag0-32bit
 - libiec61883-0-32bit
 - libigfxcmrt7-32bit
 - libimobiledevice-1_0-6-32bit
 - libimobiledevice-glue-1_0-0-32bit
 - libindiAlignmentDriver2
 - libindiclient2
 - libindiclientqt2
 - libindidriver2
 - libindilx200-2
 - libini_config-devel-32bit
 - libiniparser1-32bit
 - libjack-devel-32bit
 - libjacknet0-32bit
 - libjavascriptcoregtk-4_1-0-32bit
 - libjbig-devel-32bit
 - libjpeg62-devel-32bit
 - libjson-c3-32bit
 - libjxl-devel
 - libjxl-tools
 - libjxl0_7
 - libkate1-32bit
 - libkdecorations2private10
 - libkdevplatform510
 - libkerfuffle22
 - libkeyutils1-32bit
 - libkkc2-32bit
 - libkpmcore12
 - libkyotocabinet16-32bit
 - liblbxutil1-32bit
 - libldb2-32bit
 - liblmdb-0_9_17-32bit
 - liblqr-1-0-32bit
 - libltdl7-32bit
 - liblua5_3-5-32bit
 - libluajit-5_1-2-32bit
 - liblz4-1-32bit
 - liblzo2-2-32bit
 - libm17n0-32bit
 - libmanette-0_2-0-32bit
 - libmariadb3-32bit
 - libmikmod3-32bit
 - libminizip1-32bit
 - libmjpegutils-2_0-0-32bit
 - libmlt7-module-qt6
 - libmms0-32bit
 - libmnl0-32bit
 - libmodman1-32bit
 - libmodplug1-32bit
 - libmount-devel-32bit
 - libmount1-32bit
 - libmpc3-32bit
 - libmpcdec5-32bit
 - libmpeg2encpp-2_0-0-32bit
 - libmpg123-0-32bit
 - libmspack0-32bit
 - libmtdev1-32bit
 - libncurses6-32bit
 - libnetcdf18-32bit
 - libnetcdf18-openmpi4-32bit
 - libnetfilter_cthelper0-32bit
 - libnewt0_52-32bit
 - libnice10-32bit
 - libnotify-devel-32bit
 - libnotify4-32bit
 - libnss_usrfiles2-32bit
 - libnsssharedhelper0-32bit
 - libnuma1-32bit
 - libogg0-32bit
 - libomemo-c-devel
 - libomemo-c0
 - libopenal1-32bit
 - libopenblas_openmp-devel-32bit
 - libopenblas_pthreads-devel-32bit
 - libopenblas_pthreads0-32bit
 - libopencascade-applicationframework7_7
 - libopencascade-dataexchange7_7
 - libopencascade-draw7_7
 - libopencascade-foundationclasses7_7
 - libopencascade-modelingalgorithms7_7
 - libopencascade-modelingdata7_7
 - libopencascade-visualization7_7
 - libopenjp2-7-32bit
 - libopenjpeg1-32bit
 - libopensm9-32bit
 - libopenssl1_0_0-32bit
 - libopenssl1_0_0-hmac-32bit
 - libopenssl1_0_0-steam-32bit
 - libopenssl1_1-32bit
 - liboping-devel-32bit
 - libosmcomp5-32bit
 - libotf-devel-32bit
 - libpackagekit-glib2-18-32bit
 - libpackagekit-glib2-devel-32bit
 - libpango-1_0-0-32bit
 - libpangomm-1_4-1-32bit
 - libpapi-32bit
 - libpath_utils-devel-32bit
 - libpcap-devel-32bit
 - libpcre2-16-0-32bit
 - libpcsclite1-32bit
 - libpfm4-32bit
 - libpixman-1-0-32bit
 - libplist++-2_0-3-32bit
 - libplist-2_0-3-32bit
 - libpng16-compat-devel-32bit
 - libpng16-devel-32bit
 - libpolkit-agent-1-0-32bit
 - libpoppler-glib8-32bit
 - libpoppler-qt5-1-32bit
 - libpoppler117-32bit
 - libpoppler126-32bit
 - libportaudio2-32bit
 - libpostproc55_9-32bit
 - libpq5-32bit
 - libpspell15-32bit
 - libpulse-devel-32bit
 - libpulse-mainloop-glib0-32bit
 - libpulse0-32bit
 - libpython3_11-1_0-32bit
 - libqb-devel-32bit
 - libqb100-32bit
 - libqgpgme7-32bit
 - libqmobipocket2
 - libqrencode4-32bit
 - libqt5-dwaylandplugin
 - libqt5-kwayland-shellplugin
 - libqt5-qtbase-examples-32bit
 - libqt5-qtconnectivity-devel-32bit
 - libqt5-qtdeclarative-devel-32bit
 - libqt5-qtlocation-devel-32bit
 - libqt5-qtmultimedia-devel-32bit
 - libqt5-qtscript-devel-32bit
 - libqt5-qtspeech-devel-32bit
 - libqt5-qtsvg-devel-32bit
 - libqt5-qttools-32bit
 - libqt5-qtwayland-devel-32bit
 - libqt5-qtwebchannel-devel-32bit
 - libqt5-qtxmlpatterns-devel-32bit
 - libqtermwidget5-1
 - libraptor2-0-32bit
 - librav1e0-32bit
 - librdmacm1-32bit
 - libreadline7-32bit
 - libref_array1-32bit
 - librest-0_7-0-32bit
 - librssguard-4_3_2
 - librsvg-2-2-32bit
 - libsamba-policy0-python3-32bit
 - libsbc1-32bit
 - libscalapack2-mvapich2-32bit
 - libschroedinger-1_0-0-32bit
 - libscrypt-devel
 - libscrypt0
 - libseccomp2-32bit
 - libsensors4-32bit
 - libserd-0-0-32bit
 - libshout3-32bit
 - libsigc-3_0-0-32bit
 - libslang2-32bit
 - libslurm39
 - libsmartcols1-32bit
 - libsnappy1-32bit
 - libsnmp30-32bit
 - libsoftokn3-32bit
 - libsord-0-0-32bit
 - libsoup-3_0-0-32bit
 - libsoup-devel-32bit
 - libspandsp2-32bit
 - libspeechd2-32bit
 - libspeex1-32bit
 - libspeexdsp1-32bit
 - libsrt1-32bit
 - libsrtp1-32bit
 - libsrtp2-1-32bit
 - libssh4-32bit
 - libswresample3_9-32bit
 - libswscale5_9-32bit
 - libsyn123-0-32bit
 - libtag_c0-32bit
 - libtasn1-6-32bit
 - libtasn1-devel-32bit
 - libtelepathy-glib0-32bit
 - libtevent0-32bit
 - libtiff-devel-32bit
 - libtool-32bit
 - libts0-32bit
 - libtspi1-32bit
 - libtss2-rc0-32bit
 - libtss2-tcti-cmd0-32bit
 - libtss2-tcti-mssim0-32bit
 - libtss2-tcti-swtpm0-32bit
 - libtss2-tctildr0-32bit
 - libuchardet0-32bit
 - libudev1-32bit
 - libudf0-32bit
 - libunistring2-32bit
 - liburcu6-32bit
 - liburiparser1-32bit
 - libusb-1_0-0-32bit
 - libusb-1_0-devel-32bit
 - libutempter0-32bit
 - libuuid1-32bit
 - libuv1-32bit
 - libv4l-32bit
 - libv4l-devel-32bit
 - libv4l2-0-32bit
 - libv4l2rds0-32bit
 - libv4lconvert0-32bit
 - libva-drm2-32bit
 - libva-gl-devel-32bit
 - libva-x11-2-32bit
 - libvdpau-devel-32bit
 - libvdpau1-32bit
 - libvdpau_nouveau-32bit
 - libvdpau_r300-32bit
 - libvdpau_virtio_gpu-32bit
 - libverto-glib1-32bit
 - libverto-tevent1-32bit
 - libvirt-devel-32bit
 - libvisual-32bit
 - libvmaf1-32bit
 - libvoikko1-32bit
 - libvorbis-devel-32bit
 - libvorbis0-32bit
 - libvotequorum8-32bit
 - libvpx7-32bit
 - libwacom9-32bit
 - libwayland-cursor0-32bit
 - libwayland-egl1-32bit
 - libwebkit2gtk-4_1-0-32bit
 - libwebp6-32bit
 - libwebp7-32bit
 - libwebpdecoder2-32bit
 - libwebpdemux2-32bit
 - libwebpmux2-32bit
 - libwnck-3-0-32bit
 - libwx_baseu-suse3-32bit
 - libwx_baseu_net-suse3_0_5-32bit
 - libwx_baseu_xml-suse3-32bit
 - libwx_gtk2u_adv-suse3_0_5-32bit
 - libwx_gtk2u_core-suse3-32bit
 - libwx_gtk2u_html-suse3-32bit
 - libwx_gtk2u_propgrid-suse3-32bit
 - libwx_gtk2u_propgrid-suse3_0_5-32bit
 - libwx_gtk2u_qa-suse3_0_5-32bit
 - libwx_gtk2u_richtext-suse3-32bit
 - libwx_gtk2u_richtext-suse3_0_5-32bit
 - libwx_gtk2u_stc-suse3_0_5-32bit
 - libwx_gtk2u_xrc-suse3_0_5-32bit
 - libxapian30-32bit
 - libxcb-composite0-32bit
 - libxcb-devel-32bit
 - libxcb-dpms0-32bit
 - libxcb-image0-32bit
 - libxcb-record0-32bit
 - libxcb-render-util0-32bit
 - libxcb-util1-32bit
 - libxcb-xfixes0-32bit
 - libxcb-xkb1-32bit
 - libxcb-xtest0-32bit
 - libxcb-xvmc0-32bit
 - libxcb1-32bit
 - libxcrypt-devel-32bit
 - libxkbcommon-devel-32bit
 - libxkbcommon0-32bit
 - libxkbfile-devel-32bit
 - libxkbfile1-32bit
 - libxkbui1-32bit
 - libxklavier16-32bit
 - libxml++-3_0-1-32bit
 - libxml2-devel-32bit
 - libxslt1-32bit
 - libyajl-devel-32bit
 - libyajl2-32bit
 - libzbarqt0-32bit
 - libzen0-32bit
 - libzmq5-32bit
 - libzstd1-32bit
 - libzvbi-chains0-32bit
 - libzvbi0-32bit
 - libzzip-0-13-32bit
 - llvm11-LTO-devel-32bit
 - llvm5-LTO-devel-32bit
 - llvm5-devel-32bit
 - llvm7-devel-32bit
 - llvm9-LTO-devel-32bit
 - lucene-monitor
 - maven-resolver-named-locks
 - metacity-theme-dracula
 - metatheme-dracula-common
 - motif-devel-32bit
 - mozilla-nss-32bit
 - mpfr-devel-32bit
 - mpg123-devel-32bit
 - mpg123-jack-32bit
 - mpg123-openal-32bit
 - mpg123-portaudio-32bit
 - mpg123-pulse-32bit
 - mujs
 - mujs-devel
 - munge-devel-32bit
 - mybatis
 - mybatis-javadoc
 - mybatis-parent
 - netavark
 - ocl-icd-devel-32bit
 - openjpeg-devel-32bit
 - openmpi4-libs-32bit
 - openslp-32bit
 - opie-32bit
 - orbit2-32bit
 - p11-kit-32bit
 - pam-extra-32bit
 - pam_kwallet-32bit
 - pam_ldap-32bit
 - pam_ssh-32bit
 - pcp-pmda-hacluster
 - pcp-pmda-sockets
 - perl-32bit
 - perl-base-32bit
 - perl-core-DB_File-32bit
 - php8-imagick
 - php8-xdebug
 - pipewire-modules-0_3-32bit
 - pipewire-spa-plugins-0_2-32bit
 - plasma-nm5-libreswan
 - pmix-plugin-munge
 - pmix-test
 - python3-32bit
 - python3-base-32bit
 - python3-ldb-32bit
 - python3-qt3d-qt5-devel
 - python3-qtdatavis3d-qt5-devel
 - python3-setuptools-version-command
 - python3-tdb-32bit
 - python311-32bit
 - python311-base-32bit
 - qemu-SLOF
 - qemu-seabios
 - qemu-sgabios
 - qemu-skiboot
 - qt6-bundledembree-devel-static
 - qt6-bundledphysx-devel-static
 - qt6-bundledresonanceaudio-devel-static
 - qt6-datavisualizationqml-devel
 - qt6-datavisualizationqml-private-devel
 - qt6-declarativeopcua-private-devel
 - qt6-httpserver-devel
 - qt6-httpserver-docs-html
 - qt6-httpserver-docs-qch
 - qt6-httpserver-examples
 - qt6-httpserver-private-devel
 - qt6-jsonrpc-private-devel
 - qt6-languageserver-private-devel
 - qt6-multimedia
 - qt6-networkinformation-glib
 - qt6-qmlcompiler-private-devel
 - qt6-quick3d
 - qt6-quick3d-devel
 - qt6-quick3d-docs-html
 - qt6-quick3d-docs-qch
 - qt6-quick3d-examples
 - qt6-quick3d-imports
 - qt6-quick3d-private-devel
 - qt6-quick3dassetimport-devel
 - qt6-quick3dassetimport-private-devel
 - qt6-quick3dassetutils-devel
 - qt6-quick3dassetutils-private-devel
 - qt6-quick3deffects-devel
 - qt6-quick3dglslparser-private-devel
 - qt6-quick3dhelpers-devel
 - qt6-quick3dhelpers-private-devel
 - qt6-quick3diblbaker-devel
 - qt6-quick3diblbaker-private-devel
 - qt6-quick3dparticleeffects-devel
 - qt6-quick3dparticles-devel
 - qt6-quick3dparticles-private-devel
 - qt6-quick3dphysics
 - qt6-quick3dphysics-devel
 - qt6-quick3dphysics-docs-html
 - qt6-quick3dphysics-docs-qch
 - qt6-quick3dphysics-examples
 - qt6-quick3dphysics-imports
 - qt6-quick3dphysics-private-devel
 - qt6-quick3dphysicshelpers-private-devel
 - qt6-quick3druntimerender-devel
 - qt6-quick3druntimerender-private-devel
 - qt6-quick3dspatialaudio-private-devel
 - qt6-quick3dutils-devel
 - qt6-quick3dutils-private-devel
 - qt6-remoteobjects-docs-html
 - qt6-remoteobjects-docs-qch
 - qt6-spatialaudio-devel
 - qt6-spatialaudio-private-devel
 - qt6-speech-docs-html
 - qt6-speech-docs-qch
 - qt6-speech-examples
 - qt6-texttospeech
 - qt6-texttospeech-devel
 - qt6-texttospeech-private-devel
 - qt6-waylandglobal-private-devel
 - qt6-webengine-examples
 - qt6-webview
 - qt6-webview-devel
 - qt6-webview-docs-html
 - qt6-webview-docs-qch
 - qt6-webview-examples
 - qt6-webview-imports
 - qt6-webview-private-devel
 - qt6-webviewquick-devel
 - qt6-webviewquick-private-devel
 - rdma-core-devel-32bit
 - readline-devel-32bit
 - readline5-devel-32bit
 - relaxngcc
 - relaxngcc-javadoc
 - rhino-engine
 - rhino-javadoc
 - rhino-runtime
 - rsocket-32bit
 - samba-ad-dc-32bit
 - samba-ad-dc-libs-32bit
 - samba-client-libs-32bit
 - samba-libs-32bit
 - samba-winbind-libs-32bit
 - sane-backends-32bit
 - slf4j-reload4j
 - slurm-plugin-ext-sensors-rrd
 - slurm-testsuite
 - solid-devel-32bit
 - sssd-common-32bit
 - stax-ex
 - stax-ex-javadoc
 - sysfsutils-32bit
 - termcap-32bit
 - tesla-polyglot-java
 - tesseract-ocr-traineddata-afr
 - tesseract-ocr-traineddata-amh
 - tesseract-ocr-traineddata-ara
 - tesseract-ocr-traineddata-asm
 - tesseract-ocr-traineddata-aze
 - tesseract-ocr-traineddata-aze_cyrl
 - tesseract-ocr-traineddata-bel
 - tesseract-ocr-traineddata-ben
 - tesseract-ocr-traineddata-bod
 - tesseract-ocr-traineddata-bos
 - tesseract-ocr-traineddata-bre
 - tesseract-ocr-traineddata-bul
 - tesseract-ocr-traineddata-cat
 - tesseract-ocr-traineddata-ceb
 - tesseract-ocr-traineddata-ces
 - tesseract-ocr-traineddata-chi_sim
 - tesseract-ocr-traineddata-chi_sim_vert
 - tesseract-ocr-traineddata-chi_tra
 - tesseract-ocr-traineddata-chi_tra_vert
 - tesseract-ocr-traineddata-chr
 - tesseract-ocr-traineddata-cos
 - tesseract-ocr-traineddata-cym
 - tesseract-ocr-traineddata-dan
 - tesseract-ocr-traineddata-deu
 - tesseract-ocr-traineddata-div
 - tesseract-ocr-traineddata-doc
 - tesseract-ocr-traineddata-dzo
 - tesseract-ocr-traineddata-ell
 - tesseract-ocr-traineddata-eng
 - tesseract-ocr-traineddata-enm
 - tesseract-ocr-traineddata-epo
 - tesseract-ocr-traineddata-equ
 - tesseract-ocr-traineddata-est
 - tesseract-ocr-traineddata-eus
 - tesseract-ocr-traineddata-fao
 - tesseract-ocr-traineddata-fas
 - tesseract-ocr-traineddata-fil
 - tesseract-ocr-traineddata-fin
 - tesseract-ocr-traineddata-fra
 - tesseract-ocr-traineddata-frk
 - tesseract-ocr-traineddata-frm
 - tesseract-ocr-traineddata-fry
 - tesseract-ocr-traineddata-gla
 - tesseract-ocr-traineddata-gle
 - tesseract-ocr-traineddata-glg
 - tesseract-ocr-traineddata-grc
 - tesseract-ocr-traineddata-guj
 - tesseract-ocr-traineddata-hat
 - tesseract-ocr-traineddata-heb
 - tesseract-ocr-traineddata-hin
 - tesseract-ocr-traineddata-hrv
 - tesseract-ocr-traineddata-hun
 - tesseract-ocr-traineddata-hye
 - tesseract-ocr-traineddata-iku
 - tesseract-ocr-traineddata-ind
 - tesseract-ocr-traineddata-isl
 - tesseract-ocr-traineddata-ita
 - tesseract-ocr-traineddata-ita_old
 - tesseract-ocr-traineddata-jav
 - tesseract-ocr-traineddata-jpn
 - tesseract-ocr-traineddata-jpn_vert
 - tesseract-ocr-traineddata-kan
 - tesseract-ocr-traineddata-kat
 - tesseract-ocr-traineddata-kat_old
 - tesseract-ocr-traineddata-kaz
 - tesseract-ocr-traineddata-khm
 - tesseract-ocr-traineddata-kir
 - tesseract-ocr-traineddata-kmr
 - tesseract-ocr-traineddata-kor
 - tesseract-ocr-traineddata-kor_vert
 - tesseract-ocr-traineddata-lat
 - tesseract-ocr-traineddata-lav
 - tesseract-ocr-traineddata-lit
 - tesseract-ocr-traineddata-ltz
 - tesseract-ocr-traineddata-mal
 - tesseract-ocr-traineddata-mar
 - tesseract-ocr-traineddata-mkd
 - tesseract-ocr-traineddata-mlt
 - tesseract-ocr-traineddata-mon
 - tesseract-ocr-traineddata-mri
 - tesseract-ocr-traineddata-msa
 - tesseract-ocr-traineddata-mya
 - tesseract-ocr-traineddata-nep
 - tesseract-ocr-traineddata-nld
 - tesseract-ocr-traineddata-nor
 - tesseract-ocr-traineddata-oci
 - tesseract-ocr-traineddata-ori
 - tesseract-ocr-traineddata-osd
 - tesseract-ocr-traineddata-pan
 - tesseract-ocr-traineddata-pol
 - tesseract-ocr-traineddata-por
 - tesseract-ocr-traineddata-pus
 - tesseract-ocr-traineddata-que
 - tesseract-ocr-traineddata-ron
 - tesseract-ocr-traineddata-rus
 - tesseract-ocr-traineddata-san
 - tesseract-ocr-traineddata-script-arabic
 - tesseract-ocr-traineddata-script-armenian
 - tesseract-ocr-traineddata-script-bengali
 - tesseract-ocr-traineddata-script-canadian_aboriginal
 - tesseract-ocr-traineddata-script-cherokee
 - tesseract-ocr-traineddata-script-cyrillic
 - tesseract-ocr-traineddata-script-devanagari
 - tesseract-ocr-traineddata-script-ethiopic
 - tesseract-ocr-traineddata-script-fraktur
 - tesseract-ocr-traineddata-script-georgian
 - tesseract-ocr-traineddata-script-greek
 - tesseract-ocr-traineddata-script-gujarati
 - tesseract-ocr-traineddata-script-gurmukhi
 - tesseract-ocr-traineddata-script-hangul
 - tesseract-ocr-traineddata-script-hangul_vert
 - tesseract-ocr-traineddata-script-hans
 - tesseract-ocr-traineddata-script-hans_vert
 - tesseract-ocr-traineddata-script-hant
 - tesseract-ocr-traineddata-script-hant_vert
 - tesseract-ocr-traineddata-script-hebrew
 - tesseract-ocr-traineddata-script-japanese
 - tesseract-ocr-traineddata-script-japanese_vert
 - tesseract-ocr-traineddata-script-kannada
 - tesseract-ocr-traineddata-script-khmer
 - tesseract-ocr-traineddata-script-lao
 - tesseract-ocr-traineddata-script-latin
 - tesseract-ocr-traineddata-script-malayalam
 - tesseract-ocr-traineddata-script-myanmar
 - tesseract-ocr-traineddata-script-oriya
 - tesseract-ocr-traineddata-script-sinhala
 - tesseract-ocr-traineddata-script-syriac
 - tesseract-ocr-traineddata-script-tamil
 - tesseract-ocr-traineddata-script-telugu
 - tesseract-ocr-traineddata-script-thaana
 - tesseract-ocr-traineddata-script-thai
 - tesseract-ocr-traineddata-script-tibetan
 - tesseract-ocr-traineddata-script-vietnamese
 - tesseract-ocr-traineddata-sin
 - tesseract-ocr-traineddata-slk
 - tesseract-ocr-traineddata-slv
 - tesseract-ocr-traineddata-snd
 - tesseract-ocr-traineddata-spa
 - tesseract-ocr-traineddata-spa_old
 - tesseract-ocr-traineddata-sqi
 - tesseract-ocr-traineddata-srp
 - tesseract-ocr-traineddata-srp_latn
 - tesseract-ocr-traineddata-sun
 - tesseract-ocr-traineddata-swa
 - tesseract-ocr-traineddata-swe
 - tesseract-ocr-traineddata-syr
 - tesseract-ocr-traineddata-tam
 - tesseract-ocr-traineddata-tat
 - tesseract-ocr-traineddata-tel
 - tesseract-ocr-traineddata-tgk
 - tesseract-ocr-traineddata-tha
 - tesseract-ocr-traineddata-tir
 - tesseract-ocr-traineddata-ton
 - tesseract-ocr-traineddata-tur
 - tesseract-ocr-traineddata-uig
 - tesseract-ocr-traineddata-ukr
 - tesseract-ocr-traineddata-urd
 - tesseract-ocr-traineddata-uzb
 - tesseract-ocr-traineddata-uzb_cyrl
 - tesseract-ocr-traineddata-vie
 - tesseract-ocr-traineddata-yid
 - tesseract-ocr-traineddata-yor
 - tk-32bit
 - tslib-devel-32bit
 - typelib-1_0-Gst-1_0-32bit
 - unixODBC-devel-32bit
 - vulkan-devel-32bit
 - wine-staging-devel-32bit
 - xcb-util-devel-32bit
 - xcb-util-keysyms-devel-32bit
 - xen-libs-32bit
 - xfwm4-theme-dracula
 - xmlstreambuffer
 - xmlstreambuffer-javadoc
 - xmvn-connector
 - xmvn-connector-javadoc
 - xsom
 - xsom-javadoc
 - xz-devel-32bit
 - zathura-plugin-pdf-mupdf
 - zvbi-devel-32bit

Package Source Changes
======================

AppStream
+- Update to version 0.15.6:
+  * Features:
+    + qt: Add API for ContentRating descriptions and ratingIds
+    + Add some coccinelle semantic patches for common style issues
+    + compose: Allow building without SVG support (for bootstrap only)
+    + validator:
+  - Check for nodes that are text nodes even though they shouldn't be
+  - Extend validation for custom tag
+  - Improve Screenshot validation
+  * Specification:
+    + docs: Fix typos in <extends> documentation
+  * Bugfixes:
+    + validator:
+  - internat: Don't allow bandwidth_mbitps when value is offline-only
+  - Fix timestamp validation
+  - Allow release descriptions to start with punctuation
+    + compose:
+  - Only add no-metainfo tag if component isn't already ignored
+  - Show better error in AscImage if compose was build without rsvg
+    + Add a hack to clarify proper PtrArray element ownership for language bindings
+    + qt:
+  - Port away from deprecated QDateTime API
+  - Deprecate Component::requires
+  - Fix warning
+  - Fix stringListToCharArray and Pool::componentsByCategories
+  - Port away from deprecated foreach
+    + as-review:
+  - Add a typedef for property enums
+  - Install properties at once rather than individually
+  - Specify G_PARAM_STATIC_STRINGS for properties
+  - Emit GObject::notify on property value changes
+  - Add missing property for as_review_{get,set}_priority()
+    + ascli: fix NULL pointer dereference
+  * Miscellaneous:
+    + docs: Split releases specification into its own section
+    + style: Make code easier to read by using helper macros in all places
+    + Make some compiler warnings fatal unconditionally
+- Add patch to support meson 0.59 which is the only version available
+  in SLE 15 SP5:
+  * support-meson0.59.patch
+
+- Don't use %ldconfig_scriptlets. Leap 15.3 doesn't understand it.
+
+- Update to version 0.15.5:
+  * Features:
+    + validator:
+  - Allow severity downgrade of releases-not-in-order for GNOME
+  - Perform stricter integer validation
+  - Check for url redefinitions
+  - Validate the "internet" relation item
+  - Add validation for memory relation
+    + Implement the "replaces" tag
+    + Add convenience function that check if component is free by
+    license and origin
+    + qt: Add wrappers for AsComponent isFree/supports/replaces
+    + Always add untranslated component names to the search index
+    + Implement internet relation item
+  * Specification:
+    + spec:
+  - Specify a proper "replaces" tag
+  - Add an <internet/> kind to requires/recommends/supports
+  * Bugfixes:
+    + validator:
+  - Don't permit overriding the unknown root tag issue
+  - Distinguish translatable from not-translatable tags in
+    duplicate checks
+    + compose:
+  - Don't crash if metainfo file contains an invalid stock icon
+  - Don't synthesize components for desktop files of settings
+    apps
+    + spdx: Fix possible crash when NULL is passed to
+    is_free_license
+    + Return the correct values in as_display_length_kind_from_px()
+  * Miscellaneous:
+    + Silence static analyzer false-positives based on GCC version
+    + data: use lxml to get the XDG categories
+- Package doc sub-package as noarch.
+- Use ldconfig_scriptlets macro for post(un) handling.
+
+- AppStream 0.15.4:
+  * validator: Check timestamp validity
+  * validator: Allow (limited) overriding of issue tag severities
+  * validator: Add strict mode
+  * ascli: validate: Allow simple overriding of issue tags
+  * validator: Check for exact relation item redefinitions
+  * Add vcs-browser URL to metainfo.xml
+  * compose: Improve media-baseurl sanity checks for icon/screenshot policies
+  * compose: Don't create bad data when localized screenshots exist
+  * compose: Sanitize prefix value and verify all units for results
+  * compose: Fail and not just warn if we couldn't open a unit
+  * compose: Make no-result detection a bit more robust
+  * compose: Properly handle localized screenshots
+  * compose: Ignore current locale when analyzing screencasts
+
+- Update to version 0.15.3
+  * qt: Include enums for VcsBrowser and Contribute
+  * Add vcs-browser and contribute URL type
+  * validate: Improve validation of desktop files alongside metainfo data
+  * its: Mark deprecated rules as deprecated
+  * Implement l10n support for metainfo keyword tags
+  * validator: Perform basic validation of keywords in metainfo data
+  * compose: Prefer metainfo keywords over desktop-entry keywords
+  * Specification:
+  * docs: Document keywords for metainfo files as well
+  * docs: Spell it metainfo, not meta-info if referencing metainfo.xml files
+  * spec: Document how keywords in metainfo files should be translated
+  * Multiple Bugfixes
+- Update to version 0.15.2
+  * Relicense remaining GPL-2.0 code to LGPL-2.1+
+  * compose: Allow setting a custom CAInfo file
+  * qt: Always use C library for enum-to-string conversions
+  * compose: Allow any amount of release entries for OS components
+  * compose: Implement more flexible icon policy
+  * validator: Ensure component-ID has no punctuation prefix
+  * validator: Check existence of version and date release properties
+  * Implement component-wide end-of-life date attribute
+  * compose: Build API documentation
+  * Support the new swcatalog catalog metadata location and add app-info fallback
+  * When finding components by ID, use provided IDs if no exact matches were found
+  * ascli: Fix install/remove commands, add Flatpak support
+  * Implement XML & YAML read/write of the "branding" tag group
+  * Handle embedded lists in YAML release info paragraphs
+  * Specification:
+  * spec: Specify a "date_eol" property for the component itself
+  * spec: Specify the new "branding" tag
+  * docs: Update links to API reference pages
+  * spec: Require that branding colours start with a hash symbol
+  * docs: Clarify license and ship license copies
+  * docs: Document media_baseurl property of components
+  * Multiple bugfixes
+
+- Add Appstream Requires to Appstream-devel package, a devel
+  package should require it's own binary and config.
+
+- Don't refresh the system cache in %post. The user metadata cache
+  works much better, rely on that instead.
+
GeoIP
+- Update README.SUSE with a description how to get the latest Geo IP
+  data after the distribution changes
+  (jsc#SLE-11184, bsc#1156194, jsc#ECO-1405)
+- geoip-fetch is now obsolete and just points to the README
+
+- can't package database in /var/lib/GeoIP anymore as it breaks with
+  transactional updates (boo#1093352). Ideally one would put the
+  static version in /usr/share with the files in /var overriding
+  that. Since GeoIP is considered deprecated in favor of
+  libmaxminddb anyways, we'll just ship GeoIP-data as empty shell to
+  own the files for uninstall.
+
+- Update to version 1.6.12:
+  * Populate metro and area code when performing lookups in IPv6
+    City databases. Previously this was only done when using IPv4
+    City databases.
+- Modernise spec file with spec-cleaner
+
+- Rectify RPM groups.
+  Remove pointless --with-pic since there are no static libs.
+
+- Update to version 1.6.11:
+  * Fix use of a NULL pointer when opening a corrupt database with
+    GeoIP_open
+  * GeoIP_database_info now returns the full version string rather
+    than incorrectly truncating it.
+
+- Fix compilation errors seen by GCC6.
+
+- Update to 1.6.9
+  * Fix a regression introduced in version 1.6.8, which caused
+    GeoIP_database_info to erroneously return NULL.
+- Changes for 1.6.8
+  * Allow compilation on older systems by relaxing the autoconf
+    and automake minimum versions. Thank you, Jose Rubio!
+  * Avoid potential problems in multi-threaded environments by
+    consistently using pread() rather than read().
+  * Fix various small issues reported by clang's static analyser.
+
+- Update to 1.6.7
+  * Fixed a MSVC parser stack overflow when parsing regionName.c
+    and timeZone.c. Fix by elliotlo. GitHub #64.
+  * Updated region codes and timezones.
+    When using GEOIP_MEMORY_CACHE with an invalid database file,
+    the search tree traversal could attempt to read memory outside
+    of the memory allocated for the memory cache, resulting in a
+    segmentation fault. A check was added to ensure that the
+    traversal code does not try to read beyond the end of the file,
+    whether in memory, memory mapped, or on disk.
+  * Previously the return values from file reads were ignored. We now
+    check these values to ensure that there were no errors.
+- copy the tools from the debian package to work with the database
+  files. new BR gcc-c++. Files are installed into the same path as
+  on debian /usr/lib/geoip/. new binaries:
+  /usr/lib/geoip/geoip-generator
+  /usr/lib/geoip/geoip-generator-asn
+  /usr/lib/geoip/v4-to-v6-layout.pl
+
+- Update to 1.6.6
+  * Replaced usage of deprecated fileno, read, and lseek on Visual
+    Studio 2005+ with their ISO C++ conformant replacements.
+  * A warning about using a double as a float was fixed.
+  * Fixed segfault when doing a lookup on an empty database.
+  * Fixed a memcheck error from valgrind in the _check_mtime
+    function.
+  * Fixed _check_mtime to check the return value of gettimeofday
+    rather than just assuming it worked.
+
+- Remove unused zlib build requirement
+- fix pubpackage arch build error, for SLE 11 SP3
+
+* Updated LICENSE, using the upstream version.
+  * The GPL license has been removed:test-driver is licensed under the GPL but
+  is not packaged, libGeoIPUpdate is no longer part of the package.
+  * Changed handling of ghost files.
+  * Moved data into a seperate package.
+
+- Update to 1.6.5
+  * A segmentation fault in geoiplookup was fixed when the utility
+    was passed an invalid database. (Reported in Red Hat
+    bug #1180874.)
+  * Additional validation was added for validation of the size used
+    in the creation of the index cache. (Based on discussion in
+    Red Hat bug #832913.)
+  * Changed the code to only look up country codes by using
+    functions which ensure that we do not try to look past the end
+    of an array. (Reported by Ivan Sorokin. GitHub #53)
+
+- Disable checks, they fail with currently provided data file.
+- Update to 1.6.4:
+  + Update Fips code
+  + Several issues with the MinGW build were fixed.
+  + Use a constructor in pread.c to ensure the critical section is
+    always initialized.
+  + Added missing include of io.h on Windows
+  + Fixed configure warning that 'missing' script is too old or
+    missing.
+  + Previously nmake /f Makefile.vc clean would fail on Windows. This was fixed.
+  + Obsolete win32 and NetWare make files were removed.
+  + Numerous documentation updates.
+- Changes from 1.6.3:
+  + Added a GEOIP_SILENCE flag. Include this flag when calling
+    GeoIP_open to prevent any messages from being written to stderr.
+  + Mitigate a possible race condition when running nuder threads
+    in the GeoIP_cleanup function.
+  + Added some recommendations to the docs on using this library
+    in a threaded application.
+  + Fixed some bugs discovered by coverity, including failure to
+    check some system call return values and making sure all
+    strings are null-terminated
+- Changes from 1.6.2:
+  + Two files required for building on Win32 were missing from the
+    1.6.1 release. These files were added. There are no changes
+    affecting other platforms.
+- Changes from 1.6.1:
+  + Improve Win32 support.
+  + Update FIPS codes.
+- Changes from 1.6.0:
+  + The GeoIP Update program was move to its own repo and source
+    distribution.
+
MozillaFirefox
+- Firefox Extended Support Release 102.9.0 ESR
+  Placeholder changelog-entry (bsc#1209173)
+
-  Placeholder changelog-entry (bsc#1208144)
+  * Fixed: Various security fixes.
+  MFSA 2023-06 (bsc#1208144)
+  * CVE-2023-25728 (bmo#1790345)
+    Content security policy leak in violation reports using
+    iframes
+  * CVE-2023-25730 (bmo#1794622)
+    Screen hijack via browser fullscreen mode
+  * CVE-2023-25743 (bmo#1800203)
+    Fullscreen notification not shown in Firefox Focus
+  * CVE-2023-0767 (bmo#1804640)
+    Arbitrary memory write via PKCS 12 in NSS
+  * CVE-2023-25735 (bmo#1810711)
+    Potential use-after-free from compartment mismatch in
+    SpiderMonkey
+  * CVE-2023-25737 (bmo#1811464)
+    Invalid downcast in SVGUtils::SetupStrokeGeometry
+  * CVE-2023-25738 (bmo#1811852)
+    Printing on Windows could potentially crash Firefox with some
+    device drivers
+  * CVE-2023-25739 (bmo#1811939)
+    Use-after-free in
+    mozilla::dom::ScriptLoadContext::~ScriptLoadContext
+  * CVE-2023-25729 (bmo#1792138)
+    Extensions could have opened external schemes without user
+    knowledge
+  * CVE-2023-25732 (bmo#1804564)
+    Out of bounds memory write from EncodeInputStream
+  * CVE-2023-25734 (bmo#1784451, bmo#1809923, bmo#1810143,
+    bmo#1812338)
+    Opening local .url files could cause unexpected network loads
+  * CVE-2023-25742 (bmo#1813424)
+    Web Crypto ImportKey crashes tab
+  * CVE-2023-25744 (bmo#1789449, bmo#1803628, bmo#1810536)
+    Memory safety bugs fixed in Firefox 110 and Firefox ESR 102.8
+  * CVE-2023-25746 (bmo#1544127, bmo#1762368)
+    Memory safety bugs fixed in Firefox ESR 102.8
NetworkManager
+- Update to version 1.38.6 (bsc#1208631):
+  + Fix honoring DNS priority.
+  + Decline DHCPv6 lease when DAD fails.
+  + Various bugfixes.
+- Changes from version 1.38.4:
+  + Fix DAD for DHCPv6 addresses.
+  + Wi-Fi: improvements for OWE networks.
+  + Support EC private keys.
+  + Fix nmcli tab completion support for embedded quote characters.
+  + Fix reapply for lldp/mdns/llmnr/dns-over-tls settings.
+  + Various bugfixes.
+
QMPlay2
+- Added 0001-fix-mono-playback.patch to fix pipewire mono playback
+
+- Update some comments in spec file
+- Update to version 23.02.05
+  * add Turkish translation (mobilturka, sabriunal),
+  * fix CUVID + Vulkan on modern Nvidia hardware,
+  * fix aspect ratio specified in MKV container,
+  * unlocked last column in MediaBrowser,
+  * add YUVJ420P and YUV420P10 for VTB,
+  * add YUV420P10 for VA-API + OpenGL,
+  * fix PipeWire channel downmixing,
+  * add AV1 codec for D3D11VA,
+  * other minor fixes.
+
SDL
+- Add CVE-2021-33657.patch: always create a full 256-entry color
+  map in case color values are out of range (boo#1198001
+  CVE-2021-33657).
+
+- Add CVE-2019-13616.patch: fix heap buffer overflow when reading
+  a crafted bmp file (boo#1141844 CVE-2019-13616).
+
+- Add CVE-2019-7636.patch to fix a heap-based buffer over-read
+  issue (CVE-2019-7636, boo#1124826, CVE-2019-7638, boo#1124824).
+
+- Add CVE-2019-7635.patch to fix a heap-based buffer over-read
+  issue (CVE-2019-7635, boo#1124827).
+
+- Add CVE-2019-7578.patch to fix a heap-based buffer over-read
+  issue (CVE-2019-7578, boo#1125099, CVE-2019-7576, boo#1124799
+  CVE-2019-7573, boo#1124805).
+
+- Add CVE-2019-7572.patch to fix a buffer over-read issue
+  (CVE-2019-7572, boo#1124806).
+
+- Add CVE-2019-7574.patch to fix a heap-based buffer over-read
+  issue (CVE-2019-7574, boo#1124803).
+
+- Add CVE-2019-7575.patch to fix a heap-based buffer overflow
+  issue (CVE-2019-7575, boo#1124802).
+
+- Add CVE-2019-7577.patch to fix a buffer over-read issue
+  (CVE-2019-7577, boo#1124800).
+
+- Add CVE-2019-7637.patch to fix a heap-based buffer overflow
+  issue (CVE-2019-7637, CVE-2020-14409, CVE-2020-14410, boo#1124825,
+  boo#1181201, boo#1181202).
+
+- libspe2 doesn't exist any more
+
+- libspe2 only exists for ppc and ppc64
+
+- Avoid bs_sched computation failure by expanding %power64
+
+- Drop old soundserver support (also arts, after esound).
+  Remove --with-pic, building defaults to PIC anyway.
+  Use pkgconfig names to slurp in packages.
+
+- Remove gpg-offline leftovers
+
ack
+- ack 3.7.0
+  * Add a repeatable --not option to let user supply patterns that
+    should NOT match
+  * Add .Rmd to the list of extensions understood to be R
+  * Add file type for for Powershell (.ps1 and .psm1 files)
+
acl
+- test: Add helper library to fake passwd/group files
+- quote: escape literal backslashes (bsc#953659).
+- Added patch:
+  * 0001-test-Add-helper-library-to-fake-passwd-group-files.patch
+  * 0002-quote-escape-literal-backslashes.patch
+
+- refresh acl-2.2.52-tests.patch to work with perl 5.26
+
+- BuildRequires gettext-tools-mini instead of gettext-tools: as
+  acl is part of the bootstrap, we want to try to keep the dep
+  chain as small as possible.
+
+- Remove --with-pic that's just for static libraries.
+- Replace %__-type macro indirections.
+  Replace old $RPM_ by their macro equivalents for consistency.
+  Make the macro style consistent across the file again.
+
+- reenable full Larg File Support for i586
+
+- Make it possible to disable tests (for Ring0)
+- Add BuildRequires: system-user-daemon for the testsuite
+
+- Add BuildRequires for system user bin needed by test suite
+
+- Update to git snapshot dated 21 Sep 2015.
+  - Added:
+  * 0001-Install-the-libraries-to-the-appropriate-directory.patch
+  * 0002-setfacl.1-fix-typo-inclu-de-include.patch
+  * 0003-test-fix-insufficient-quoting-of.patch
+  * 0004-Makefile-rename-configure.in-to-configure.ac.patch
+  * 0005-Bad-markup-in-acl.5-page.patch
+  * 0006-.gitignore-ignore-and-config.h.in.patch
+  * 0007-Use-autoreconf-rather-than-autoconf-to-regenerate-th.patch
+  * 0008-libacl-Make-sure-that-acl_from_text-always-sets-errn.patch
+  * 0009-libacl-fix-SIGSEGV-of-getfacl-e-on-overly-long-group.patch
+  * 0010-punt-debian-rpm-packaging-logic.patch
+  * 0011-move-gettext-logic-into-misc.h.patch
+  * 0012-test-make-running-parallel-out-of-tree-safe.patch
+  * 0013-modernize-build-system.patch
+  * 0014-po-regenerate-files-after-move.patch
+  * 0015-build-drop-aclincludedir-use-pkgincludedir.patch
+  * 0016-build-make-use-of-an-aux-dir-to-stow-away-helper-scr.patch
+  * 0017-build-ship-a-pkgconfig-file-for-libacl.patch
+  * 0018-read_acl_-comments-seq-rename-line-to-lineno.patch
+  * 0019-read_acl_-comments-seq-switch-to-next_line.patch
+  * 0020-telldir-return-value-and-seekdir-second-parameters-a.patch
+  * 0021-mark-libmisc-funcs-as-hidden-so-they-are-not-exporte.patch
+  * 0022-add-__acl_-prefixes-to-internal-symbols.patch
+  * 0023-cp.test-Check-permissions-of-the-right-file.patch
+  * 0024-libacl-acl_set_file-Remove-unnecesary-racy-check.patch
+  * 0025-fix-compilation-with-latest-xattr-git.patch
+  * 0026-getfacl-Fix-memory-leak.patch
+  * 0027-Fix-the-display-block-nesting-in-acl.5.patch
+  * 0028-setfacl-man-page-Minor-wording-improvements.patch
+  * 0029-getfacl-Fix-minor-resource-leak.patch
+  * 0030-Do-not-export-symbols-that-are-not-supposed-to-be-ex.patch
+  * 0031-walk_tree-mark-internal-variables-as-static.patch
+  * 0032-ignore-configure.lineno.patch
+- Signficant spec file restructuring due to 0013-modernize-build-system.patch
+- removed builddefs.in.diff
+
+- Reduce size of filelist by using wildcards;
+  remove %doc (some locations are always %doc),
+  remove %attr (files already have proper permissions)
+
+- add acl-2.2.52-tests.patch and enable tests, check section taken
+  from Fedora package
+
+- remove gpg-offline calls from bootstrap package
+
+- Update to new upstream release 2.2.52
+  * This release fixes a few build system issues that were found and
+  merges in a tree walking bug fix.
+- Remove acl-fiximplicit.patch (merged upstream),
+  config-guess-sub-update.diff (no longer applies)
+- Sync baselibs.conf with in-.spec obsoletes/provides.
+
+- add gpg checking
+
+- use source url
+
+- Add config-guess-sub-update.diff:
+  update config.guess/sub to latest state for AArch64
+
+- Use OS byteswapping routines, application already Includes
+  "endian.h" but then goes ahead defining ad-hoc equivalent
+  functionality (0001-Use-OS-byteswapping-macros.patch)
+
+- remove useless automake deps
+
+- patch license to follow spdx.org standard
+
+- license update: GPL-2.0+;LGPL-2.1+
+  SPDX format
+
+- add automake as buildrequire to avoid implicit dependency
+
+- Fix provides/Obsoletes
+
+- Implement shlib package (libacl1)
+- Enable libacl-devel on all baselib arches
+
+- upgrade to 2.2.51
+  - Test fixes
+
+- upgrade to 2.2.50
+  - OPTIONS in man pages should be a section heading, not a subsection heading
+  - Fix a typo in the setfacl man page
+  - setfacl: Clarify that removing a non-existent acl entry is not an error
+  - Prevent setfacl --restore from SIGSEGV on malformed restore file
+  - setfacl: make sure that -R only calls stat(2) on symlinks when it needs to
+  - libacl: fix potential null pointer dereference
+  - setfacl: fix restore crash on malformed input
+  - setfacl: print useful error from read_acl_comments
+  - setfacl: changing owner and when S_ISUID should be set --restore fix
+
+- use %_smp_mflags
+
+- add baselibs.conf as a source
+- adjust baselibs.conf for SPARC
+
+- readded incorrectly removed libattr-devel requires in -devel
+
+- fixed implicit strchr() usage.
+
+- do not package static libraries
+- fix -devel package dependencies
+
+- Version bump to 2.2.48
+  - Document the new flags comments
+  - Include the S_ISUID, S_ISGID, S_ISVTX flags in the getfacl output, and restore them with "setfacl --restore=file".
+  - Make sure that getfacl -R only calls stat(2) on symlinks when it needs to
+  - Stop quoting nonprintable characters in the getfacl output
+  - Avoid unnecessary but destructive chown calls
+  - Clarify license notice
+
akonadi-calendar
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Drop patch to fix the reminder daemon not starting on login.
+  The autostart key is not automatically set to true here, so it was
+  effectively disabled completely. The daemon tries to not start
+  akonadi unless configured, so the patch can be dropped:
+  * 0001-Make-sure-the-reminder-daemon-is-not-started-by-defa.patch
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Move the reminder daemon from Kalendar here
+  * Explicitly link against MailTransport where needed
+  * Fix compile against qt6
+  * Fix include
+  * Use new akonadi calendar install include
+  * Make it compile against qt6
+  * Use properly namespaced includes from KIdentityManagement
+  * Use upper case includes
+  * Fix install headers
+  * Adapt build system for building against qt6
+  * Determine active alarms without copying incidences
+  * Fix cppcheck warning
+  * Correct invalid paths used to PIM projects
+
+- Add patch to disable the autostart of the new reminder daemon:
+  * 0001-Make-sure-the-reminder-daemon-is-not-started-by-defa.patch
+
akonadi-calendar-tools
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Use new akonadi calendar install include
+  * Fix includes
+  * Adapt build system for building against qt6
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+  * Not neccessary to use I18N_NOOP here
+
akonadi-contact
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Use the new KContacts address formatting API
+  * Improve search element
+  * Fix compile without deprecated method
+  * Use @QT_VERSION@
+  * Fix includes
+  * normalize install header include (fix qt6 build)
+  * Fix compile error
+  * Make it compile against qt6
+  * Fix some qt6 compile error
+  * fix install dir (qt6 fix compile error)
+  * Remove unused config header file
+  * Use geo: URIs to show an address on a map
+  * Make sure helper apps we start are in path
+  * Prepare to port to KTextTemplate
+  * Prepare using future KF6TextTemplate
+  * Remove extra KIOCore
+  * Explicitely link to KCoreAddons
+  * Clean up include
+  * Fix build with GCC 12 (standard attributes in middle of decl-specifiers)
+  * Remove Kleo dependency
+  * We depend against kf5.90
+  * Adapt build system for building against qt6
+  * Fix duplicated MIME types
+  * Add previously missing dependency
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
akonadi-import-wizard
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Simplify qt5/qt6 build
+  * Use QListIterator in qt6
+  * Use upper case include
+  * Fix includes
+  * USe correct qtkeychain
+  * Adapt build system for building against qt6
+  * Use SingleMainWindow=true
+  * Fix unity build support
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
akonadi-mime
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Increase dep
+  * It generates correctly interface (qt6 macro doesn't support 4 arguments)
+  * Fix includes
+  * normalize install header include (fix qt6 build)
+  * Fix some qt6 compile error
+  * It builds fine without deprecated methods
+  * Use upper case includes
+  * We depend against kf5.90
+  * Adapt build system for building against qt6
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+  * Make it compile without deprecated methods
+
akonadi-notes
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * normalize install header include (fix qt6 build)
+  * Adapt build system for building against qt6
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
akonadi-search
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Append the soname to libKF5AkonadiSearch
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes to list here.
+
akonadi-server
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+- Drop akonadiserver-apparmor-typos-mr94.patch. Fixed upstream
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Add akonadiserver-apparmor-typos-mr94.patch to ensure mariadbd_akonadi
+  AppArmor profile actually gets used
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Apparmor: Also look in /usr/libexec
+  * Fix some qt6 compile error
+  * Fix compile without deprecated method
+  * Make it compile against qt6
+  * Fix install private includes (qt6 compile fix)
+  * Fix cmake variable
+  * Show missing header in qtc6
+  * Fix some qtc6 compile error
+  * Check executables exist in PATH before passing them to QProcess
+  * kaccounts-integration is Linux/FreeBSD only - so don't try to use it elsewhere
+  * Remove kplugindesigner dep
+  * Fix build with GCC 12 (standard attributes in middle of decl-specifiers)
+  * Fix compile error against qt6
+  * Change build system for building against qt6
+  * Remove dependence on Boost
+  * Update postgres paths
+  * Fix brackets issue
+  * Use capturedView directly
+  * Enable new CI on FreeBSD
+  * Switch to new GitLab CI tooling
+  * Fix kaccounts-integration dep
+  * Fix warning
+  * Port deprecated I18N_NOOP macro
+- Drop patch, now upstream:
+  * akonadi-server/0001-Apparmor-Also-look-in-usr-libexec.patch
+
+- Add patch:
+  * 0001-Apparmor-Also-look-in-usr-libexec.patch
+
akonadiconsole
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix Akonadi Search include
+  * Fix compile without deprecated method
+  * Fix includes path (help fixing qt6 build)
+  * Use new akonadi contact include
+  * code will be removed in qt6
+  * Fix compile against last libkdepim
+  * Adapt build system for building against qt6
+  * We don't translate it. => not necessary to try to install po file
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
akregator
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Synchronize normalize method
+  * Fix compile without deprecated method
+  * Search Diacritic support
+  * Add textutil
+  * Fix build without texttospeech
+  * Make it compile without texttospeach
+  * Use KDE_INSTALL_KSERVICESDIR
+  * It compile fine without deprecated qt5 method
+  * Remove unused Grantlee5
+  * Use upper case include
+  * Fix includes
+  * It will be removed in qt6
+  * Start to remove QNetworkConfigurationManager necessary for qt6 build
+  * Use isOnline method directly
+  * Add content rating tag in appdata
+  * Qt5::WebEngine doesn't exist in qt6 and it's not necessary for qt5 build
+  * Adapt build system for building against qt6
+  * Use SingleMainWindow=true
+  * Mark as single-instance using X-GNOME-SingleWindow key
+  * Convert desktop files to JSON
+  * Port deprecated methods
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
analitza
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Fix the library soname
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add support for the combinatoric operators "comb" and "perm"
+
ant
-- Security fixes:
-  * [CVE-2021-36373, bsc#1188468] excessive memory allocation when
-  reading a specially crafted TAR archive
-  * [CVE-2021-36374, bsc#1188469] excessive memory allocation when
-  reading a specially crafted ZIP archive or a derived formats
-- Add patches:
-  * ant-CVE-2021-36373-and-CVE-2021-36374.patch
-
-- Security fix: [bsc#1171696, CVE-2020-1945]
-  * Insecure temporary file vulnerability
-- Add patches:
-  * ant-CVE-2020-1945-1.patch ant-CVE-2020-1945-2.patch
-  * ant-CVE-2020-1945-3.patch ant-CVE-2020-1945-4.patch
-  * ant-CVE-2020-1945-5.patch
+- Disable a test failing to compile with junit5 5.8.x
+
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Update to 1.10.12:
+  * The update includes fixes for the following CVEs:
+  CVE-2021-36374, bsc#1188469
+    Excessive memory allocation when reading a specially
+    crafted ZIP archive or a derived formats.
+  CVE-2021-36373, bsc#1188468
+    Excessive memory allocation when reading a specially
+    crafted TAR archive.
+  * The http condition would follow redirects even when "followRedirects" attribute
+  was set to "false". This has now been fixed. Bugzilla Report 65489
+  * Made sure setting build.compiler to the fully qualified classname
+  that corresponds to extJavac or modern has the same effect as using
+  the shorter alias names. Bugzilla Report 65539
+  * Prevent potential deadlocks in org.apache.tools.ant.IntrospectionHelper.
+  Bugzilla Report 65424
+  * The implementation of AntClassLoader#findResources() has been changed to optimize
+  it for potential performance issues, as those noted at https://issues.jenkins.io/browse/JENKINS-22310?focusedCommentId=197405&page=com.atlassian.jira.plugin.system.issuetabpanels:comment-tabpanel#comment-197405
+  Github Pull Request #151
+  * AntClassLoader now implements the ClassLoader#findResource(String) method.
+  Github Pull Request #150
+  * Ant tries to avoid file name canonicalization when possible.
+  Bugzilla Report 65499
+  * javadoc task will now look for warning messages in the STDERR stream too
+  when "failonwarning" is set to true to account for changes in JDK 17+
+  * The tar task now preserves symlinks of nested tarfilesets.
+  Github Pull Request #142
+- Changes from 1.10.11:
+  * a race condition could lead to NullPointerExceptions when running
+  tasks in parallel.
+  Bugzilla Report 65316
+  * fixed potential OutOfMemory errors when reading broken archives
+  using the tar or zip formats or formats derived from zip.
+  * org.apache.tools.ant.taskdefs.optional.junitlauncher.confined.JUnitLauncherTask now
+  has a new protected createExecuteWatchdog() method for allowing it to be overriden.
+  Github Pull Request #147
+  * Upgraded AntUnit to 1.4.1.
+
+- Update to 1.10.10
+  * SCP (with sftp=true) task would fail if fetching file located
+    in root directory.
+  * Fixed: javac task would fail if the arguments file it
+    (internally) created didn't quote the # character.
+  * Make sure LegacyXmlResultFormatter encodes characters illegal
+    in XML the same way JUnit5's built-in formatter would.
+  * LegacyXmlResultFormatter no longer double-encodes <>& in
+    system-err and system-out.
+  * Fixes a bug in junitlauncher task's legacy-xml formatter,
+    where the testcase representing a @Parameterized JUnit4 test
+    wasn't being reported in the XML.
+  * Fixes a bug where the ant-testutil-sources.jar that gets
+    published to Maven central repository didn't contain any
+    source files.
+  * The <http> condition didn't follow redirects from http to https.
+  * ZipOutputStream now overrides write(int) in order to make sure
+    single byte writes get the same treatment as array writes.
+  * Fixes a potential deadlock in junitlauncher task when using
+    legacy-xml reporter.
+  * javaversion condition now has a new "atmost" attribute. See
+    the javaversion manual for more details
+  * The "listener" nested element of the "junitlauncher" task now
+    has a new "useLegacyReportingName" attribute which can be used
+    to control the test identifiers names that get reported by the
+    listener. See the junitlauncher manual for more details. Note that
+    this change also introduces a new "setUseLegacyReportingName" method
+    on the org.apache.tools.ant.taskdefs.optional.junitlauncher.TestResultFormatter
+    interface. This will break backward compatibility with any of your custom
+    result formatters which implemented this interface and such implementations
+    are now expected to implement this new method.
+  * A new attribute preserveduplicates allows <resourcelist> to
+    return the same resource multiple times when set to true.
+  * A new attribute filterbeforeconcat in <concat> can be used to
+    decide whether the filterchain should be applied to the
+    concatenated content (the default) or each nested resource
+    individually before concatenating them.
+  * The ssh tasks now share a new nested element additionalConfig that can
+    be used to set config values for the jsch Session used by the task.
+  * Added new discardOutput and discardError properties to redirector
+    and the exec, apply and java tasks which can be used to completely
+    discard any (error) output. This is a platform independent
+    alternative to directiong output to any kind of null device.
+  * junitlauncher now prints a more useful and instantaneous summary of
+    tests being run, closely matching the junit task's summary.
+
+- Update to 1.10.9
+  * Security fix: [bsc#1177180, CVE-2020-11979]
+  - Insecure temporary file vulnerability
+  * Fixed bugs:
+  - The ftp task could throw a NullPointerException if an
+    error occured.
+  - Propertyset now also sees in-scope local properties.
+  - Replaced ReaderInputStream with the version of Apache
+    Commons IO due to problems with surrogate pairs.
+  - <fixcrlf> will no longer remove the temporary file it
+    just created before writing to it.
+  - <sshexec> and <scp> didn't deal with wildcard hostnames
+    in shs config files properly.
+  * Other changes:
+  - Ant will no longer log a warning if it doesn't find tools.jar.
+  - The <jar> task accepts now a nested <indexjarsmapper>
+    element that can be used to perform custom filename
+    transformations for the <indexjars> archives.
+  - Added a new PropertyEnumerator interface that extensions can
+    provide if they are managing properties unknown to the Ant project.
+  - Added some special code to support GraalVM JavaScript as
+    javax.script scripting engine for JavaScript. In particular we
+    relax some security settings of GraalVM so that scripts can access
+    Ant objects.
+  - Also Ant enables Nashorn compatibility mode by default, you can
+    disable that by setting the magic Ant property
+    ant.disable.graal.nashorn.compat to true.
+  - If the magic property ant.tmpdir hasn't been set and Ant can
+    control the permissions of directories it creates it will create an
+    owner-owned temporary directory unaccessible to others as default
+    tempdir as soon as a temporary file is created for the first time.
+
+- Update to 1.10.8
+  * Security fix: [CVE-2020-1945, bsc#1171696]
+  - A new property ant.tmpdir provides improved control over the
+    location Ant uses to create temporary files
+  * sshexec failed to write output to a file if the file didn't exist
+  * Fixes a regression in javac task involving command line argument files.
+  * sshexec, sshsession and scp now support a new sshConfig parameter.
+  It specified the SSH configuration file (typically ${user.home}/.ssh/config)
+  defining the username and keyfile to be used per host.
+  * "legacy-xml" formatter of junitlauncher task wasn't writing out
+  exceptions that happen in @BeforeAll method of a test.
+  * Fixes a potential ConcurrentModificationException in XMLLogger.
+  * Fixes a bug in junitlauncher task in forked mode, where if a listener element
+  was used as a sibling element for either the test or testclasses element,
+  then the forked mode launch would fail.
+  * Fixes an issue in AntStructure where an incorrect DTD was being generated.
+  * Fixes an incorrect variable name usage in junit-frames-xalan1.xsl.
+  * The runant.py script should now work with Python 3.
+  * rmic has been removed from Java 15. The task will now throw an
+  exception if you try to use it while running Java 15 or newer.
+- Remove ant-python3.patch fixed upstream
+
+- Add rhino to the ant-apache-bsf optional tasks [bsc#1134001]
+
+- Remove jakarta-commons-* dependencies [bsc#1133997]
+  * Use apache-commons-logging and apache-commons-net in optional tasks
ant-antlr
-- Security fixes:
-  * [CVE-2021-36373, bsc#1188468] excessive memory allocation when
-  reading a specially crafted TAR archive
-  * [CVE-2021-36374, bsc#1188469] excessive memory allocation when
-  reading a specially crafted ZIP archive or a derived formats
-- Add patches:
-  * ant-CVE-2021-36373-and-CVE-2021-36374.patch
-
-- Security fix: [bsc#1171696, CVE-2020-1945]
-  * Insecure temporary file vulnerability
-- Add patches:
-  * ant-CVE-2020-1945-1.patch ant-CVE-2020-1945-2.patch
-  * ant-CVE-2020-1945-3.patch ant-CVE-2020-1945-4.patch
-  * ant-CVE-2020-1945-5.patch
+- Disable a test failing to compile with junit5 5.8.x
+
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Update to 1.10.12:
+  * The update includes fixes for the following CVEs:
+  CVE-2021-36374, bsc#1188469
+    Excessive memory allocation when reading a specially
+    crafted ZIP archive or a derived formats.
+  CVE-2021-36373, bsc#1188468
+    Excessive memory allocation when reading a specially
+    crafted TAR archive.
+  * The http condition would follow redirects even when "followRedirects" attribute
+  was set to "false". This has now been fixed. Bugzilla Report 65489
+  * Made sure setting build.compiler to the fully qualified classname
+  that corresponds to extJavac or modern has the same effect as using
+  the shorter alias names. Bugzilla Report 65539
+  * Prevent potential deadlocks in org.apache.tools.ant.IntrospectionHelper.
+  Bugzilla Report 65424
+  * The implementation of AntClassLoader#findResources() has been changed to optimize
+  it for potential performance issues, as those noted at https://issues.jenkins.io/browse/JENKINS-22310?focusedCommentId=197405&page=com.atlassian.jira.plugin.system.issuetabpanels:comment-tabpanel#comment-197405
+  Github Pull Request #151
+  * AntClassLoader now implements the ClassLoader#findResource(String) method.
+  Github Pull Request #150
+  * Ant tries to avoid file name canonicalization when possible.
+  Bugzilla Report 65499
+  * javadoc task will now look for warning messages in the STDERR stream too
+  when "failonwarning" is set to true to account for changes in JDK 17+
+  * The tar task now preserves symlinks of nested tarfilesets.
+  Github Pull Request #142
+- Changes from 1.10.11:
+  * a race condition could lead to NullPointerExceptions when running
+  tasks in parallel.
+  Bugzilla Report 65316
+  * fixed potential OutOfMemory errors when reading broken archives
+  using the tar or zip formats or formats derived from zip.
+  * org.apache.tools.ant.taskdefs.optional.junitlauncher.confined.JUnitLauncherTask now
+  has a new protected createExecuteWatchdog() method for allowing it to be overriden.
+  Github Pull Request #147
+  * Upgraded AntUnit to 1.4.1.
+
+- Update to 1.10.10
+  * SCP (with sftp=true) task would fail if fetching file located
+    in root directory.
+  * Fixed: javac task would fail if the arguments file it
+    (internally) created didn't quote the # character.
+  * Make sure LegacyXmlResultFormatter encodes characters illegal
+    in XML the same way JUnit5's built-in formatter would.
+  * LegacyXmlResultFormatter no longer double-encodes <>& in
+    system-err and system-out.
+  * Fixes a bug in junitlauncher task's legacy-xml formatter,
+    where the testcase representing a @Parameterized JUnit4 test
+    wasn't being reported in the XML.
+  * Fixes a bug where the ant-testutil-sources.jar that gets
+    published to Maven central repository didn't contain any
+    source files.
+  * The <http> condition didn't follow redirects from http to https.
+  * ZipOutputStream now overrides write(int) in order to make sure
+    single byte writes get the same treatment as array writes.
+  * Fixes a potential deadlock in junitlauncher task when using
+    legacy-xml reporter.
+  * javaversion condition now has a new "atmost" attribute. See
+    the javaversion manual for more details
+  * The "listener" nested element of the "junitlauncher" task now
+    has a new "useLegacyReportingName" attribute which can be used
+    to control the test identifiers names that get reported by the
+    listener. See the junitlauncher manual for more details. Note that
+    this change also introduces a new "setUseLegacyReportingName" method
+    on the org.apache.tools.ant.taskdefs.optional.junitlauncher.TestResultFormatter
+    interface. This will break backward compatibility with any of your custom
+    result formatters which implemented this interface and such implementations
+    are now expected to implement this new method.
+  * A new attribute preserveduplicates allows <resourcelist> to
+    return the same resource multiple times when set to true.
+  * A new attribute filterbeforeconcat in <concat> can be used to
+    decide whether the filterchain should be applied to the
+    concatenated content (the default) or each nested resource
+    individually before concatenating them.
+  * The ssh tasks now share a new nested element additionalConfig that can
+    be used to set config values for the jsch Session used by the task.
+  * Added new discardOutput and discardError properties to redirector
+    and the exec, apply and java tasks which can be used to completely
+    discard any (error) output. This is a platform independent
+    alternative to directiong output to any kind of null device.
+  * junitlauncher now prints a more useful and instantaneous summary of
+    tests being run, closely matching the junit task's summary.
+
+- Update to 1.10.9
+  * Security fix: [bsc#1177180, CVE-2020-11979]
+  - Insecure temporary file vulnerability
+  * Fixed bugs:
+  - The ftp task could throw a NullPointerException if an
+    error occured.
+  - Propertyset now also sees in-scope local properties.
+  - Replaced ReaderInputStream with the version of Apache
+    Commons IO due to problems with surrogate pairs.
+  - <fixcrlf> will no longer remove the temporary file it
+    just created before writing to it.
+  - <sshexec> and <scp> didn't deal with wildcard hostnames
+    in shs config files properly.
+  * Other changes:
+  - Ant will no longer log a warning if it doesn't find tools.jar.
+  - The <jar> task accepts now a nested <indexjarsmapper>
+    element that can be used to perform custom filename
+    transformations for the <indexjars> archives.
+  - Added a new PropertyEnumerator interface that extensions can
+    provide if they are managing properties unknown to the Ant project.
+  - Added some special code to support GraalVM JavaScript as
+    javax.script scripting engine for JavaScript. In particular we
+    relax some security settings of GraalVM so that scripts can access
+    Ant objects.
+  - Also Ant enables Nashorn compatibility mode by default, you can
+    disable that by setting the magic Ant property
+    ant.disable.graal.nashorn.compat to true.
+  - If the magic property ant.tmpdir hasn't been set and Ant can
+    control the permissions of directories it creates it will create an
+    owner-owned temporary directory unaccessible to others as default
+    tempdir as soon as a temporary file is created for the first time.
+
+- Update to 1.10.8
+  * Security fix: [CVE-2020-1945, bsc#1171696]
+  - A new property ant.tmpdir provides improved control over the
+    location Ant uses to create temporary files
+  * sshexec failed to write output to a file if the file didn't exist
+  * Fixes a regression in javac task involving command line argument files.
+  * sshexec, sshsession and scp now support a new sshConfig parameter.
+  It specified the SSH configuration file (typically ${user.home}/.ssh/config)
+  defining the username and keyfile to be used per host.
+  * "legacy-xml" formatter of junitlauncher task wasn't writing out
+  exceptions that happen in @BeforeAll method of a test.
+  * Fixes a potential ConcurrentModificationException in XMLLogger.
+  * Fixes a bug in junitlauncher task in forked mode, where if a listener element
+  was used as a sibling element for either the test or testclasses element,
+  then the forked mode launch would fail.
+  * Fixes an issue in AntStructure where an incorrect DTD was being generated.
+  * Fixes an incorrect variable name usage in junit-frames-xalan1.xsl.
+  * The runant.py script should now work with Python 3.
+  * rmic has been removed from Java 15. The task will now throw an
+  exception if you try to use it while running Java 15 or newer.
+- Remove ant-python3.patch fixed upstream
+
+- Add rhino to the ant-apache-bsf optional tasks [bsc#1134001]
+
+- Remove jakarta-commons-* dependencies [bsc#1133997]
+  * Use apache-commons-logging and apache-commons-net in optional tasks
ant-contrib
+- Modified patch:
+  * local-ivy.patch
+    + fix build with apache-ivy 2.5.1
+
-- disable javadoc build
-
ant-junit
-- Security fixes:
-  * [CVE-2021-36373, bsc#1188468] excessive memory allocation when
-  reading a specially crafted TAR archive
-  * [CVE-2021-36374, bsc#1188469] excessive memory allocation when
-  reading a specially crafted ZIP archive or a derived formats
-- Add patches:
-  * ant-CVE-2021-36373-and-CVE-2021-36374.patch
-
-- Security fix: [bsc#1171696, CVE-2020-1945]
-  * Insecure temporary file vulnerability
-- Add patches:
-  * ant-CVE-2020-1945-1.patch ant-CVE-2020-1945-2.patch
-  * ant-CVE-2020-1945-3.patch ant-CVE-2020-1945-4.patch
-  * ant-CVE-2020-1945-5.patch
+- Disable a test failing to compile with junit5 5.8.x
+
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Update to 1.10.12:
+  * The update includes fixes for the following CVEs:
+  CVE-2021-36374, bsc#1188469
+    Excessive memory allocation when reading a specially
+    crafted ZIP archive or a derived formats.
+  CVE-2021-36373, bsc#1188468
+    Excessive memory allocation when reading a specially
+    crafted TAR archive.
+  * The http condition would follow redirects even when "followRedirects" attribute
+  was set to "false". This has now been fixed. Bugzilla Report 65489
+  * Made sure setting build.compiler to the fully qualified classname
+  that corresponds to extJavac or modern has the same effect as using
+  the shorter alias names. Bugzilla Report 65539
+  * Prevent potential deadlocks in org.apache.tools.ant.IntrospectionHelper.
+  Bugzilla Report 65424
+  * The implementation of AntClassLoader#findResources() has been changed to optimize
+  it for potential performance issues, as those noted at https://issues.jenkins.io/browse/JENKINS-22310?focusedCommentId=197405&page=com.atlassian.jira.plugin.system.issuetabpanels:comment-tabpanel#comment-197405
+  Github Pull Request #151
+  * AntClassLoader now implements the ClassLoader#findResource(String) method.
+  Github Pull Request #150
+  * Ant tries to avoid file name canonicalization when possible.
+  Bugzilla Report 65499
+  * javadoc task will now look for warning messages in the STDERR stream too
+  when "failonwarning" is set to true to account for changes in JDK 17+
+  * The tar task now preserves symlinks of nested tarfilesets.
+  Github Pull Request #142
+- Changes from 1.10.11:
+  * a race condition could lead to NullPointerExceptions when running
+  tasks in parallel.
+  Bugzilla Report 65316
+  * fixed potential OutOfMemory errors when reading broken archives
+  using the tar or zip formats or formats derived from zip.
+  * org.apache.tools.ant.taskdefs.optional.junitlauncher.confined.JUnitLauncherTask now
+  has a new protected createExecuteWatchdog() method for allowing it to be overriden.
+  Github Pull Request #147
+  * Upgraded AntUnit to 1.4.1.
+
+- Update to 1.10.10
+  * SCP (with sftp=true) task would fail if fetching file located
+    in root directory.
+  * Fixed: javac task would fail if the arguments file it
+    (internally) created didn't quote the # character.
+  * Make sure LegacyXmlResultFormatter encodes characters illegal
+    in XML the same way JUnit5's built-in formatter would.
+  * LegacyXmlResultFormatter no longer double-encodes <>& in
+    system-err and system-out.
+  * Fixes a bug in junitlauncher task's legacy-xml formatter,
+    where the testcase representing a @Parameterized JUnit4 test
+    wasn't being reported in the XML.
+  * Fixes a bug where the ant-testutil-sources.jar that gets
+    published to Maven central repository didn't contain any
+    source files.
+  * The <http> condition didn't follow redirects from http to https.
+  * ZipOutputStream now overrides write(int) in order to make sure
+    single byte writes get the same treatment as array writes.
+  * Fixes a potential deadlock in junitlauncher task when using
+    legacy-xml reporter.
+  * javaversion condition now has a new "atmost" attribute. See
+    the javaversion manual for more details
+  * The "listener" nested element of the "junitlauncher" task now
+    has a new "useLegacyReportingName" attribute which can be used
+    to control the test identifiers names that get reported by the
+    listener. See the junitlauncher manual for more details. Note that
+    this change also introduces a new "setUseLegacyReportingName" method
+    on the org.apache.tools.ant.taskdefs.optional.junitlauncher.TestResultFormatter
+    interface. This will break backward compatibility with any of your custom
+    result formatters which implemented this interface and such implementations
+    are now expected to implement this new method.
+  * A new attribute preserveduplicates allows <resourcelist> to
+    return the same resource multiple times when set to true.
+  * A new attribute filterbeforeconcat in <concat> can be used to
+    decide whether the filterchain should be applied to the
+    concatenated content (the default) or each nested resource
+    individually before concatenating them.
+  * The ssh tasks now share a new nested element additionalConfig that can
+    be used to set config values for the jsch Session used by the task.
+  * Added new discardOutput and discardError properties to redirector
+    and the exec, apply and java tasks which can be used to completely
+    discard any (error) output. This is a platform independent
+    alternative to directiong output to any kind of null device.
+  * junitlauncher now prints a more useful and instantaneous summary of
+    tests being run, closely matching the junit task's summary.
+
+- Update to 1.10.9
+  * Security fix: [bsc#1177180, CVE-2020-11979]
+  - Insecure temporary file vulnerability
+  * Fixed bugs:
+  - The ftp task could throw a NullPointerException if an
+    error occured.
+  - Propertyset now also sees in-scope local properties.
+  - Replaced ReaderInputStream with the version of Apache
+    Commons IO due to problems with surrogate pairs.
+  - <fixcrlf> will no longer remove the temporary file it
+    just created before writing to it.
+  - <sshexec> and <scp> didn't deal with wildcard hostnames
+    in shs config files properly.
+  * Other changes:
+  - Ant will no longer log a warning if it doesn't find tools.jar.
+  - The <jar> task accepts now a nested <indexjarsmapper>
+    element that can be used to perform custom filename
+    transformations for the <indexjars> archives.
+  - Added a new PropertyEnumerator interface that extensions can
+    provide if they are managing properties unknown to the Ant project.
+  - Added some special code to support GraalVM JavaScript as
+    javax.script scripting engine for JavaScript. In particular we
+    relax some security settings of GraalVM so that scripts can access
+    Ant objects.
+  - Also Ant enables Nashorn compatibility mode by default, you can
+    disable that by setting the magic Ant property
+    ant.disable.graal.nashorn.compat to true.
+  - If the magic property ant.tmpdir hasn't been set and Ant can
+    control the permissions of directories it creates it will create an
+    owner-owned temporary directory unaccessible to others as default
+    tempdir as soon as a temporary file is created for the first time.
+
+- Update to 1.10.8
+  * Security fix: [CVE-2020-1945, bsc#1171696]
+  - A new property ant.tmpdir provides improved control over the
+    location Ant uses to create temporary files
+  * sshexec failed to write output to a file if the file didn't exist
+  * Fixes a regression in javac task involving command line argument files.
+  * sshexec, sshsession and scp now support a new sshConfig parameter.
+  It specified the SSH configuration file (typically ${user.home}/.ssh/config)
+  defining the username and keyfile to be used per host.
+  * "legacy-xml" formatter of junitlauncher task wasn't writing out
+  exceptions that happen in @BeforeAll method of a test.
+  * Fixes a potential ConcurrentModificationException in XMLLogger.
+  * Fixes a bug in junitlauncher task in forked mode, where if a listener element
+  was used as a sibling element for either the test or testclasses element,
+  then the forked mode launch would fail.
+  * Fixes an issue in AntStructure where an incorrect DTD was being generated.
+  * Fixes an incorrect variable name usage in junit-frames-xalan1.xsl.
+  * The runant.py script should now work with Python 3.
+  * rmic has been removed from Java 15. The task will now throw an
+  exception if you try to use it while running Java 15 or newer.
+- Remove ant-python3.patch fixed upstream
+
+- Add rhino to the ant-apache-bsf optional tasks [bsc#1134001]
+
+- Remove jakarta-commons-* dependencies [bsc#1133997]
+  * Use apache-commons-logging and apache-commons-net in optional tasks
ant-junit5
-- Security fixes:
-  * [CVE-2021-36373, bsc#1188468] excessive memory allocation when
-  reading a specially crafted TAR archive
-  * [CVE-2021-36374, bsc#1188469] excessive memory allocation when
-  reading a specially crafted ZIP archive or a derived formats
-- Add patches:
-  * ant-CVE-2021-36373-and-CVE-2021-36374.patch
-
-- Security fix: [bsc#1171696, CVE-2020-1945]
-  * Insecure temporary file vulnerability
-- Add patches:
-  * ant-CVE-2020-1945-1.patch ant-CVE-2020-1945-2.patch
-  * ant-CVE-2020-1945-3.patch ant-CVE-2020-1945-4.patch
-  * ant-CVE-2020-1945-5.patch
+- Disable a test failing to compile with junit5 5.8.x
+
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Update to 1.10.12:
+  * The update includes fixes for the following CVEs:
+  CVE-2021-36374, bsc#1188469
+    Excessive memory allocation when reading a specially
+    crafted ZIP archive or a derived formats.
+  CVE-2021-36373, bsc#1188468
+    Excessive memory allocation when reading a specially
+    crafted TAR archive.
+  * The http condition would follow redirects even when "followRedirects" attribute
+  was set to "false". This has now been fixed. Bugzilla Report 65489
+  * Made sure setting build.compiler to the fully qualified classname
+  that corresponds to extJavac or modern has the same effect as using
+  the shorter alias names. Bugzilla Report 65539
+  * Prevent potential deadlocks in org.apache.tools.ant.IntrospectionHelper.
+  Bugzilla Report 65424
+  * The implementation of AntClassLoader#findResources() has been changed to optimize
+  it for potential performance issues, as those noted at https://issues.jenkins.io/browse/JENKINS-22310?focusedCommentId=197405&page=com.atlassian.jira.plugin.system.issuetabpanels:comment-tabpanel#comment-197405
+  Github Pull Request #151
+  * AntClassLoader now implements the ClassLoader#findResource(String) method.
+  Github Pull Request #150
+  * Ant tries to avoid file name canonicalization when possible.
+  Bugzilla Report 65499
+  * javadoc task will now look for warning messages in the STDERR stream too
+  when "failonwarning" is set to true to account for changes in JDK 17+
+  * The tar task now preserves symlinks of nested tarfilesets.
+  Github Pull Request #142
+- Changes from 1.10.11:
+  * a race condition could lead to NullPointerExceptions when running
+  tasks in parallel.
+  Bugzilla Report 65316
+  * fixed potential OutOfMemory errors when reading broken archives
+  using the tar or zip formats or formats derived from zip.
+  * org.apache.tools.ant.taskdefs.optional.junitlauncher.confined.JUnitLauncherTask now
+  has a new protected createExecuteWatchdog() method for allowing it to be overriden.
+  Github Pull Request #147
+  * Upgraded AntUnit to 1.4.1.
+
+- Update to 1.10.10
+  * SCP (with sftp=true) task would fail if fetching file located
+    in root directory.
+  * Fixed: javac task would fail if the arguments file it
+    (internally) created didn't quote the # character.
+  * Make sure LegacyXmlResultFormatter encodes characters illegal
+    in XML the same way JUnit5's built-in formatter would.
+  * LegacyXmlResultFormatter no longer double-encodes <>& in
+    system-err and system-out.
+  * Fixes a bug in junitlauncher task's legacy-xml formatter,
+    where the testcase representing a @Parameterized JUnit4 test
+    wasn't being reported in the XML.
+  * Fixes a bug where the ant-testutil-sources.jar that gets
+    published to Maven central repository didn't contain any
+    source files.
+  * The <http> condition didn't follow redirects from http to https.
+  * ZipOutputStream now overrides write(int) in order to make sure
+    single byte writes get the same treatment as array writes.
+  * Fixes a potential deadlock in junitlauncher task when using
+    legacy-xml reporter.
+  * javaversion condition now has a new "atmost" attribute. See
+    the javaversion manual for more details
+  * The "listener" nested element of the "junitlauncher" task now
+    has a new "useLegacyReportingName" attribute which can be used
+    to control the test identifiers names that get reported by the
+    listener. See the junitlauncher manual for more details. Note that
+    this change also introduces a new "setUseLegacyReportingName" method
+    on the org.apache.tools.ant.taskdefs.optional.junitlauncher.TestResultFormatter
+    interface. This will break backward compatibility with any of your custom
+    result formatters which implemented this interface and such implementations
+    are now expected to implement this new method.
+  * A new attribute preserveduplicates allows <resourcelist> to
+    return the same resource multiple times when set to true.
+  * A new attribute filterbeforeconcat in <concat> can be used to
+    decide whether the filterchain should be applied to the
+    concatenated content (the default) or each nested resource
+    individually before concatenating them.
+  * The ssh tasks now share a new nested element additionalConfig that can
+    be used to set config values for the jsch Session used by the task.
+  * Added new discardOutput and discardError properties to redirector
+    and the exec, apply and java tasks which can be used to completely
+    discard any (error) output. This is a platform independent
+    alternative to directiong output to any kind of null device.
+  * junitlauncher now prints a more useful and instantaneous summary of
+    tests being run, closely matching the junit task's summary.
+
+- Update to 1.10.9
+  * Security fix: [bsc#1177180, CVE-2020-11979]
+  - Insecure temporary file vulnerability
+  * Fixed bugs:
+  - The ftp task could throw a NullPointerException if an
+    error occured.
+  - Propertyset now also sees in-scope local properties.
+  - Replaced ReaderInputStream with the version of Apache
+    Commons IO due to problems with surrogate pairs.
+  - <fixcrlf> will no longer remove the temporary file it
+    just created before writing to it.
+  - <sshexec> and <scp> didn't deal with wildcard hostnames
+    in shs config files properly.
+  * Other changes:
+  - Ant will no longer log a warning if it doesn't find tools.jar.
+  - The <jar> task accepts now a nested <indexjarsmapper>
+    element that can be used to perform custom filename
+    transformations for the <indexjars> archives.
+  - Added a new PropertyEnumerator interface that extensions can
+    provide if they are managing properties unknown to the Ant project.
+  - Added some special code to support GraalVM JavaScript as
+    javax.script scripting engine for JavaScript. In particular we
+    relax some security settings of GraalVM so that scripts can access
+    Ant objects.
+  - Also Ant enables Nashorn compatibility mode by default, you can
+    disable that by setting the magic Ant property
+    ant.disable.graal.nashorn.compat to true.
+  - If the magic property ant.tmpdir hasn't been set and Ant can
+    control the permissions of directories it creates it will create an
+    owner-owned temporary directory unaccessible to others as default
+    tempdir as soon as a temporary file is created for the first time.
+
+- Update to 1.10.8
+  * Security fix: [CVE-2020-1945, bsc#1171696]
+  - A new property ant.tmpdir provides improved control over the
+    location Ant uses to create temporary files
+  * sshexec failed to write output to a file if the file didn't exist
+  * Fixes a regression in javac task involving command line argument files.
+  * sshexec, sshsession and scp now support a new sshConfig parameter.
+  It specified the SSH configuration file (typically ${user.home}/.ssh/config)
+  defining the username and keyfile to be used per host.
+  * "legacy-xml" formatter of junitlauncher task wasn't writing out
+  exceptions that happen in @BeforeAll method of a test.
+  * Fixes a potential ConcurrentModificationException in XMLLogger.
+  * Fixes a bug in junitlauncher task in forked mode, where if a listener element
+  was used as a sibling element for either the test or testclasses element,
+  then the forked mode launch would fail.
+  * Fixes an issue in AntStructure where an incorrect DTD was being generated.
+  * Fixes an incorrect variable name usage in junit-frames-xalan1.xsl.
+  * The runant.py script should now work with Python 3.
+  * rmic has been removed from Java 15. The task will now throw an
+  exception if you try to use it while running Java 15 or newer.
+- Remove ant-python3.patch fixed upstream
+
+- Add rhino to the ant-apache-bsf optional tasks [bsc#1134001]
+
+- Remove jakarta-commons-* dependencies [bsc#1133997]
+  * Use apache-commons-logging and apache-commons-net in optional tasks
antlr
+- Build antlr-manual package without examples files [bsc#1120360]
+- Remove not needed files
+
antlr-maven-plugin
+- Build with maven.compiler.release=8 on any JDK >= 9
+
+- Added patch:
+  * new-reporting-api.patch
+    + fix building with the new maven-reporting-api
+
antlr3
+- Build with source and target levels 8
+
antlr4
+- Upgrade to version 4.9.3
+  * changes https://github.com/antlr/antlr4/releases/tag/4.9.3
+- Removed patch:
+  * utf8cpp-from-system.patch
+    + merged upstream in 4.9.3
+- Updated patch:
+  * antlr4-install-path.patch.in
+    + removed space at line ending to match current code
+
+- Small fixes to allow to build on SLE12-SP5
+
+- Upgrade to version 4.9.2
+  * changes https://github.com/antlr/antlr4/releases/tag/4.9.2
+
+- Upgrade to version 4.9.1
+- Added patch:
+  * utf8cpp-from-system.patch -- 4.9.1 tries to download utfcpp from
+    github, so avoid that.
+
+- Upgrade to version 4.8
+- Removed patch:
+  * antlr4-install-path.patch
+    + replaced by antlr4-install-path.patch.in which allows us to
+    patch the right library version with a new release
+- Added patch:
+  * unicodedata.patch
+    + The UnicodeData.java generated from unicodedata.st with newer
+    icu versions hits the limit of 64k for the size of a bytecode
+    function. It is due to increase in number of unicode codes.
+    This prevents upgrades of icu4j. So, we take the
+    UnicodeData.java generated using icu4j 63.1 and patch it into
+    the source tree instead of generating the file during the
+    build. This is a temporary solution before we find a proper
+    solution in the template itself.
+
aopalliance
+- Build with source/target levels 8
+
apache-commons-cli
+- Rebased patch CLI-253-workaround.patch to new version.
+- Updated build XML file to new version.
+- Harmonized the use of X.Y.X strings everywhere.
+- Updated new source locations from Apache.
+- Added 'apache-commons-cli-rpmlintrc' to silence 'package-with-huge-docs' warning (Javadoc generates many files...)
+- Update to 1.5:
+  * New features:
+  - (CLI-217) Accommodate toggling partial matching in DefaultParser. Thanks to Rubin Simons.
+  - (CLI-274) Option parser type EXISTING_FILE_VALUE not check file existing Thanks to Béla Schaum.
+  - (CLI-271) CommandLine.getXXX and CommandLine.hasXXX should accept an Option as a parameter Thanks to Christoph Läubrich.
+  - (CLI-276) Adjust access-modifier of checkRequiredOptions() to protected. Thanks to Jason Dillon.
+  - (CLI-282) TypeHandler should throw ParseException for an unsupported class. Thanks to Alex Nordlund.
+  - Added setter for Builder.option #33. Thanks to Waldemar Sojka, Gary Gregory.
+  - Add Option unit tests #76. Thanks to Waldemar Sojka, Gary Gregory.
+  * Fixed bugs:
+  - Fix NPE in DefaultParser.isLongOption(String). Thanks to Gary Gregory.
+  - (CLI-279) @param or @return lines should end with a period in CommandLine.java Thanks to Krishna Mohan Rao Kandunoori.
+  - Replace deprecated FindBugs with SpotBugs. Thanks to Gary Gregory.
+  - Replace CLIRR with JApiCmp. Thanks to Gary Gregory.
+  - Option Javadocs grammar nits #55. Thanks to Elliotte Rusty Harold.
+  - Minor Improvements #57, #61. Thanks to Arturo Bernal, Gary Gregory.
+  - (CLI-254) Input "test" gets parsed as test, quotes die #58. Thanks to stoty.
+  - (CLI-287) Allow whitespace-only header and footer #26. Thanks to MrQubo, Gary Gregory.
+  * Updates:
+  - (CLI-294) Update Java from version 5 to 7.
+  - Docs: Replace OptionBuilder in usage page #30. Thanks to Mincong Huang.
+  - Remove deprecated sudo setting. #36. Thanks to dengliming.
+  - Bump junit:junit from 4.12 to 4.13.2, #53, #60. Thanks to Gary Gregory, Dependabot.
+  - Bump commons-parent from 48 to 52. Thanks to Dependabot.
+  - Bump maven-pmd-plugin from 3.12.0 to 3.15.0, #44, #54, #67. Thanks to Dependabot.
+  - Bump actions/checkout from v2.3.1 to v2.3.5 #46, #72. Thanks to Dependabot.
+  - Bump actions/setup-java from v1.4.2 to v2 #50. Thanks to Dependabot, Gary Gregory.
+  - Bump maven-antrun-plugin from 1.7 to 3.0.0 #43. Thanks to Dependabot.
+  - Bump maven-checkstyle-plugin from 2.15 to 3.1.2 #41. Thanks to Gary Gregory.
+  - Bump checkstyle to 9.0.1 #68. Thanks to Gary Gregory.
+  - Bump actions/cache from 2 to 2.1.6 #64, #65. Thanks to Dependabot.
+  - Bump commons.animal-sniffer.version 1.19 -> 1.20. Thanks to Gary Gregory.
+  - Bump maven-bundle-plugin 5.1.1 -> 5.1.2. Thanks to Gary Gregory.
+  - Bump biz.aQute.bndlib.version 5.1.2 -> 6.0.0. Thanks to Gary Gregory.
+  - Bump spotbugs from 4.4.1 to 4.4.2 #70. Thanks to Dependabot.
+  - Bump spotbugs-maven-plugin from 4.4.1 to 4.4.2.2 #71. Thanks to Dependabot.-
+
+- Add OSGi manifest to the build files.
+- Set java source/target levels to 6
+
apache-commons-codec
+- Do not alias the artifact to itself
+
+- Update to 1.15
+  * Fix: MurmurHash3: Ensure hash128 maintains the sign extension bug.
+  * Update: Base32/Base64/BCodec: Added strict decoding property to
+    control handling of trailing bits. Default lenient mode discards
+    them without error. Strict mode raise an exception.
+  * Update: Base32/Base64 Input/OutputStream: Added strict decoding
+    property to control handling of trailing bits. Default lenient
+    mode discards them without error. Strict mode raise an exception.
+  * Update: Update tests from JUnit 4.12 to 4.13.
+  * Add: Base16Codec and Base16Input/OutputStream.
+  * Add: Hex encode/decode with existing arrays.
+  * Update: Update actions/checkout from v1 to v2.3.2.
+  * Update: Update actions/setup-java from v1.4.0 to v1.4.1.
+- Remove timeout.patch
+
+- Update to version 1.14
+  * Release 1.14 - 2019-12-30
+  - Fix: Hex: Allow encoding read-only ByteBuffer.
+  - Fix: Hex: Only use an available ByteBuffer backing array if
+    the length equals the remaining byte count.
+  - Update: MurmurHash3: Deprecate hash64 methods and hash methods
+    accepting a String that use the default encoding.
+  - Fix: BaseNCodec to expand buffer using overflow conscious code.
+  - Fix: Base32/64: Fixed decoding check that all the final trailing
+    bits to discard are zero.
+  - Add: Add MurmurHash3.hash128x64 methods to fix sign extension error
+    during seeding in hash128 methods.
+  - Add: Add MurmurHash3.hash32x86 methods and IncrementalHash32x86 to
+    fix sign extension error in hash32 methods.
+  - Fix: Allow repeat calls to MurmurHash3.IncrementalHash32.end() to
+    generate the same value.
+  - Add: Add RandomAccessFile digest methods #31.
+  - Add: Add Path APIs to org.apache.commons.codec.digest.DigestUtils
+    similar to File APIs.
+  - Add: Add SHA-512/224 and SHA-512/256 to DigestUtils for Java 9 and up.
+  - Add: Add missing note in javadoc when sign extension error is present #34.
+  - Fix: Reliance on default encoding in MurmurHash2 and MurmurHash3.
+  - Update: Don't reload standard Charsets in org.apache.commons.codec.Charsets.
+  - Update: Deprecate Charset constants in org.apache.commons.codec.Charsets
+    in favor of java.nio.charset.StandardCharsets.
+  * Release 1.13 - 2019-07-20
+  - Fix: ColognePhonetic handles x incorrectly.
+  - Fix: ColognePhonetic does not treat the letter H correctly.
+  - Fix: Reject any decode request for a value that is impossible to
+    encode to for Base32/Base64 rather than blindly decoding.
+  - Add: MurmurHash2 for 32-bit or 64-bit value.
+  - Add: MurmurHash3 for 32-bit or 128-bit value.
+  - Update: Broken direct java.nio.ByteBuffer support in
+    org.apache.commons.codec.binary.Hex.
+  * Release 1.12 - 2019-02-04
+  - Fix: B64 salt generator: Random -> ThreadLocalRandom.
+  - Fix: Wrong value calculated by Cologne Phonetic if a special character
+    is placed between equal letters.
+  - Update: Update from Java 6 to Java 7.
+  - Add: Add Percent-Encoding Codec (described in RFC3986 and RFC7578).
+  - Fix: ColognePhoneticTest.testIsEncodeEquals missing assertions.
+  - Add: Add SHA-3 methods in DigestUtils.
+
-- Set the bytecode properly on sle11
-
apache-commons-collections
+- Do not use a dummy pom that only declares dependencies for the
+  testframework artifact
+- Clean up the spec file
+
-- Do not depend on junit4 but use junit
-
apache-commons-collections4
+- Build with source/target levels 8
+
apache-commons-compress
+- Added patch:
+  * 0003-Remove-Pack200-compressor.patch
+    + Remove support for pack200 which depends on old asm3
+
apache-commons-configuration
+- Build with source and target levels 1.8
+
apache-commons-daemon
+- Build with source/target levels 8
+
+- Define %%make_build for systems where it is not defined in
+  rpm macros
+
+- Update to 1.2.4
+  * Procrun. Ensure that log messages written to stdout and stderr
+    are not lost during start-up.
+  * Procrun. Correct a regression introduced in 1.2.3. Enable the
+    service to start if the Options value is not present in the
+    registry.
+  * jsvc. Don't fail if the CAP_DAC_READ_SEARCH capability is not
+    available. Fall back to using argv[0] rather than
+    /proc/self/exe to determine the path for the current binary.
+  * Improved JRE/JDK detection to support increased range of both
+    JVM versions and vendors
+
+- Update to 1.2.3
+  * Fix: Procrun. Correct multiple issues related to enabling a
+    service to interact with the desktop. Provide a better error
+    message if this option is used with an invalid user, install
+    the service with the option enabled if requested and correctly
+    save the setting if it is enabled in the GUI.
+  * Fix: jsvc. Update the list of paths searched for libjvm.so to
+    include the path used by OpenJDK 11.
+  * Add: Procrun. Add additional debug logging for Java start mode.
+  * Fix: jsvc. Remove incorrect definition 'supported_os' which
+    defined in psupport.m4 file to fix jsvc build error on s390,
+    arm, aarch64, mipsel and mips.
+  * Add: More debug logging in prunsrv.c and javajni.c.
+  * Add: Update arguments.c to support Java 11 --enable-preview.
+  * Add: jsvc and Procrun. Add support for Java native memory tracking.
+  * Add: Procrun. Add a new command, print, that outputs the command to
+    (re-)configure the service with the current settings. This is
+    intended to be used to save settings such as before an upgrade.
+- Rebase apache-commons-daemon-riscv64.patch
+- Remove apache-commons-daemon-s390x.patch fixed upstream
+
+- Generate ant build file and customize it in order to be able to
+  build this ring package without cycles. Ring packages cannot be
+  built using maven.
+- Modified patches:
+  * apache-commons-daemon-JAVA_OS.patch
+  * apache-commons-daemon-riscv64.patch
+  * apache-commons-daemon-s390x.patch
+    + Do not patch configure file itself, since we generate it
+    during the build
+
+- Update to 1.2.2
+  * Release 1.2.2 - 2019-10-04
+  - Fix: Procrun. Correct a regression in the fix for DAEMON-401
+    that prevented the service from starting unless support for the
+    universal C runtime had been installed.
+  - Update: Update Commons-Parent to version 49.
+  * Release 1.2.1 - 2019-09-09
+  - Fix: jsvc. Correct debug log message that reports change in umask.
+  - Fix: Procrun. Correct a regression in the previous fix for this
+    issue that caused 32-bit services to crash on start-up. Fixes DAEMON-401.
+  - Fix: Procrun. Correct a regression in the fix for DAEMON-391
+    that caused the GUI to mix-up the WARN and INFO logging levels.
+  * Release 1.2.0 - 2019-07-02
+  - Fix: Procrun. Only set the global shutdown event if the event is created.
+  - Fix: Unable to build with Java 9 using ant; dropped Ant build files.
+  - Fix: Procrun. prunsrv stopping with error due to hard-coded timeout.
+  - Fix: Update config.guess and config.sub.
+  - Fix: Jsvc. Set the sun.java.command system property when starting via jsvc
+    so that tools like jconsole show something meaningful for the process name.
+  - Fix: Procrun. Correct the level name used in the GUI for WARN so that
+    changes made via the GUI are recognised. Order the log levels in the
+    drop-down from ERROR to DEBUG.
+  - Fix: Procrun. Correct reversed code comments for JRE and JDK locations
+    in the registry.
+  - Fix: Procrun. Fix a bug that meant a value provided for LibraryPath
+    replaced the value of the PATH environment variable rather than prepended to it.
+  - Fix: Procrun. Ensure that the java.library.path environment variable is
+    correctly configured when running on a JRE that depends on the Universal CRT.
+  - Add: Procrun. Log the error code returned if JVM creation fails to aid debugging.
+  - Fix: Procrun. Ensure that environment variables set via prunsrv are visible
+    to native libraries that depend on the Universal CRT.
+  - Fix: Procrun. Remove the code that removed quotes from configured Java and
+    Java 9 Options.
+  - Add: Procrun. Add an option to configure the service to use the 'Automatic
+    (Delayed Start)' startup mode.
+  - Add: Procrun. When running in jre mode, if the standard Java registry
+    entries for JavaHome and RuntimeLib are not present, attempt to use the
+    Procrun JavaHome key to find the runtime library.
+  - Add: jsvc. Include the full path to the jsvc executable in the debug log.
+  * Release 1.1.0 - 2017-11-15
+  - Update: Update the minimum Java requirement from version 5 to 6.
+  - Update: Add AArch64 support to src/native/unix/support/apsupport.m4.
+  - Fix: Remove calls to explicit garbage collection during daemon start and stop.
+  - Fix: Update config.guess and config.sub to add support, amongst others,
+    for the 64-bit PowerPC Little-Endian architecture.
+  - Update: Update Commons-Parent to version 41.
+  - Fix: Update apsupport.m4 add support for 64-bit PowerPC architectures.
+  - Fix: Suppress spurious "The data area passed to a system call is too small"
+    error message in the log when Procrun fails to stop the service.
+  - Fix: Enable jsvc to start when running on Java 9.
+  - Fix: Fix a resource leak opening the JVM configuration file.
+    _ Fix: Improve the jsvc code that restarts the process if the JVM crashes so
+    that if the JVM crashes after a signal has been received to shut down jsvc
+    does not attempt to restart the JVM.
+  - Fix: Ensure that the child process is started with the correct umask.
+  - Fix: Correct conflicting information for the behaviour of Procrun when
+    using jvm mode.
+  - Fix: Ensure that, when using Procrun in java or exe mode, the service
+    process waits for the stop process to complete before starting clean-up
+    to avoid a crash in the stop process.
+  - Fix: Enable jsvc to find the jvm when running on AIX.
+  - Fix: Ensure that Procrun treats JVM crashes as service failures so the
+    recovery options will apply.
+  - Fix: Ensure that the //MQ command closes the prunmgr process even if
+    the configuration dialog is open when the //MQ command is used.
+  - Fix: Add support for Java 9 command line arguments to jsvc.
+  - Add: Add a restarts options to jsvc to control the number of permitted
+    restarts after a system crash.
+  - Remove: Remove support for building Procrun for the Itanium platform.
+  - Fix: Fix race conditions in PID file handling in jsvc.
+- Remove patches:
+  * apache-commons-daemon-ppc64.patch
+  * apache-commons-daemon-aarch64.patch
+- Refresh patches:
+  * apache-commons-daemon-riscv64.patch
+  * apache-commons-daemon-JAVA_OS.patch
+- Update project keyring.
+
-- add javapackages-tools to build requires
-
-- update to 1.0.15
-  * bugfix release, see RELEASE-NOTES.txt for a list of fixed bugs
-- obsoleted patches:
-  * 0001-execve-path-warning.patch, already upstream
-  * jsvc-libcap-relative.patch, already upstream
-  * config-guess-sub-update.patch, already upstream
-- don't install pointless filesfor SUSE Linux
-- verify package signature on openSUSE 12.3+
-- use source urls
-
apache-commons-digester
+- Build with java source and target levels 8
+
+- Fixed SPEC file: Replaced broken URL.
+
-- Current version 1.6 from JPackage.org
-
-- enable build of rss package (needed by struts)
-
apache-commons-el
+- Build with java source and target levels 8
+
apache-commons-exec
+- Build with java source and target levels 8
+
apache-commons-fileupload
+- Build with java source and target levels 8
+
-- fix bnc#846174/CVE-2013-2186: null byte injection flaw
-  http://svn.apache.org/viewvc?view=revision&revision=1507048
-  * jakarta-commons-fileupload-CVE-2013-2186.patch
-
apache-commons-io
-- Security fix: [bsc#1184755, CVE-2021-29425]
-  * Limited path traversal when invoking the method
-    FileNameUtils.normalize with an improper input string
-  * Add apache-commons-io-CVE-2021-29425.patch
+- Update to 2.11.0
+  * Lots of added functions, fixes and updates.
+  * https://commons.apache.org/proper/commons-io/changes-report.html#a2.11.0
+- Update to 2.10.0
+  * Lots of added functions, fixes and updates.
+  * https://commons.apache.org/proper/commons-io/changes-report.html#a2.10.0
+
+- Update to 2.9.0
+  * Lots of added functions, fixes and updates.
+  * https://commons.apache.org/proper/commons-io/changes-report.html#a2.9.0
+
+- Update to 2.8.0
+  * Lots of added functions, fixes and updates.
+  * https://commons.apache.org/proper/commons-io/changes-report.html#a2.8.0
+
+- Update to upstream version 2.7 (bsc#1184755, CVE-2021-29425)
+  * https://commons.apache.org/proper/commons-io/changes-report.html#a2.7
+  * Lots of bugfixes, updates and enhancements
+  * Java 8 or later is required
-- Use junit not junit4
-
-- Move from jpackage-utils to javapackage-tools
-
apache-commons-jexl
+- Build with java source and target levels 8
+
apache-commons-lang3
+- Remove the junit bom dependency for now as it breaks the build of
+  other packages like log4j.
+  * Add apache-commons-lang3-junit-bom.patch
+
+- Fix component version in default.properties to 3.12
+
+- Updated download URL.
+- Update to 3.12.0:
+  - New features:
+  * Add BooleanUtils.booleanValues().
+  * Add BooleanUtils.primitiveValues().
+  * Add StringUtils.containsAnyIgnoreCase(CharSequence, CharSequence...).
+  * Add StopWatch.getStopTime().
+  * More test coverage for CharSequenceUtils.
+  * Add fluent-style ArraySorter.
+  * Add and use LocaleUtils.toLocale(Locale) to avoid NPEs.
+  * Add FailableShortSupplier, handy for JDBC APIs.
+  * Add JavaVersion.JAVA_17.
+  * Add missing boolean[] join method.
+  * Add StringUtils.substringBefore(String, int).
+  * Add Range.INTEGER.
+  * Add DurationUtils.
+  * Introduce the use of @Nonnull, and @Nullable, and the Objects class as a helper tool.
+  * Add and use true and false String constants.
+  * Add and use ObjectUtils.requireNonEmpty().
+  - Fixed Bugs:
+  * Correct implementation of RandomUtils.nextLong(long, long).
+  * Restore handling of collections for non-JSON ToStringStyle.
+  * ContextedException Javadoc add missing semicolon.
+  * Resolve JUnit pioneer transitive dependencies using JUnit BOM.
+  * NumberUtilsTest - incorrect types in min/max tests.
+  * Improve StringUtils.stripAccents conversion of remaining accents.
+  * StringUtils.countMatches - clarify Javadoc.
+  * Remove redundant argument from substring call.
+  * BigDecimal is created when you pass it the min and max values.
+  * ArrayUtils.contains() and indexOf() fail to handle Double.NaN.
+  * ArrayUtils contains() and indexOf() fail to handle Float.NaN.
+  * Fix potential NPE in TypeUtils.isAssignable(Type, ParameterizedType, Map, Type>).
+  * TypeUtils.isAssignable returns wrong result for GenericArrayType and ParameterizedType.
+  * testGetAllFields and testGetFieldsWithAnnotation sometimes fail.
+  * Fix Javadoc for SystemUtils.isJavaVersionAtMost().
+  * Fix StringUtils.unwrap throws StringIndexOutOfBoundsException.
+  * Fix formatting of isAnyBlank() and isAnyEmpty().
+  * TypeUtils. containsTypeVariables does not support GenericArrayType.
+  * Javadoc of some methods incorrectly refers to another method.
+  * Refine StringUtils.lastIndexOfIgnoreCase.
+  * Refine StringUtils.abbreviate.
+  * Refine StringUtils.isNumericSpace.
+  * Refine StringUtils.deleteWhitespace.
+  * Correction in Javadoc of some methods.
+  * Javadoc for RandomStringUtils.random() letters, numbers parameters is wrong.
+  * Correct markup in Javadoc for unbalanced braces.
+  * MethodUtils.invokeMethod NullPointerException in case of null in args list.
+  * Fix 2 digit week year formatting.
+  * Fix broken Javadoc links to commons-text.
+  * Add and use ThreadUtils.sleep(Duration).
+  * Add and use ThreadUtils.join(Thread, Duration).
+  * Add ObjectUtils.wait(Duration).
+  - Changes:
+  * ArrayUtils.toPrimitive(Object) does not support boolean and other types.
+  * Enable Dependabot.
+  * Bump junit-jupiter from 5.6.2 to 5.7.0.
+  * Bump spotbugs from 4.1.2 to 4.2.1.
+  * Bump spotbugs-maven-plugin from 4.0.0 to 4.2.0.
+  * Bump biz.aQute.bndlib from 5.1.1 to 5.3.0.
+  * Bump junit-pioneer from 0.6.0 to 1.1.0.
+  * Bump checkstyle from 8.34 to 8.40.
+  * Bump actions/checkout from v2.3.1 to v2.3.4.
+  * Bump actions/setup-java from v1.4.0 to v1.4.2.
+  * Update commons.jacoco.version 0.8.5 to 0.8.6 (Fixes Java 15 builds).
+  * Update maven-surefire-plugin 2.22.2 -> 3.0.0-M5.
+  * Bump maven-pmd-plugin from 3.13.0 to 3.14.0.
+  * Bump jmh.version from 1.21 to 1.27.
+  * Update commons.japicmp.version 0.14.3 -> 0.15.2.
+  * Processor.java: check enum equality with == instead of .equals() method.
+  * Bump junit-pioneer from 1.1.0 to 1.3.0.
+  * Bump maven-checkstyle-plugin from 3.1.1 to 3.1.2.
+  * Bump actions/cache from v2 to v2.1.4.
+  * Bump junit-bom from 5.7.0 to 5.7.1.
+  * Minor Improvements.
+  * Minor Improvement: Add final variable.try to make the code read-only.
+  * Minor Improvement: Remove redundant initializer.
+  * Use own validator ObjectUtils.anyNull to check null String input.
+- From 3.11 Update:
+  - New features:
+  * Add ArrayUtils.isSameLength() to compare more array types.
+  * Added the Locks class as a convenient possibility to deal with locked objects.
+  * Add to Functions: FailableBooleanSupplier, FailableIntSupplier, FailableLongSupplier, FailableDoubleSupplier, and so on.
+  * Add ArrayUtils.get(T[], index, T) to provide an out-of-bounds default value.
+  * Add JavaVersion enum constants for Java 14 and 15.
+  * Add JavaVersion enum constants for Java 16.
+  * Use Java 8 lambdas and Map operations.
+  * Change removeLastFieldSeparator to use endsWith.
+  * Change a Pattern to a static final field, for not letting it compile each time the function invoked.
+  * Add ImmutablePair factory methods left() and right().
+  * Add ObjectUtils.toString(Object, Supplier<String>).
+  * Add org.apache.commons.lang3.StringUtils.substringAfter(String, int).
+  * Add org.apache.commons.lang3.StringUtils.substringAfterLast(String, int).
+  - Fixed Bugs:
+  * Fix Javadoc for StringUtils.appendIfMissingIgnoreCase().
+  * Refine Javadoc.
+  * Fix typos
+  * Ignored exception `ignored`, should not be called so.
+  * StringUtils.replaceEachRepeatedly gives IllegalStateException.
+  * [JSON string for maps] ToStringBuilder.reflectionToString doesnt render nested maps correctly.
+  * Correct Javadocs of methods that use Validate.notNull() and replace some uses of Validate.isTrue() with Validate.notNull().
+  * Add allNull() and anyNull() methods to ObjectUtils.
+  - Changes:
+  * Refine test output for FastDateParserTest
+  * CharSequenceUtils.lastIndexOf : remake it
+  * remove encoding and docEncoding and use inherited values from commons-parent
+  * Simplify null checks in Pair.hashCode() using Objects.hashCode().
+  * Simplify null checks in Triple.hashCode() using Objects.hashCode().
+  * Simplify some if statements in StringUtils.
+  * Simplify a null check in the private replaceEach() method of StringUtils.
+  * Replace some usages of the ternary operator with calls to Math.max() and Math.min().
+  * (Javadoc) Fix return tag for throwableOf*() methods.
+  * CharSequenceUtils.regionMatches is wrong dealing with Georgian.
+  * Optimize ArrayUtils::isArrayIndexValid method.
+  * Use List.sort instead of Collection.sort.
+  * Use StandardCharsets.UTF_8.
+  * Use Collections.singletonList insteadof Arrays.asList when there be only one element.
+  * Change array style from `int a[]` to `int[] a`.
+  * Change from addAll to constructors for some List.
+  * Simplify if as some conditions are covered by others.
+  * Fixed Javadocs for setTestRecursive().
+  * ToStringBuilder.reflectionToString - Wrong JSON format when object has a List of Enum.
+  * Make org.apache.commons.lang3.CharSequenceUtils.toCharArray(CharSequence) public.
+  * org.apache.commons:commons-parent 50 -> 51.
+  * org.junit-pioneer:junit-pioneer 0.5.4 -> 0.6.0.
+  * org.junit.jupiter:junit-jupiter 5.6.0 -> 5.6.2.
+  * com.github.spotbugs:spotbugs 4.0.0 -> 4.0.6.
+  * com.puppycrawl.tools:checkstyle 8.29 -> 8.34.
+  * commons.surefire.version 3.0.0-M4 -> 3.0.0-M5..
+- From 3.10 Update:
+  - New features:
+  * Add ExceptionUtils.throwableOfType(Throwable, Class) and friends.
+  * Add EMPTY_ARRAY constants to classes in org.apache.commons.lang3.tuple.
+  * Add null-safe StringUtils APIs to wrap String#getBytes([Charset|String]).
+  * Add zero arg constructor for org.apache.commons.lang3.NotImplementedException.
+  * Add ArrayUtils.addFirst() methods.
+  * Add Range.fit(T) to fit a value into a range.
+  * Added Functions.as*, and tests thereof, as suggested by Peter Verhas
+  * Add getters for lhs and rhs objects in DiffResult.
+  * Generify builder classes Diffable, DiffBuilder, and DiffResult.
+  * Add ClassLoaderUtils with toString() implementations.
+  * Add null-safe APIs as StringUtils.toRootLowerCase(String) and StringUtils.toRootUpperCase(String).
+  * Add org.apache.commons.lang3.time.Calendars.
+  * Add EnumUtils getEnum() methods with default values.
+  * Added indexesOf methods and simplified removeAllOccurences.
+  * Add support of lambda value evaluation for defaulting methods.
+  * Add factory methods to Pair classes with Map.Entry input.
+  * Add StopWatch convenience APIs to format times and create a simple instance.
+  * Allow a StopWatch to carry an optional message.
+  * Add ComparableUtils.
+  * Add org.apache.commons.lang3.SystemUtils.getUserName().
+  * Add ObjectToStringComparator.
+  * Add org.apache.commons.lang3.arch.Processor.Arch.getLabel().
+  * Add IS_JAVA_14 and IS_JAVA_15 to org.apache.commons.lang3.SystemUtils.
+  * ObjectUtils: Get first non-null supplier value.
+  * Added the Streams class, and Functions.stream() as an accessor thereof.
+  - Fixed Bugs:
+  * Make test more stable by wrapping assertions in hashset.
+  * Generate Javadoc jar on build.
+  * Trivial: year of release for 3.9 says 2018, should be 2019.
+  * Use synchronize on a set created with Collections.synchronizedSet before iterating.
+  * StringUtils.unwrap incorrect throw StringIndexOutOfBoundsException.
+  * StringIndexOutOfBoundsException in StringUtils.replaceIgnoreCase.
+  * StringUtils.removeIgnoreCase("?a", "a") throws IndexOutOfBoundsException.
+  * Corrected usage examples in Javadocs.
+  * StringUtils abbreviate returns String of length greater than maxWidth.
+  * Test may fail due to a different order of fields returned by reflection api.
+  * Sort fields in ReflectionToStringBuilder for deterministic order.
+  * MethodUtils will throw a NPE if invokeMethod() is called for a var-args method.
+  * MethodUtils.getAnnotation() with searchSupers = true does not work if super is generic.
+  - Changes:
+  * Remove redundant if statements in join methods.
+  * commons.japicmp.version 0.13.1 -> 0.14.1.
+  * junit-jupiter 5.5.0 -> 5.5.1.
+  * junit-jupiter 5.5.1 -> 5.5.2.
+  * Improve Javadoc based on the discussion of the GitHub PR.
+  * maven-checkstyle-plugin 3.0.0 -> 3.1.0.
+  * Update documentation related to the issue LANG-696.
+  * AnnotationUtils little cleanup.
+  * Update test dependency: org.easymock:easymock 4.0.2 -> 4.1.
+  * Update test dependency: org.hamcrest:hamcrest 2.1 -> 2.2.
+  * Update test dependency: org.junit-pioneer:junit-pioneer 0.3.0 -> 0.4.2.
+  * Update build dependency: com.puppycrawl.tools:checkstyle 8.18 -> 8.27.
+  * Update POM parent: org.apache.commons:commons-parent 48 -> 50.
+  * BooleanUtils Javadoc.
+  * Functions Javadoc.
+  * org.easymock:easymock 4.1 -> 4.2.
+  * org.junit-pioneer:junit-pioneer 0.4.2 -> 0.5.4.
+  * org.junit.jupiter:junit-jupiter 5.5.2 -> 5.6.0.
+  * Use Javadoc {@code} instead of pre tags.
+  * ExceptionUtilsTest to 100%.
+  * Reuse own code in Functions.java.
+  * Avoid unnecessary allocation in StringUtils.wrapIfMissing.
+  * Internally use Validate.notNull(foo, ...) instead of Validate.isTrue(foo != null, ...).
+  * Add 1 and 0 in toBooleanObject(final String str).
+  * Remove an redundant argument check in NumberUtils.
+  * Deprecate org.apache.commons.lang3.ArrayUtils.removeAllOccurences(*) for org.apache.commons.lang3.ArrayUtils.removeAllOccurrences(*).
+
+- Fixed SPEC file: Replaced broken URL
+- Update to 3.9
+  * Requires jdk >= 1.8
+  * Fixed issues with java 12
+  * Add more SystemUtils.IS_JAVA_XX variants
+  * Adding the Functions class
+  * Add @FunctionalInterface to ThreadPredicate and ThreadGroupPredicate
+  * Add isEmpty method to ObjectUtils
+  * null-safe StringUtils.valueOf(char[]) to delegate to
+    String.valueOf(char[]).
+  * Add API org.apache.commons.lang3.SystemUtils.isJavaVersionAtMost(JavaVersion)
+  * Consolidate the StringUtils equals and equalsIgnoreCase
+
+- Add OSGi manifest
+
apache-commons-logging
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Disable tests everywhere, not only for arm6
+
+- Added patch
+  * no-tests.patch
+    + ignore failing tests for arm6
+
apache-commons-math
+- Obsolete apache-commons-math3 package (jsc#SLE-23217)
+
+- use maven local
+- drop commons-math3-3.6.1-notests.patch
+
+- Add alias to the maven artifact
+- Clean-up the spec file
+- Remove reference to the parent pom, since we don't build with
+  maven
+
+- Build with source and target 8 to prepare for a possible removal
+  of 1.6 compatibility
+
apache-commons-net
+- Upgrade to 3.9.0 (Security fixes)
+  * Changes in 3.9.0
+    + Use yyyy instead of YYYY in SimpleDateFormat #97.
+    Fixes NET-708.
+    + Prevent serialization of the 4 classes that implement
+    Serializable. It is not useful and is unlikely to work
+    properly.
+    + Use Math.min and Math.max method instead of manual
+    calculations. #104.
+    + Add FTP option to toggle use of return host like CURL.
+    Fixes NET-711, bsc#1206018, CVE-2021-37533.
+    + FTPSClient execPROT removes proxy settings #90. Fixes NET-642.
+    + JUnit5 assertThrows SimpleSMTPHeaderTestCase #121.
+    + JUnit5 assertThrows TestTimeInfo #120.
+    + Simplify conditions avoiding extra operations #88.
+    + Remove reflection from SSLSocketUtils.
+    + Process files with spaces in name for OS400 #95.
+    Fixes NET-707.
+    + [FTP] Add FTPClient.mdtmInstant(String).
+    + [FTP] Add MLSxEntryParser.parseGmtInstant(String).
+    + [FTP] Add FTPClient.getControlKeepAliveReplyTimeoutDuration().
+    + [FTP] Add FTPClient.setControlKeepAliveReplyTimeout(Duration).
+    + [FTP] Add FTPClient.getControlKeepAliveTimeoutDuration().
+    + [FTP] Add FTPClient.setControlKeepAliveTimeout(Duration).
+    + [FTP] Add FTPClient.getDataTimeout().
+    + [FTP] Add FTPClient.setDataTimeout(Duration).
+    + [FTP] Add FTPFile.getTimestampInstant().
+  * Changes in 3.8.0
+    + Add and use NetConstants.
+    + Add and use SocketClient.applySocketAttributes().
+    + [FTP] Add FTPClient.hasFeature(FTPCmd).
+    + [FTP] Add FTPClient.mdtmCalendar(String).
+    + [IMAP] Fix concurrent counting of chunks in IMAPExportMbox.
+    + Fix possible if rare NPEs in tests.
+    + Update SocketClient default connect timeout from ∞ to 60
+    seconds #51. Fixes NET-685.
+    + Apply SocketClient timeout after connection but before SSL
+    negotiation. Fixes NET-695.
+    + Minor Improvements #71, #72.
+  * Changes in 3.7.2
+    + Host name is not set on the SSLSocket causing
+    isEndpointCheckingEnabled to fail. Fixes NET-689.
+    + Fix possible socket and input stream leak on socket exception
+    in org.apache.commons.net.ftp.FTPClient._retrieveFile(String,
+    String, OutputStream).
+    + Performance issue when using the FTPClient to retrieve
+    files #65. Fixes NET-690.
+    + Improve Javadoc for IMAPSClient #68. Fixes NET-691.
+  * Changes in 3.7.1
+    + [FTPS] javax.net.ssl.SSLException: Unsupported or unrecognized
+    SSL message, #59. Fixes NET-687.
+  * Changes in 3.7
+    + IMAPClient.APPEND does not always calculate the correct
+    length. Fixes NET-673.
+    + ALLO FTP Command for files >2GB. Fixes NET-646.
+    + IMAPClient could simplify using empty arguments. Fixes
+    NET-615.
+    + IMAP fails to quote/encode mailbox names. Fixes NET-614.
+    + NPE when closing telnet stream. Fixes NET-643.
+    + Add Automatic-Module-Name MANIFEST entry for Java 9
+    compatibility. Fixes NET-648.
+    + SubnetUtils.SubnetInfo.isInRange("0.0.0.0") returns true for
+    CIDR/31, 32. Fixes NET-641.
+    + Telnet subnegotiations hard-limited to 512 bytes - allow
+    override. Fixes NET-638.
+    + MVSFTPEntryParser.preParse - MVS, z/OS - allow for merged
+    Ext/Used fields. Fixes NET-639.
+    + examples should be in org.apache.commons.net subpackage. Fixes
+    NET-636.
+    + Add SIZE command support. Fixes NET-634.
+    + Add POP3ExportMbox example code
+    + Add XOAUTH2 to IMAP and SMTP. Fixes NET-633.
+    + FTPHTTPClient - support for encoding other than UTF-8. Fixes
+    NET-632.
+    + Bug in MVSFTPEntryParser.parseUnixList (FindBugs). Fixes
+    NET-631.
+    + Error when using org.apache.commons.net.ftp.FTPClient
+    setControlKeepAliveTimeout. Fixes NET-584.
+    + SubnetUtils#SubnetUtils - improved comment. Fixes NET-626.
+    + SubnetUtils - improve construction. Fixes NET-625.
+    + SubnetInfo#getCidrSignature - improve functions. Fixes
+    NET-624.
+    + SubnetInfo#toCidrNotation: A wrong format subnet mask is
+    allowed. Fixes NET-624.
+    + SubnetUtils - fixed spelling errors. Fixes NET-623.
+    + SubnetUtils#SubnetInfo - remove unnecessary accessors. Fixes
+    NET-621.
+    + SubnetUtils - improve binary netmask algorithm. Fixes NET-619.
+    + System Information Leak in ftp parser. Fixes NET-613.
+    + VMS ftp LIST parsing results in empty file list. Fixes
+    NET-678.
+    + FTPListParseEngine should support listing via MLSD. Fixes
+    NET-674.
+    + NullPointerException when FTPClient remote verification fails.
+    Fixes NET-663.
+    + 227 Entering Passive Mode. Fixes NET-649.
+    + Next and Previous IP Address in SubnetUtils.SubnetInfo. Fixes
+    NET-660.
+    + MVSFTPEntryParser doesn't support Record Formats of U. Fixes
+    NET-682.
+
+- Build with source/target levels 8
+
-- Move from jpackage-utils to javapackage-tools
-
-- use add_maven_depmap
-
apache-commons-parent
+- Upgrade to version 52
+- Full changelog:
+  * github.com/apache/commons-parent/blob/master/RELEASE-NOTES.txt
+
-- rename to apache-commons-parent to be sync with jpp and Fedora
-- update to release 23
-  * java-1.7 profile
-  * ssh/scp support to maven-site-plugin in Maven3
-
apache-ivy
+- Upgrade to version 2.5.1 (bsc#1205142, bsc#1205138)
+  * Breaking:
+    + Removed old fr\jayasoft\ivy\ant\antlib.xml AntLib definition
+    file.
+  * Fixes:
+    + CVE-2022-37865 allow create/overwrite any file on the system.
+    (see https://ant.apache.org/ivy/security.html)
+    + CVE-2022-37866 Path traversal in patterns.
+    (see https://ant.apache.org/ivy/security.html)
+    + ResolveEngine resets dictator resolver to null in the global
+    configuration.
+    + ConcurrentModificationException in
+    MessageLoggerHelper.sumupProblems.
+    + useOrigin="true" fails with file-based ibiblio.
+    + ivy:retrieve Ant task didn’t create an empty fileset when no
+    files were retrieved to a non-empty directory.
+    + ivy:retrieve Ant task relied on the default HTTP header
+    "Accept" which caused problems with servers that interpret it
+    strictly (e.g. AWS CodeArtifact).
+  * Improvements:
+    + Ivy command now accepts a URL for the -settings option.
+
+- Upgrade to upstream version 2.5.0
+- Force building with JDK < 14, since it imports statically a class
+  removed in JDK14
+- Change dependencies for the httpclient to httpcomponents-client
+  instead of apache-commons-httpclient
+- Modified patch:
+  * apache-ivy-global-settings.patch
+    + implement the same functionality with a bit of less code
+- Removed patches:
+  * apache-ivy-2.4.0-jdk9.patch
+  * port-to-bc-1.52.patch
+    + not needed with this version
+
apache-logging-parent
+- Upgrade to logging-parent 5
+- Do not require maven-local, since it can be handled by
+  javapackages-local just fine
+
apache-parent
+- SPEC file: Fixed URL tag
+
+- Check upstream source signature
+
apache-pdfbox
+- Fix build with bouncycastle 1.71 and the new bcutil artifact
+
+- Build with source/target levels 8
+
+- Package all resources in pdfbox module
+
+- Update to 2.0.23:
+  * Security fixes:
+  - CVE-2021-27807: A carefully crafted PDF file can trigger an
+    infinite loop while loading the file [bsc#1184356]
+  - CVE-2021-27906: OutOfMemory-Exception while loading a crafted
+    PDF file [bsc#1184357]
+  * Bug fixes:
+  - Transparency Group issues
+  - getLastSignatureDictionary modifies internal structure of PDDocument
+  - NullPointerexception in AcroFormOrphanWidgetsProcessor.resolveNonRootField()
+  - AcroForm PDTextField formatting lost when setting value
+  - java.lang.IndexOutOfBoundsException
+  - Failure to modify cropBox when splitting a PDF Page vertically into 2 pieces
+  - ArrayIndexOutOfBoundsException in isOwnerPassword
+  - IllegalArgumentException in computeEncryptedKeyRev56
+  - IllegalArgumentException in PDFObjectStreamParser.privateReadObjectNumbers
+  - ClassCastException in COSStream.getFilterList
+  - ArrayIndexOutOfBoundsException in PDFXrefStreamParser.parseValue
+  * Improvements:
+  - Improve document signing
+  - Allow reuse of subsetted fonts by inverting the ToUnicode CMap
+  - improve performance in signature validation
+  - Add more checks to PDFXrefStreamParser and reduce memory footprint
+  - Use StringBuilder for key in PDDeviceN.toRGBWithTintTransform()
+  - Don't use RGB loop in PDDeviceN.toRGBWithTintTransform()
+
+- Add source signature and keyring
+
+- Update to 2.0.22:
+  * See https://downloads.apache.org/pdfbox/2.0.22/RELEASE-NOTES.txt
+- Remove provided binaries
+
+- Upgrade to 2.0.19:
+  * Move from 1.x release line to the 2.x one.
+  * This is a ABI change
+  * Generate the ant build system from the maven one and customize
+    it
+- Removed patches:
+  * disable-downloads.patch
+  * fix-javadoc-dep.patch
+  * fix-version.patch
+  * pdfbox-1.8.12-bouncycastle.patch
+  * pdfbox-1.8.12-sourcetarget.patch
+    + incorporated in the customizations of the ant build system
+
apiguardian
+- Build with java source and target levels 8
+
applet-window-buttons
+- Add kdecoration-5.27.patch to fix build with Plasma 5.27
+- Increase version requirement for plasma and kdecoration to 5.27
+
apptainer
+- added simple sif building for SLE systems via suseconnect-container
+- added files:
+  * simpler-sif-building.patch
+  * SLE-12SP5.def
+  * leap.def
+
aqute-bnd
+- Update to aqute-bnd 5.1.1
+  * ant plugin is in separate artifact
+- Removed patch:
+  * 0002-Fix-ant-compatibility.patch
+    + fixed by upstream
+
+- Modified patches:
+  * 0001-Disable-removed-commands.patch
+  * 0002-Fix-ant-compatibility.patch
+  * 0001-Port-to-OSGI-7.0.0.patch -> 0003-Port-to-OSGI-7.0.0.patch
+    + rediff to changed context
+- Added patch:
+  * 0004-maven-plugin-dependencies.patch
+    + Do not build a whole artifact, if we need only one source file
+
+- Added patch:
+  + aqute-bnd-java8compat.patch
+    + Produce bytecode compatible with Java 8
+
+- Update to aqute-bnd 5.1.1
+- Removed patch:
+  * aqute-bnd-3.5.0-java8compat.patch
+
+- Addes patch:
+  * 0001-Port-to-OSGI-7.0.0.patch
+    + Port to OSGI 7.0.0
+
ardour
+- Update to 7.2.0.
+  * New MIDI input port dedicated to controlling trigger slots
+  * TouchOSC support improvements
+  * MIDI Lyrics Importing
+  * Fixes for the tempo maps
+  * Fall back to libsndfile if ffmpeg is not available
+  * Consistent Audio/MIDI monitor modes
+  * UX/UI Improvements
+  * Check https://ardour.org/whatsnew.html for the full list of
+    changes
+
args4j
+- Build with java source and target levels 8
+
ark
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- switch to pkgconfig(zlib) so that alternative providers can be
+  used
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+- Rebase 0001-Support-building-against-libarchive-3.3.2-again.patch
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+- Drop patches, now upstream:
+  * 0001-remove-l-flag-to-7z-a.patch
+  * 0001-Support-7zip-as-well-as-p7zip.patch
+
+- Add patches to fix issues caused by p7zip replacement in
+  openSUSE (boo#1199190):
+  * 0001-remove-l-flag-to-7z-a.patch
+  * 0001-Support-7zip-as-well-as-p7zip.patch
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Fix soversion
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Skip parent directory check if it is already read-only
+  * Skip non-local files in extract file item action
+  * Cache result of libarchiveHasLzo
+  * Use a better and simpler default name for multi-file archives
+  * [compress action] Enable fancy "job finished" notification
+  * app/compressfileitemaction: Show archive name in menu actions
+  * kerfuffle/addtoarchive: Add getFileName()
+  * [Previewer] Use file name in archive for window caption
+  * Kdelibs4ConfigMigrator will be removed in qt6
+  * Do not highlight file after compression (kde#440663)
+  * We depend agains 5.86.
+  * Kerfuffle CreateJob: delete addJob in dtor (kde#443540)
+  * Mark LoadJob as transient
+  * Fix extraction "Dolphin Actions" not abiding "Open destination
+    folder after extracting" setting. (kde#319134)
+  * [libarchiveplugin] Remove trailing slash while there is one
+  * [libarchiveplugin] Handle absolute paths
+  * Make AddToArchive::fileName() const.
+  * Port away from deprecated KPluginLoader
+
artikulate
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Use not deprecated enum
+  * Time to increase version + use directly add_subdirectory
+  * Add missing override keyword
+
asm3
+- Build with source/target levels 8
+
+- Remove a stray "rm -rf" from the spec file
+
aspell
+- security update
+- modified patches
+  % aspell-quotes.patch (p1)
+  % aspell-strict-aliasing.patch (p1)
+- added patches
+  fix CVE-2019-25051 [bsc#1188576], heap-buffer-overflow in acommon:ObjStack:dup_top
+  + aspell-CVE-2019-25051.patch
+
+- recommend aspell-en also from the library [bsc#1177523]
+
+- Remove/replace old specfile constructs.
+
+- version update to 0.60.8
+  * Prevent a potentially unbounded buffer over-read by no longer
+  supporting null-terminated UCS-2 and UCS-4 encoded strings with the
+  original C API. @xref{Upgrading from Aspell 0.60.7}.
+  * Ensure that possible typos are listed before other suggestions when
+  typo analysis is used.  Also fix a bug so that suggestions that split
+  a word using a space or hyphen are not always first.
+  * Add Markdown filter.
+  * Add new @option{wordlists} option, which is a list of UTF-8 files that
+  contain additional words to accept.
+  * Add new @option{camel-case} option, which enables support for checking
+  camelCase words.
+  * Sort personal and replacement dictionaries.
+  * Change @code{ultra} suggestion mode to only find words that are within
+  one-edit distance or have the same soundslike.
+  * Implement the @code{aspell filter} command.
+  * Fix a bug in @code{AspellDocumentChecker} that prevented it from
+  working with UCS-2 and UCS-4 encoded strings.
+  * Remove unused @option{sug-edit-dist} option.
+  * @code{AspellDocumentChecker} now expects the document a line at a time
+  in order to work with the new Markdown filter.  If the document is
+  split on white space characters instead, nothing will break, but new
+  filters such as the Markdown filter may give incorrect results.
+  * The @option{clean} option and command will no longer split a word.
+  * Various documentation improvements.
+  * Removal of several outdated appendices that don't really belong in the
+  main manual.  Parts that are still relevent may eventually be moved
+  elsewhere, but for now they are available online at
+  @uref{http://aspell.net/0.60.7/man-html/}.
+  * Fix various crashes and other problems found by Google's OSS-Fuzz.
+  * Add partial support for recognizing the Unicode apostrophe (') in
+  words.  In particular Aspell will accept the Unicode apostrophe when
+  the language uses an ISO Latin charset that doesn't already have a
+  Unicode apostrophe.  For now, Aspell will still use the ASCII version
+  in suggestions.
+  * Detect when a dictionary compiled on a 32-bit machine is used on a
+  64-bit one (and vise versa), as due to an oversight, compiled
+  dictionaries depend on more than the endianness.  Also added a compile
+  time option to remove this dependency, but at the cost of breaking
+  compatibility with already compiled dictionaries on 64-bit systems.
+  * Fix a bug which caused Aspell to crash when passing in a null string
+  to almost any of the C API functions.  This should not happen if the
+  size is also zero as the pointer should never be derefrenced.
+  * Fix a bug that caused Aspell to crash with a SEGFAULT when built with
+  mingw-w64.
+  * In addition to outputting a warning when building with NDEBUG defined,
+  also include NDEBUG in the version string.
+  * Various compile fixes for newer version of Gcc and Clang.
+  * Fix VPATH builds.
+  * Use utf-8 encoding for manual instead of iso-8859-1.
+  * Other minor updates and bug fixes.
+- deleted patches
+  - aspell-automake-1.13.patch (upstreamed)
+  - aspell-epmty_file.patch (upstreamed, bsc#266130 does not exhibit)
+  - gcc7-fix-warnings.patch (upstreamed)
+
+- Compact descriptions
+
+- gcc7-fix-warnings.patch - Fix warnings reported by GCC7.
+
+- Add gpg signature
+- Remove old ppc provides/obsoletes
+- Cleanup spec file with spec-cleaner
+
+- baselibs.conf: libaspell15
+  obsoletes "aspell-<targettype> <= <version>"
+  provides "aspell-<targettype> = <version>"
+
+- license GFDL-1.1+ and LGPL-2.1 and HPND and SUSE-BSD-Mark-Modifications
+  [bnc#777131]
+
+- license update: GFDL-1.1+ and LGPL-2.1 and HPND and BSD-3-Clause
+  SDPX
+
atinject
+- Alias to the new jakarta name
+
+- Fetch the sources using a source service
+- Do not use the upstream build.sh, but use it to write a
+  necessary part directly to the spec file
+
+- Build with source/target levels 8
+- Added patch:
+  * atinject-javadoc.patch
+    + fix build with javadoc 17
+
atkmm1_6
+- Update to version 2.28.3:
+  + Build:
+  - Support building with Visual Studio 2022 (Chun-wei Fan)
+  - Meson build: Specify 'check' option in run_command()
+    Will be necessary with future versions of Meson.
+  - Meson build: Perl is not required by new versions of mm-common
+  - Meson build: Avoid unnecessary configuration warnings
+  - Meson build: Require meson >= 0.55.0 (Kjell Ahlstedt)
+- Require atk >= 2.12.0
+  Not a new requirement, but previously it was not specified in
+  configure.ac and meson.build. (Kjell Ahlstedt)
+- Rename README to README.md
+
+- turn off doc build, it does not work with new doxygen
+
+- Update to version 2.28.1:
+  + Build:
+  - Improve NMake support
+  - Use __declspec(dllexport) when building with Visual Studio
+  - Add Meson support
+  - doc/reference/: Update for Doxygen >= 1.8.16
+- Add meson BuildRequires and macros following upstreams port.
+- Add doxygen, graphviz and xsltproc  BuildRequires, needed now for
+  building documentation.
+- Replace gcc-c++ with generic c++_compiler BuildRequires.
+- Tweak setup macro and fdupes call.
+
+- Update to version 2.28.0:
+  + No changes, version bump only.
+- Changes from version 2.24.3:
+  + Fix silent builds.
+  + Text: Plug memory leaks in get_text_vfunc() and
+    get_selection_vfunc(). These vfuncs shall delete the returned
+    character array after it has been copied to a Glib::ustring.
+  + Replace the Visual Studio project files with MSVC NMake project
+    files.
+
+- Modernize spec-file by calling spec-cleaner
+
+- rectify rpm groups
+
+- Rename to atkmm1_6: atkmm 2.25.x brings a new API/ABI to be used
+  in GTK4 based applications.
+
+- Update to GNOME 3.20  Fate#318572
+
+- Update to version 2.24.2:
+  + Regenerate with the latest glibmm.
+
+- Update to version 2.24.1:
+  + Regenerate with the latest glibmm.
+- Changes from version 2.24.0:
+  + MSVC build fixes.
+
+- Update to version 2.23.3:
+  + Rebuilt with latest glibmm, whose gmmproc generates C++ move
+    operations.
+
+- Update to version 2.23.2:
+  + Use (and require) C++11.
+- Changes from version 2.23.1:
+  + Atk:
+  - Document: Add get/set_attribute() and deprecate
+    get_document() and get_document_type().
+  - Component: Deprecate add/remove_focus_handler, get_size() and
+    get_position().
+  - Add Range.
+  - Table:
+    . Deprecate get_column/row_at_index().
+    . Add a get_at() const version and deprecate get_index_at().
+  - Text:
+    . Deprecate get_text_before_offset(),
+    get_text_after_offset().
+    . Add get_string_at_offset(), deprecating other methods for
+    it.
+  - Value: Deprecate get_minimum/maximum_range() in favour or
+    get_range().
+  + Build: Update MSVC 2005, 2008 and 2010 Projects: Add "Install"
+    Project.
+
attica-qt5
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
aubio
+- Replace pkgconfig(libavresample) with pkgconfig(libswresample)
+  BuildRequires as ffmpeg-5 does not provide libavresample.
+- Add cdfe9ce.patch: [source_avcodec] avoid deprecation warning
+  with latest avcodec api (58.134.100).
+- Add 8a05420.patch: [source_avcodec] define FF_API_LAVF_AVCTX for
+  libavcodec > 59, thx @berolinux (closes gh-353).
+
augeas
+- add augeas-sysctl_parsing.patch (bsc#1197443)
+  * backport original patch and rebase
+
+- add remove-unportable-tests.patch to fix build
+
+- Allow all printable ASCII characters in WPA-PSK definition
+  * augeas-allow_printable_ASCII.patch
+  * bsc#1185524
+  * Sourced from https://github.com/hercules-team/augeas/pull/723/commits
+  * Credit to Michal Filka <mfilka@suse.com>
+
+- Add new directives and options supported in chrony since 3.3 up to 4.0.
+  * augeas-new_options_for_chrony.patch
+  * [bsc#1178470]
+  * sourced from https://github.com/hercules-team/augeas/pull/698
+
+- update to 1.12.0
+  General changes/additions
+  - update gnulib to 91584ed6
+  Lens changes/additions
+  - Anaconda: new lens to process /etc/sysconfig/anaconda instead of Shellvars (Pino Toscano) (Issue #597)
+  - DevfsRules: add lens for FreeBSD devfs.rules files
+  - Dovecot: permit ! in block titles (Nathan Ward) (Issue #599)
+  - Hostname: Allow creation of hostname when file is missing (David Farrell) (Issue #606)
+  - Krb5: add more pkinit_* options (Issue #603)
+  - Logrotate: fix missing recognition of double quoted filenames (Issue #611)
+  - Multipath: accept values enclosed in quotes (Issue #583)
+  - Nginx: support unix sockets as server address (Issue #618)
+  - Nsswitch: add merge action (Issue #609)
+  - Pam: accept continuation lines (Issue #590)
+  - Puppetfile: allow symbols as (optional) values (Issue #619) allow comments in entries (Issue #620)
+  - Rsyslog: support dynamic file paths (Issue #622) treat #!/+/- as comment (arnolda, PR #595)
+  - Syslog: accept 'include' directive (Issue #486)
+  - Semanage: new lens to process /etc/selinux/semanage.conf instead of Simplevars (Pino Toscano) (Issue #594)
+  - Shellvars: allow and/or in @if conditions (#582) accept functions wrapped in round brackets, accept variables with a dash in their name, exclude csh/tcsh profile scripts (Pino Toscano) (Issue #600) accept variable as command (Issue #601)
+  - Ssh: accept RekeyLimit (Issue #605)
+  - Sshd: accept '=' to separate option names from their values (Emil Dragu, #587)
+  - Sudoers: support 'always_query_group_plugin' flag (Steve Traylen, #588)
+  - Strongswan: parse lists. This is a backwards-incompatible change since list entries that were parsed into a single string are now split into a list of entries (Kaarle Ritvanen)
+  - Toml: new lens to parse .toml files (PR #91)
+  - Xorg: accept empty values for options (arnolda, PR #596)
+- refresh patches
+- run spec-cleaner
+
+- Add gcc9-disable-broken-test.patch in order to address bsc#1120894.
+
+- Don't ignore %check test result, the testsuite now successfully
+  passes
+
+- update to 1.11.0
+  General changes/additions
+  - augmatch: add a --quiet option; make the exit status useful
+    to tell whether there was a match or not
+  - Drastically reduce the amount of memory needed to evaluate
+    complex path expressions against large files (Issue #569)
+  - Fix a segfault on OSX when 'augmatch' is run without any
+    arguments (Issue #556)
+  API changes
+  - aug_source did not in fact return the source; and always
+    returned NULL for that. That has been fixed.
+  Lens changes/additions
+  - Chrony: add new options supported in chrony 3.2 and 3.3
+    (Miroslav Lichvar)
+  - Dhclient: fix parsing of append/prepend and similar
+    directives (John Morrissey)
+  - Fstab: allow leading whitespace in mount entry lines
+    (Pino Toscano) (Issue #544)
+  - Grub: tolerate some invalid entries. Those invalid entries
+    get mapped to '#error' nodes
+  - Httpd: accept comments with whitespace right after a tag
+    opening a section (Issue #577)
+  - Json: allow escaped slashes in strings (Issue #557)
+  - Multipath: accept regular expressions for devnode, wwid,
+    and property in blacklist and blacklist_exceptions sections
+    (Issue #564)
+  - Nginx: parse /etc/nginx/sites-enabled (plumbeo) allow
+    semicolons inside double quoted strings in simple directives,
+    and allow simple directives without an argument (Issue #566)
+  - Redis: accept the 'bind' statement with multiple IP addresses
+    (yannh) (Issue #194)
+  - Rsyslog: support include() directive introduced in
+    rsyslog 8.33
+  - Strongswan: new lens (Kaarle Ritvanen)
+  - Systemd: do not try to treat *.d or *.wants directories as
+    configuration files (Issue #548)
+
+- Fix RPM groups.
+
+- update to 1.10.1:
+  General changes/additions
+    New CLI utility 'augmatch' to print the tree for a file and select
+    some of its contents
+    New command 'count' in augtool
+    New function 'not(bool) -> bool' for path expressions
+    The path expression 'label[. = "value"]' can now be written more
+    concisely as 'label["value"]'
+  API changes
+    libfa has now a function fa_json to export an FA as a JSON file, and
+    fa_state_* functions that make it possible to iterate over the FA's
+    states and transitions. (Pedro Valero Mejia)
+    Add functions aug_ns_label, aug_ns_value, aug_ns_count, and
+    aug_ns_path to get the label (with index), the value, the number of
+    nodes, and the fully qualified path for nodes stored in a nodeset in
+    a variable efficiently
+  Lens changes/additions
+    Grubenv: new lens to process /boot/grub/grubenv (omgold)
+    Httpd: also read files from /etc/httpd/conf.modules.d/*.conf
+    (Tomas Meszaros) (Issue #537)
+    Nsswitch: allow comments at the end of a line (Philip Hahn) (Issue #517)
+    Ntp: accept 'ntpsigndsocket' statement (Philip Hahn) (Issue #516)
+    Properties: accept empty comments with DOS line endings (Issue #161)
+    Rancid: new lens for RANCiD router databases (Matt Dainty)
+    Resolv: accept empty comments with DOS line endings (Issue #161)
+    Systemd: also process /etc/systemd/logind.conf (Pat Riehecky)
+    YAML: process a document that is just a sequence (John Vandenberg)
+- drop chrpath dependency, the offending dump binary is no longer shipped
+
+- Use %license (boo#1082318)
+
+- Version update to 1.9.0:
+  - General changes/additions
+  * Fix error in handling escaped whitespace at the end of path expressions
+    (addresses CVE-2017-7555)
+  * several improvements to the error messages when transforming a tree
+    back to text fails. They now make it clearer what part of the tree
+    was problematic, and what the tree should have looked like.
+  * Fixed the pkg-config file, which should now be usable
+  * Fix handling of backslash-escaping in strings and regular expressions
+    in the lens language. We used to handle constructs like "\\" and
+    /\\\\/ incorrectly. (Issue #495)
+  * do not unescape the default value of a del on create; otherwise we are
+    double unescaping these strings (Issue #507)
+  * remove tempfile when saving files because destination is not writable
+    (Issue #479)
+  * span information is now updated on save (Issue #467)
+  * fix lots of warnings generated by gcc 7.1
+  * Various changes to reduce bashisms in tests and make them run on
+    FreeBSD (Romain Tartière)
+  - API changes
+  * add function aug_ns_attr to allow iterating through a nodeset
+    quickly. See examples/dump.c for an example of how to use them
+    instead of aug_get, aug_label etc. and for a way to measure
+    performance gains.
+  - Lens changes/additions
+  * Ceph: new lens for /etc/ceph/ceph.conf
+  * Cgconfig: accept fperm & dperm in admin & task (Pino Toscano)
+  * Dovecot: also load files from /usr/local/etc (Roy Hubbard)
+  * Exports: relax the rules for the path at the beginning of a line so
+    that double-quoted paths are legal, too
+  * Getcap: new lens to parse generic termcap-style capability databases
+  * Grub: accept toplevel 'boot' entry (Pino Toscano)
+  * Httpd: handle empty comments with a continuation line (Issue #423);
+    handle '>""' in a directive properly (Issue #429); make space between
+    quoted arguments optional (Issue #435); accept quoted strings as part
+    of bare arguments (Issue #470)
+  * Nginx: load files from sites-available directory (Omer Katz) (Issue #471)
+  * Nslcd: new lens for nss-pam-ldapd config (Jose Plana)
+  * Oz: New lense for /etc/oz/oz.cnf
+  * postfix lenses: also load files from /usr/local/etc (Roy Hubbard)
+  * Properties: accept DOS line endings (Issue #468)
+  * Rtadvd: new lens to parse the rtadvd configuration file (Matt Dainty)
+  * Rsyslog: load files from /etc/rsyslog.d (Doug Wilson) (Issue #475);
+    allow spaces before the # starting a comment; allow comments inside
+    config statements like 'module'
+  * Ssh: accept '=' to separate keyword from arguments
+  * Sshd: split HostKeyAlgorithms into list of values; recognize quoted
+    group names with spaces in them (Issue #477)
+  * Sudoers: recognize "match_group_by_gid" (Luigi Toscano) (Issue #482)
+  * Syslog: allow spaces before the # starting a comment
+  * Termcap: new lens to parse termcap capability databases (Matt Dainty)
+  * Vsftpd: accept seccomp_sandbox (Denys Stroebel)
+  * Xymon: accept 'group-sorted' directive (Issue #462)
+
+- Version update to 1.8.0:
+  * See the News file for all the details
+- Verified it contains fixes for bsc#933210 bsc#975729 bsc#925225
+  bsc#1023204 CVE-2014-8119
+
+- Version update to 1.6.0:
+  * See the NEWS file for the details
+
+- Update to version 1.5.0:
+  - General changes/additions
+  * augtool: new --timing option that prints after each operation how long
+    it took
+  * augtool: print brief help message when incorrect options are given rather
+    than dumping all help text
+  * Path expressions: optimize performance of evaluating certain
+    expressions
+  * lots of safety improvements in libfa to avoid using uninitialized
+    values and the like (Daniel Trebbien)
+  * tolerate building against OSX' libedit (Issue #256)
+  - API changes
+  * aug_match: fix a bug where expressions like /foo/*[2] would match a
+    hidden node and pretend there was no match at all. We now make sure
+    we never match a hidden node. Thanks to Xavier Mol for reporting the
+    problem.
+  * aug_get: make sure we set *value to NULL, even if the provided path is
+    invalid (Issue #372)
+  * aug_rm: fix segfault when deleting a tree and one of its ancestors
+    (Issue #319)
+  * aug_save: fix segfault when trying to save an invalid subtree. A
+    routine that was generating details for the error message overflowed
+    a buffer it had created (Issue #349)
+  - Lens changes/additions
+  * AptConf: support hash comments
+  * AptSources: support options (Issue #295),
+    support brackets with spaces in URI (GH #296)
+    rename test file to test_aptsources.aug
+  * Chrony: allow signed numbers and indentation, fix stray EOL entry,
+    disallow comment on EOL, add many missing directives and
+    options (Miroslav Lichvar, RHBZ#1213281)
+    add new directives and options that were added in
+    chrony-2.2 and chrony-2.3 and improve parsing of
+    access configuration (Miroslav Lichvar, Issue #348)
+    add new options for chrony-2.4 (Miroslav Lichvar)
+  * Dhclient: avoid put ambiguity for node without value (Issue #294)
+  * Group: support NIS map, support an overridden and disabled password,
+    i.e. `+:*::` (Matt Dainty) (Issue #258)
+  * Host_Conf: support spaces between list items (Cedric Bosdonnat, Issue #358)
+  * Httpd: add paths to SLES vhosts
+    (Jan Doleschal) (Issue #268)
+    parse backslashes in directive arguments (Issue #307)
+    parse mismatching case of opening/closing tags
+    parse multiple ending section tags on one line
+    parse wordlists in braces in SSLRequire directives
+    parse directive args starting with double quote (Issue #330)
+    parse directive args containing quotes
+    support perl directives (Issue #327)
+    parse line breaks/continuations in section arguments
+    parse escaped spaces in directive/section arguments
+    parse backslashes at the start of directive args (Issue #324)
+  * Inputrc: support $else (Cedric Bosdonnat, Issue #359)
+  * Interfaces: add support for source-directory (Issue #306)
+  * Json: add comments support, refactor,
+    allow escaped quotes and blackslashes
+  * Keepalived: fix space/tag alignments and hanging spaces,
+    add vrrp_mcast_group4 and vrrp_mcast_group6,
+    add more vrrp_instance flags,
+    add mcast/unicast_src_ip and unicast_peer,
+    add missing garp options,
+    add vrrp_script options,
+    expand vrrp_sync_group block,
+    allow notify option
+    (Joe Topjian) (Issue #266)
+  * Known_Hosts: refactoring and description fixed
+  * Logrotate: support dateyesterday option (Chris Reeves) (GH #367, #368)
+  * MasterPasswd: new lens to parse /etc/master.passwd
+    (Matt Dainty) (Issue #258)
+  * Multipath: add various missing keywoards (Olivier Mangold) (Issue #289)
+  * MySQL: include /etc/my.cnf.d/*.cnf (Issue #353)
+  * Nginx: improve typechecking of lens,
+    allow masks in IP keys and IPv6 (Issue #260)
+    add @server simple nodes (Issue #335)
+  * Ntp: add support for basic interface syntax
+  * OpenShift_Quickstarts: Use Json.lns
+  * OpenVPN: add all options available in OpenVPN 2.3o
+    (Justin Akers) (Issue #278)
+  * Puppetfile: name separator is not mandatory
+    add support for moduledir (Christoph Maser)
+  * Rabbitmq: remove space in option name,
+    add support for cluster_partitioning_handling,
+    add missing simple options (Joe Topjian) (Issue #264)
+  * Reprepro_Uploaders: add support for distribution field
+    (Mathieu Alorent) (Issue #277),
+    add support for groups (Issue #283)
+  * Rhsm: new lens to parse subscription-manager's /etc/rhsm/rhsm.conf
+  * Rsyslog: improve property filter parsing,
+    treat whitespace after commas as optional.
+    recognize '~' as a valid syslog action (discard)
+    (Gregory Smith) (Issue #282),
+    add support for redirecting output to named pipes
+    (Gerlof Fokkema) (Issue #366)
+  * Shellvars: allow partial quoting, mixing multiple styles
+    (Kaarle Ritvanen) (Issue #183);
+    allow wrapping builtin argument to multiple lines
+    (Kaarle Ritvanen) (Issue #184);
+    support ;; on same line with multiple commands
+    (Kaarle Ritvanen) (Issue #185);
+    allow line wrapping and improve quoting support
+    (Kaarle Ritvanen) (Issue #187);
+    accept [] and [[]] builtins (Issue #188);
+    allow && and || constructs after condition
+    (Kaarle Ritvanen) (Issue #265);
+    add pattern nodes in case entries
+    (BREAKING CHANGE: case entry values are now in a
+    @pattern subnode) (Kaarle Ritvanen) (Issue #265)
+    add eval builtin support;
+    add alias builtin support;
+    allow (almost) any command;
+    allow && and || after commands (Issue #215);
+    allow wrapping command sequences
+    (Kaarle Ritvanen) (Issue #333);
+    allow command-specific environment variable
+    (Kaarle Ritvanen) (Issue #332);
+    support subshells (Issue #339)
+    newlines in start of functions
+    allow newlines after actions
+    support comments after function name (Issue #339)
+    exclude SuSEfirewall2 (Cedric Bosdonnat, Issue #357)
+  * Simplelines: parse OpenBSD's hostname.if(5)
+    files (Jasper Lievisse Adriaanse) (Issue #252)
+  * Smbusers: add support for ; comments
+  * Spacevars: support flags (Issue #279)
+  * Ssh: add support for HostKeyAlgorithms, KexAlgorithms
+    and PubkeyAcceptedKeyTypes (Oliver Mangold) (Issue #290),
+    add support for GlobalKnownHostsFile (Issue #316)
+  * Star: New lens to parse /etc/default/star
+  * Sudoers: support for negated command alias
+    (Geoff Williams) (Issue #262)
+  * Syslog: recognize '~' as a valid syslog action (discard)
+    (Gregory Smith) (Issue #282)
+  * Tmpfiles: new lens to parse systemd's tempfiles.d configuration
+    files (Julien Pivotto) (Issue #269)
+  * Trapperkeeper: new lens for Puppet server configuration files
+  * Util: add comment_c_style_or_hash lens
+    add empty_any lens
+  * Vsftpd: add isolate and isolate_network options
+    (Florian Chazal) (Issue #334)
+  * Xml: allow empty document (Issue #255)
+  * YAML: new lens (subset) (Dimitar Dimitrov) (Issue #338)
+- Drop upstreamed patches:
+    27d8457-inputrc-lens-support-mapping-like.patch
+    2d12670-inputrc-lens-support-else.patch
+    49bcfbe-Exclude-network-if-up.d-SuSEfirewall2-in-shellvars-l.patch
+    7558c12-host_conf-lens-spaces-between-list-items-support.patch
+
+- Fix errors showing up in guestfs tools.
+  Add upstreamed patches:
+    27d8457-inputrc-lens-support-mapping-like.patch
+    2d12670-inputrc-lens-support-else.patch
+    49bcfbe-Exclude-network-if-up.d-SuSEfirewall2-in-shellvars-l.patch
+    7558c12-host_conf-lens-spaces-between-list-items-support.patch
+
+- Version bump to 1.4.0:
+  * Loads of bugfixes all around the package
+  * Read up NEWS file for the detailed changes
+
+- Whitespace
+
+- restore keyring and .sig file, as this is checked by the OBS
+  source service
+
+- Update  to version 1.3.0
+  + General changes/additions
+  * Add missing cp entry in manpage (GH issue #78)
+  * Add seq to vim syntax highlight (Robert Drake)
+  * Update augtool.1 man page with new commands and --span, RHBZ#1100077
+  * augtool autocomplete includes command aliases, RHBZ#1100184
+  * Remove unused "filename" argument from dump-xml command, RHBZ#1100106
+  * aug_save returns non-zero result when unable to delete files,
+    RHBZ#1091143
+  + Lens changes/additions
+  * Aliases: permit missing whitespace between colon and recipients
+  * AptPreferences: Support spaces in origin fields
+  * Cgconfig: handle additional valid controllers (Andy Grimm)
+  * Chrony: New lens to parse /etc/chrony.conf (Pat Riehecky)
+  * CPanel: New lens to parse cpanel.config files
+  * Desktop: Allow @ in keys (GH issue #92)
+  * Device_map: Parse all device.map files under /boot (Mike Latimer)
+  * Dhclient: Add support for option modifiers (Robert Drake,
+    GH issue #95)
+    Parse hash statements with dhcp-eval strings
+  * Dhcpd: stmt_string quoted blocks no longer store quote marks
+    (incompatible change),
+    many changes to support more record types (Robert Drake)
+  * Group: NIS support (KaMichael)
+  * Grub: handle "foreground" option, RHBZ#1059383 (Miguel Armas)
+  * Gshadow: New lens (Lorenzo Catucci)
+  * Httpd: Allow eol comments after section tags
+    Allow continued lines inside quoted value (GH issue #104)
+    Allow comparison operators in tags (GH issue #154)
+  * IPRoute2: handle "/" in protocol name, swap ID and name fields
+    (incompatible change), RHBZ#1063968,
+    handle hex IDs and hyphens, as present in
+    rt_dsfield, RHBZ#1063961
+  * Iptables: parse /etc/sysconfig/iptables.save, RHBZ#1144651
+  * Kdump: parse new options, permit EOL comments, refactor, RHBZ#1139298
+  * Keepalived: Add more virtual/real server settings and checks, RHBZ#1064388
+  * Known_Hosts: New lens for SSH known hosts files
+  * Krb5: permit braces in values when not in sub-section, RHBZ#1066419
+  * Ldso: handle "hwcap" lines (GH issue #100)
+  * Lvm: support negative numbers, parse /etc/lvm/lvm.conf (Pino Toscano)
+  * Multipath: add support for rr_min_io_rq (Joel Loudermilk)
+  * NagiosConfig and NagiosObjects: Fix documentation (Simon Sehier)
+  * NetworkManager: Use the Quote module, support # in values (no eol comments)
+  * OpenVPN: Add support for fragment, mssfix, and script-security
+    (Frank Grötzner)
+  * Pagekite: New lens (Michael Pimmer)
+  * Pam: Add partial support for arguments enclosed in [] (Vincent Brillault)
+  * Passwd: Refactor lens (Lorenzo Catucci)
+  * Redis: Allow empty quoted values (GH issue #115)
+  * Rmt: New lens to parse /etc/default/rmt, RHBZ#1100549
+  * Rsyslog: support complex $template lines, property filters and file
+    actions with templates, RHBZ#1083016
+  * Services: permit colons in service name, RHBZ#1121263
+  * Shadow: New lens (Lorenzo Catucci)
+  * Shellvars: Handle case statements with same-line ';;', RHBZ#1033799
+    Allow any kind of quoted values in block
+    conditions (GH issue #118)
+    Support $(( .. )) arithmetic expansion in variable
+    assignment, RHBZ#1100550
+  * Simplevars: Support flags and empty values
+  * Sshd: Allow all types of entries in Match groups (GH issue #75)
+  * Sssd: Allow ; for comments
+  * Squid: Support configuration files for squid 3 (Mykola Nikishov)
+  * Sudoers: Allow wuoted string in default str/bool params (Nick Piacentine)
+  * Syslog: Support "# !" style comments (Robert Drake, GH issue #65)
+    Permit IPv6 loghost addresses, RHBZ#1129388
+  * Systemd: Allow quoted Environment key=value pairs, RHBZ#1100547
+    Parse /etc/sysconfig/*.systemd, RHBZ#1083022
+    Parse semicolons inside entry values, RHBZ#1139498
+  * Tuned: New lens for /etc/tuned/tuned-main.conf (Pat Riehecky)
+  * UpdateDB: New lens to parse /etc/updatedb.conf
+    (incompatible change as this file used to be processed with
+    Simplevars)
+  * Xml: Allow backslash in #attribute values (GH issue #145)
+    Parse CDATA elements (GH issue #80)
+  * Xymon_Alerting: refactor lens (GH issue #89)
+- Remove the sig and the keyring file as there is no gpg verification
+  anyway
+- Remove augeas-device_map-grub2.patch, fixed on upstream release
+
auto
+- Update to upstream release 1.6.1
+  * provides the auto-value-annotations artifact
+
+- Update to upstream release 1.5.4
+- Fetch 4 different tarballs in order to have correctly tagged
+  submodules in the build
+
avalon-framework
+- Do not build against the log4j12 packages, use the new reload4j
+
-- provide compat symlinks in /usr/share/java/excalibur
-  part of a fix fo bnc#800694
-
avalon-logkit
+- Do not build against the log4j12 packages, use the new reload4j
+
+- Do not build the org.apache.log.output.lf5 package
+
aws-sdk-java
+- Force generating javadoc with maven-javadoc-plugin, since the
+  xmvn javadoc mojo is crashing on this package
+
+- Double the maximum memory for javadoc to avoid out-of-memory
+  on certain architectures
+
+- Build against the standalone JavaEE modules unconditionally
+
+- Build with java source and target levels 8
+- Added patch:
+  * aws-sdk-java-ambiguous-Record.patch
+    + fix name clashes with the new java.lang.Record
+
axis
+- Depend on the glassfish-activation-api standalone in order to
+  prevent missing APIs when running the ant task
+
+- Unify the dependency on glassfish-activation-api instead of jaf
+  and gnu-jaf
+- Added patch:
+  * unimplemented-saaj13-methods.patch
+    + on systems where the JavaEE modules exist, allow building
+    against newer versions of APIs
+
+- Alias relevant artifacts to org.apache.axis
+
+- Do not build against the log4j12 packages, use the new reload4j
+
baloo5
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Change KIO worker logging categories to kf.kio.workers.*
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * [TermGeneratorTest] Reduce code duplication
+  * Correct and simplify OrpostingIterator constructor
+  * Convert kded metadata to JSON
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * tag:/ better handle uds name field (kde#449126)
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * [Timeline KIO] Don't announce that we can write
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- No code change since 5.92.0
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Use libc rename() calls rather than QFile to simulate renames
+
+- Replace %_libdir/libexec with %_libexecdir (boo#1174075)
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add Qt6 Linux CI
+  * Static libs linked into shared libs need -fPIC
+  * Fix KFileMetaData::PropertyMap related Qt6 build issues
+  * install in kf<version>
+  * now exec line is not usefull
+  * Use camel case include
+  * Add missing include (qt6)
+  * engine/idutils.h - fix compile in filePathToStat
+
baloo5-widgets
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Skip slow files (kde#423501)
+  * Remove unused cpp from target baloo_filemetadata_temp_extractor
+  * small adjustements around dimensions field
+  * Add Dimensions field, hiding width and height by default
+  * Prepare to port to qt6
+  * Add "Details" tab only when metadata was fetched
+  * Fix some clazy warnings
+  * Clean up unnecessary cmake include_directories statements
+  * Display extra fields
+  * Add git blame ignore file
+  * Add and make use of ECM clang-format
+
blinken
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add missing KCoreAddons link
+  * Make it compiles against qt6
+
bluedevil5
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+- Remove obsolete scriptlets for mime info
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Too many changes to list here
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- Changes since 5.26.3:
+  * Install translated documentation from po/ too
+
+- Update to 5.26.3.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * SendFilesJob: Set total and processed amount of files
+  * SendFilesJob: Don't emit description in doStart since nextJob already does
+  * kcm: Simplify ListView sections using existing shorthand role
+  * kcm: Copy model data into the "Forget…" dialog (kde#459855)
+  * kcm: Port TextField to onTextEdited signal to avoid recursive changes (kde#459853)
+  * Install po folder
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Show notification popups even when Do not Disturbe is active
+  * Remove kdevelop project file
+  * Add missing license file
+  * applet: add arrow key navigation support
+  * applet: set default focus to checkbox
+  * [kded] Fix metadata types
+  * Fix installing the kcm (kde#457464)
+  * Remove ServiceType from KDED metadata
+  * Utilize kcmutils_generate_desktop_file cmake method
+  * applet: add highlight to details area
+  * applet: add accessible description to details area
+  * applet: use less MouseArea in detail area
+  * applet: use `opacity: 0.6` for label text
+  * applet: add `isContent` property to details
+  * applet: use template string in ExpandableListItem
+  * KCM: Rename "Remember" option to "Restore previous state" (kde#457131)
+  * kcm: Standardize device deletion UI (kde#456439)
+  * Port away from ERR_SLAVE_DEFINED
+  * Request passing unit tests on Linux and BSD
+  * applet: remove `logic.js` in `FullRepresentation.qml`
+  * [applet] Refactor bluetooth state properties
+  * Add basic documentation
+  * Use appropriate jobs to lauch helpers
+  * Remove unneeded KAboutData
+  * Fix single instance window activation on Wayland
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Recommend pulseaudio-module-bluetooth only if pulseaudio is installed
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * Use appropriate jobs to lauch helpers
+  * Fix single instance window activation on Wayland
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Changes since 5.24.5:
+  * DeviceItem: Port to contextualActionsModel
+  * applet: Make placeholder text consistent with what's in the KCM
+  * KCM: Add icons to PlaceholderMessage instances
+  * applet: put PlaceholderMessage in a Loader to save a bit of memory
+  * applet: give PlaceholderMessage an icon
+  * applet: use common property to get list emptiness status
+  * Add qt6 CI support
+  * It's enabled in qt6
+  * Port to PlasmaExtras version of Highlight
+  * [wizard] Don't set minimum size
+  * install plugins in kf<version>
+  * kded/devicemonitor: Check BlueDevilDaemon exists when calling login1PrepareForSleep (kde#450195)
+  * Make it compile against qt6
+  * Remove unused Exec entry
+  * applet: set contentWidth properly
+  * applet: remove unnecessary delegate width override
+  * [applet] Fix undefined property access
+  * [applet] Add a bit of small spacing on the left of the checkbox
+  * [applet] Replace == equality with strict === equality in JavaScript
+  * Fix "Enable bluetooth" button
+  * Remove redundant saveState call
+  * applet: Toggle Bluetooth status on middle-click (kde#427816)
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
bluez-qt
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Expose battery of a DeclarativeDevice via property
+  * .kde-ci.yml: enable static CI builds
+  * Fix QML plugin when building project statically (kde#459340)
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Fix managertest
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- No code change since 5.93.0
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Require unittests to pass for CI jobs to pass
+  * Fix typo in GenericAccess Bluetooth service
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Port to ecm_add_qml_module
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add CI qt6 support
+
bnd-maven-plugin
+- Update to aqute-bnd 5.1.1
+  * ant plugin is in separate artifact
+- Removed patch:
+  * 0002-Fix-ant-compatibility.patch
+    + fixed by upstream
+
+- Modified patches:
+  * 0001-Disable-removed-commands.patch
+  * 0002-Fix-ant-compatibility.patch
+  * 0001-Port-to-OSGI-7.0.0.patch -> 0003-Port-to-OSGI-7.0.0.patch
+    + rediff to changed context
+- Added patch:
+  * 0004-maven-plugin-dependencies.patch
+    + Do not build a whole artifact, if we need only one source file
+
+- Added patch:
+  + aqute-bnd-java8compat.patch
+    + Produce bytecode compatible with Java 8
+
+- Update to aqute-bnd 5.1.1
+- Removed patch:
+  * aqute-bnd-3.5.0-java8compat.patch
+
+- Addes patch:
+  * 0001-Port-to-OSGI-7.0.0.patch
+    + Port to OSGI 7.0.0
+
bomber
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Adapt build system for building against qt6
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+
bouncycastle
-- Security fix: [bsc#1186328, CVE-2020-15522]
-  * Fixes a timing issue within the EC math library
-  * Blind the inversion when normalizing
-- Add bouncycastle-CVE-2020-15522.patch
+- Version update to 1.71
+  * Defects Fixed
+  - In line with GPG the PGP API now attempts to preserve
+    comments containing non-ascii UTF8 characters.
+  - An accidental partial dependency on Java 1.7 has been removed
+    from the TLS API.
+  - JcaPKIXIdentityBuilder would fail to process File objects
+    correctly. This is now fixed.
+  - Some byte[] parameters to the CMP API were not being
+    defensively cloned to prevent accidental changes. Extra
+    defensive cloning has been added.
+  - CMS primitives would sometimes convert ASN.1 definite-length
+    encodings into indefinite-length encodings. The primitives
+    will now try and preserve the original encoding where possible.
+  - CMSSignedData.getAttributeCertificates() now properly
+    restricts the tag values checked to just 1 (the obsolete
+    v1 tag) and 2 (for the more current v2 certificates).
+  - BCJSSE now tries to validate a custom KeyManager selection
+    in order to catch errors around a key manager ignoring
+    key type early.
+  - Compressed streams in PGP ending with zero length partial
+    packets could cause failure on parsing the OpenPGP API.
+    This has been fixed.
+  - The fallback mode for JceAsymmetricKeyWrapper/Unwrapper
+    would lose track of any algorithm parameters generated
+    in the initial attempt. The algorithm parameters are now
+    propagated.
+  - An accidental regression introduced by a fix for another
+    issue in PKIXCertPathReviewer around use of the
+    AuthorityKeyIdentifier extension and it failing to match
+    a certificate uniquely when the serial number field
+    is missing has been fixed.
+  - An error was found in the creation of TLS 1.3 Export Keying
+    Material which could cause compatibility issues. This has
+    been fixed.
+  * Additional Features and Functionality
+  - Support has been added for OpenPGP regular expression
+    signature packets.
+  - Support has been added for OpenPGP PolicyURI signature
+    packets.
+  - A utility method has been added to PGPSecretKeyRing to allow
+    for inserting or replacing a PGPPublicKey.
+  - The NIST PQC Finalist, Classic McEliece has been added to the
+    low level API and the BCPQC provider.
+  - The NIST PQC Alternate Candidate, SPHINCS+ has been added to
+    the BCPQC provider.
+  - The NIST PQC Alternate Candidate, FrodoKEM has been added to
+    the low level API and the BCPQC provider.
+  - The NIST PQC Finalist, SABER has been added to the low level
+    API and the BCPQC provider.
+  - KMAC128, KMAC256 has been added to the BC provider (empty
+    customization string).
+  - TupleHash128, TupleHash256 has been added to the BC provider
+    (empty customization string).
+  - ParallelHash128, ParallelHash256 has been added to the BC
+    provider (empty customization string, block size 1024 bits).
+  - Two new properties: "org.bouncycastle.rsa.max_size" (default
+    15360) and "org.bouncycastle.ec.fp_max_size" (default 1042)
+    have been added to cap the maximum size of RSA and EC keys.
+  - RSA modulus are now checked to be provably composite using
+    the enhanced MR probable prime test.
+  - Imported EC Fp basis values are now validated against the MR
+    prime number test before use. The certainty level of the
+    prime test can be determined by
+    "org.bouncycastle.ec.fp_certainty" (default 100).
+  - The BC entropy thread now has a specific name:
+    "BC-ENTROPY-GATHERER".
+  - Utility methods have been added for joining/merging PGP
+    public keys and signatures.
+  - Blake3-256 has been added to the BC provider.
+  - DTLS: optimisation to delayed handshake hash.
+  - Further additions to the ETSI 102 941 support in the ETSI/ITS
+    package: certification request, signed message generation and
+    verification now supported.
+  - CMSSignedDataGenerator now supports the direct generation of
+    definite-length data.
+  - The NetscapeCertType class now has a hasUsages() method on it
+    for querying usage settings on its bit string.
+  - Support for additional input has been added for deterministic
+    (EC)DSA.
+  - The OpenPGP API provides better support for subkey
+    generation.
+  - BCJSSE: Added boolean system properties
+    "org.bouncycastle.jsse.client.dh.disableDefaultSuites" and
+    "org.bouncycastle.jsse.server.dh.disableDefaultSuites".
+    Default "false". Set to "true" to disable inclusion of DH
+    cipher suites in the default cipher suites for client/server
+    respectively.
+  * Notes
+  - The deprecated QTESLA implementation has been removed from
+    the BCPQC provider.
+  - The submission update to SPHINCS+ has been added. This
+    changes the generation of signatures - particularly
+    deterministic ones.
+- Version update to 1.70
+  * Defects Fixed
+  - Blake 3 output limit is enforced.
+  - The PKCS12 KeyStore was relying on default precedence for its
+    key Cipher implementation so was sometimes failing if used
+    from the keytool. The KeyStore class now makes sure it uses
+    the correct Cipher implementation.
+  - Fixed bzip2 compression for empty contents (GH #993).
+  - ASN.1: More robust handling of high tag numbers and
+    definite-length forms.
+  - BCJSSE: Fix a concurrent modification issue in session
+    contexts (GH#968).
+  - BCJSSE: Don't log sensitive system property values (GH#976).
+  - BCJSSE: Fixed a priority issue amongst imperfect-match
+    credentials in KeyManager classes.
+  - The IES AlgorithmParameters object has been re-written to
+    properly support all the variations of IESParameterSpec.
+  - getOutputSize() for ECIES has been corrected to avoid
+    occassional underestimates.
+  - The lack of close() in the ASN.1 Dump command line utility
+    was triggering false positives in some code analysis tools. A
+    close() call has been added.
+  - PGPPublicKey.getBitStrength() now properly recognises EdDSA
+    keys.
+  * Additional Features and Functionality
+  - Missing PGP CRC checksums can now be optionally ignored using
+    setDetectMissingCRC() (default false) on ArmoredInputStream.
+  - PGPSecretKey.copyWithNewPassword() now has a variant which
+    uses USAGE_SHA1 for key protection if a PGPDigestCalculator
+    is passed in.
+  - PGP ASCII armored data now skips "\t", "\v", and "\f".
+  - PKCS12 files with duplicate localKeyId attributes on
+    certificates will now have the incorrect attributes filtered
+    out, rather than the duplicate causing an exception.
+  - PGPObjectFactory will now ignore packets representing
+    unrecognised signature versions in the input stream.
+  - The X.509 extension generator will now accumulate some
+    duplicate X.509 extensions into a single extension where it
+    is possible to do so.
+  - Removed support for maxXofLen in Kangaroo digest.
+  - Ignore marker packets in PGP Public and Secret key ring
+    collection.
+  - An implementation of LEA has been added to the low-level API.
+  - Access, recovery, and direct use for PGP session keys has
+    been added to the OpenPGP API for processing encrypted data.
+  - A PGPCanonicalizedDataGenerator has been added which converts
+    input into canonicalized literal data for text and UTF-8
+    mode.
+  - A getUserKeyingMaterial() method has been added to the
+    KeyAgreeRecipientInformation class.
+  - ASN.1: Tagged objects (and parsers) now support all tag
+    classes. Special code for ApplicationSpecific has been
+    deprecated and re-implemented in terms of TaggedObject.
+  - ASN.1: Improved support for nested tagging.
+  - ASN.1: Added support for GraphicString, ObjectDescriptor,
+    RelativeOID.
+  - ASN.1: Added support for constructed BitString encodings,
+    including efficient parsing for large values.
+  - TLS: Added support for external PSK handshakes.
+  - TLS: Check policy restrictions on key size when determining
+    cipher suite support.
+  - A performance issue in KeccakDigest due to left over debug
+    code has been identified and dealt with.
+  - BKS key stores can now be used for collecting protected keys
+    (note: any attempt to store such a store will cause an
+    exception).
+  - A method for recovering user keying material has been added
+    to KeyAgreeRecipientInformation.
+  - Support has been added to the CMS API for SHA-3 based
+    PLAIN-ECDSA.
+  - The low level BcDefaultDigestProvider now supports the SHAKE
+    family of algorithms and the SM3 alogirthm.
+  - PGPKeyRingGenerator now supports creation of key-rings with
+    direct-key identified keys.
+  - The PQC NIST candidate, signature algorithm SPHINCS+ has been
+    added to the low-level API.
+  - ArmoredInputStream now explicitly checks for a '\n' if in
+    crLF mode.
+  - Direct support for NotationDataOccurances, Exportable,
+    Revocable, IntendedRecipientFingerPrints, and AEAD algorithm
+    preferences has been added to PGPSignatureSubpacketVector.
+  - Further support has been added for keys described using
+    S-Expressions in GPG 2.2.X.
+  - Support for OpenPGP Session Keys from the (draft) Stateless
+    OpenPGP CLI has been added.
+  - Additional checks have been added for PGP marker packets in
+    the parsing of PGP objects.
+  - A CMSSignedData.addDigestAlgorithm() has been added to allow
+    for adding additional digest algorithm identifiers to CMS
+    SignedData structures when required.
+  - Support has been added to CMS for the LMS/HSS signature
+    algorithm.
+  - The system property
+    "org.bouncycastle.jsse.client.assumeOriginalHostName"
+    (default false) has been added for dealing with SNI problems
+    related to the host name not being propagate by the JVM.
+  - The JcePKCSPBEOutputEncryptorBuilder now supports SCRYPT with
+    ciphers that do not have algorithm parameters (e.g. AESKWP).
+  - Support is now added for certificates using ETSI TS 103 097,
+    "Intelligent Transport Systems (ITS)" in the bcpkix package.
+  * Notes.
+  - While this release should maintain source code compatibility,
+    developers making use of some parts of the ASN.1 library will
+    find that some classes need recompiling. Apologies for the
+    inconvenience.
+- Version update to 1.69
+  * Defects Fixed
+  - Lightweight and JCA conversion of Ed25519 keys in the PGP API
+    could drop the leading byte as it was zero. This has been
+    fixed.
+  - Marker packets appearing at the start of PGP public key rings
+    could cause parsing failure. This has been fixed.
+  - ESTService could fail for some valid Content-Type headers.
+    This has been fixed.
+  - Originator key algorithm parameters were being passed as NULL
+    in key agreement recipients. The parameters now reflect the
+    value of the parameters in the key's SubjectPublicKeyInfo.
+  - ContentType on encapsulated data was not been passed through
+    correctly for authenticated and enveloped data. This has been
+    fixed.
+  - NTRUEncryptionParameters and
+    NTRUEncryptionKeyGenerationParameters were not correctly
+    cloning the contained message digest. This has been fixed.
+  - CertificateFactory.generateCertificates()/generateCRLs()
+    would throw an exception if extra data was found at the end
+    of a PEM file even if valid objects had been found. Extra
+    data is now ignored providing at least one object found.
+  - Internal class PKIXCRLUtil could throw a NullPointerException
+    for CRLs with an absent nextUpdate field. This has been
+    fixed.
+  - PGP ArmoredInputStream now fails earlier on malformed
+    headers.
+  - The McElieceKobaraImaiCipher was randomly throwing "Bad
+    Padding: invalid ciphertext" exception while decrypting due
+    to leading zeroes been missed during processing of the cipher
+    text. This has been fixed.
+  - Ed25519 keys being passed in via OpenSSH key spec are now
+    validated in the KeyFactory.
+  - Blowfish keys are now range checked on cipher construction.
+  - In some cases PGPSecretKeyRing was failing to search its
+    extraPubKeys list when searching for public keys.
+  - The BasicConstraintsValidation class in the BC cert path
+    validation tools has improved conformance to RFC 5280.
+  - AlgorithmIdentifiers involving message digests now attempt to
+    follow the latest conventions for the parameters field
+    (basically DER NULL appears less).
+  - Fix various conversions and interoperability for XDH and
+    EdDSA between BC and SunEC providers.
+  - TLS: Prevent attempts to use KeyUpdate mechanism in versions
+    before TLS 1.3.
+  * Additional Features and Functionality
+  - GCM-SIV has been added to the lightweight API and the
+    provider.
+  - Blake3 has been added to the lightweight API.
+  - The OpenSSL PEMParser can now be extended to add specialised
+    parsers.
+  - Base32 encoding has now been added, the default alphabet is
+    from RFC 4648.
+  - The KangarooTwelve message digest has been added to the
+    lightweight API.
+  - An implementation of the two FPE algorithms, FF1 and FF3-1 in
+    SP 800-38G has been added to the lightweight API and the JCE
+    provider.
+  - An implementation of ParallelHash has been added to the
+    lightweight API.
+  - An implementation of TupleHash has been added to the
+    lightweight API.
+  - RSA-PSS now supports the use of SHAKE128 and SHAKE256 as the
+    mask generation function and digest.
+  - ECDSA now supports the use of SHAKE128 and SHAKE256.
+  - PGPPBEEncryptedData will now reset the stream if the initial
+    checksum fails so another password can be tried.
+  - Iterators on public and secret key ring collections in PGP
+    now reflect the original order of the public/secret key rings
+    they contain.
+  - KeyAgreeRecipientInformation now has a getOriginator() method
+    for retrieving the underlying orginator information.
+  - PGPSignature now has a getDigestPrefix() method for people
+    wanting exposure to the signature finger print details.
+  - The old BKS-V1 format keystore is now disabled by default. If
+    you need to use BKS-V1 for legacy reasons, it can be
+    re-enabled by adding: org.bouncycastle.bks.enable_v1=true to
+    the java.security file. We would be interested in hearing
+    from anyone that needs to do this.
+  - PLAIN-ECDSA now supports the SHA3 digests.
+  - Some highlevel support for RFC 4998 ERS has been added for
+    ArchiveTimeStamp and EvidenceRecord. The new classes are in
+    the org.bouncycastle.tsp.ers package.
+  - ECIES has now also support SHA256, SHA384, and SHA512.
+  - digestAlgorithms filed in CMS SignedData now includes counter
+    signature digest algorithms where possible.
+  - A new property "org.bouncycastle.jsse.config" has been added
+    which can be used to configure the BCJSSE provider when it is
+    created using the no-args constructor.
+  - In line with changes in OpenSSL 1.1.0,
+    OpenSSLPBEParametersGenerator can now be configured with a
+    digest.
+  - PGPKeyRingGenerator now includes a method for adding a subkey
+    with a primary key binding signature.
+  - Support for ASN.1 PRIVATE tags has been added.
+  - Performance enhancements to Nokeon, AES, GCM, and
+    SICBlockCipher.
+  - Support for ecoding/decoding McElieceCCA2 keys has been added
+    to the PQC API
+  - BCJSSE: Added support for jdk.tls.maxCertificateChainLength
+    system property (default is 10).
+  - BCJSSE: Added support for jdk.tls.maxHandshakeMessageSize
+    system property (default is 32768).
+  - BCJSSE: Added support for jdk.tls.client.enableCAExtension
+    (default is 'false').
+  - BCJSSE: Added support for jdk.tls.client.cipherSuites system
+    property.
+  - BCJSSE: Added support for jdk.tls.server.cipherSuites system
+    property.
+  - BCJSSE: Extended ALPN support via standard JSSE API to JDK 8
+    versions after u251/u252.
+  - BCJSSE: Key managers now support EC credentials for use with
+    TLS 1.3 ECDSA signature schemes (including brainpool).
+  - TLS: Add TLS 1.3 support for brainpool curves per RFC 8734.
+  * Notes
+  - There is a small API change in the PKIX package to the
+    DigestAlgorithmIdentifierFinder interface as a find() method
+    that takes an ASN1ObjectIdentifier has been added to it. For
+    people wishing to extend their own implementations, see
+    DefaultDigestAlgorithmIdentifierFinder for a sample
+    implementation.
+  - A version of the bcmail API supporting Jakarta Mail has now
+    been added (see bcjmail jar).
+  - Some work has been done on moving out code that does not need
+    to be in the provider jar. This has reduced the size of the
+    provider jar and should also make it easier for developers to
+    patch the classes involved as they no longer need to be
+    signed. bcpkix and bctls are both dependent on the new bcutil
+    jar.
+- Add build dependencies on
+  mvn(jakarta.activation:jakarta.activation-api) and
+  mvn(jakarta.mail:jakarta.mail-api)
+- Remove unneeded script bouncycastle_getpoms.sh from sources
+
+- Build against the standalone JavaEE modules unconditionally
+
+- Build with source/target levels 8
+
+- Add glassfish-activation-api dependency so that we can build with
+  JDK that does not contain the JavaEE modules
+
+- Directory core/docs does not exist
+
+- Add bouncycastle_getpoms.sh to get pom files from Maven repos
+
+- Version update to 1.68
+  * Defects Fixed:
+  - Some BigIntegers utility methods would fail for
+    BigInteger.ZERO. This has been fixed.
+  - PGPUtil.isKeyRing() was not detecting secret sub-keys in its
+    input. This has been fixed.
+  - The ASN.1 class, ArchiveTimeStamp was insisting on a value
+    for the optional reducedHashTree field. This has been fixed.
+  - BCJSSE: Lock against multiple writers - a possible
+    synchronization issue has been removed.
+  * Additional Features and Functionality
+  - BCJSSE: Added support for system property
+    com.sun.net.ssl.requireCloseNotify. Note that we are using a
+    default value of 'true'.
+  - BCJSSE: 'TLSv1.3' is now a supported protocol for both client
+    and server. For this release it is only enabled by default for
+    the 'TLSv1.3' SSLContext, but can be explicitly enabled using
+    'setEnabledProtocols' on an SSLSocket or SSLEngine, or via
+    SSLParameters.
+  - BCJSSE: Session resumption is now also supported for servers
+    in TLS 1.2 and earlier. For this release it is disabled by
+    default, and can be enabled by setting the boolean system
+    property org.bouncycastle.jsse.server.enableSessionResumption
+    to 'true'.
+  - The provider RSA-PSS signature names that follow the JCA
+    naming convention.
+  - FIPS mode for the BCJSSE now enforces namedCurves for any
+    presented certificates.
+  - PGPSignatureSubpacketGenerator now supports editing of a
+    pre-existing sub-packet list.
+
+- Version update to 1.67 [bsc#1180215, CVE-2020-28052]
+  * CVE-2020-28052: OpenBSDBCrypt.checkPassword utility method
+    compared incorrect data when checking the password
+  * Defects Fixed:
+  - BCJSSE: SunJSSE compatibility fix - override of getChannel()
+    removed and 'urgent data' behaviour should now conform to
+    what the SunJSSE expects
+  - Nested BER data could sometimes cause issues in octet strings
+  - Certificates/CRLs with short signatures could cause an exception
+    in toString() in the BC X509 Certificate implmentation
+  - In line with latest changes in the JVM, SignatureSpis which
+    don't require parameters now return null on engineGetParameters()
+  - The RSA KeyFactory now always preferentially produces RSAPrivateCrtKey
+    where it can on requests for a KeySpec based on an RSAPrivateKey
+  - CMSTypedStream$FullReaderStream now handles zero length reads correctly
+  - Unecessary padding was added on KMAC when the key string was block aligned
+  - Zero length data would cause an unexpected exception from RFC5649WrapEngine
+  - OpenBSDBcrypt was failing to handle some valid prefixes
+  * Additional Features and Functionality
+  - Performance improvement of Argon2 and Noekeon
+  - A setSessionKeyObfuscation() method has been added to
+    PublicKeyKeyEncryptionMethodGenerator to allow turning off of session key
+    obfuscation (default is on, method primarily to get around early version
+    GPG issues with AES-128 keys)
+  - Implemented 'safegcd' constant-time modular inversion (as well as a
+    variable-time variant). It has replaced Fermat inversion in all our EC
+    code, and BigInteger.modInverse in several other places, particularly
+    signers. This improves side-channel protection, and also gives a
+    significant performance boost
+  - Performance of custom binary ECC curves and Edwards Curves has been improved
+  - BCJSSE: New boolean system property 'org.bouncycastle.jsse.keyManager.checkEKU'
+    allows to disable ExtendedKeyUsage restrictions when selecting credentials
+    (although the peer may still complain)
+  - Initial support has been added for "Composite Keys and Signatures For Use
+    In Internet PKI" using the test OID. Please note there will be further
+    refinements to this as the draft is standardised
+  - The BC EdDSA signature API now supports keys implementing all methods on
+    the EdECKey and XECKey interfaces directly
+  - Work has begun on classes to support the ETSI TS 103 097, Intelligent
+    Transport Systems (ITS) in the bcpkix package
+  - Further optimization work has been done on GCM
+  - A NewHope based processor, similar to the one for Key Agreement has been
+    added for trying to "quantum hard" KEM algorithms
+  - PGP clear signed signatures now support SHA-224
+  - Treating absent vs NULL as equivalent can now be configured by a system
+    property. By default this is not enabled
+  - Mode name checks in Cipher strings should now make sure an improper mode
+    name always results in a NoSuchAlgorithmException
+  - In line with changes in OpenSSL, the OpenSSLPBKDF now uses UTF8 encoding
+
+- Version update to 1.66 [bsc#1186328, CVE-2020-15522]
+  * Defects Fixed:
+  - EdDSA verifiers now reset correctly after rejecting overly long signatures.
+  - BCJSSE: SSLSession.getPeerCertificateChain could throw NullPointerException.
+  - qTESLA-I verifier would reject some valid signatures.
+  - qTESLA verifiers now reject overly long signatures.
+  - PGP regression caused failure to preserve existing version header when
+    headers were reset.
+  - PKIXNameConstraintValidator had a bad cast preventing use of multiple
+    OtherName constraints.
+  - Serialisation of the non-CRT RSA Private Key could cause a NullPointerException.
+  - An extra 4 bytes was included in the start of HSS public key encodings.
+  - CMS with Ed448 using a direct signature was using id-shake256-len
+    rather than id-shake256.
+  - Use of GCMParameterSpec could cause an AccessControlException under
+    some circumstances.
+  - DTLS: Fixed high-latency HelloVerifyRequest handshakes.
+  - An encoding bug for rightEncoded() in KMAC has been fixed.
+  - For a few values the cSHAKE implementation would add unnecessary pad bytes
+    where the N and S strings produced encoded data that was block aligned.
+  - There were a few circumstances where Argon2BytesGenerator might hit an
+    unexpected null. These have been removed.
+  * Additional Features and Functionality
+  - The qTESLA signature algorithm has been updated to v2.8 (20191108).
+  - BCJSSE: Client-side OCSP stapling now supports status_request_v2 extension.
+  - Support has been added for "ocsp.enable", "ocsp.responderURL" and
+    PKIXRevocationChecker for users of Java 8 and later.
+  - Support has been added for "org.bouncycastle.x509.enableCRLDP" to the PKIX validator.
+  - BCJSSE: Now supports system property 'jsse.enableFFDHE'
+  - BCJSSE: Now supports system properties 'jdk.tls.client.SignatureSchemes'
+    and 'jdk.tls.server.SignatureSchemes'.
+  - Multi-release support has been added for Java 11 XECKeys.
+  - Multi-release support has been added for Java 15 EdECKeys.
+  - The MiscPEMGenerator will now output general PrivateKeyInfo structures.
+  - A new property "org.bouncycastle.pkcs8.v1_info_only" has been added to
+    make the provider only produce version 1 PKCS8 PrivateKeyInfo structures.
+  - The PKIX CertPathBuilder will now take the target certificate from the target
+    constraints if a specific certificate is given to the selector.
+  - BCJSSE: A range of ARIA and CAMELLIA cipher suites added to supported list.
+  - BCJSSE: Now supports the PSS signature schemes from RFC 8446 (TLS 1.2 onwards).
+  - Performance of the Base64 encoder has been improved.
+  - The PGPPublicKey class will now include direct key signatures when checking
+    for key expiry times.
+  * NOTES:
+  - The qTESLA update breaks compatibility with previous versions.
+    Private keys now include a hash of the public key at the end,
+    and signatures are no longer interoperable with previous versions.
+
+- Version update to 1.65
+  * Defects Fixed:
+  - DLExternal would encode using DER encoding for tagged SETs.
+  - ChaCha20Poly1305 could fail for large (>~2GB) files.
+  - ChaCha20Poly1305 could fail for small updates when used via the provider.
+  - Properties.getPropertyValue could ignore system property when other
+    local overrides set.
+  - The entropy gathering thread was not running in daemon mode, meaning there
+    could be a delay in an application shutting down due to it.
+  - A recent change in Java 11 could cause an exception with the BC Provider's
+    implementation of PSS.
+  - BCJSSE: TrustManager now tolerates having no trusted certificates.
+  - BCJSSE: Choice of credentials and signing algorithm now respect the peer's
+    signature_algorithms extension properly.
+  - BCJSSE: KeyManager for KeyStoreBuilderParameters no longer leaks memory.
+  * Additional Features and Functionality:
+  - LMS and HSS (RFC 8554) support has been added to the low level library and
+    the PQC provider.
+  - SipHash128 support has been added to the low level library and the JCE provider.
+  - BCJSSE: BC API now supports explicitly specifying the session to resume.
+  - BCJSSE: Ed25519, Ed448 are now supported when TLS 1.2 or higher is
+    negotiated (except in FIPS mode).
+  - BCJSSE: Added support for extended_master_secret system properties:
+    jdk.tls.allowLegacyMasterSecret, jdk.tls.allowLegacyResumption,
+    jdk.tls.useExtendedMasterSecret .
+  - BCJSSE: Ed25519, Ed448 are now supported when TLS 1.2 or higher is
+    negotiated (except in FIPS mode).
+  - BCJSSE: KeyManager and TrustManager now check algorithm constraints for
+    keys and certificate chains.
+  - BCJSSE: KeyManager selection of server credentials now prefers matching
+    SNI hostname (if any).
+  - BCJSSE: KeyManager may now fallback to imperfect credentials (expired,
+    SNI mismatch).
+  - BCJSSE: Client-side OCSP stapling support (beta version: via status_request
+    extension only, provides jdk.tls.client.enableStatusRequestExtension, and
+    requires CertPathBuilder support).
+  - TLS: DSA in JcaTlsCrypto now falls back to stream signing to work around
+    NoneWithDSA limitations in default provider.
+
+- Added patch:
+  * bouncycastle-osgi.patch
+    + Add OSGi manifests to the distributed jars so that they can
+    be used from eclipse
bovo
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * For c++11 as random_shuffle is removed in c++17 freebsd
+  * Clean up it
+  * Adapt build system for building against qt6
+  * Use include QStringList, fix some error on qt6
+  * Migration code will be removed in qt6 + AA_UseHighDpiPixmaps
+    is enabled by default in qt6
+  * Use override
+  * Modernize code
+  * Port to for(...:...) + use nullptr
+  * Use Q_EMIT/Q_SLOTS/Q_SIGNALS
+  * Not necessary to use I18N_NOOP
+
bpftrace
+- Add Vendor-BPF_F_KPROBE_MULTI_RETURN-definition.patch to fix build on
+  SLE15-SP5
+
+- Set USE_SYSTEM_BPF_BCC to ON so system libraries are used
+- Update to 0.17.0
+  + Support opaque pointer (boo#1207295)
+  + Support 32-bit ARM systems
+  + Support BTF in kernel modules
+  + Add %rh option to print buffer as hex without \x
+  + Add stdbool.h to built-in headers
+  + Raise minimum versions for libbpf and bcc and vendor them for local builds
+  + Support comparison for integer arrays
+  + Drop Ubuntu 19.10 lockdown detection
+  + Fix pointer/register loads on 32-bit architectures
+  + Fix kprobe multi-attachment
+  + Fix attaching to multiple USDT probes using the same wildcard
+  + Fix pointer arithmetics codegen
+  + Fix segfault for invalid AssignVarStatement visit
+  + Better handling of missing function trace support files
+  + Fix unroll ID reset
+  + Support profile and interval probes in probe matcher
+  + Fix BTF detection macro in tools/old/mdflush.bt
+
breeze
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- Changes since 5.26.90:
+  * MenuItem,TitleBar: Don't stretch icons, instead scale them down to fit and center inside their rect
+  * Revert "MenuItem: Don't stretch icons, instead scale them down to fit rect"
+  * MenuItem: Don't stretch icons, instead scale them down to fit rect
+  * Factor out 3 pixelMetric calls in MenuItemControl drawing
+  * Moved old wallpaper, added new one, updated previews
+  * ToolButton: Fix text position in text-with-menu-but-no-icon RTL mode
+  * ToolButton: Fix drop-down menu arrow in RTL layouts
+  * ScrollBar: Fix pixel alignment in RTL mode
+  * kdecoration: Fix outline gap with fractional scale (kde#461358)
+  * Only use frameworkintegration on Linux/BSD
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Too many changes to list here
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * wallpapers/Next: Update Dark Kay to latest version from the author
+  * wallpapers/Next: add Dark Kay
+  * wallpapers/Next: update vertical wallpapers
+  * wallpapers/Next: add Kay
+  * KStyle: fix hasIcon calculation for toolbutton labels
+  * kstyle: don't blindly fill contentsRect when calculating textRect (kde#459444)
+  * KStyle: re-add centering of toolbutton icons
+  * KStyle: fix text-only toolbuttons, check icon/text rects accurately
+  * Remove animated wallpapers used in beta testing
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Do not query an unexisting kconfig file
+  * Make inactive tab color lighter for dark color schemes
+  * wallpapers: add animated wallpaper for beta testing
+  * Add pressed appearance for checked checkboxes and radio buttons (kde#451428)
+  * make sure _eventInQQuickWidget is false when needed (kde#453692)
+  * CMake: Fix condition to also handle Qt6Quick
+  * Add FreeBSD Qt6 CI support
+  * kstyle: Fix class name to fix indeterminate progress bars animations
+  * Add missing license file
+  * Look at QStyleOptionProgressBar::orientation again
+  * Consider small icon size from system (kde#455513)
+  * kstyle: make shortcuts in menus look visually subdued (kde#456254)
+  * kstyle: Use menuTitle font metrics for size calculation (kde#443805)
+  * Add cursor 'tcross' -> crosshair (kde#452102)
+  * kstyle: Remove superfluous null pointer check of painter
+  * kstyle: Draw explicitly added focus frames
+  * kstyle: Fix build with KF 5.90
+  * Request passing unit tests on Linux and BSD
+  * KStyle: Fix QQC2 ProgressBar desktop style in RTL layout direction (kde#430101)
+  * kstyle: remove button gradients
+  * KStyle: Reuse existing local const variable
+  * kstyle: fix qqc2 desktop style sliders in RtL (kde#430101)
+  * Fix mixup of PM_ToolBarItemMargin & PM_ToolBarFrameWidth
+  * Added Landing
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- Changes since 5.25.4:
+  * kstyle: Fix class name to fix indeterminate progress bars animations
+  * Look at QStyleOptionProgressBar::orientation again
+- Drop patches, now upstream:
+  * 0001-Look-at-QStyleOptionProgressBar-orientation-again.patch
+
+- Add patch to fix progress bars in some applications:
+  * 0001-Look-at-QStyleOptionProgressBar-orientation-again.patch
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- Changes since 5.25.3:
+  * kstyle: Use menuTitle font metrics for size calculation (kde#443805)
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- Changes since 5.25.1:
+  * Add cursor 'tcross' -> crosshair (kde#452102)
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- 5.25.0 tarball got respun. Changes:
+  * Added Landing
+  * KStyle: Fix QQC2 ProgressBar desktop style in RTL layout direction (kde#430101)
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * kstyle: fix qqc2 desktop style sliders in RtL (kde#430101)
+  * Fix mixup of PM_ToolBarItemMargin & PM_ToolBarFrameWidth
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Too many changes to list here
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- Changes since 5.24.4:
+  * Add Windows CI
+  * Disable decoration on Windows and mac
+  * Add missing kcoreaddons dep
+
breeze-gtk
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * Add gtk-dark-4.0.css target
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- No code changes since 5.25.90
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Fix typo: selction -> selection
+  * Add FreeBSD Qt6 CI support
+  * Add missing license files and remove unused one
+  * Request passing unit tests on Linux and BSD
+  * GTK3,4: Make checkbox colors a pixel-perfect copy of QStyle
+  * assets: Make checkmark a pixel-perfect copy of qstyle
+  * Add CI for Linux and FreeBSD
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * GTK3,4: Make checkbox colors a pixel-perfect copy of QStyle
+  * assets: Make checkmark a pixel-perfect copy of qstyle
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Too many changes to list here
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
breeze5-icons
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Revert "Add SimpleScreenRecorder icon" (kde#462905)
+  * Add some links for symbolic icons
+  * Don't generate BINARY_ICONS_RESOURCE by default with Qt >= 6
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Add kdesrc-build icons
+  * scalabletest "QString("" -> "QStringLiteral(""
+  * Add SimpleScreenRecorder icon (kde#412490)
+  * application-x-executable: make symbolic icon follow color scheme
+  * Add touchscreen icons to devices and preferences (kde#461562)
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add accessories-dictionary-symbolic symlink to a book-looking icon (kde#461033)
+  * Add new icons for Fortran source code
+  * Add 64px audio-headset, fix issues with 64px audio-headphones (kde#447536)
+  * Add data-success icon
+  * Add icon for OpenOffice extensions
+  * Add Qt 6 Windows CI
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * .gitlab-ci.yml: enable static builds
+  * Add text/javascript symlink
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+  * Update chatroom names in the README
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Add mimetypes/{16,22,32,64}/application-x-msdownload, which is used for DLLs
+  * Remove monochrome versions of help-related app icons (kde#456737)
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Require passing tests for the CI to pass
+  * Create edit-image icon that's a symlink to tool_imageeffects
+  * Add new okular icon
+  * Create sidebar-show-symbolic symlink (kde#455247)
+  * applets/256: Add dark version of analogclock
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * port to standard C++ smart pointers where possible
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add view-left-new action
+  * Add windows CI
+  * New debug step icons
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Add some more symlinks for zoom icons (kde#450870)
+  * Add input-tvremote
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Add app icon for TeXstudio (kde#391459)
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * start-here-kde: Make icon adaptable to dark themes (kde#416302)
+  * Fix icon colors to be consistent across all sizes
+  * Check executables exist in PATH before passing them to QProcess
+  * Add Linux Qt6 CI
+  * Declare namespace for kongress icon
+  * Fix naming of brightness icons
+  * Fix dupe tests by replacing icons with symlinks
+
brotli
+- Fix CVE-2020-8927, decoder: integer overflow when input chunk
+  is larger than 2GiB. (CVE-2020-8927, bsc#1175825)
+  * fix-cve-2020-8927.patch
+
+- Add brotli_Verbose-CLI+Shared-Brotli.patch: Verbose CLI + start
+  pulling "Shared-Brotli".
+  * verbose CLI output; fix gh#google/brotlie#666.
+  * pull `SHIFT` transforms; currently this is semantically dead
+    code; later it will be used by "Shared-Brotli".
+- Add brotli_Ensure-decompression-consumes-all-input.patch: Ensure
+  decompression consumes all input. If not, it's a corrupt stream.
+- Tweak spec slightly.
+
+- Avoid bashisms, install manpages without +x bit, get rid of
+  wrap descriptions, feed through cleaner.
+
+- brotli 1.0.7:
+  * faster decoding on ARM
+  * improved precision of window size calculation in CLI
+- includes changes from 1.0.6:
+  * fix unaligned 64-bit accesses on AArch32
+  * add ASAN/MSAN unaligned read specializations
+  * fix JDK 8<->9 incompatibility
+
+- Add baselibs.conf, build 32bit library support.
+
+- Use cmake macros for building and tests
+
+- Update to version 1.0.5:
+  * improve q=1 compression on small files
+  * inverse Bazel workspace tree
+  * add rolling-composite-hasher for large-window mode
+  * add tools to download and transform static dictionary data
+- Changes for version 1.0.4:
+  * fix unaligned access for aarch64-cross-armhf build
+  * fix aarch64 target detection
+  * allow CLI to compress with enabled "large window" feature
+  * add NPOSTFIX / NDIRECT encoder parameters
+  * automatic NDIRECT/NPOSTFIX tuning (better compression)
+  * fix "memory leak" in python tests
+  * fix bug in durchschlag
+  * fix source file lists (add params.h)
+  * fix Bazel/MSVC compilator options
+  * fix "fall though" warnings
+
+- Add missing libbrotlicommon%%{sover} and libbrotlidec%%{sover}
+  Requires to devel subpackage.
+
+- Update to new upstream release 1.0.3
+  * New "Large Window Brotli" feature
+  * New dictionary generator
+
+- Merge devel subpackages as libbrotli-devel
+
+- Avoid shipping duplicate files.
+  Avoid shipping README.md, this just contains the description -
+  and build instructions.
+- Drop duplicate Requires on -devel.
+
+- build for SLE_12 and SLE_12_SP1
+
+- update to Brotli 1.0.2
+  + Major chnages
+  * added Autotools build files
+  * switched shared library version to libtool scheme
+  + Minor changes
+  * BrotliDictionary members are not const now
+  * ZopfliNode distance could be up to 128MiB
+  * fixed API documentation typos
+  * total_out is always set by decoder
+  * fixed BROTLI_ENSURE_CAPACITY macro; no-op in preprocessed output
+  + Other changes
+  * fixed scripts for oss-fuzz, test them with Travis
+  * made Bazel JNI tests less messy
+  * fixed linter warnings in JS decoder
+  * fixed permissions of various files
+  * added Bazel build to Appveyor matrix
+  * added Sieve dictionary generator
+
+- update to Brotli 1.0.1
+  + updated README.md
+  + fixed parallel exeuction of CMake "compatibility" tests
+- update to Brotli 1.0.0
+  + new CLI; bro -> brotli; + man page
+  + remove "custom dictionary" support
+  + add ability to side-load brotli RFC dictionary
+  + add decoder API to avoid ringbuffer reallocation
+  + PY streaming decompression support
+  + PY wrapper accepts memview
+- spec file changes
+  + improve descriptions
+  + add man pages
+
+- spec file changes
+  + improve package description
+
+- update to Brotli 0.6.0
+  + better compression on 1MiB+ files
+  + update "common" API to make dictionary fetching more flexible
+  + fix decoder bug #502
+  + faster compression on mid-low quality levels
+  + fix encoder q10-11 slowdown after long copy #468
+  + introduce Brotli*TakeOutput API
+- now build shared libraries and development files in the following
+  new packages:
+  + libbrotlicommon0_6_0
+  + libbrotlicommon-devel
+  + libbrotlidec0_6_0
+  + libbrotlidec-devel
+  + libbrotlienc0_6_0
+  + libbrtolienc-devel
+
+- initial package
+
buildah
+- Update to version 1.29.1:
+  * [release-1.29] Bump to Buildah v1.29.1
+  * Update to c/image 5.24.1
+
+- Update to version 1.29.0:
+  * Bump to v1.29.0
+  * tests: improve build-with-network-test
+  * Bump c/storagev1.45.3, c/imagev5.24.0, c/commonv0.51.0
+  * build(deps): bump github.com/onsi/gomega from 1.25.0 to 1.26.0
+  * Flake 3710 has been closed. Reenable the test.
+  * [CI:DOCS] Fix two diversity issues in a tutorial
+  * build(deps): bump github.com/fsouza/go-dockerclient from 1.9.2 to 1.9.3
+  * vendor in latests containers/(storage, common, image)
+  * fix bud-multiple-platform-with-base-as-default-arg flake
+  * stage_executor: while mounting stages use freshly built stage
+  * build(deps): bump github.com/fsouza/go-dockerclient from 1.9.0 to 1.9.2
+  * build(deps): bump github.com/onsi/gomega from 1.24.2 to 1.25.0
+  * vendor in latests containers/(storage, common, image, ocicyrpt)
+  * [Itests: change the runtime-flag test for crun
+  * [CI:DOCS] README: drop sudo
+  * Fix multi-arch manifest-list build timeouts
+  * Cirrus: Update VM Images
+  * bud: Consolidate multiple synthetic LABEL instructions
+  * build, secret: allow realtive mountpoints wrt to work dir
+  * fixed squash documentation
+  * build(deps): bump github.com/containerd/containerd from 1.6.14 to 1.6.15
+  * Correct minor comment
+  * Vendor in latest containers/(common, image, storage)
+  * system tests: remove unhelpful assertions
+  * buildah: add prune command and expose CleanCacheMount API
+  * vendor: bump c/storage to a747b27
+  * Add support for --group-add to buildah from
+  * build(deps): bump actions/stale from 6 to 7
+  * Add documentation for buildah build --pull=missing
+  * build(deps): bump github.com/containerd/containerd from 1.6.12 to 1.6.14
+  * build(deps): bump github.com/docker/docker
+  * parse: default ignorefile must not point to symlink outside context
+  * buildah: wrap network setup errors
+  * build, mount: allow realtive mountpoints wrt to work dir
+  * Update to F37 CI VM Images, re-enable prior-fedora
+  * Update vendor or containers/(image, storage, common)
+  * build(deps): bump golang.org/x/crypto from 0.3.0 to 0.4.0
+  * Update contact information
+  * build(deps): bump golang.org/x/term from 0.2.0 to 0.3.0
+  * Replace io/ioutil calls with os calls
+  * [skip-ci] GHA/Cirrus-cron: Fix execution order
+  * Vendor in containers/common
+  * build(deps): bump golang.org/x/sys from 0.2.0 to 0.3.0
+  * remote-cache: support multiple sources and destinations
+  * Update c/storage after https://github.com/containers/storage/pull/1436
+  * util.SortMounts(): make the returned order more stable
+  * version: Bump to 1.29.0-dev
+  * [CI:BUILD] Cirrus: Migrate OSX task to M1
+  * Update vendor of containers/(common, storage, image)
+  * mount=type=cache: seperate cache parent on host for each user
+  * Fix installation instructions for Gentoo Linux
+  * build(deps): bump github.com/containerd/containerd from 1.6.9 to 1.6.10
+  * GHA: Reuse both cirrus rerun and check workflows
+  * Vendor in latest containers/(common,image,storage)
+  * build(deps): bump github.com/onsi/gomega from 1.24.0 to 1.24.1
+  * copier.Put(): clear up os/syscall mode bit confusion
+  * build(deps): bump golang.org/x/sys from 0.1.0 to 0.2.0
+  * Use TypeBind consistently to name bind/nullfs mounts
+  * Add no-new-privileges flag
+  * Update vendor of containers/(common, image, storage)
+  * imagebuildah:build with --all-platforms must honor args for base images
+  * codespell code
+  * Expand args and env when using --all-platforms
+  * build(deps): bump github.com/onsi/gomega from 1.23.0 to 1.24.0
+  * GHA: Simplify Cirrus-Cron check slightly
+  * Stop using ubi8
+  * remove unnecessary (hence misleading) rmi
+  * chroot: fix mounting of ro bind mounts
+  * executor: honor default ARG value while eval base name
+  * userns: add arbitrary steps/stage to --userns=auto test
+  * Don't set allow.mount in the vnet jail on Freebsd
+  * copier: Preserve file flags when copying archives on FreeBSD
+  * Remove quiet flag, so that it works in podman-remote
+  * test: fix preserve rootfs with --mount for podman-remote
+  * test: fix prune logic for cache-from after adding content summary
+  * vendor in latest containers/(storage, common, image)
+  * Fix RUN --mount=type=bind,from=<stage> not preserving rootfs of stage
+  * Define and use a safe, reliable test image
+  * Fix word missing in Container Tools Guide
+  * Makefile: Use $(MAKE) to start sub-makes in install.tools
+  * imagebuildah: pull cache from remote repo after adding content summary
+  * Makefile: Fix install on FreeBSD
+  * Ensure the cache volume locks are unlocked on all paths
+  * Vendor in latest containers/(common,storage)
+  * Simplify the interface of GetCacheMount and getCacheMount
+  * Fix cache locks with multiple mounts
+  * Remove calls to Lockfile.Locked()
+  * Maintain cache mount locks as lock objects instead of paths
+  * test: cleaning cache must not clean lockfiles
+  * run: honor lockfiles for multiple --mount instruction
+  * mount,cache: lockfiles must not be part of users cache content
+  * Update vendor containers/(common,image,storage)
+  * [CI:BUILD] copr: buildah rpm should depend on containers-common-extra
+  * pr-should-include-tests: allow specfile, golangci
+  * build(deps): bump dawidd6/action-send-mail from 3.7.0 to 3.7.1
+  * build(deps): bump github.com/docker/docker
+  * build(deps): bump github.com/fsouza/go-dockerclient from 1.8.3 to 1.9.0
+  * Update vendor containers/(common,image,storage)
+  * build(deps): bump actions/upload-artifact from 2 to 3
+  * build(deps): bump actions/checkout from 2 to 3
+  * build(deps): bump actions/stale from 1 to 6
+  * build(deps): bump dawidd6/action-send-mail from 2.2.2 to 3.7.0
+  * build(deps): bump tim-actions/get-pr-commits from 1.1.0 to 1.2.0
+  * sshagent: LockOSThread before setting SocketLabel
+  * Update tests for error message changes
+  * Update c/image after https://github.com/containers/image/pull/1299
+  * Fix ident for dependabot gha block
+  * build(deps): bump github.com/containers/ocicrypt from 1.1.5 to 1.1.6
+  * Fix man pages to match latest cobra settings
+  * build(deps): bump github.com/spf13/cobra from 1.5.0 to 1.6.0
+  * build(deps): bump github.com/onsi/gomega from 1.20.2 to 1.22.1
+  * test: retrofit 'bud with undefined build arg directory'
+  * imagebuildah: warnOnUnsetBuildArgs while processing stages from executor
+  * Update contrib/buildahimage/Containerfile
+  * Cirrus CI add flavor parameter
+  * Correction - `FLAVOR` not `FLAVOUR`
+  * Changed build argument from `RELEASE` to `FLAVOUR`
+  * Combine buildahimage Containerfiles
+  * bud.bats refactoring: $TEST_SCRATCH_DIR, part 2 of 2
+  * bud.bats refactoring: $TEST_SCRATCH_DIR, part 1 of 2
+  * System test cleanup: document, clarify, fix
+  * test: removing unneeded/expensive COPY
+  * test: warning behaviour for unset/set TARGETOS,TARGETARCH,TARGETPLATFORM
+  * Bump to v1.28.1-dev
+
cal10n
+- Fetch sources using source service from ch.qos git
+- Upgrade to the 10th commit after 0.8.1 calling it 0.8.1.10
+- Redo completely the packaging including the possibility to run
+  tests if --with tests is specified
+- Add the cal10n-ant-task to built artifacts
+- Removed patch:
+  * cal10n-0.7.7-sourcetarget.patch
+    + changes factored into the build system
+
+- Update to 0.8.1:
+  * This release adds JSR-269 support. In other words, verification
+    of bundles can be performed at compilation time. See the related
+    documentation for more details.
+  * Fix issue with Eclipse not finding existing resources. With
+    release 0.8.1, Eclipse will find bundles located under
+    "src/main/resources" but still fail to find bundles located
+    under "src/test/resources/".
+  * When reading in bundles, the verify method in MessageKeyVerifier
+    now uses the locale passed as parameter instead of always
+    Locale.FR. This bug was reported by Dale Wijnand who also
+    provided the releavant patch.
+- Update build.xml-0.7.7.tar.xz to build.xml-0.8.1.tar.xz with
+  references to version 0.8.1 to build correctly versioned jar
+  files.
+
-- fix build.xml files to build in openSUSE 12.1 and newer.
-  MANIFEST contained an absolute path in maven-build.xml
-- Fix group for javadoc subpackage
-- remove id generation for buildroot (used in Fedora)
-
-- Un-mavenize. Build with ant
-
calendarsupport
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Port QTextBrowser::setSource override method
+  * Use new akonadi calendar install include
+  * Use new akonadi notes install include
+  * Link against KPIMTextEdit explicitly where it's used
+  * USe Qt
+  * Fix install headers
+  * Install *_version.h in KF5/<module>
+  * Adapt build system for building against qt6
+  * Modernize code
+  * Add KHolidays to CI deps
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
cantor
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+* Minor changes
+  * [R] properly handle the case in the variable model when there is no variable value for
+    a given variable name (e.g. 'l = c()').
+  * [maxima] properly handle the switch to the Lisp mode.
+  * Small fixes required for the integration in LabPlot
+  * Fixed the signature of the virtual functions on luaexpression.h.
+  * Allow to enable/disable the LaTeX typesetting before the session login.
+  * Added missing virtual functions ins KAlgebraSession.
+  * Moved the functions parseOutput() and parseError() to the base class Expression
+  * [octave] code cleanup in OctaveSesson.
+  * [python] minor code cleanup and trying to fix a python test failing on CI.
+  * [R] parse the mime type 'image' before the type 'octet-stream' is parsed.
+  * Add content rating tag
+  * [octave] changed the default octave executable from 'octave-cli' to 'octave'
+  * Removed the border and reduced the margins of the LaTeX preview image. (kde#434812)
+  * [maxima] properly parse the output of the internal help
+  * Highlight the warning results differently to clearly separate them visually from
+    the normal output.
+  * Enable the copy action in the context menu of the text result item
+  * [maxima] in case a warning is produced, treat it as such
+  * Don't crash when openning an  invalid project file from an invalid URL.
+  * Fix the build.
+  * [octave] removed the usage of EPS and libspectre.
+  * Started removing the usage of libspectre.
+  * Fix build with julia 1.7
+  * Support older KF5 versions
+  * Remove not necessary I18N_NOOP
+
cargo-c
+- add constraints to avoid out of disk space errors
+
cargo-packaging
+- Update vendored dependencies
+- Add supporting sources for cargo metadata extraction
+  * cargo-packaging-1.2.0+0.tar.xz
+  * cargo_config
+  * vendor.tar.xz
+
+- Update to version 1.2.0+0:
+  * marcos.cargo: add path parameter in cargo_install (#3)
+
+- Update to version 1.1.0
+  * Improve support for bundle metadata in rpm provides
+
+- Update to version 1.0.0~git8.6919af0:
+  * Disable incremental builds as they don't work with sccache and don't help in obs
+
+- Add depends on zstd to allow zst compression in rust projects
+
+- Update to version 1.0.0~git7.63c3500:
+  * Improve macros when libgit is a dependency
+
cbi-plugins
+- Fix build with newer auto version by adding the
+  auto-value-annotations artifact to the dependencies
+
+- Do not build against the legacy version of guava any more
+
+- Build only on architectures where eclipse is supported
+
cdi-api
+- Update to upsteam release 2.0.2
+  * No changelog was made available.
+- Added patch:
+  * 0001-Remove-dependency-on-glassfish-el.patch
+    + patch out the two el wrapper functions that are unused
+
+- Build with java source and target levels 8
+
cervisia
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
cglib
+- Remove links between artifacts and their parent since we are
+  not building with maven
+
+- Don't inject <optional>true</optional> in cglib pom, as 3.3.0
+  already provides that option and it makes the POM xml incorrect.
+
+- Update to upstream 3.3.0
+  * emits code compatible with java 1.8, so we can call static
+    interface methods.
+  * minor fix for allowing a fastclass to call static interface
+    methods.
+  * update to asm 7.1
+  * make ant dependency optional
+  * add Automatic Module Names
+  * Expose non-bridge methods more frequently.
+  * Drop support for Java6. (It may continue to work, but continuous
+    integration tests will no longer validate it does.)
+  * Fix #115: Release resources eagerly.
+  * Deprecated TinyBitSet.
+  * Add workarounds for changes coming from Jigsaw.
+  * Fix #89 / #90 (generated incorrect code for bridge methods sometimes)
+- Update project url to new github site (old one redirects there)
+
-- add javapackages-tools to build requires
-
chromium
+- Revert back to GCC 11 on 15.4 as Clang 13 doesn't support GCC 12
+
+- Bump Leap's GCC to 12 as Chromium really likes newer standards
+
+- Chromium 111.0.5563.64
+  * New View Transitions API
+  * CSS Color Level 4
+  * New developer tools in style panel for color functionality
+  * CSS added trigonometric functions, additional root font units
+    and extended the n-th child pseudo selector.
+  * previousslide and nextslide actions are now part of the Media
+    Session API
+  * A number of security fixes (boo#1209040)
+  * CVE-2023-1213: Use after free in Swiftshader
+  * CVE-2023-1214: Type Confusion in V8
+  * CVE-2023-1215: Type Confusion in CSS
+  * CVE-2023-1216: Use after free in DevTools
+  * CVE-2023-1217: Stack buffer overflow in Crash reporting
+  * CVE-2023-1218: Use after free in WebRTC
+  * CVE-2023-1219: Heap buffer overflow in Metrics
+  * CVE-2023-1220: Heap buffer overflow in UMA
+  * CVE-2023-1221: Insufficient policy enforcement in Extensions API
+  * CVE-2023-1222: Heap buffer overflow in Web Audio API
+  * CVE-2023-1223: Insufficient policy enforcement in Autofill
+  * CVE-2023-1224: Insufficient policy enforcement in Web Payments API
+  * CVE-2023-1225: Insufficient policy enforcement in Navigation
+  * CVE-2023-1226: Insufficient policy enforcement in Web Payments API
+  * CVE-2023-1227: Use after free in Core
+  * CVE-2023-1228: Insufficient policy enforcement in Intents
+  * CVE-2023-1229: Inappropriate implementation in Permission prompts
+  * CVE-2023-1230: Inappropriate implementation in WebApp Installs
+  * CVE-2023-1231: Inappropriate implementation in Autofill
+  * CVE-2023-1232: Insufficient policy enforcement in Resource Timing
+  * CVE-2023-1233: Insufficient policy enforcement in Resource Timing
+  * CVE-2023-1234: Inappropriate implementation in Intents
+  * CVE-2023-1235: Type Confusion in DevTools
+  * CVE-2023-1236: Inappropriate implementation in Internals
+- drop patches:
+  * chromium-86-ImageMemoryBarrierData-init.patch
+  * chromium-93-InkDropHost-crash.patch
+  * chromium-110-NativeThemeBase-fabs.patch
+  * chromium-110-CredentialUIEntry-const.patch
+  * chromium-110-DarkModeLABColorSpace-pow.patch
+  * v8-move-the-Stack-object-from-ThreadLocalTop.patch
+  * chromium-icu72-1.patch
+
clamav-database
+- database refresh on 2023-03-20 (bsc#1084929)
+
+- database refresh on 2023-03-13 (bsc#1084929)
+
+- database refresh on 2023-03-06 (bsc#1084929)
+
cloud-netconfig
+- Update to version 1.7:
+  + Overhaul policy routing setup (issue #19)
+  + Support alias IPv4 ranges (issue #14)
+  + Add support for NetworkManager (bsc#1204549)
+  + Remove dependency on netconfig
+  + Install into libexec directory
+  + Clear stale ifcfg files for accelerated NICs (bsc#1199853)
+  + More debug messages
+  + Documentation update
+
+- /etc/netconfig.d/ moved to /usr/libexec/netconfig/netconfig.d/ in
+  Tumbleweed, update path (poo#116221)
+
coccigrep
+- Use python build macros
+
+- Use ExclusiveArch the same as coccinelle
+
-- update to latest snapshot (20121222)
-  * see ChangeLog for changes
-
-- update to latest snapshot (1347289051)
-  * see ChangeLog for changes
-
codenarc
+- Do not generate test stubs by gmavenplus-plugin, since we are not
+  building or running tests during build
+
colord-kde
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
-- Fix the SLES build (%make_install is not expanded on SLES)
-
-- initial import from version 0.2.0
-
console-setup
+- Add patch to fix Caps_Lock mapping for us.map and others (bsc#1202853):
+  * 0001-ckbcomp-Fix-check-for-non-ascii.patch
+
corosync
+Deleted:
+  bsc#1189680-cancel_hold_on_retransmit-option.patch
+  bsc#1192467_dont-block-local-socket-pair.patch
+  bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
+  bug-1166899-quorumtool-Fix-exit-status-codes.patch
+- Update to version 2.4.6:
+  * totemsrp: More informative messages
+  * icmap: fix the icmap_get_*_r functions
+  * stats: Add basic schedule-miss stats to needle
+  * icmap: icmap_init_r() leaks if trie_create() fails
+  * test: Fix cpgtest
+  * pkgconfig: Add libqb dependency
+  * man: votequorum.5: use proper single quotes
+  * cpg: Change downlist log level
+  * totem: Increase ring_id seq after load
+  * totempg: Check sanity (length) of received message
+  * totemsrp: Reduce MTU to left room second mcast
+  * qnetd: Rename qnetd-log.c to log.c
+  * qnetd: Fix double -d description
+  * qnetd: Check log initialization error
+  * qnetd: Add function to set log target
+  * qdevice: Use log instead of libqb log
+  * qdevice: Import log instead of qdevice-log
+  * qdevice: Merge msg_decode_error functions
+  * qnetd: Use log-common for nodelist debug dump
+  * qdevice: Configurable log priority bump
+  * tests: Add utils_parse_bool_str test
+  * qdevice: Free memory used by log
+  * qdevice: Add log test
+  * qdevice: Add header files to list of test sources
+  * qdevice: Add chk variant of vsyslog to test-log
+  * qdevice: Add prototype of __vsyslog_chk
+  * votequorum: Ignore the icmap_get_* return value
+  * logconfig: Remove double free of value
+  * cmap: Assert copied string length
+  * sync: Assert sync_callbacks.name length
+  * votequorum: Assert copied strings length
+  * cpghum: Remove unused time variables and functions
+  * cfgtool: Remove unused callbacks
+  * cmapctl: Free bin_value on error
+  * quorumtool: Assert copied string length
+  * votequorum: Reflect runtime change of 2Node to WFA
+  * main: Add schedmiss timestamp into message
+  * votequorum: Change check of expected_votes
+  * quorumtool: Fix exit status codes
+  * quorumtool: exit on invalid expected votes
+  * votequorum: set wfa status only on startup
+  * Revert "totemip: Add support for sin6_scope_id"
+  * Revert "totemip: compare sin6_scope_id and interface_num"
+  * main: Make schedmiss in cmap and log equal
+  * totemip: Add support for sin6_scope_id
+  * qnetd: Do not call ffsplit_do on shutdown
+  * qdevice: Fix connect heuristics result callback
+  * qdevice: Fix connect heuristics result callback
+  * qdevice: Log adds newline automatically
+  * qnetd: Fix dpd timer
+  * qnetd: Add support for keep active partition vote
+  * common_lib: Remove trailing spaces in cs_strerror
+  * totemsrp: Move token received callback
+  * tests: Use CS_DISPATCH_BLOCKING instead of cycle
+  * qnetd: Fix NULL dereference of client
+  * qnetd: Simplify KAP Tie-breaker logic
+  * totem: Add cancel_hold_on_retransmit config option
+  * logsys: Unlock config mutex on error
+  * totemsrp: Switch totempg buffers at the right time
+  * totemudpu: Don't block local socketpair
+  * configure.ac: fix pkgconfig issue of rdma
+  * totemip: Add support for sin6_scope_id
+  * totemip: compare sin6_scope_id and interface_num
+  * qdevice: Change log level to NOTICE on PASS
+  * cfgtool: output error messages to stderr
+  * tools: use util_strtonum for options checking
+  * cmapctl: return EXIT_FAILURE on failure
+  * quorumtool: Help shouldn't require running service
+  * quorumtool: strict check for -o option
+  * cmapctl: check NULL for key type and value for -p
+  * man: adjust description about interface section
+  * qnetd: sort by node_id when add new client
+  * man: replace votequorum_poll for actually used fn
+
+- corosync totemudpu: bsc#1192467, Fix don't block local socketpair when interface is down
+  Added: bsc#1192467_dont-block-local-socket-pair.patch
+
+- corosync totem: bsc#1189680, Add cancel_hold_on_retransmit config option
+  Added: bsc#1189680-cancel_hold_on_retransmit-option.patch
+
+- (Again) Fix bsc#1163460 Corosync does not support link-local IPv6 addresses
+  Added: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
+  Reason: This time the path will NOT cause problems when doing rolling
+    upgrade, see bsc#1168771
+
+- Stop mangling libexecdir: it's not needed at all.
+
+- Revoke the patch bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
+  Deleted: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
+  Reason: That path will cause problems while doing rolling upgrade, see bsc#1168771
+
+- Fix bsc#1163460 Corosync does not support link-local IPv6 addresses
+  Added: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
+
+- Fix bsc#1166899, return value of "corosync-quorumtool -s" was not correct
+  Added: bug-1166899-quorumtool-Fix-exit-status-codes.patch
+
+- Don't package sysconfig file in tmpfiles.d, it's a bug. Instead correctly
+  add it to /etc/sysconfig, invoking fillup accordingly.
+
+- Packaging bug updating Corosync(bsc#1155792)
+  Some noisy output from Tumbleweed caused by RPM macro not fairly used
+  Make sure corosync sysconfig keep original configured firstly(bsc1153502)
+  Store the tmp file to a more security directory
+
+- Replace corosync-2.4.5.tar.gz with a clean source.tar.gz(bsc#1144200)
+  The reason is some binaries left in corosync-2.4.5.tar.gz
+
+- corosync-2.4.5 upgrade(bsc#1144200)
+  block_unlisted_ips block package from ips not in nodelist
+  Qnetd now supports updated NSS database format
+  Partly fixed problem with ifdown (only for UDPU)
+  Added:
+  corosync-2.4.5.tar.gz
+  bug-1001164_corosync.conf-example.patch
+  corosync-init-lockfile-path-error.patch
+  Deleted:
+  corosync-2.4.4.tar.gz
+  0003-fix-tmpfiles-create.patch
+  0004-mark-corosync-as-a-static-service.patch
+  0005-do-not-convert-empty-uid-gid-to-0.patch
+  0007-add-config-for-corosync-qnetd.patch
+  0009-bsc#1088619-add-version.patch
+  0010-qdevice-net-instance.c-optarg-should-be-str.patch
+  0011-NSS_NoDB_Init-the-parameter-is-reserved-must-be-NULL.patch
+  0012-cpg-Inform-clients-about-left-nodes-during-pause.patch
+  bnc#872651-stop-cluster.patch
+  disable-build-html-docs.patch
+  Renamed:
+  0001-coroapi-Use-size_t-for-private_data_size.patch -> upstream-afd97d7884940_coroapi-Use-size_t-for-private_data_size.patch
+  0006-Fix-compile-warnings-with-GCC-7.2.1.patch -> Fix-compile-warnings-with-GCC-7.2.1.patch
+  0008-bsc#1083561-upgrade-from-1-x-y.patch -> bug-1083561_upgrade-from-1-x-y.patch
+  bnc#882449-corosync-conf-example.patch -> bug-882449_corosync-conf-example.patch
+  0002-fix-ifdown-udp.patch -> bug-1032634_fix-ifdown-udp.patch
+  bsc#1001164-corosync.conf-example.patch -> bug-1001164_corosync.conf-example.patch
+
+- cpg: Inform clients about left nodes during pause(bsc#1091593)
+    Added: 0012-cpg-Inform-clients-about-left-nodes-during-pause.patch
+
+- NSS_NoDB_Init: the parameter is reserved, must be NULL(bsc#1090996)
+    Added: 0011-NSS_NoDB_Init-the-parameter-is-reserved-must-be-NULL.patch
+
+- corosync-2.4.4 is available now(bsc#1089836)
+    man:fix in corosync-qdevice.8
+    quorumtool: remove duplicated help message
+    cfg: nodeid should be unsigned int
+    coroparse: Use readdir instead of readdir_r
+    wd: fix snprintf warnings
+    Fix compile errors in qdevice on FreeBSD
+    qdevice: mv free(str) after port validation
+    Fix various typos
+    Fix typo: recomended -> recommended
+    man: support SOURCE_DATE_EPOCH
+    configure: add --with-initconfigdir option
+    Use static case blocks to determine distro flavor
+    Use RuntimeDirectory instead of tmpfiles.d
+    coroparse: Do not convert empty uid, gid to 0
+    sam: Fix snprintf compiler warnings
+    quorumtool: Use full buffer size in snprintf
+    man: Add note about qdevice parallel cmds start
+    sync: Remove unneeded determine sync code
+    sync: Call sync_init of all services at once
+    corosync.conf: publicize nodelist.node.name
+    totemudp[u]: Drop truncated packets on receive
+    logging: Make blackbox configurable
+    logging: Close before and open blackbox after fork
+    init: Quote subshell result properly
+    blackbox: Quote subshell result properly
+    qdevice: quote certutils scripts properly
+    sam_test_agent: Remove unused assignment
+    qdevice: Fix NULL pointer dereference
+    quorumtool: Don't set our_flags without v_handle
+    qdevice: Nodelist is set into string not array
+    qdevice: Check if user_data can be dereferenced
+    qdevice: Add safer wrapper of strtoll
+    qdevice: Replace strtol by strtonum
+    qnetd: Replace strtol by strtonum
+    main: Set errno before calling of strtol
+    totemcrypto: Implement bad crypto header guess
+    cpg: Use list_del instead of qb_list_del
+    totemcrypto: Check length of the packet
+    totemsrp: Implement sanity checks of received msgs
+    totemsrp: Check join and leave msg length
+    totemudp: Check lenght of message to sent
+    qdevice msgio: Fix reading of msg longer than i32
+    logsys: Avoid redundant callsite section checking
+    man: corosync-qdevice: fix formatting vs. punctuation
+    man: corosync-qdevice: some more stylistics
+    man: fix cpg_mcast_joined.3.in
+    libcpg: Fix issue with partial big packet assembly
+    totempg: Fix fragmentation segfault
+    totempg: use iovec[i].iov_len instead of copy_len
+    totempg: Fix corrupted messages
+    cpg: Handle fragmented message sending interrupt
+    corosync.aug: Add missing options
+    systemd: Delete unnecessary soft_margin
+    Added:
+    corosync-2.4.4.tar.gz
+    0010-qdevice-net-instance.c-optarg-should-be-str.patch
+    Deleted:
+    0007-sync-Call-sync_init-of-all-services-at-once.patch
+    0008-wd-fix-snprintf-warnings.patch
+    0009-add-config-for-corosync-qnetd.patch
+    0010-qdevice-mv-free-str-after-port-validation.patch
+    0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
+    0012-totemudp-u-Drop-truncated-packets-on-receive.patch
+    0013-logging-Make-blackbox-configurable.patch
+    0014-logging-Close-before-and-open-blackbox-after-fork.patch
+    0015-coverity-fixes.patch
+    0018-bsc#1089346-corosync-Integer-overflow-in-totemcrypto.patch
+    corosync-2.4.3.tar.gz
+    Renamed:
+    0009-add-config-for-corosync-qnetd.patch -> 0007-add-config-for-corosync-qnetd.patch
+    0016-bsc#1083561-upgrade-from-1-x-y.patch -> 0008-bsc#1083561-upgrade-from-1-x-y.patch
+    0017-bsc#1088619-add-version.patch -> 0009-bsc#1088619-add-version.patch
+
+-  (CVE-2018-1084) VUL-0: CVE-2018-1084: corosync: Integer overflow in totemcrypto(bsc#1089346)
+    Added: 0018-bsc#1089346-corosync-Integer-overflow-in-totemcrypto.patch
+
+- UNKNOWN version in corosync pkg-config(bsc#1088619)
+    Added: 0017-bsc#1088619-add-version.patch
+
+- [Build 489.1] Corosync is not working after upgrade from sle11sp4-ha to sle15-ha(bsc#1083561)
+    Added: 0016-bsc#1083561-upgrade-from-1-x-y.patch
+
+- some coverity fixes for corosync on upstream(bsc#1083895)
+    Added: 0015-coverity-fixes.patch
+
+- corosync exposes itself for a self-crash under rare circumstance(bsc#1078412)
+    Added: 0013-logging-Make-blackbox-configurable.patch
+    0014-logging-Close-before-and-open-blackbox-after-fork.patch
+    Modified: remove unncessary git commit messages
+    0001-coroapi-Use-size_t-for-private_data_size.patch
+    0002-fix-ifdown-udp.patch
+    0005-do-not-convert-empty-uid-gid-to-0.patch
+    0008-wd-fix-snprintf-warnings.patch
+    0010-qdevice-mv-free-str-after-port-validation.patch
+    0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
+    0012-totemudp-u-Drop-truncated-packets-on-receive.patch
+
+- totemudp[u]: Drop truncated packets on receive(bsc#1075300)
+    Added: 0012-totemudp-u-Drop-truncated-packets-on-receive.patch
+
+- issue with partial packets assembly when multiple nodes are sending big packets(bsc#1074929)
+    Added: 0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
+
+- qdevice failed to run(bsc#1074276)
+    Added: 0010-qdevice-mv-free-str-after-port-validation.patch
+
+- add support for corosync-qdevice in yast2-cluster and bootstrap(bsc#1070961)
+    Added: 0009-add-config-for-corosync-qnetd.patch
+
+- wd: gcc shows snprintf warnings(bsc#1071187)
+    Added: 0008-wd-fix-snprintf-warnings.patch
+
+- Replace references to /var/adm/fillup-templates with new
+  %_fillupdir macro (boo#1069468)
+
+- corosync race condition when node leaves immediately after joining(bsc#1067958)
+    Added: 0007-sync-Call-sync_init-of-all-services-at-once.patch
+
+- gcc: snprintf gives warning: ‘%s’ directive output may be truncated writing
+    8 bytes into a region of size between 1 and 255(bsc#1066090)
+    Added: 0006-Fix-compile-warnings-with-GCC-7.2.1.patch
+
+- coroparse: uidgid with empty uid or gid results into add uid 0(bsc#1066585)
+    Added: 0005-do-not-convert-empty-uid-gid-to-0.patch
+    Modified: 0005-do-not-convert-empty-uid-gid-to-0.patch,
+    check whether the uid, gid is empty before calling strtol
+
+- Upgrade corosync-2.4.2 to corosync-2.4.3(fate#321385)
+    doc: document watchdog_device parameter
+    Main: Call mlockall after fork
+    Totempg: remove duplicate memcpy in mcast_msg func
+    Qdevice: fix spell errors in qdevice
+    logconfig: Do not overwrite logger_subsys priority
+    totemconfig: Prefer nodelist over bindnetaddr
+    cpghum: Fix printf of size_t variable
+    Qnetd lms: Use UTILS_PRI_RING_ID printf format str
+    wd: Report error when close of wd fails
+    votequorum: Don't update expected_votes display if value is too high
+    votequorum: simplify reconfigure message handling
+    quorumtool: Add option to show all node addresses
+    main: Don't ask libqb to handle segv, it doesn't work
+    man: Document -a option to corosync-quorumtool
+    main: use syslog & printf directly for early log messages
+    votequorum: make atb consistent on nodelist reload
+    Fix typo: Destorying -> Destroying
+    init: Add doc URIs to the systemd service files
+    wd: fix typo
+    corosync.conf.5: Fix watchdog documentation
+    corosync.conf.5: add warning about slow watchdogs
+    wd: remove extra capitalization typo
+    corosync.conf.5: watchdog support is conditional
+    notifyd: Add the community name to an SNMP trap
+    Logsys: Change logsys syslog_priority priority
+    totemrrp: Fix situation when all rings are faulty
+    main: Display reason why cluster cannot be formed
+    totem: Propagate totem initialization failure
+    totemcrypto: Refactor symmetric key importing
+    totemcrypto: Use different method to import key
+    main: Add option to set priority
+    main: Add support for libcgroup
+    totemcrypto: Fix compiler warning
+    cmap: Remove noop highest config version check
+    qdevice: Add support for heuristics
+    Spec: drop unneeded dependency
+    Spec: make internal dependencies arch-qualified
+    cmap: don't shutdown highest config_version node
+    totemudp: Remove memb_join discarding
+    Spec: fix arch-qualified dependencies
+    Include fcntl.h for F_* and O_* defines
+    totemudp: Retry if bind fails
+    Remove deprecated doxygen flags
+    man: Fix typos in man page
+    man: Modify man-page according to command usage
+    Remove redundant header file inclusion
+    upstart: Add softdog module loading example
+    Added:
+    corosync-2.4.3.tar.gz
+    Removed:
+    corosync-2.4.2.tar.gz
+    bsc#1047860-add-version.patch
+    0001-Logsys-Change-logsys-syslog_priority-priority.patch
+    0001-logconfig.c-make-logging.syslog_priority-and-logging.patch
+    0001-totemconfig.c-Fixed-Evicted-from-CPG-membership.patch
+    0002-Main-call-mlock-after-fork.patch
+    0003-totemrrp-Fix-situation-when-all-rings-are-faulty.patch
+    0004-main-Display-reason-why-cluster-cannot-be-formed.patch
+    0005-votequorum-Report-errors-from-votequorum_exec_send_r.patch
+    0007-Make-corosync-work-when-FIPS-mode-is-enabled.patch
+    0008-main.c-add-option-to-set-priority.patch
+    0009-totem-Propagate-totem-initialization-failure.patch
+    Modified:
+    bsc#1047860-add-version.patch: change version to 2.4.3
+    corosync.changes: add changelogs
+    corosync.spec: remove unnecessary patches
+    Renamed:
+    0006-coroapi-Use-size_t-for-private_data_size.patch -> 0001-coroapi-Use-size_t-for-private_data_size.patch
+    0010-fix-ifdown-udp.patch -> 0002-fix-ifdown-udp.patch
+    0011-fix-tmpfiles-create.patch -> 0003-fix-tmpfiles-create.patch
+    0012-mark-corosync-as-a-static-service.patch -> 0004-mark-corosync-as-a-static-service.patch
+
+- wrong "service_del_postun corosync.service"(bsc#1060767)
+    Modified: corosync.spec, remove service_del_postun in postun of corosync
+
+- Restore conformance to shared library packaging guideline.
+- Remove redundant cleaning in %install and %clean.
+
+- corosync.service should be marked as a static service(bsc#1055585)
+    Added: 0012-mark-corosync-as-a-static-service.patch
+
+- Fix RPM groups.
+
+- L3: corosync: assert(sender_node != NULL) fails after tearing down a network interface(bsc#1032634)
+    Added: 0010-fix-ifdown-udp.patch
+- Fix rpmlint warnings
+    Added: 0011-fix-tmpfiles-create.patch
+
+- some errors in spec file(bsc#1047862)
+  Modified:corosync.spec
+  1) as in openSUSE:factory, there are %define, but bcond_with coudld be toggled by osc command , change %define to %bcond_with and %bcond_without
+  2) change service_del_postun to service_del_preun, since service_del_postun is not a right macro
+  3) remove macro tpmfiles_create define from corosync.spec.
+
+- make corosync.spec uniform (bsc#1051385)
+  Modified: corosync.spec
+    1. there are some lines are commented in corosync.spec, will define new macro to make these lines uncommented
+    2. in former, xmlconf, rdma and snmp were disabled, these features are wrongly enabled, will disable them
+
+-  some upstream fixes for corosync(bsc#1048259)
+  Added:
+    bsc#1047860-add-version.patch
+    0007-Make-corosync-work-when-FIPS-mode-is-enabled.patch
+    0008-main.c-add-option-to-set-priority.patch
+    0009-totem-Propagate-totem-initialization-failure.patch
+  Removed:
+    bnc#867767-add-version.patch
+    0007-improve-corosync-keygen.patch(since this patch is not for corosync v2.x)
+  Modified:
+    corosync.spec, add judgement whether /etc/sysconfig/corosycn* exist before remove these files
+
+- some errors in spec file(bsc#1047862)
+  Modified:
+    corosync.spec
+- improvement for corosync-keygen(bsc#1047861)
+  Added:
+    0007-improve-corosync-keygen.patch
+- 1047860corosync report wrong version number(bsc#1047860)
+  Modified:
+    bnc#867767-add-version.patch
+
+-  some Fixes from upstream(bsc#1043045)
+  Added:
+    0004-main-Display-reason-why-cluster-cannot-be-formed.patch
+    0005-votequorum-Report-errors-from-votequorum_exec_send_r.patch
+    0006-coroapi-Use-size_t-for-private_data_size.patch
+
+[patch-lost-in-sle] Missing issues in openSUSE:Factory/corosync(bsc#1041587)
+  add change log for upgrading corosync to v2.3.6 and make this change log contain all records in SLE12 SP3
+  make the format consistent
+
+- totemrrp: Fix situation when all rings are faulty(bsc#1039215)
+  Added:
+    0003-totemrrp-Fix-situation-when-all-rings-are-faulty.patch
+
+- calling mlockall before corosync_tty_detach is noop when corosync is executed as a daemon(bsc#1038147)
+  Added:
+    0002-Main-call-mlock-after-fork.patch
+
+- [upgrade] Changing the pre-upgrade role for node failed(bsc#1030437)
+  Added:
+    0001-totemconfig.c-Fixed-Evicted-from-CPG-membership.patch
+  Removed:
+    0001-totemip.c-Fixed-Evicted-from-CPG-membership.patch
+
+- L3-Question: corosync logging priority takes no effect(bsc#1023959)
+  Added:
+    0001-Logsys-Change-logsys-syslog_priority-priority.patch
+    0001-logconfig.c-make-logging.syslog_priority-and-logging.patch
+
+-  Corosync 2.4.1 still produces libvotequorum.so.7.0.0, just like Corosync 2.3.6.(bsc#1013842)
+  Added:
+  disable-build-html-docs.patch
+  upgrade to corosync-2.4.2:
+    Man: Fix corosync-qdevice-net-certutil link
+    man: mention qdevice incompatibilites in votequorum.5
+    Qnetd LMS: Fix two partition use case
+    cfg: Prevents use of uninitialized buffer
+
+- upgrade to corosync-2.4.1(bsc#1004967)
+  Added:
+    corosync-start-stop-level.patch
+  Deleted:
+    Config-Flag-config-uidgid-entries.patch
+    cfg-Prevents-use-of-uninitialized-buffer.patch
+    cts-Make-it-run-with-pacemaker-1.13.patch
+    get_cluster_mcast_addr-error-is-not-fatal.patch
+    totemsrp-Addition-of-the-log.patch
+  modified: bnc#867767-add-version.patch, change version to 2.4.1
+  corosync-2.4.1:
+    Low: totemsrp: Addition of the log.
+    cts: Make it run with pacemaker-1.13+
+    Config: Flag config uidgid entries
+    Spec: Qdevice require same version of corosync
+  corosync-2.4.0:
+    qdevice and qnet
+    config: get_cluster_mcast_addr error is not fatal
+    some typo fixes
+
+upgrade corosync-v2.3.5 to corosync-v2.3.6, and backport patches from v2.4.2(FATE#322113, bsc#1020550)
+  Added:
+    Config-Flag-config-uidgid-entries.patch
+    cfg-Prevents-use-of-uninitialized-buffer.patch
+    cts-Make-it-run-with-pacemaker-1.13.patch
+    get_cluster_mcast_addr-error-is-not-fatal.patch
+    totemsrp-Addition-of-the-log.patch
+  Removed:
+    corosync-cts-api-error.patch
+  v2.3.6
+- logconfig: Fix logging reload disabling logfiles
+- wd: Warn if values are out of range
+- parser: WD Read type correctly from corosync.conf
+- Add some more RO keys
+- Reapply config defaults corosync.conf reload
+- schedwrk: Cleanup and make it work on PPC BE
+- cmapctl: Handle corosync errors in print_key func
+- Adds doxygen stubs to include directory
+- Add clang-format configuration file
+- wd: make watchdog device configurable
+- logging: Use our own version of basename
+- logsys: fix TOTEM logging when corosync built out of tree
+- parser: Make config file parser more hierarchy
+- totemconfig: Explicitly pass IP version
+- cpg: Handle ipc error in cpg_zcb_alloc/free
+- cpg: Memory not unmapped in cpg_zcb_free
+- totempg: Fix memory leak
+- Fix spelling errors
+- Add section in manual title for cpg_zcb_free 3
+- Add section in manual title for cpg_zcb_alloc 3
+- Update corosync.spec source link
+- Update gitignore files
+- Remove all links to old ML
+- totemsrp: Fix clang warning (tautological compare)
+- configure.ac: Make location of .pc overrideable
+- Remove a few unused variables and functions
+- configure.ac: We don't need no C++ compiler
+- configure.ac: Remove deprecated AC_PROG_LIBTOOL
+- configure.ac: make foreign apply to all Makefiles
+- Remove unused, obsolete check
+- Fix detection of qb_log_thread_priority_set
+- cpghum: Fix type of recv_crc
+- Check for fdatasync
+- Fix detection of warning flags for clang
+- quorum: Display node id as unsigned int.
+- cts: InitClusterManager is now BootCluster
+- totemudp: Move udp bind() so that multicast works with IPv6
+- cfgtool: Display nodeid as unsigned int
+- votequorum: Don't send multiple callbacks when nodes join
+- man: Add synopsis for cpg_zcb_alloc and free
+- man html index: Update index
+- votequorum: Make sure cs_error_t is defined
+- Doxygen fix for cmap_iter_next()
+- configure: Correct help entry for logdir
+- totmesrp: Fix typo in log message
+- configure: typo in include
+- man page: Correct option letter for DBus
+- wd: fix setting of watchdog timeouts
+- CFG: Prevent CFG orignating messages during SYNC
+
+- Default token timeout was 5000 ms in SLE 11 SP4, but is 1000 ms in SLE 12(bsc#1001164)
+  Added: bsc#1001164-corosync.conf-example.patch
+
+- Fix: [s390]Upgrade from SP1-GM + HA to SP2-RC2 +: Failed to start Corosync Cluster engine(bsc#996230)
+- modify corosync.spec to remove "chkconfig --add"
+- remove corosync-devel and require lines from baselibs.conf
+
+-  corosync process still exists when stop pacemaker service(bnc#988683)
+
+- remove git files from tarball(bnc#941910)
+- modify corosync.spec to delete logrotate.d
+
+update from v2.3.3 to v2.3.5 (bnc#939328)
+  v2.3.5
+- Log: Add logrotate configuration file
+- totemsrp: Improve logging of left/down nodes
+- totemconfig: Check for duplicate nodeids
+- Really add cpghum
+- cpg: Add support for messages larger than 1Mb
+- Handle adding and removing UDPU members atomically
+- add patches:
+  * corosync-cts-api-error.patch
+  * bnc#867767-add-version.patch
+
+- mv the place of corosync.conf.example*(fate#318190)
+
+- Replace systemd BuildRequires with pkgconfig(systemd): we do not
+  require the full installation / dep chain of systemd.
+
+- fix bashisms in mem_leak_test.sh script
+- add patches:
+  * corosync-2.3.4-fix-bashisms.patch
+
+- fix bashism in preun script
+
cracklib
+- %check: really test the package [bsc#1191736]
+
+- Update to version 2.9.7:
+  + fix a buffer overflow processing long words.
+- Drop 0003-overflow-processing-gecos.patch and
+  0004-overflow-processing-long-words.patch: fixed upstream.
+- Update source URI.
+- Remove use of translation-update-upstream. It cannot be added to
+  ring 0 on leap, and 2.9.7 has some translation fixes
+  (bsc#1172396).
+
+- Enable translation-update-upstream on leap, to remove the use of
+  is_opensuse (jsc#SLE-12096).
+
+- use /usr/lib instead of %{_libexecdir}, %{_libexecdir} should
+  contain internal binaries, not data
+
+- Use %license (boo#1082318)
+
+- Update to 2.9.6
+  * fix issue with sort and locale
+  * some particularly bad cases to the cracklib small dictionary
+  * updates to cracklib-words (adds a bunch of other dictionary lists)
+  * migration to github
+- run spec-cleaner
+
+- Only buildrequire and call translation-update-upstream on SLE:
+  the package in openSUSE is a dummy and is empty.
+
+- Add patch 0004-overflow-processing-long-words.patch
+  to fix a new buffer overflow identified together with bsc#992966.
+
+- Relabel patches:
+  cracklib-magic.diff -> 0001-cracklib-magic.diff
+  cracklib-2.9.2-visibility.patch -> 0002-cracklib-2.9.2-visibility.patch
+- Add patch 0003-overflow-processing-gecos.patch
+  to fix a buffer overflow in GECOS parser (bsc#992966 CVE-2016-6318)
+
+- Update to 2.9.5
+  * fix matching against first password in dictionary (Anton Dobkin)
+- Changes for 2.9.4
+  * remove doubled prototype
+- Changes for 2.9.3
+  * expose additional functions externally
+
+- Cleanup spec file with spec-cleaner
+- Remove old ppc provides/obsoletes
+
+- Update to version 2.9.2
+  + support build of python support outside of source tree
+  + fix bug in Python string distance calculation
+  + fix bug #16 / debian bug 724570 - broken optimization with packlib
+    prevblock
+- Adapt patch to upstream changes
+  + cracklib-visibility.patch > cracklib-2.9.2-visibility.patch
+
crmsh
+- Update to version 4.5.0+20230309.a4c4192d:
+  * Dev: version: Bump crmsh version to 4.5.0
+  * Fix: report: Fix crm report issue under non-root user
+  * Fix: log: Redirect debug messages into stderr (bsc#1208991)
+
+- Update to version 4.4.1+20230302.2b5310b9:
+  * Fix: qdevice: Unable to setup qdevice under non-root user (bsc#1208770)
+
cups
+- cups-branch-2.2-commit-3e4dd41459dabc5d18edbe06eb5b81291885204b.diff
+  is 'git show 3e4dd41459dabc5d18edbe06eb5b81291885204b' for
+  https://github.com/apple/cups/commit/3e4dd41459dabc5d18edbe06eb5b81291885204b
+  (except the not needed hunk for patching CHANGES.md which fails)
+  that fixes handling of MaxJobTime 0 (Issue #5438) in the CUPS 2.2 branch
+  bsc#1201511:
+  Stuck print jobs being cancelled immediately, despite MaxJobTime being set to 0
+
+- cups-2.2.7-CVE-2022-26691.patch fixes CVE-2022-26691
+  cups: authentication bypass and code execution (bsc#1199474)
+
+- SUSE_bsc_1189517.patch is
+  https://github.com/apple/cups/commit/821b3cc956d46b811facd50986acc9f24f0e1c79
+  which belongs to https://github.com/apple/cups/issues/5288
+  that fixes bsc#1189517
+  "cups printservice takes much longer than before
+  with a big number of printers"
+  see in particular
+  https://github.com/apple/cups/issues/5288#issuecomment-921626381
+- SUSE_bsc_1195115.patch is
+  https://github.com/apple/cups/commit/ba9d68cc7467a7a47ef219071902b9e9eb6dbc44
+  which belongs to https://github.com/apple/cups/issues/5538
+  that fixes bsc#1195115
+  "CUPS PreserveJobHistory doesn't work with seconds"
+
+- When cupsd creates directories with specific owner group
+  and permissions (usually owner is 'root' and group matches
+  "configure --with-cups-group=lp") specify same owner group and
+  permissions in the RPM spec file to ensure those directories
+  are installed by RPM with the right settings because if those
+  directories were installed by RPM with different settings then
+  cupsd would use them as is and not adjust its specific owner
+  group and permissions which could lead to privilege escalation
+  from 'lp' user to 'root' via symlink attacks e.g. if owner is
+  falsely 'lp' instead of 'root' CVE-2021-25317 (bsc#1184161)
+
+- cups-2.2.7-web-ui-kerberos-authentication.patch (bsc#1175960)
+  Fix web UI kerberos authentication
+
+- cups-2.2.7-CVE-2020-10001.patch fixes CVE-2020-10001
+  access to uninitialized buffer in ipp.c (bsc#1180520)
+- cups-2.2.7-CVE-2019-8842.patch fixes CVE-2019-8842 (bsc#1170671)
+  the ippReadIO function may under-read an extension field
+
+- cups-2.2.7-CVE-2020-3898.patch fixes CVE-2020-3898 (bsc#1168422)
+  heap-buffer-overflow in libcups ppdFindOption() function
+
+- cups-2.2.7-CVE-2019-8675.CVE-2019-8696.patch fixes
+  CVE-2019-8675 and CVE-2019-8696 (bsc#1146358 and bsc#1146359)
+  and some other security/disclosure issues
+  https://github.com/apple/cups/commit/f24e6cf6a39300ad0c3726a41a4aab51ad54c109
+  (Apple's internal issues rdar://51685251, rdar://50035411,
+  rdar://51373853, rdar://51373929)
+
+- Add issue5509-fix-utf-8-validation-issue.patch (bsc#1118118)
+  Fixes https://github.com/apple/cups/issues/5509
+
+- cups-2.2.7-CVE-2018-4700.patch fixes CVE-2018-4700: session
+  cookie is extremely predictable, effectively breaking the
+  CSRF protection of the CUPS web interface (bsc#1115750)
+
+- cups-branch-2.2-commit-97cb566568a8c3a9c07c7ccec09f28f5c5015954.diff
+  is 'git show 97cb566568a8c3a9c07c7ccec09f28f5c5015954' for
+  https://github.com/apple/cups/commit/97cb566568a8c3a9c07c7ccec09f28f5c5015954
+  (except the not needed hunk for patching CHANGES.md which fails)
+  that fixes local privilege escalation to root and sandbox
+  bypasses in scheduler (Apple's internal issues rdar://37836779,
+  rdar://37836995, rdar://37837252, rdar://37837581)
+  in the CUPS 2.2 branch
+  bsc#1096405 CVE-2018-4180:
+  Local Privilege Escalation to Root in dnssd Backend (CUPS_SERVERBIN)
+  bsc#1096406 CVE-2018-4181:
+  Limited Local File Reads as Root via cupsd.conf Include Directive
+  bsc#1096407 CVE-2018-4182:
+  cups-exec Sandbox Bypass Due to Insecure Error Handling
+  bsc#1096408 CVE-2018-4183:
+  cups-exec Sandbox Bypass Due to Profile Misconfiguration
+
+- Version upgrade to 2.2.7:
+  CUPS 2.2.7 is a general bug fix release.
+  For details see https://github.com/apple/cups/releases
+  or the CHANGES.md file.
+  Changes include:
+  * Additional security fixes for:
+    bsc#1061066 DBUS library aborts caller process
+    in _dbus_check_is_valid_utf8 (in particular that aborts cupsd)
+    and
+    bsc#1087018 CVE-2017-18248: cups: The add_job function in
+    scheduler/ipp.c in CUPS before 2.2.6, when D-Bus support is
+    enabled, can be crashed by remote attackers by sending print
+    jobs with an invalid username, related to a D-Bus notification
+    which are the CUPS upstream issues
+    https://github.com/apple/cups/issues/5143
+    Remote DoS attack against cupsd via invalid username
+    and malicious D-Bus library
+    and
+    https://github.com/apple/cups/issues/5186
+    squash non-UTF-8 strings into ASCII on plain IPP level
+    and
+    https://github.com/apple/cups/issues/5229
+    persistently substitute invalid job attributes
+    with default values - not only in add_job
+    see also
+    bsc#1087072 dbus-1:
+    Disable assertions to prevent un-expected DDoS attacks
+  * NOTICE: Raw print queues are now deprecated (Issue #5269)
+    so that now there is a warning message when you
+    add or modify a queue to use the "raw driver" but
+    raw printing will continue to work through CUPS 2.3.x, cf.
+    https://lists.cups.org/pipermail/cups/2018-March/074060.html
+  * Fixed an Avahi crash bug in the scheduler (Issue #5268)
+  * Systemd did not restart cupsd when configuration changes
+    were made that required a restart (Issue #5263)
+  * The scheduler could crash while adding an IPP Everywhere
+    printer (Issue #5258)
+  * The scheduler now supports using temporary print queues
+    for older IPP/1.1 print queues like those shared by CUPS 1.3
+    and earlier (Issue #5241)
+  * Kerberized printing to another CUPS server did not work
+    correctly (Issue #5233)
+  * More fixes for printing to old CUPS servers (Issue #5211)
+  * The scheduler now substitutes default values for invalid
+    job attributes when running in "relaxed conformance"
+    mode (Issue #5186)
+  * The cups-driverd program incorrectly stopped scanning PPDs
+    as soon as a loop was seen (Issue #5170)
+  * The `SSLOptions` directive now supports `MinTLS` and `MaxTLS`
+    options to control the minimum and maximum TLS versions
+    that will be allowed, respectively (Issue #5119)
+  * The scheduler did not write out dirty configuration and
+    state files if there were open client connections (Issue #5118)
+  * The `lpadmin` command now provides a better error message when
+    an unsupported System V interface script is used (Issue #5111)
+  * No longer support backslash, question mark, or quotes
+    in printer names (Issue #4966)
+  * The CUPS library now supports the latest HTTP Digest
+    authentication specification including support
+    for SHA-256 (Issue #4862)
+  * TLS connections now properly timeout (rdar://34938533)
+
+- Make sure cups-libs-<targettype> is removed
+
+- Version upgrade to 2.2.6:
+  CUPS 2.2.6 is a general bug fix release.
+  For details see https://github.com/apple/cups/releases
+  Changes include:
+  * DBUS notifications could crash the scheduler (Issue #5143)
+    (see also bsc#1061066 "DBUS library aborts caller process")
+
+- Use again the baselibs.conf from Fri Oct 13 11:11:10 UTC 2017
+  that got broken by the change on Wed Oct 18 06:11:10 UTC 2017.
+- Version upgrade to 2.2.5:
+  CUPS 2.2.5 is a general bug fix release.
+  For details see https://github.com/apple/cups/releases
+- Version upgrade to 2.2.4:
+  CUPS 2.2.4 is a general bug fix release.
+  For details see https://github.com/apple/cups/releases
+- Removed
+  0001-Update-cupsEnumDests-implementation-to-return-early-if-all.patch
+  0002-Save-work-on-Avahi-code.patch
+  0003-Avahi-fixes-for-cupsEnumDests.patch
+  because since CUPS 2.2.4 it is fixed in the upstream code
+  via https://github.com/apple/cups/pull/4989 more precisely via
+  https://github.com/apple/cups/commit/a2187a63425a3d6c05de1e1cbf8c26fd39a1aced
+  https://github.com/apple/cups/commit/657c5b5f91e6d5120c4ad7b118cf9098dd27f03d
+  https://github.com/apple/cups/commit/3fae3b337df0be1a766857be741173d8a9915da7
+
+- Fix typo in requires
+
+- Implement shared library packaging guideline [boo#862112]
+- Update package descriptions.
+
+- Remove redundant Requires(pre) line — the use of %post -p
+  already implies it.
+
+- Pre-require user(lp) in cups-libs
+
+- In /usr/lib/tmpfiles.d/cups.conf use
+  group 'root' for /run/cups/certs (boo#1042916).
+
+- Major backward incompatible change since CUPS 2.2.0:
+  There is no longer the directory /etc/cups/interfaces because
+  since CUPS 2.2.0 so called "System V style Interface Scripts"
+  are no longer supported for security reasons (see below the
+  entry about the changes included in CUPS 2.2.0).
+- Disabled cups-2.1.0-cups-systemd-socket.patch
+  because it does no longer apply which needs to be examined
+  and decided by someone who knows about systemd internals.
+- Disabled
+  0001-Update-cupsEnumDests-implementation-to-return-early-if-all.patch
+  0002-Save-work-on-Avahi-code.patch
+  0003-Avahi-fixes-for-cupsEnumDests.patch
+  because they do no longer apply which needs to be examined
+  and decided by someone who knows about Avahi internals.
+- Version upgrade to 2.2.3:
+  CUPS 2.2.3 is a general bug fix release.
+  See https://github.com/apple/cups/releases
+  Changes include:
+  * The IPP backend could get into an infinite loop for certain
+    errors, causing a hung queue (rdar://problem/28008717)
+  * The scheduler could pause responding to client requests in
+    order to save state changes to disk (rdar://problem/28690656)
+  * Added support for PPD finishing keywords
+    (Issue #4960, Issue #4961, Issue #4962)
+  * The IPP backend did not send a media-col attribute for just
+    the source or type (Issue #4963)
+  * IPP Everywhere print queues did not always support all print
+    qualities supported by the printer (Issue #4953)
+  * IPP Everywhere print queues did not always support all media
+    types supported by the printer (Issue #4953)
+  * The IPP Everywhere PPD generator did not return useful error
+    messages (Issue #4954)
+  * The IPP Everywhere finishings support did not work correctly
+    with common UI or command-line options (Issue #4976)
+  * Fixed an error handling issue for the network backends
+    (Issue #4979)
+  * The "reprint job" option was not available for some canceled
+    jobs (Issue #4915)
+  * Updated the job listing in the web interface (Issue #4978)
+  A detailed list of changes can be found in the CHANGES.txt file.
+- Version upgrade to 2.2.2:
+  CUPS 2.2.2 is a general bug fix release.
+  See https://github.com/apple/cups/releases
+  Changes include:
+  * Fixed some issues with IPP Everywhere printer support
+    (Issue #4893, Issue #4909, Issue #4916, Issue #4921,
+    Issue #4923, Issue #4932, Issue #4933, Issue #4938)
+  * The rastertopwg filter could crash with certain input
+    (Issue #4942)
+  * The scheduler did not detect when an encrypted connection
+    was closed by the client on Linux (Issue #4901)
+  * The cups-lpd program did not catch all legacy usage
+    of ISO-8859-1 (Issue #4899)
+  * The scheduler no longer creates log files on startup
+    (<rdar://problem/28332470>)
+  * The ippContainsString function now uses case-insensitive
+    comparisons for mimeMediaType, name, and text values in
+    conformance with RFC 2911.
+  * The network backends now log the addresses that were found
+    for a printer (<rdar://problem/29268474>)
+  * Let's Encrypt certificates did not work when the hostname
+    contained uppercase letters (Issue #4919)
+  * Fixed reporting of printed pages in the web interface
+    (Issue #4924)
+  * Updated systemd config files (Issue #4935)
+  A detailed list of changes can be found in the CHANGES.txt file.
+- Version upgrade to 2.2.1:
+  CUPS 2.2.1 is a general bug fix release.
+  See https://github.com/apple/cups/releases
+  Changes include:
+  * Added "CreateSelfSignedCerts" directive for cups-files.conf
+    to control whether the scheduler automatically creates
+    its own self-signed X.509 certificates for TLS connections
+    (Issue #4876)
+  * http*Connect did not handle partial failures (Issue #4870)
+  * cupsHashData did not use the correct hashing algorithm
+    (<rdar://problem/28209220>)
+  * Updated man pages (PR #4885)
+  A detailed list of changes can be found in the CHANGES.txt file.
+- Version upgrade to 2.2.0:
+  CUPS 2.2.0 adds support for local IPP Everywhere print queues
+  and includes several performance and security improvements.
+  See https://github.com/apple/cups/releases
+  Changes include:
+  * Normalized the TLS certificate validation code and added
+    additional error messages to aid troubleshooting.
+  * http*Connect did not work on Linux when cupsd was not running
+    (Issue #4870)
+  * The --no-remote-any option of cupsctl had no effect
+    (Issue #4866)
+  * http*Connect did not return early when all addresses failed
+    (Issue #4870)
+  * The IPP backend did not validate TLS credentials properly.
+  * The printer-state-message attribute was not cleared after a
+    print job with no errors (Issue #4851)
+  * The CUPS-Add-Modify-Class and CUPS-Add-Modify-Printer
+    operations did not always return an error for failed
+    adds (Issue #4854)
+  * PPD files with names longer than 127 bytes did not work
+    (Issue #4860)
+  * CUPS now supports Let's Encrypt certificates on Linux.
+  * All CUPS commands now support POSIX options (Issue #4813)
+  * The scheduler now restarts faster (Issue #4760)
+  * Improved performance of web interface with large numbers
+    of jobs (Issue #3819)
+  * Encrypted printing can now be limited to only trusted
+    printers and servers (<rdar://problem/25711658>)
+  * The scheduler now advertises PWG Raster attributes for
+    IPP Everywhere clients (Issue #4428)
+  * The scheduler now logs informational messages for jobs
+    at LogLevel "info" (Issue #4815)
+  * The scheduler now uses the getgrouplist function
+    when available (Issue #4611)
+  * The IPP backend no longer enables compression by default
+    except for certain raster formats that generally benefit
+    from it (<rdar://problem/25166952>)
+  * The scheduler did not handle out-of-disk situations
+    gracefully (Issue #4742)
+  * The LPD mini-daemon now detects invalid UTF-8 sequences
+    in job, document, and user names (Issue #4748)
+  * The IPP backend now continues on to the next job
+    when the remote server/printer puts the job on hold
+    (<rdar://problem/24858548>)
+  * The scheduler did not cancel multi-document jobs immediately
+    (<rdar://problem/24854834>)
+  * The scheduler did not return non-shared printers to local
+    clients unless they connected to the domain socket
+    (<rdar://problem/24566996>)
+  * The scheduler now reads the spool directory if one or more
+    job cache entries point to deleted jobs
+    (<rdar://problem/24048846>)
+  * Added support for disc media sizes (<rdar://problem/20219536>)
+  * The httpAddrConnect and httpConnect* APIs now try connecting
+    to multiple addresses in parallel (<rdar://problem/20643153>)
+  * Interface scripts are no longer supported for security reasons
+    (<rdar://problem/23135640>)
+  A detailed list of changes can be found in the CHANGES.txt file.
+- Version upgrade to 2.1.4:
+  CUPS 2.1.4 is a general bug fix release.
+  See https://github.com/apple/cups/releases
+  Changes include:
+  * Fixed reporting of 1284 Device IDs (Issue #3835, PR #3836)
+  * Fixed printing of multiple files to raw queues (Issue #4782)
+  * The scheduler did not implement the Hold-New-Jobs opertion
+    correctly (Issue #4767)
+  * The cups-lpd mini-daemon incorrectly included the document-name
+    attribute when creating a job.  It should only be included when
+    sending a job (Issue #4790)
+  A detailed list of changes can be found in the CHANGES.txt file.
+
+- Replace krb5-devel BuildRequires with pkgconfig(krb5) on
+  suse_version >= 1315: give OBS a better chance to break up build
+  cycles.
+
+- Drop cups-1.7.5-cupsEnumDests-react-to-all-for-now.diff and add
+  0001-Update-cupsEnumDests-implementation-to-return-early-if-all.patch,
+  0002-Save-work-on-Avahi-code.patch and
+  0003-Avahi-fixes-for-cupsEnumDests.patch which is what upstream
+  finally commited to cups 2.2 sources in response to
+  https://github.com/apple/cups/pull/4989 in order to fix cupsEnumDests
+  to react to the ALL_FOR_NOW avahi event (and also include a similar
+  fix for the dnssd case). Related to bsc#955432.
+
+- Add cups-2.1.3-cupsEnumDests-react-to-all-for-now.diff .
+  Avahi sends an ALL_FOR_NOW event when it finishes sending
+  its cache contents. This patch makes cupsEnumDests finish
+  when the signal is received so it doesn't block the caller
+  doing nothing until the timeout finishes (related to bsc#955432,
+  submitted upstream at https://github.com/apple/cups/pull/4989)
+
+- Add /etc/cups to cups-libs package [bsc#1025689]
+
+- Replace pkgconfig(libsystemd-daemon) BuildRequires with
+  pkgconfig(libsystemd) on openSUSE 13.2 and newer: the various
+  sub-libraries have been merged into libsystemd since version 209.
+  openSUSE 13.1 was the last product to ship systemd 208.
+
+- Remove CUPS.desktop and pixmap
+  * Obsoletes patch cups-1.3.9-desktop_file.patch
+
+- Version upgrade to 2.1.3:
+  CUPS 2.1.3 fixes some issues in the scheduler, sample drivers,
+  and user commands.
+  A detailed list of changes can be found in the CHANGES.txt file.
+  Changes include (excerpt):
+  * The scheduler should not exit under memory pressure
+    (<rdar://problem/23255001>)
+  * Fixed some issues in ipptool for skipped tests
+    (<rdar://problem/24137160>)
+  * The "lp -H resume" command did not reset the
+    "job-state-reasons" attribute value (STR #4752)
+  * The scheduler did not allow access to resource files
+    (icons, etc.) when the web interface was disabled (STR #4755)
+- Version upgrade to 2.1.2:
+  CUPS 2.1.2 fixes an issue in the 2.1.1 source archives which
+  actually contained a current 2.2 snapshot.
+  There are no other changes.
+- Version upgrade to 2.1.1:
+  CUPS 2.1.1 fixes a number of USB and IPP printing issues,
+  addresses some error reporting and hardening issues in
+  the scheduler, and updates some localizations.
+  A detailed list of changes can be found in the CHANGES.txt file.
+  Changes include (excerpt):
+  * Security hardening fixes (<rdar://problem/23131948>,
+    <rdar://problem/23132108>, <rdar://problem/23132353>,
+    <rdar://problem/23132803>, <rdar://problem/23133230>,
+    <rdar://problem/23133393>, <rdar://problem/23133466>,
+    <rdar://problem/23133833>, <rdar://problem/23133998>,
+    <rdar://problem/23134228>, <rdar://problem/23134299>,
+    <rdar://problem/23134356>, <rdar://problem/23134415>,
+    <rdar://problem/23134506>, <rdar://problem/23135066>,
+    <rdar://problem/23135122>, <rdar://problem/23135207>,
+    <rdar://problem/23144290>, <rdar://problem/23144358>,
+    <rdar://problem/23144461>)
+  * The cupsGetPPD* functions did not work with IPP printers
+    (STR #4725)
+  * Some older HP LaserJet printers need a delayed close when
+    printing using the libusb-based USB backend (STR #4549)
+  * The libusb-based USB backend did not unload the kernel usblp
+    module if it was preventing the backend from accessing the
+    printer (STR #4707)
+  * Current Primera printers were incorrectly reported as Fargo
+    printers (STR #4708)
+  * The IPP backend did not always handle jobs getting canceled
+    at the printer (<rdar://problem/22716820>)
+  * Added USB quirk for Canon MP530 (STR #4730)
+  * The scheduler did not deliver job notifications for jobs
+    submitted to classes (STR #4733)
+  * Changing the printer-is-shared value for a remote queue
+    did not produce an error (STR #4738)
+  * The IPP backend incorrectly included the job-password
+    attribute in Validate-Job requests (<rdar://problem/23531939>)
+
+- add -devel to build a 32bit wine on 64bit only Leap systems.
+
+- Version upgrade to 2.1.0:
+  CUPS 2.1.0 offers improved support for IPP Everywhere,
+  adds support for advanced logging using journald on Linux, and
+  includes new security features for encrypted printing and
+  reduced network visibility in the default configuration.
+  A detailed list of changes can be found in the CHANGES.txt file.
+  Changes include (excerpt):
+  * Added support for 3D printers (basic types only,
+    no built-in filters) based on PWG white paper.
+  * The IPP backend now stops sending print data
+    if the printer indicates the job has been aborted
+    or canceled (<rdar://problem/17837631>)
+  * The IPP backend now sends the job-pages-per-set
+    attribute when printing multiple copy jobs with
+    finishings (<rdar://problem/16792757>)
+  * The IPP backend now updates the cupsMandatory values when the
+    printer configuration changes (<rdar://problem/18126570>)
+  * No longer install banner files since third-party banner
+    filters now supply their own (STR #4518)
+  * The scheduler no longer listens on the loopback
+    interface unless the web interface or printer sharing
+    are enabled (<rdar://problem/9136448>)
+  * Added a PPD generator for IPP Everywhere printers (STR #4258)
+  * Now install "default" versions of more configuration
+    files (<rdar://problem/19024491>) in particular
+    cups-files.conf.default and snmp.conf.default
+  * Added SSLOptions values to allow Diffie-Hellman key exchange
+    and disable TLS/1.0 support.
+  * Updated the scheduler to support more IPP Everywhere
+    attributes (STR #4630)
+  * The scheduler now supports advanced ASL and journald logging
+    when "syslog" output is configured (STR #4474)
+  * The scheduler now supports logging to stderr when running
+    in the foreground (STR #4505)
+- Adapted patches so that they apply to CUPS 2.1.0 sources:
+  * cups-2.1.0-choose-uri-template.patch replaces
+    cups-1.2rc1-template.patch
+  * cups-2.1.0-default-webcontent-path.patch replaces
+    cups-1.4.3-default-webcontent-path.patch
+  * cups-2.1.0-cups-systemd-socket.patch replaces
+    cups-systemd-socket.patch
+
+- Fix bnc#943950, escape the macro call %systemd-tmpfiles
+  in comment.
+
+- Add gpg verification for the tarball
+- Version update to 2.0.4:
+  * Fixed a bug in cupsRasterWritePixels (STR #4650)
+  * Fixed redirection in the web interface (STR #4538)
+  * The IPP backend did not respond to side-channel
+    requests (STR #4645)
+  * The scheduler did not start all pending jobs
+    at once (STR #4646)
+  * The web search incorrectly searched time-at-xxx
+    values (STR #4652)
+  * Fixed an RPM spec file issue (STR #4657)
+  * The scheduler incorrectly started jobs while canceling
+    multiple jobs (STR #4648)
+  * Fixed processing of server overrides without
+    port numbers (STR #4675)
+  * Documentation changes (STR #4651, STR #4674)
+
+- cups-2.0.3-additional_policies.patch replaces
+  cups-1.7-additional_policies.patch that still adds the same
+  "allowallforanybody" policy but now with separated "Limit All"
+  to avoid https://www.cups.org/str.php?L4659 (boo#936309).
+- Added "-p /bin/bash" to RPM shell commands scriptlets that
+  enforces bash to be safe against any possible "bashisms", cf
+  https://en.opensuse.org/openSUSE:Packaging_scriptlet_snippets
+
+- Fix the previous commit by using direct systemd call and
+  ensuring we work even on older distros
+
+- Fix postin-without-tmpfile-creation and run %tmpfiles_create
+  macro on our cups.conf
+
+- Version upgrade to 2.0.3:
+  The new release addresses two security vulnerabilities,
+  add localizations for German and Russian, and includes several
+  general bug fixes. Changes include (excerpt):
+  * Security: Fixed CERT VU #810572 CVE-2015-1158 CVE-2015-1159
+    exploiting the dynamic linker (STR #4609) (bsc#924208)
+  * Security: The scheduler could hang with malformed gzip data
+    (STR #4602)
+  * Restored missing generic printer icon file (STR #4587)
+  * Fixed logging of configuration errors to show up as errors
+    (STR #4582)
+  * Fixed potential buffer overflows in raster code and filters
+    (STR #4598, STR #4599, STR #4600, STR #4601)
+  * Fixed <Limit> inside <Location> (STR #4575)
+  * Fixed lpadmin when both -m and -o are used (STR #4578)
+  * The web interface always showed support for 2-sided printing
+    (STR #4595)
+  * cupsRasterReadHeader did not fully validate the raster header
+    (STR #4596)
+  * The rastertopwg filter did not check for truncated input
+    (STR #4597)
+  * The cups-lpd mini-daemon did not check for request parameters
+    (STR #4603)
+  * The scheduler could get caught in a busy loop (STR #4605)
+  * The sample Epson driver could crash (STR #4616)
+  * The IPP backend now correctly monitors jobs
+    (<rdar://problem/20495955>)
+  * The ppdhtml and ppdpo utilities crashed when the -D option
+    was used before a driver information file (STR #4627)
+  * ippfind incorrectly substituted "=port" for service_port.
+  * The IPP/1.1 test file did not handle the initial print job
+    completing early (STR #4576)
+  * Fixed a memory leak in cupsConnectDest (STR #4634)
+  * PWG Raster Format output contained invalid ImageBox values
+    (<rdar://problem/21144309>)
+  * Added Russian translation (STR #4577)
+  * Added German translation (STR #4635)
+- cups-busy-loop.patch fixed STR #4605 is obsolete because
+  it is fixed upstream (see above).
+- cleaned up this whole RPM changlog (wrapped too long lines if
+  possible and removed trailing whitespaces).
+
+- Add patch cups-busy-loop.patch to fix rh#1179596 , cups#4605
+
+- Add back the posttrans cleanup script as it is needed
+
+- Add patch cups-systemd-socket.patch to fix socket activation
+  and to match socket approach Fedora has.
+
+- Version bump to 2.0.2:
+  * Security: cupsRasterReadPixels buffer overflow with invalid
+    page header and compressed raster data (STR #4551)
+  * Mapping of PPD keywords to IPP keywords did not work if the PPD
+    keyword was already an IPP keyword (<rdar://problem/19121005>)
+  * cupsGetPPD* sent bad requests (STR #4567)
+  * For detailed list see CHANGES.txt file
+
+- Enable PIE for build
+
+- Remove legacy paralel-port support as it is not really needed
+  as most do not want it
+
+- Update descriptions to just state what changed and let user
+  find it out.
+- Add back comment about %fdupes
+- Remove exit 0 on scriptlets as it is provided by
+  the %service bla ones already
+- Fix the comment about openSUSE version on tmpfilesdir declaration
+
+- cups-2.0.1 update:
+  * lengthy list of changes see the upstream CHANGES.txt that is
+    distributed with the package
+  * Disabling of sslv3 to mitigate poodle
+- Use gnutls to provide SSLOPtions configuration directive
+  * openssl is no longer supported upstream
+  * Remove the with-openssl-exception from license
+- Remove cups.sysconfig as it is not used with systemd based distros
+- Purposely lose support for SLE11 as it doubles size of some of the
+  sections and keep suppor for openSUSE+SLE12
+  * even with the conditions we would have to go unencrypted only
+    as needs newer gnutls, so don't bother with keeping the compat
+- Use upstream service and socket files to allow more working tools
+- Removed patches:
+  * cups-0001-systemd-add-systemd-socket-activation-and-unit-files.patch
+  * cups-0002-systemd-listen-only-on-localhost-for-socket-activation.patch
+  * cups-0003-systemd-secure-cups.service-unit-file.patch
+  * cups-1.3.6-access_conf.patch
+  * cups-1.5-additional_policies.patch
+  * cups-1.5.4-CVE-2012-5519.patch
+  * cups-1.5.4-strftime.patch
+  * cups-move-everything-to-run.patch
+  * cups-polld_avoid_busy_loop.patch
+  * cups-provides-cupsd-service.patch
+  * str4190.patch
+  * str4351.patch
+  * str4450.CVE-2014-3537.str4455.CVE-2014-5029.CVE-2014-5030.CVE-2014-5031.CUPS-1.5.4.patch
+- Refreshed patches:
+  * cups-1.3.9-desktop_file.patch
+  * cups-config-libs.patch
+- Added patches:
+  * cups-1.7-additional_policies.patch
+  * cups-systemd-socket.patch
+
cyrus-sasl
-- CVE-2022-24407: cyrus-sasl: SQL injection in sql_auxprop_store
-  in plugins/sql.c (bsc#1196036)
-  o add upstream patch:
-    0001-CVE-2022-24407-Escape-password-for-SQL-insert-update.patch
+- drop optional opie dependency
+
+- Do not set directories inside doc/ mode 644; otherwise the
+  directories are set 644 as well, which means no files inside are
+  accessible. This resulted in the past in doc/ actually not being
+  added to the devel package.
+
+- update to 2.1.28 (bsc#1196036, CVE-2022-24407):
+  * https://www.cyrusimap.org/sasl/sasl/release-notes/2.1/index.html#new-in-2-1-28
+- drop cyrus-sasl-bug587.patch (upstream)
+
+- cyrus-sasl: prevent fail of %pre when berkely db utils are
+  not installed (seems like we want to use this only for upgrade
+  so no Prereq added)
+- move license to licensedir
+- remove use of RPM_BUILD_ROOT
+- minimal spec cleanups
+- avoid bashisms
+- Fix build: Do not build libsasl2-3 in the bdb package. This will
+  not be linked to berkely db. libsasl2-3 is now defined as
+  %BuildRequires and %Requires
+
cyrus-sasl-bdb
-- CVE-2022-24407: cyrus-sasl: SQL injection in sql_auxprop_store
-  in plugins/sql.c (bsc#1196036)
-  o add upstream patch:
-    0001-CVE-2022-24407-Escape-password-for-SQL-insert-update.patch
+- Do not set directories inside doc/ mode 644; otherwise the
+  directories are set 644 as well, which means no files inside are
+  accessible. This resulted in the past in doc/ actually not being
+  added to the devel package.
+
+- update to 2.1.28 (bsc#1196036, CVE-2022-24407):
+  * https://www.cyrusimap.org/sasl/sasl/release-notes/2.1/index.html#new-in-2-1-28
+- drop cyrus-sasl-bug587.patch (upstream)
+
+- cyrus-sasl: prevent fail of %pre when berkely db utils are
+  not installed (seems like we want to use this only for upgrade
+  so no Prereq added)
+- move license to licensedir
+- remove use of RPM_BUILD_ROOT
+- minimal spec cleanups
+- avoid bashisms
+
+- postfix: sasl authentication with password fails (bsc#1194265)
+  Add config parameter --with-dblib=gdbm
+- Avoid converting of /etc/sasldb2 by every update. Convert
+  /etc/sasldb2 only if it is a Berkeley DB
+- CVE-2020-8032: cyrus-sasl: Local privilege escalation to root
+  due to insecure tmp file usage. (bsc#1180669)
+  Use /var/adm/update-scripts/ instead of /tmp. Clean up temporary
+  files.
+
cyrus-sasl-saslauthd
-- CVE-2022-24407: cyrus-sasl: SQL injection in sql_auxprop_store
-  in plugins/sql.c (bsc#1196036)
-  o add upstream patch:
-    0001-CVE-2022-24407-Escape-password-for-SQL-insert-update.patch
+- update to 2.1.28 (bsc#1196036, CVE-2022-24407):
+  * https://www.cyrusimap.org/sasl/sasl/release-notes/2.1/index.html#new-in-2-1-28
+- drop cyrus-sasl-bug587.patch (upstream)
+
+- cyrus-sasl: prevent fail of %pre when berkely db utils are
+  not installed (seems like we want to use this only for upgrade
+  so no Prereq added)
+- move license to licensedir
+- remove use of RPM_BUILD_ROOT
+- minimal spec cleanups
+- avoid bashisms
+
+- Avoid converting of /etc/sasldb2 by every update. Convert
+  /etc/sasldb2 only if it is a Berkeley DB
+
+- Fix build: Do not build libsasl2-3 in the bdb package. This will
+  not be linked to berkely db. libsasl2-3 is now defined as
+  %BuildRequires and %Requires
+
+- CVE-2020-8032: cyrus-sasl: Local privilege escalation to root
+  due to insecure tmp file usage. (bsc#1180669)
+  Use /var/adm/update-scripts/ instead of /tmp. Clean up temporary
+  files.
-  The pacakges cyrus-sasl and cyrus-sasl-saslauthd are build
+  The packages cyrus-sasl and cyrus-sasl-saslauthd are built
-  The pacakges cyrus-sasl-bdb and cyrus-sasl-saslauthd-bdb are build
+  The packages cyrus-sasl-bdb and cyrus-sasl-saslauthd-bdb are built
cyrus-sasl-saslauthd-bdb
-- CVE-2022-24407: cyrus-sasl: SQL injection in sql_auxprop_store
-  in plugins/sql.c (bsc#1196036)
-  o add upstream patch:
-    0001-CVE-2022-24407-Escape-password-for-SQL-insert-update.patch
+- update to 2.1.28 (bsc#1196036, CVE-2022-24407):
+  * https://www.cyrusimap.org/sasl/sasl/release-notes/2.1/index.html#new-in-2-1-28
+- drop cyrus-sasl-bug587.patch (upstream)
+
+- cyrus-sasl: prevent fail of %pre when berkely db utils are
+  not installed (seems like we want to use this only for upgrade
+  so no Prereq added)
+- move license to licensedir
+- remove use of RPM_BUILD_ROOT
+- minimal spec cleanups
+- avoid bashisms
+
+- postfix: sasl authentication with password fails (bsc#1194265)
+  Add config parameter --with-dblib=gdbm
+- Avoid converting of /etc/sasldb2 by every update. Convert
+  /etc/sasldb2 only if it is a Berkeley DB
+
+- Fix build: Do not build libsasl2-3 in the bdb package. This will
+  not be linked to berkely db. libsasl2-3 is now defined as
+  %BuildRequires and %Requires
+
+- CVE-2020-8032: cyrus-sasl: Local privilege escalation to root
+  due to insecure tmp file usage. (bsc#1180669)
+  Use /var/adm/update-scripts/ instead of /tmp. Clean up temporary
+  files.
dbus-1
+- Fix a potential crash that could be triggered by an invalid signature.
+  (CVE-2022-42010, bsc#1204111)
+  * fix-upstream-CVE-2022-42010.patch
+- Fix an out of bounds read caused by a fixed length array (CVE-2022-42011,
+  bsc#1204112)
+  * fix-upstream-CVE-2022-42011.patch
+- A message in non-native endianness with out-of-band Unix file descriptors
+  would cause a use-after-free and possible memory corruption CVE-2022-42012,
+  bsc#1204113)
+  * fix-upstream-CVE-2022-42012.patch
+- Disable asserts (bsc#1087072)
+- Refreshed patches
+  * fix-upstream-CVE-2020-35512.patch
+
+- Remove pointless %%post scriptlet leveraging non-existent systemd env
+  variables
+  FIRST_ARG has been used in our systemd macros, but this has now been gone for
+  years. Thus the true branch of the if has never been executed for years and is
+  only causing warnings when installing dbus.
+
+- Add missing patch for CVE-2020-12049
+  * fix-upstream-CVE-2020-12049_2.patch
+
+- Fix CVE-2020-12049 truncated messages lead to resource exhaustion
+  (CVE-2020-12049, bsc#1172505)
+  * fix-upstream-CVE-2020-12049.patch
+- Rebased fix-CVE-2019-12749.patch
+
+- Fix CVE-2020-35512 - shared UID's caused issues (CVE-2020-35512 bsc#1187105)
+  * fix-upstream-userdb-constpointer.patch
+  * fix-upstream-CVE-2020-35512.patch
+
+- Fix CVE-2019-12749 Authentication bypass (CVE-2019-12749 bsc#1137832)
+  * added fix-CVE-2019-12749.patch
+
+- Make libdbus-1-3 own the %{_datadir}/dbus-1/system.d directory
+
+- Use %license instead of %doc [bsc#1082318]
+
+- Avoid bashisms in scriptlets.
+
+- Avoid ugly error message from %pre(install) script when installing
+  for the first time.
+
+- Don't spit out a warning if /usr/bin/dbus-daemon does not exist
+  when we run the pre-script.
+
+- Swap a missed libdir to libexecdir
+
+- Do not hide errors during useradd.
+
+- Fix dbus-daemon-launch-helper to use proper ref to libexecdir
+
+- use %{_libexecdir}/dbus-1 as libexecdir
+
+- Update to 1.12.2
+  Deprecations:
+  • Eavesdropping is officially deprecated in favour of BecomeMonitor.
+  See the release notes for spec version 0.31 (in dbus 1.11.14).
+  • [Unix] Flag files in /var/run/console/${username} are deprecated.
+  See the release notes for 1.11.18.
+  New APIs:
+  • <allow> and <deny> rules in dbus-daemon configuration can now
+  include send_broadcast="true", send_broadcast="false",
+  max_unix_fds="N", min_unix_fds="N" (for some integer N).
+  See the release notes for 1.11.18.
+  • dbus_try_get_local_machine_id() is like
+  dbus_get_local_machine_id(), but returns a DBusError.
+  • New APIs around DBusMessageIter to simplify cleanup.
+  See the release notes for 1.11.16.
+  • The message bus daemon now implements the standard Introspectable,
+  Peer and Properties interfaces. See the release notes for
+  dbus 1.11.14 and spec version 0.31.
+  • DTDs for introspection XML and bus configuration are installed.
+  • [Unix] A new unix:dir=… address family resembles unix:tmpdir=… but
+  never uses Linux abstract sockets, which is advantageous for
+  containers. On non-Linux it is equivalent to unix:tmpdir=….
+  See the release notes for dbus 1.11.14 and spec version 0.31.
+  • [Unix] New option "dbus-launch --exit-with-x11".
+  • [Unix] Session managers can create transient .service files in
+  $XDG_RUNTIME_DIR/dbus-1/services. See the release notes for 1.11.12.
+  • [Unix] A sysusers.d snippet can create the messagebus user on-demand.
+  Miscellaneous behaviour changes:
+  • [Unix] The session bus now logs to syslog if it was started by
+  dbus-launch.
+  • [Unix] Internal warnings are logged to syslog if configured.
+  • [Unix] Exceeding an anti-DoS limit is logged to syslog if configured,
+  or to stderr.
+- Enabled "make check test suite"
+- Patches removed, fixed upstream
+  * fix-upstream-drop-install-sections-from-user-services.patch
+  * fix-upstream-increase-backlog.patch
+  * fix-upstream-timeout-reset-1.patch
+  * fix-upstream-timeout-reset-2.patch
+
+- boo#1027201 dbus-daemon not found
+- boo#978477 systemd reseting under heavy load
+  * fix-upstream-timeout-reset-1.patch
+  * fix-upstream-timeout-reset-2.patch
+
+- boo#1027200 don't generate machine-id in %post systemd will do it
+  on first boot.
+- swap usage of /bin/false to /usr/bin/false
+- Use libexecdir=%{_libdir}/dbus-1 rather then /lib/dbus-1
+
+- No need to set --libdir anymore now that prefix is /usr/bin,
+  * fixes boo#1047532
+- No need to set --bindir, bindir in dbus-1-x11 was incorrect
+- Other fixes required to properly change prefix
+- Don't pass --with-initscripts we don't use them anymore.
+
+- Update to 1.10.20
+  * Fixes:
+    + Fix a reference leak when blocking on a pending call on a
+    connection that has been disconnected (fdo#101481, Shin-ichi
+    MORITA)
+    + Don't put timestamps in the Doxygen-generated documentation,
+    for closer-to-reproducible builds (fdo#100692, Simon
+    McVittie)
+    + Avoid an assertion failure when connecting to a
+    semicolon-separated series of addresses, one of which fails
+    (fdo#101257, Simon McVittie)
+  * Documentation:
+    + Update git URIs in HACKING document to sync up with
+    cgit.freedesktop.org (fdo#100715, Simon McVittie)
+
+- swap to /usr/bin bsc#1029968
+- Add the following fixes from SLE12
+  * bsc#980928 increase listen() backlog of AF_UNIX sockets to
+    SOMAXCONN fix-upstream-increase-backlog.patch
+- The following bugs were already fixed but are missing changelog
+  entries
+  * bsc#867256 (No longer applicable)
+  * bsc#916785 (No longer applicable)
+  * bsc#1012564 (Not applicable)
+  * fdo#90004 (Fixed Upstream)
+- Rename the following patches as a tidy up
+  * dbus-log-deny.patch to feature-suse-log-deny.patch
+  * dbus-do-autolaunch.patch feature-suse-do-autolaunch.patch
+  * 0001-Add-RefuseManualStartStop.patch to
+    feature-suse-refuse-manual-start-stop.patch
+  * 0001-Drop-Install-sections-from-user-services.patch to
+    fix-upstream-drop-install-sections-from-user-services.patch
+
+- Update to 1.10.18
+  * Fixes
+    + Re-order dbus-daemon startup so that on SELinux systems, the
+    thread that reads AVC notifications retains the ability to
+    write to the audit log (fdo#92832, Debian #857660; Laurent
+    Bigonville)
+    + Fix a harmless read overflow and some memory leaks in a unit
+    test (fdo#100568, Philip Withnall)
+
+- Update to 1.10.16
+  Fixes:
+  * Prevent symlink attacks in the nonce-tcp transport on Unix that could
+  allow an attacker to overwrite a file named "nonce", in a directory
+  that the user running dbus-daemon can write, with a random value
+  known only to the user running dbus-daemon. This is unlikely to be
+  exploitable in practice, particularly since the nonce-tcp transport
+  is really only useful on Windows.
+  (fd.o #99828, Simon McVittie) (bsc#1025950)
+  * Avoid symlink attacks in the "embedded tests", which are not enabled
+  by default and should never be enabled in production builds of dbus.
+  (fd.o #99828, Simon McVittie) (bsc#1025951)
+  * Work around an undesired effect of the fix for CVE-2014-3637
+  (fd.o #80559), in which processes that frequently send fds, such as
+  logind during a flood of new PAM sessions, can get disconnected for
+  continuously having at least one fd "in flight" for too long;
+  dbus-daemon interprets that as a potential denial of service attack.
+  The workaround is to disable that check for uid 0 process such as
+  logind, with a message in the system log. The bug remains open while
+  we look for a more general solution.
+  (fd.o #95263, LP#1591411; Simon McVittie)
+  * Don't run the test test-dbus-launch-x11.sh if X11 autolaunching
+  was disabled at compile time. That test is not expected to work
+  in that configuration. (fd.o #98665, Simon McVittie)
+  Enhancements:
+  * Do the Travis-CI build in Docker containers for Ubuntu LTS, Debian
+  stable and Debian testing in addition to the older Ubuntu that is
+  the default (fd.o #98889, Simon McVittie)
+
+- A note for scripts bsc#974092 (remove sysvinit script) is already
+  fixed here.
+
+- Don't restart dbus on upgrade - Includes temporary work around
+  for last version boo#1020301
+- Add 0001-Add-RefuseManualStartStop.patch don't allow users to Manually
+  start or stop dbus.
+
+- Add systemd unit files to start session bus via systemd
+- Added patch:
+  * 0001-Drop-Install-sections-from-user-services.patch
+    + remove install section from socket unit because it does not
+    need to be enabled explicitly (see fdo#92402)
+
+- Requires systemd >= 209 and drop the compatibility pkg-config
+  names that don't exist in newer systemd
+
+- Drop useless --with-pic which is only for static libs
+- Abort installation when user/group creation fails
+- Avoid calling %service_* more than once
+
+- Build the dbus-1 package without X in the dbus-1.spec
+- Move the dbus-launch.nox11 to the dbus-1 package and install
+  it by default
+- Build devel-doc package in dbus-1.spec and don't build any
+  documentation in dbus-1-x11
+- Make dbus-1-x11 package contains only the X11-enabled dbus-launch
+- Fix some rpmlint warnings
+- Delete the dbus-1-x11.spec.in file, since maintaining it is
+  more complicated then keeping in sync a dbus-1-x11.spec file of
+  less then 120 lines
+
+- Create new subpackage: dbus-1-nox11
+  - contains dbus-launch without x11 support
+- Rename dbus-launch to dbus-launch.x11
+- use update-alternatives to switch between dbus-launch with and
+  without X11
+- Solves [bnc#934214]
+
+- Update to 1.10.12
+  * Security fixes:
+    + Do not treat ActivationFailure message received from
+    root-owned systemd name as a format string. In principle this
+    is a security vulnerability, but we do not believe it is
+    exploitable in practice, because only privileged processes can
+    own the org.freedesktop.systemd1 bus name, and systemd does
+    not appear to send activation failures that contain "%".
+    Please note that this probably *was* exploitable in dbus
+    versions older than 1.6.30, 1.8.16 and 1.9.10 due to a missing
+    check which at the time was only thought to be a denial of
+    service vulnerability (CVE-2015-0245). If you are still
+    running one of those versions, patch or upgrade immediately.
+    (fdo#98157, bsc#1003898, Simon McVittie)
+  * Other fixes:
+    + Harden dbus-daemon against malicious or incorrect
+    ActivationFailure messages by rejecting them if they do not
+    come from a privileged process, or if systemd activation is
+    not enabled (fdo#98157, Simon McVittie)
+    + Avoid undefined behaviour when setting reply serial number
+    without going via union DBusBasicValue (fdo#98035, Marc Mutz)
+    + autogen.sh: fail cleanly if autoconf fails (Simon McVittie)
+
+- Moved dbus-run-session from dbus-1-x11 to dbus-1 (bdo#836296)
+
+- Update to 1.10.10
+  * Fixes:
+    + On Linux, when dbus-daemon is run with reduced susceptibility
+    to the OOM killer (typically via systemd), do not let child
+    processes inherit that setting (fdo#32851;
+    Kimmo Hämäläinen, WaLyong Cho)
+    + Output valid shell syntax in ~/.dbus/session-bus/ if the bus
+    address contains a semicolon (fdo#94746, Thiago Macieira)
+    + Fix memory leaks and thread safety in subprocess starting on
+    Windows (fdo#95191, Ralf Habacker)
+    + Do not require systemd to have a service file if using it for
+    activation (fdo#93194; Simon McVittie; backport from 1.11.0)
+    + Stop test-dbus-daemon incorrectly failing on platforms that
+    cannot discover the process ID of clients (fdo#96653,
+    Руслан Ижбулатов)
+    + In tests that exercise correct handling of crashing D-Bus
+    services, suppress Windows crash handler (fdo#95155;
+    Yiyang Fei, Ralf Habacker)
+    + Explicitly check for stdint.h (Ioan-Adrian Ratiu)
+    + update-activation-environment: produce better diagnostics on
+    error (fdo#96653, Simon McVittie)
+    + Don't fail the build with an unused const variable warning
+    under gcc 6 (fdo#97282; Thomas Zimmermann, Simon McVittie)
+    + Merge dbus-1.10-ci branch, containing backports from 1.11.0
+    in build/test code to support continuous integration
+    (fdo#93194, Simon McVittie)
+  - Avoid -Wunused-label when compiling with libselinux but no
+    libaudit
+  - In development builds, allow OOM tests to be disabled as
+    documented
+  - Accept and ignore the --tap argument in all "embedded
+    tests", and run all automated tests with that argument for
+    better diagnostics
+  - Fix the systemd activation test under CMake by installing
+    the required files
+  - In Automake, fix shell syntax for installcheck-local with
+    no DESTDIR
+  - In Automake, don't try to run manual tests in installcheck
+  - In CMake, don't run manual-tcp test as an automated test
+  - Add travis-ci.org build machinery
+
+- Update to 1.10.8
+  * Fixes:
+    + Enable "large file support" on systems where it exists:
+    dbus-daemon is not expected to open large files, but it might
+    need to stat files that happen to have large inode numbers
+    (fdo#93545, Hongxu Jia)
+    + Eliminate padding inside DBusMessageIter on 64-bit platforms,
+    which might result in a pedantic C compiler not copying the
+    entire contents of a DBusMessageIter; statically assert that
+    this is not an ABI change in practice (fdo#94136, Simon
+    McVittie)
+    + Document dbus-test-tool echo --sleep-ms=N instead of
+    incorrect --sleep=N (fdo#94244, Dmitri Iouchtchenko)
+    + Correctly report test failures in C tests from run-test.sh
+    (fdo#93379; amit tewari, Simon McVittie)
+    + When tests are enabled, run all the marshal-validate tests,
+    not just the even-numbered ones (fdo#93908, Nick Lewycky)
+    + Correct the expected error from one marshal-validate test,
+    which was previously not run due to the above bug(fdo#93908,
+    Simon McVittie)
+
+- Update to 1.10.6
+  * Fixes:
+  - On Unix when running tests as root, don't assert that root
+    and the dbus-daemon user can still call
+    UpdateActivationEnvironment; assert that those privileged
+    users can call BecomeMonitor instead (fdo#93036, Simon
+    McVittie)
+  - On Windows, fix a memory leak in the autolaunch transport
+    (fdo#92899, Simon McVittie)
+  - On Windows Autotools builds, don't run tests that rely on
+    dbus-run-session and other Unix-specifics (fdo#92899, Simon
+    McVittie)
+
+- Update to 1.10.4
+  * Changes between 1.10.2 and 1.10.4
+  - Enhancements:
+    + GetConnectionCredentials, GetConnectionUnixUser and
+    GetConnectionUnixProcessID with argument
+    "org.freedesktop.DBus" will now return details of the
+    dbus-daemon itself. This is required to be able to call
+    SetEnvironment on systemd. (fdo#92857, Jan Alexander
+    Steffens)
+  - Fixes:
+    + Make UpdateActivationEnvironment always fail with
+    AccessDenied  on the system bus. Previously, it was
+    possible to configure it so root could call it, but the
+    environment variables were not actually used, because the
+    launch helper would discard them. (fdo#92857, Jan Alexander
+    Steffens)
+    + On Unix with --systemd-activation on a user bus, make
+    UpdateActivationEnvironment pass on its arguments to
+    systemd's SetEnvironment method, solving inconsistency
+    between the environments used for traditional activation
+    and systemd user-service activation. (fdo#92857, Jan
+    Alexander Steffens)
+    + On Windows, don't crash if <syslog/> or --syslog is used
+    (fdo#92538, Ralf Habacker)
+    + On Windows, fix a memory leak when setting a DBusError from
+    a Windows error (fdo#92721, Ralf Habacker)
+    + On Windows, don't go into infinite recursion if we abort the
+    process with backtraces enabled (fdo#92721, Ralf Habacker)
+    + Fix various failing tests, variously on Windows and
+    cross-platform:
+    . don't test system.conf features (users, groups) that only
+    make sense on the system bus, which is not supported on
+    Windows
+    . don't call _dbus_warn() when we skip a test, since it is
+    fatal
+    . fix computation of expected <standard_session_servicedirs/>
+    . when running TAP tests, translate newlines to Unix format,
+    fixing cross-compiled tests under Wine on Linux
+    . don't stress-test refcounting under Wine, where it's
+    really slow
+    . stop assuming that a message looped-back to the test will
+    be received immediately
+    . skip some system bus tests on Windows since they make no
+    sense there (fdo#92538, fdo#92721; Ralf Habacker, Simon
+    McVittie)
+  * Changes between 1.10.0 and 1.10.2
+  - Fixes:
+    + Correct error handling for activation: if there are multiple
+    attempts to activate the same service and it fails
+    immediately, the first attempt would get the correct reply,
+    but the rest would time out. We now send the same error
+    reply to each attempt. (fdo#92200, Simon McVittie)
+    + If BecomeMonitor is called with a syntactically invalid
+    match rule, don't crash with an assertion failure, fixing a
+    regression in 1.9.10. This was not exploitable as a denial
+    of service, because the check for a privileged user is done
+    first. (fdo#92298, Simon McVittie)
+    + On Linux with --enable-user-session, add the bus address to
+    the environment of systemd services for better backwards
+    compatibility (fdo#92612, Jan Alexander Steffens)
+    + On Windows, fix the logic for replacing the installation
+    prefix in service files' Exec lines (fdo#83539; Milan Crha,
+    Simon McVittie)
+    + On Windows, if installed in the conventional layout with
+    ${prefix}/etc and ${prefix}/share, use relative paths
+    between bus configuration files to allow the tree to be
+    relocated (fdo#92028, Simon McVittie)
+    + Make more of the regression tests pass in Windows builds
+    (fdo#92538, Simon McVittie)
+  * Summary of major changes since 1.8.0:
+  - The basic setup for the well-known system and session buses is
+    now done in read-only files in ${datadir} (normally /usr/share).
+  - AppArmor integration has been merged, with features similar to
+    the pre-existing SELinux integration. It is mostly compatible
+    with the patches previously shipped by Ubuntu, with one
+    significant change: Ubuntu's GetConnectionAppArmorSecurityContext
+    method has been superseded by GetConnectionCredentials and was
+    not included.
+  - The --enable-user-session configure option can be enabled
+    by OS integrators intending to use systemd to provide a
+    session bus per user (in effect, treating all concurrent
+    graphical and non-graphical login sessions as one large session).
+  - The new listenable address mode "unix:runtime=yes" listens on
+    $XDG_RUNTIME_DIR/bus, the same AF_UNIX socket used by the
+    systemd user session. libdbus and "dbus-launch --autolaunch"
+    will connect to this address by default. GLib >= 2.45.3 and
+    sd-bus >= 209 have a matching default.
+  - All executables are now dynamically linked to libdbus-1.
+    Previously, some executables, most notably dbus-daemon, were
+    statically linked to a specially-compiled variant of libdbus.
+    This results in various private functions in the _dbus
+    namespace being exposed by the shared library. These are not
+    API, and must not be used outside the dbus source tree.
+  - On platforms with ELF symbol versioning, all public symbols
+    are versioned LIBDBUS_1_3.
+  * New bus APIs:
+  - org.freedesktop.DBus.GetConnectionCredentials returns
+    LinuxSecurityLabel where supported
+  - org.freedesktop.DBus.Monitoring interface (privileged)
+    . BecomeMonitor method supersedes match rules with eavesdrop=true,
+    which are now deprecated
+  - org.freedesktop.DBus.Stats interface (semi-privileged)
+    . now enabled by default
+    . new GetAllMatchRules method
+  - org.freedesktop.DBus.Verbose interface (not normally compiled)
+    . toggles the effect of DBUS_VERBOSE
+  * New executables:
+  - dbus-test-tool
+  - dbus-update-activation-environment
+  * New optional dependencies:
+  - The systemd: pseudo-transport requires libsystemd or libsd-daemon
+  - Complete documentation requires Ducktype and yelp-tools
+  - Full test coverage requires GLib 2.36 and PyGI
+  - AppArmor integration requires libapparmor and optionally libaudit
+  * Dependencies removed:
+  - dbus-glib
+
+- Update to 1.8.20:
+  * Fixes:
+  - Fix a memory leak when GetConnectionCredentials() succeeds
+    (fdo#91008, Jacek Bukarewicz)
+  - Ensure that dbus-monitor does not reply to messages intended
+    for others (fdo#90952, Simon McVittie)
+
+- Account for openSUSE:Leap in the conditional for chosing right
+  local state directories (boo#941352)
+
+- Move common-begin sections around to make pre_checkin work again
+- Unconditionally build with systemd features, there are no cycles
+  now, systemd no longer buildrequires dbus-1-devel
+
+- Update to 1.8.18:
+  * Security hardening:
+  - On Unix platforms, change the default configuration for the
+    session bus to only allow EXTERNAL authentication (secure
+    kernel-mediated credentials-passing), as was already done for
+    the system bus.
+    This avoids falling back to DBUS_COOKIE_SHA1, which relies on
+    strongly unpredictable pseudo-random numbers; under certain
+    circumstances (/dev/urandom unreadable or malloc() returns
+    NULL), dbus could fall back to using rand(), which does not
+    have the desired unpredictability. The fallback to rand() has
+    not been changed in this stable-branch since the necessary
+    code changes for correct error-handling are rather intrusive.
+    If you are using D-Bus over the (unencrypted!) tcp: or
+    nonce-tcp: transport, in conjunction with DBUS_COOKIE_SHA1
+    and a shared home directory using NFS or similar, you will
+    need to reconfigure the session bus to accept DBUS_COOKIE_SHA1
+    by commenting out the <auth> element. This configuration is
+    not recommended. (bsc#931066, fdo#90414, Simon McVittie)
+  * Other fixes:
+  - Add locking to DBusCounter's reference count and notify
+    function (fdo#89297, Adrian Szyndela)
+  - Ensure that DBusTransport's reference count is protected by
+    the corresponding DBusConnection's lock (fdo#90312,
+    Adrian Szyndela)
+  - On Windows, listen on the same port for IPv4 and IPv6
+    (previously broken by an endianness mistake), and fix a
+    failure to bind TCP sockets on approximately 1 attempt in 256
+    (fdo#87999, Ralf Habacker)
+  - Correctly release DBusServer mutex before early-return if we
+    run out of memory while copying authentication mechanisms
+    (fdo#90021, Ralf Habacker)
+  - Correctly initialize all fields of DBusTypeReader (fdo#90021,
+    Ralf Habacker, Simon McVittie)
+  - Fix some missing \n in verbose (debug log) messages
+    (fdo#90021, Ralf Habacker)
+  - Clean up some memory leaks in test code (fdo#90021,
+    Ralf Habacker)
+
+- Sync changes from SLE12 conditionalized for suse_version <= 1315
+
+- Update to 1.8.16:
+  * Security fixes:
+  - Do not allow non-uid-0 processes to send forged
+    ActivationFailure messages. On Linux systems with systemd
+    activation, this would allow a local denial of service:
+    unprivileged processes could flood the bus with these forged
+    messages, winning the race with the actual service activation
+    and causing an error reply to be sent back when service
+    auto-activation was requested. This does not prevent the real
+    service from being started, so it only works while the real
+    service is not running. (CVE-2015-0245, fdo#88811, bnc#916343;
+    Simon McVittie)
+  * Other fixes:
+  - fix a Windows build failure (fdo#88009, Ralf Habacker)
+  - on Windows, allow up to 8K connections to the dbus-daemon
+    instead of the previous 64, completing a previous fix which
+    only worked under Autotools (fdo#71297, Ralf Habacker)
+
+- Update to 1.8.14
+  * Security hardening:
+  - Do not allow calls to UpdateActivationEnvironment from uids
+    other than the uid of the dbus-daemon. If a system service
+    installs unsafe security policy rules that allow arbitrary
+    method calls (such as CVE-2014-8148) then this prevents
+    memory consumption and possible privilege escalation via
+    UpdateActivationEnvironment.
+    We believe that in practice, privilege escalation here is
+    avoided by dbus-daemon-launch-helper sanitizing its
+    environment; but it seems better to be safe.
+  - Do not allow calls to UpdateActivationEnvironment or the
+    Stats interface on object paths other than
+    /org/freedesktop/DBus. Some system services install unsafe
+    security policy rules that allow arbitrary method calls to
+    any destination, method and interface with a specified object
+    path; while less bad than allowing arbitrary method calls,
+    these security policies are still harmful, since dbus-daemon
+    normally offers the same API on all object paths and other
+    system services might behave similarly.
+  * Other fixes:
+  - Add missing initialization so GetExtendedTcpTable doesn't
+    crash on Windows Vista SP0 (fdo#77008, Ilya A. Tkachenko)
+
+- Update to 1.8.12:
+  * Fixes:
+  - Partially revert the CVE-2014-3639 patch by increasing the
+    default authentication timeout on the system bus from 5
+    seconds back to 30 seconds, since this has been reported to
+    cause boot regressions for some users, mostly with parallel
+    boot (systemd) on slower hardware.
+    On fast systems where local users are considered particularly
+    hostile, administrators can return to the 5 second timeout
+    (or any other value in milliseconds) by saving this as
+    /etc/dbus-1/system-local.conf:
+    <busconfig>
+    <limit name="auth_timeout">5000</limit>
+    </busconfig>
+    (fdo#86431, Simon McVittie)
+  - Add a message in syslog/the Journal when the auth_timeout is
+    exceeded (fdo#86431, Simon McVittie)
+  - Send back an AccessDenied error if the addressed recipient is
+    not allowed to receive a message (and in builds with
+    assertions enabled, don't assert under the same conditions).
+    (fdo#86194, Jacek Bukarewicz)
+
+- Update to 1.8.10:
+  * Security fixes:
+  - Increase dbus-daemon's RLIMIT_NOFILE rlimit to 65536
+    so that CVE-2014-3636 part A cannot exhaust the system bus'
+    file descriptors, completing the incomplete fix in 1.8.8.
+    (CVE-2014-7824, fdo#85105; Simon McVittie, Alban Crequy)
+
decentxml
+- Build with java source and target levels 8
+
deepin-branding-openSUSE
+- Update com.deepin.dde.dock.gschema.xml and com.deepin.xsettings.gschema.xml
+
+- Update com.deepin.dde.dock.gschema.xml
+
deepin-compressor
+- update to 5.12.13:
+  * fix missing changelog
+
ding-libs
+- Update to 0.6.1 from 0.6.0 (jsc#ECO-248):
+  * libini now supports validators that check for well-formed INI
+    files.
+- Update URL
+  * Remove the git link info as it 404 atm
+- Add patches from upstream to fix ini behaviour:
+  * INI-Fix-detection-of-error-messages.patch
+  * INI-Silence-ini_augment-match-failures.patch
+  * TEST-validators_ut_check-Fix-fail-with-new-glibc.patch
+- Add patch fixing errors writeout to stdout:
+  * INI-Remove-definiton-of-TRACE_LEVEL.patch
+
+- Update to new upstream release 0.6.0
+  * libini now supports validators that check for well-formed INI
+  files.
+
+- Introduce patch 0001-increase-ini-max-value-length.patch
+  to support longer values in INI file parser. bsc#989488
+
+- Bump subpackage version numbers to match .pc files
+
+- Correct the version number of library packages in spec file.
+
+- Upgrade to latest upstream version 0.5.0.
+  The new version is ABI compatible with 0.4.0.
+  * libini_config: This release adds an API to create, modify and
+  save INI files
+  * libini_config: Merging configuration snippets installed in
+  different locations is supported
+  * libcollection: New functions: col_get_dup_item,
+  col_delete_item_with_cb, col_remove_item_with_cb
+
+- Update to new upstream release 0.4.0
+  * libini_config: Ability to convert input INI file from UTF-16/32
+  to UTF8- during parsing
+  * ini_config: Support C style comments in INI file
+  * ini_config: Ability to read configuration data from a memory buffer
+- Remove doxygen-notimestamp.diff,
+  0001-build-add-missing-Requires-to-pkgconfig-file.patch
+  (merged upstream)
+
+- remove pkgconfig-deps.diff since it's obsoleted by
+  0001-build-add-missing-Requires-to-pkgconfig-file.patch
+
+- Update to new upstream release 0.3.0.1
+  * A new libini_config interface (merging config section,
+  better handling of metadata)
+- Optional signature verification
+- Add 0001-build-add-missing-Requires-to-pkgconfig-file.patch
+  for corrected pkgconfig dependencies
+
+- Update to new upstream release 0.1.3
+  * Fixes a serious bug in libdhash with very large (>1024 slots)
+  initial size
+
discover
+- Add patch to fix some pages not loading (kde#466765):
+  * 0001-pk-Don-t-forget-to-finish-streams.patch
+
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- Changes since 5.27.1:
+  * Don't claim 3rd-party repos are part of the OS on Debian derivatives
+  * Flatpak: correctly check for the appstream-qt version
+  * ApplicationPage: Improve narrow layout with lots of buttons
+  * pk: Properly check for AppStream versions
+  * fwupd: do fwupd_client_connect before setting user agent
+  * Fix rendering Missing Backends
+  * pk: Fix searching by state
+  * screenshots: Only use AnimatedImage if we think there's a chance
+  * Always show distro name for PackageKit apps (kde#465204)
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- Changes since 5.27.0:
+  * [notifier] Fix KAboutData component name
+  * Fix parsing of the <Categories> tag.
+  * Extend CategoriesTest with checking of <Categories> tag parsing.
+  * flatpak: fix build with appstream<0.16
+  * flatpak: Allow using newer appstream API to look up by bundle id
+
+- Discover 5.27 can be built again on archs missing QtWebEngine
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- Changes since 5.26.90:
+  * Workaround visibly empty changelog
+  * PackageKit: PackageState takes the packageName not the appstreamId (kde#464357)
+  * ui: Fix plural calculation of app list page heading (kde#464882)
+  * flatpak: Use the recommended URL for flathub's flatpakrepo
+  * flatpak: Make sure we are reading the correct metadata (kde#464128)
+  * flatpak: Don't filter twice the componentsByFlatpakId result for its bundle id
+  * flatpak: Make test run a bit faster
+  * flatpak: Address install package look-up
+  * flatpak: Properly read .flatpakrepo names
+  * flatpak: Fix test on the CI
+  * Specify the domain in libdiscover's QML i18n calls
+  * DiscoverObject: Also show C++ errors in the messages sheet
+  * flatpak: Fix loading flatpakref files (kde#464206)
+  * Add network timeouts by default
+  * ReviewsPage: Fix clipping under scroll bar
+- Refresh 0001-Warning-for-FlatHub.patch
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Too many changes to list here
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- Changes since 5.26.4:
+  * libdiscover: fix permission text not being translated
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- Changes since 5.26.3:
+  * Prefer openining the installed version of an app (kde#461664)
+  * packagekit: check free space when update size changes
+  * pk: Only issue a resolve if something changed (kde#461813)
+  * ProgressView: disable highlight effect for real (kde#461812)
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- Changes since 5.26.2:
+  * Remove top margin caused by empty header on UpdatesPage
+  * Notifier: Fix notification logic
+  * pk/?: Fix problem when using faulty URL
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- Changes since 5.26.1:
+  * flatpak: make sure we look up the correct resource (kde#460365)
+  * flatpak: Only show the beta information for apps (kde#459131)
+  * flatpak: Properly render if the beta package is too old
+  * snap: Port away from Kirigami.ItemViewHeader (kde#460391)
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- Changes since 5.26.0:
+  * Reviews: Don't check for name field being empty when it's not visible (kde#460504)
+  * Fix i18n warning
+  * flatpak: Address transaction progress skipping (kde#404819,kde#434948,kde#435450,kde#448280)
+  * Delay subCategoriesChanged signals when disabling (kde#401666,kde#457408)
+  * flatpak: Improve flatpaktest reliability
+  * flatpak: Just disable the test on the CI
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * Install po folder
+  * Provide the alternatives to an appstream id together with the URL (kde#441299)
+  * ApplicationPage: Make more room for metadata with smaller spacing (kde#459574)
+  * Fix warning
+  * Set QSurfaceFormat::ResetNotification
+  * reviews: Fix warning on constant property
+  * Support systems without a Qt WebView
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Too many changes to list here
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- Changes since 5.25.4:
+  * Fix Flatpak Permissions
+  * When drawer is a drawer, close it when clicking leaf items in it (kde#457539)
+  * Request inhibiting sleep while transactions are on (kde#401304)
+  * snap: Properly communicate a snap's licence
+  * Be faster when all KNS categories fail at once (i.e. when you are offline) (kde#454442)
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- Changes since 5.25.3:
+  * Fix crash after update (kde#457278)
+  * Do not change the sorting among resources in the default backend (kde#451667)
+  * Sources: Give a minimum size to section headers (kde#434349)
+  * fwupd: Make sure we don't crash trying to print an error (kde#455132)
+  * kns: Make KNSReview aware of its possible lack of AtticaProvider (kde#457145)
+  * AppListPage: Make sure the PlaceholderMessage doesn't get in the way (kde#457029)
+  * appstream: Do not treat spdx operators as licenses
+  * appstream: Treat unknown licences
+  * kns: join into the AppStreamUtils::license party
+  * pk: Try harder to convert non-appstream packages licences (kde#454480)
+  * pk: Allow some error codes from offline updates (kde#443090)
+  * snap: Do not install a categories file (kde#456889)
+  * Do not warn anymore about missing categories
+  * odrs: Make sure we don't fail when the application page is opened early (kde#426270)
+  * Fix submitting usefulness
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- Changes since 5.25.2:
+  * ApplicationResourceButton: switch to individual ToolTip instances (kde#456129)
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- Changes since 5.25.1:
+  * flatpak: Use flatpak remote prio property to prioritise remotes
+  * updates: Move the extended delegate state into the model (kde#452129)
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- Changes since 5.25.0:
+  * Properly center align the compact application delegate
+  * Drop no longer necessary KF5ItemModels dependency
+  * Drop no longer necessary Qt5X11Extras/Qt6GuiPrivate dependency
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * PackageKit backend: fix searching for appstream id's without .desktop suffix
+  * Clean up Kirigami.Heading code a bit
+  * ApplicationPage: standardize on whitespace between sections
+  * flatpak notifier: Be more precise about when notifying about updates
+  * flatpak notifier: Do not set up twice the system installation
+  * notifier: Pass a token when we are starting from a notification
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Too many changes to list here
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- Changes since 5.24.4:
+  * flatpak: Fix state change emits (kde#451111)
+  * flatpak: Improve stability of different sources integration
+  * flatpak: Centralise remote integration in FlatpakBackend (kde#443745)
+  * pk: Consider multiple package ids for one upgradeable resource (kde#444600)
+  * Don't use the appdata version in the installed version string if empty
+  * libdiscover: Fix Discover doesn't show license or description of local package (kde#452150)
+- Refresh patch and drop part of the message which might sound a
+  bit too harsh and is mostly redundant anyway:
+  * 0001-Warning-for-FlatHub.patch
+
docker
+- update to 20.10.23-ce.
+  * see upstream changelog at https://docs.docker.com/engine/release-notes/#201023
+- drop kubic flavor as kubic is EOL. this removes:
+  kubelet.env docker-kubic-service.conf 0003-PRIVATE-REGISTRY-add-private-registry-mirror-support.patch
+
+- Update to Docker 20.10.21-ce. See upstream changelog online at
+  <https://docs.docker.com/engine/release-notes/#201021>. bsc#1206065
+  bsc#1205375 CVE-2022-36109
+- Rebase patches:
+  * 0001-SECRETS-daemon-allow-directory-creation-in-run-secre.patch
+  * 0002-SECRETS-SUSE-implement-SUSE-container-secrets.patch
+  * 0003-PRIVATE-REGISTRY-add-private-registry-mirror-support.patch
+  * 0004-bsc1073877-apparmor-clobber-docker-default-profile-o.patch
+  * 0005-bsc1183855-btrfs-Do-not-disable-quota-on-cleanup.patch
+  * 0006-bsc1193930-vendor-update-golang.org-x-crypto.patch
+  * 0007-bsc1200022-fifo.Close-prevent-possible-panic-if-fifo.patch
+- The PRIVATE-REGISTRY patch will now output a warning if it is being used (in
+  preparation for removing the feature). This feature was never meant to be
+  used by users directly (and is only available in the -kubic/CaaSP version of
+  the package anyway) and thus should not affect any users.
+
+- Fix wrong After: in docker.service, fixes bsc#1188447
+
+- Add apparmor-parser as a Recommends to make sure that most users will end up
+  with it installed even if they are primarily running SELinux.
+
+- Fix syntax of boolean dependency
+
+- Allow to install container-selinux instead of apparmor-parser.
+
+- Change to using systemd-sysusers
+
dolphin
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * KItemListHeaderWidget: don't crash if widget == nullptr (kde#449238)
+  * Display Apply button in KCMs (kde#448352)
+  * [CompactView] Remove animation on file rename (kde#449179)
+  * KStandardItemListWidget: handle RtL drawing properly (kde#449211)
+  * Fix zooming animation (kde#449179)
+  * Expose konsolepart shortcuts in Dolphin's shortcuts view (kde#428265)
+  * Full row highlight implementation (kde#181438)
+  * Properly display parent folders when filtering is active and items
+    are added or refreshed (kde#442275)
+  * Move "Default" option to the front in "Select Remote Charset" menu (kde#445148)
+
dolphin-plugins
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Use parent widget for better positioning in Wayland
+  * Remove unneeded QOverload for QProcess::finished signal
+  * Build without KF and Qt deprecations
+  * Bump KF5 min version & define KDE_COMPILERSETTINGS_LEVEL
+  * Use lower-case UDID
+  * [Mount ISO Action] Allow mounting generic disk images
+  * Add GitLab CI
+  * Remove arcconfig file
+  * Fix clazy-non-pod-global-static warning
+  * Add missing this receiver
+  * Fix clazy range-loop-detach warning
+
dom4j
+- Build against the standalone JavaEE modules unconditionally
+
+- Add alias to the new artifact coordinates org.dom4j:dom4j
+- Simplify the spec file a bit
+
+- Add jaxb-api dependency for relevant distribution versions so that
+  we can build with JDKs that do not include the JavaEE modules
+
-- Do not depend on ant-trax and run spec-cleaner.
-
-- Move from jpackage-utils to javapackage-tools
-
double-conversion
+- Use proper cmake calls
+- Do not pull in py2 that is EOL but use python3 for build
+
+- Update to version 3.1.5 jsc#ECO-1190, jsc#SLE-11474
+  * Fix `0x` for string->double conversion when Hex Floats are allowed.
+    Avoid integer overflow when exponents for hex floats were too big.
+    Update version number.
+  * Fixed warning in gcc4.9.
+  * Merged changes to install libraries in the correct place when
+    using 64-bit libraries.
+  * Use relative includes in the library. This shouldn't have any visible effect
+    for consumers of the library.
+  * Fix typo in test.
+  * Fix separator characters when they they don't fit into 8 bits.
+  * Check correctly for _MSC_VER.
+  * Allow the library to be compiled for Emscripten.
+
+- Update to version 3.0.3
+  * Support RISC-V
+  * Bug fixes
+- Switch to cmake
+- Use %license
+
+- Fix RPM groups.
+  Slightly trim/compact descriptions.
+
+- Add baselibs.conf: Build 32-bit support (boo#1002561).
+
+- Update project and download urls
+- Cleanup spec file with spec-cleaner
+
+- Initial package, version 2.0.1
+
dracula-gtk-theme
+- Update to version 3.0+git94.9840b6b:
+  * Gnome 43: Improve popovers appearance
+  * Gnome 43: Fix treeviews header appearance
+  * Gnome 43: Improve nautilus pathbar appearance
+  * Gnome 43: Fix spacing in nautilus list rows
+  * Xfce v4.18: Fix odd transparency in panel items
+  * Gnome-shell v43: Improve sliders appearance
+  * Xfce v4.18: Fix invisible items in thunar sidebar
+  * Gnome 43: Fix background color of tab bar and action bar
+  * Gnome-shell v43: Quick-settings - Improve toggle buttons appearance
+  * Gnome-shell: Fix page navigation arrow appearance
+
+- Update to version 3.0+git88.b64d36a:
+  * Xfce v4.18: Fix invisible items in thunar sidebar
+  * Gnome 43: Fix background color of tab bar and action bar
+  * Gnome-shell v43: Quick-settings - Improve toggle buttons appearance
+  * Gnome-shell: Fix page navigation arrow appearance
+  * Gnome 43: Fix nautilus sidebar appearance
+  * Gnome 43: Fix nautilus pathbar appearance
+  * Gnome-shell v43: Add styles for quick settings menu
+  * Gnome 42: Fix nautilus path bar buttons appearance in hover state
+  * KDE: Plasma-solid - Update tasks indicator appearance
+  * Gnome 42: Fix nautilus path bar buttons appearance
+  * Xfce: Thunar - Reduce padding in sidebar items to prevent scrolling
+  * KDE: Plasma - Update tasks indicator appearance
+  * Cinnamon: Nemo -  Improve appearance of highlighted items in sidebar
+  * Gnome-shell: Fix app folders dialog appearance in Zorin OS
+  * KDE: Kvantum - Update sliders color
+  * Gnome-shell: Fix visual issues in Zorin OS
+- Define explicit Provides/Obsoletes for the various subpackages
+
+- Split dracula-gtk-theme into flavours subpackages:
+  * metatheme-dracula-common
+  * kde-theme-dracula
+  * gtk2-metatheme-dracula
+  * gtk3-metatheme-dracula
+  * gtk4-metatheme-dracula
+  * gnome-shell-theme-dracula
+  * cinnamon-theme-dracula
+  * metacity-theme-dracula
+  * xfwm4-theme-dracula
+
+- Update to version 3.0+git72.2452278:
+  * Cinnamon: Fix workspace switcher (as buttons) appearance
+  * Cinnamon: Fix cutted text in search bar
+  * Elementary OS: Fix missing highlight color in task switcher
+  * feature request added
+  * bug report added
+  * Gnome-shell v42: Improve notifications appearance on hover state
+  * Gnome-shell v42: Remove odd shadow in calendar area
+  * KDE: Sddm - Improve focused text entries appearance
+  * Update min_prelight
+  * Restore shell theme
+  * Gnome: Improve window control buttons visibility
+  * Gnome-shell v42: Improve prompt dialog appearance
+  * Gnome-shell v42: Fix media control buttons appearance
+  * Gnome: Fix flickering above Chrome URL bar, Fix #201. Fix #195
+  * KDE: Sddm - Improve general appearance
+  * Xfce: Fix thunar appearance
+  * Cinnamon: Fix grouped window list visibility issue
+  * KDE: Sddm - Fix missing spacing around text entries
+  * Gnome-shell v42: Improve notifications appearance
+  * Gnome-shell v42: Fix some visual issues
+  * KDE: Sddm - Improve input appearance
+  * Fix background hovering effect on Dash to Dock
+  * Gnome-shell v42: Improve calendar area appearance
+  * Gnome-shell:  Add specific styles for dash-to-dock
+  * Gnome-shell v42: Fix wasted space in calendar area
+  * Gnome-shell v42: Fix styling issues in popups
+  * KDE: Sddm - Fix shrink buttons/entries
+  * Gnome-shell: Improve popups appearance
+  * KDE: SDDM - Improve button appearance
+  * Gnome-shell-v42: Fix issue with app folders
+  * Gnome-shell-v42: Remove odd border in message list
+  * Gnome-shell-v42: Fix issue with calendar
+  * Gnome-shell-v42: Fix issue with popovers
+  * Gnome-shell: Fix issue with page indicator
+  * Gnome-shell: Update text entries appearance
+  * KDE: Sddm - Fix small font size
+  * Gnome: Fix appearance of linked buttons in headerbar
+
dracut
+- Update to version 055+suse.353.g5603b001:
+  A series of changes for the NVMeoF boot with IPv6 (bsc#1209166):
+  * fix(nvmf): move connect logic to initqueue script
+  * fix(nvmf): don't assume prefix lenth 64 by default
+  * fix(nvmf): prefix syntax for static iBFT IPv6 addresses
+  * fix(network): IPv6: don't wait for RA for static IPv6 assignments
+  * fix(network-legacy): always include af_packet
+  * fix(network): don't assume prefix lenth 64 by default
+  * fix(iscsi): prefix syntax for static iBFT IPv6 addresses
+
dracut-saltboot
+- Update to verion 0.1.1674034019.a93ff61
+  * Install copied wicked config as client.xml (bsc#1205599)
+
dragonplayer
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
drkonqi5
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- Changes since 5.27.1:
+  * Add plasma-welcome to mappings file
+  * scroll bug description (kde#466180)
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- Changes since 5.27.0:
+  * Make python distro and psutil modules in the gdb preable optional
+  * Handle WITH_SENTRY correctly
+  * login on field accepting (kde#466109)
+- Drop patches, now upstream:
+  * 0001-Handle-WITH_SENTRY-correctly.patch
+  * 0002-Make-python-distro-and-psutil-modules-in-the-gdb-pre.patch
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Add patch to actually disable sentry:
+  * 0001-Handle-WITH_SENTRY-correctly.patch
+- Add patch to avoid unnecessary dependencies of the gdb script:
+  * 0002-Make-python-distro-and-psutil-modules-in-the-gdb-pre.patch
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * pass the bug id not the attachment id to the gui (kde#462432)
+  * remove pointless todo
+  * check telemetrymode
+  * Use qdbus to query for the hostname
+  * allow using debuginfod for symbol resolution with gdb12 (kde#454063)
+  * add some a11y annotations
+  * do not submit to sentry when the bugzilla url is overridden
+  * Install po folder
+  * Port away from deprecated KDeclarative::setupEngine
+- Avoid try-restarting a template unit in %postun
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- Changes since 5.26.1:
+  * check telemetrymode
+  * Use qdbus to query for the hostname
+  * allow using debuginfod for symbol resolution with gdb12 (kde#454063)
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * Install po folder
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * kdbgwin: add missing override specifier
+  * Fix desktopFileName for coredump GUI
+  * handle debugpackageinstaller signals (kde#458435)
+  * Add mapping for akonadi_indexing_agent
+  * Add FreeBSD Qt6 CI support
+  * Add mapping for Akonadi Google Resource
+  * Remove duplicate headers between cpp/h
+  * Add missing license files
+  * typo-- (kde#457036)
+  * KMessageBox::sorry is deprecated in kf5.97
+  * do not send auto-submissions if files were deleted
+  * sub is part of re not a member of string
+  * fixate the home dir
+  * fix bad property access
+  * allow saving the report in case of error (kde#456768)
+  * disable automatic sentry'ing when run in testing mode
+  * set default focuses (kde#456753)
+  * ensure we catch kwin_wayland dumps
+  * ignore KeyboardInterrupts
+  * Request passing unit tests on Linux and BSD
+  * add sentry support
+  * Fix variant comparison with Qt6
+  * It's enabled by default in qt6
+  * Drop bogus KConfigWidgets dep, add explicit KConfig dep
+  * remove wrong visibility toggle (kde#454927)
+  * coredump-gui: Show the app's icon name by the delegate
+  * allow navigating back to the mainpage (kde#453989)
+  * DeveloperPage: do not automatically hide Save and Copy actions
+  * DeveloperPage: Remove extra padding on the backtrace
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- Changes since 5.25.0:
+  * Drop bogus KConfigWidgets dep, add explicit KConfig dep
+
+- Add missing runtime dependencies
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * remove wrong visibility toggle (kde#454927)
+  * allow navigating back to the mainpage (kde#453989)
+  * DeveloperPage: do not automatically hide Save and Copy actions
+  * DeveloperPage: Remove extra padding on the backtrace
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Too many changes to list here
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- Changes since 5.24.4:
+  * fix processor invocation
+  * fix the instance filter
+  * instance ids have 2 hyphens not 3
+
dtb-aarch64
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
dynare
+- Update to version 5.3:
+  * Long list of changes, see
+    https://www.dynare.org/new-dynare-release/dynare-5.3-released/
+- Remove upstream patches:
+  * dynare-5.1-gcc-12.patch
+  * dynare-octave7-compat.patch
+
ecj
+- Added patch:
+  * encoding.patch
+    + the encoding needs to be set for all JDK versions
+- Modified patch:
+  * ecj-rpmdebuginfo.patch
+    + rediff
+  * javaAPI.patch
+    + extract the encoding part to a separate patch
+
+- Upgrade to eclipse 4.18 ecj
+- Switch java14api to java15api to be compatible to JDK 15
+
+- Upgrade to eclipse 4.17 ecj
+  * No changelog was made available.
+- Removed patches:
+  * ecj-encoding.patch
+  * jdk10u-jdk8compat.patch
+- Switch to JDK 11 for build a JDK 8 is not supported anymore by ecj
+- Switch java10api to java14api to be compatible to JDK 14
+
+  * No changelog was made available.
-- Remove upstream git URL for MANIFEST.MF as it is not
-  versioned. File will change and Factory bots will
-  complain.
-
-- restore bootstrap dependencies
-- Restored patches and GCJ Main, as they are used
-  to bootstrap other packages.
-  * eclipse-gcj-compat4.2.1.patch
-  * eclipse-gcj-nodummysymbol.patch
-- Removed obsolete ecj-native, as old SUSE package did
-  not had it and no package provides it
-
-- clean spec file
-
eclipse
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- eclipse-riscv64.patch: Add support for riscv64
+
+- Allow building with objectweb-asm 9.x
+
+- Do not require Java10 APIs artifact when building with java 11
+
+- Added patch:
+  * eclipse-libkeystorelinuxnative.patch
+    + Fix unresolved symbols when trying to load
+    libkeystorelinuxnative.so on platforms that have it
+
+- Update to 4.15
+  * No changelog was made available.
+- Build only on 64-bit architectures, since 32-bit support was
+  dropped upstream
+- Modified patches:
+  * eclipse-debug-symbols.patch
+  * eclipse-disable-droplets-in-dropins.patch
+  * eclipse-disable-uses-constraints.patch
+  * eclipse-feature-plugins-to-category-ius.patch
+  * eclipse-fix-dropins.patch
+  * eclipse-fix-tests.patch
+  * eclipse-hide-droplets-from-install-wizard.patch
+  * eclipse-ignore-version-when-calculating-home.patch
+  * eclipse-make-droplets-runnable.patch
+  * eclipse-no-source-for-dependencies.patch
+  * eclipse-p2-pick-up-renamed-jars.patch
+  * eclipse-pde-tp-support-droplets.patch
+  * eclipse-secondary-arches.patch
+  * eclipse-support-symlink-bundles.patch
+  * eclipse-suse-batik.patch
+  * fix_ant_build.patch
+  * prefer_x11_backend.patch
+- Removed patches:
+  * eclipse-adjust-droplets.patch
+  * eclipse-arm32.patch
+  * eclipse-asm7.patch
+  * eclipse-felix-scr-dependencies.patch
+  * eclipse-force-gtk2.patch
+  * eclipse-gcc10.patch
+  * eclipse-imagedescriptor.patch
+  * eclipse-lucene-8.patch
+  * eclipse-mockito.patch
+  * eclipse-remove-jgit-provider.patch
+  * eclipse-swt-disable-gtk2.patch
+  * eclipse-test-support.patch
+- Added patches:
+  * compiler-release.patch
+  * eclipse-patch-out-fileupload-dep.patch
+  * eclipse-swt-avoid-javascript-at-build.patch
+  * explicit-hamcrest.patch
+  * force-clean-after-p2-operations.patch
+
+- Added patch:
+  * eclipse-gcc10.patch
+    + fix build with gcc 10
+
+- Build against jgit, since jgit-bootstrap does not exist
+
+- Added patch:
+  * eclipse-lucene-8.patch
+    + port to lucene 8.x
+    + apply if building against lucene >= 8
+
+- Added patch:
+  * eclipse-felix-scr-dependencies.patch
+    + The dependencies of felix-scr changed. So stop linking xpp3
+    and kxml and link osgi.cmpn as symlink plugins.
+
+- Filter out the *SUNWprivate_1.1* symbols from requires
+  * They were unconditionally sucking in java-1_8_0-openjdk-devel
+
+- Added patches:
+  * eclipse-arm32.patch
+    + Fix detection of libjawt.so on 32-bit arm
+  * eclipse-force-gtk2.patch
+    + On 32-bit architectures, force use of GTK2, since GTK3
+    platform does not work on those systems
+
eclipse-ecf
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- Allow building with objectweb-asm 9.x
+
+- Update to 3.14.8
+  * No changelog was made available.
+- Remove patch:
+  * eclipse-ecf-feature-deps.patch
+- Added patches:
+  * 0001-Avoid-hard-coding-dependency-versions-by-using-featu.patch
+  * 0002-Remove-unneeded-dep-on-jdt-annotations.patch
+
+- Update to 3.14.7
+  * No changelog was made available.
+- Refresh eclipse-ecf-feature-deps.patch
+- Remove eclipse-ecf-asm7.patch fixed upstream
+
+- Build against jgit, since jgit-bootstrap does not exist
+
eclipse-egit
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- Upgrade to eclipse-egit 5.11.0
+  * No changelog was made available.
+  * Needed because of change of eclipse-jgit to 5.11.0
+
+- Upgrade to eclipse-egit 5.8.0
+  * No changelog was made available.
+
eclipse-emf
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- Upgrade to 2.22.0
+  * No changelog was made available.
+- Removed patches:
+  * remove-nebula-dep.patch
+  * remove-network-tests.patch
+  * remove-timezone-test.patch
+  * remove-unnecessary-imports.patch
+- Added patches:
+  * 0001-Remove-dependency-on-nebula.patch
+  * 0002-Remove-test-that-requires-talking-to-the-internet.patch
+
+- Build against jgit, since jgit-bootstrap does not exist
+
eclipse-jgit
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- Update to 5.11.0
+  * No changelog was made available.
+  * fixes build against apache-sshd 2.7.0
+- Modified patches:
+  * 0001-Ensure-the-correct-classpath-is-set-for-the-jgit-com.patch
+  * 0002-Don-t-embed-versions-of-third-party-libs-use-feature.patch
+  * jgit-shade.patch
+  * jgit-5.8.0-java8.patch -> jgit-5.11.0-java8.patch
+    + Rediff to changed context
+- Added patch:
+  * jgit-apache-sshd-2.7.0.patch
+    + Adapt to apache-sshd api changes between 2.6.0 and 2.7.0
+- Removed patch:
+  * 0003-Remove-requirement-on-assertj-core.patch
+    + Not needed anymore
+
+- Fix provides
+
+- Added patch:
+  * jgit-5.8.0-java8.patch
+    + restore java 8 compatibility when building with java 9+
+
+- Upgrade to 5.8.0
+  * No changelog was made available.
+- Removed patches:
+  * fix_jgit_sh.patch
+  * jgit-feature-deps.patch
+- Added patches:
+  * 0001-Ensure-the-correct-classpath-is-set-for-the-jgit-com.patch
+  * 0002-Don-t-embed-versions-of-third-party-libs-use-feature.patch
+  * 0003-Remove-requirement-on-assertj-core.patch
+  * jgit-shade.patch
+
+- Split the build into two spec files instead of multibuild
+  * First one produces the maven artifacts, the jgit command-line
+    tool and ant feature
+  * Second one produces eclipse features
+
eclipse-license
+- Update the eclipse-license2 feature to 2.0.0
+  * No changelog was made available.
+- The tarballs are not accessible any more on web, so keep them
+  around
+
+- Force building with Java 11, since tycho is not knowing about any
+  Java >= 15
+
+- Build only on architectures where eclipse is supported
+
elfutils
+- Add support for zstd, needed to inspect kernel modules (bsc#1196510)
+
+- Enhance license fields: all the libraries actually have a different
+  license to the tools. While the tools are GPL-3.0-or-later, the
+  libraries are (LGPL-3.0-or-later OR GPL-2.0-or-later)
+  SLE bug (for tracking the above) bsc#1191310
+
+- Add disable-run-deleted-test.patch in order to disable
+  failing test-case (boo#1189153).
+
+- For version 0.185, the below patches are no longer needed
+  (jsc#SLE-17288, jsc#SLE-17951)
+  libdw-check-end-of-attributes-list-consistently.patch
+  elflint-dont-check-section-group-without-flags-word.patch
+  libelf-error-if-elf_compress_gnu-is-used-on-SHF_COMPRESSED.patch
+  libdw-readelf-make-sure-there-is-enough-data-to-read.patch
+  elfutils-dont-trust-sh_entsize.patch
+  elflint-check-symbol-table-data-is-big-enough-before-check.patch
+  size-handle-recursive-elf-ar-files.patch
+  elflint-sanity-check-the-number-of-phdrs-and-shdrs.patch
+  use-the-empty-string-for-note-names-with-zero-size.patch
+  readelf-fix-off-by-one-sanity-check.patch
+  libebl-check-NT_PLATFORM-core-notes.patch
+  libdwfl-sanity-check-partial-core-file-dyn-data-read.patch
+  libelf-check-compression-before-allocate-output-buffer.patch
+  libdwfl-sanity-check-partial-core-file-data-reads.patch
+  arlib-check-that-sh_entsize-isnt-zero.patch
+
+- Update to version 0.185:
+  debuginfod-client: Simplify curl handle reuse so downloads which
+    return an error are retried.
+  elfcompress: Always exit with code 0 when the operation succeeds (even
+    when nothing was done). On error the exit code is now always 1.
+
+- Update to version 0.184:
+  debuginfod: Use libarchive's bsdtar as the .deb-family file unpacker.
+  debuginfod-client: Client caches negative results. If a query for a
+    file failed with 404, an empty 000 permission
+    file is created in the cache. This will prevent
+    requesting the same file for the next 10 minutes.
+    Client objects now carry long-lived curl handles
+    for outgoing connections.  This makes it more
+    efficient for multiple sequential queries, because
+    the TCP connections and/or TLS state info are kept
+    around awhile, avoiding O(100ms) setup latencies.
+  libdw: handle DW_FORM_indirect when reading attributes
+  translations: Update Polish translation.
+
+- Add disable-run-readelf-self-test.patch in order to disable
+  a failing test-case with GCC 11 (PR27367).
+
+- Update to version 0.183:
+  debuginfod: New thread-busy metric and more detailed error metrics.
+    New --fdcache-mintmp and tracking of filesystem freespace.
+    New increased webapi concurrency while grooming.
+  debuginfod-client: DEBUGINFOD_SONAME macro added to debuginfod.h which
+    can be used to dlopen the libdebuginfod.so library.
+    New function debuginfod_set_verbose_fd and
+    DEBUGINFOD_VERBOSE environment variable.
+  config: profile.sh and profile.csh won't export DEBUGINFOD_URLS unless
+    configured --enable-debuginfod-urls[=URLS]
+  elflint, readelf: Recognize SHF_GNU_RETAIN.
+    Handle SHT_X86_64_UNWIND as valid relocation target.
+- Remove config-do-not-define-DEBUGINFOD_URLS-environment-var.patch patch.
+
+- Enable LTO (boo#1138796) for elfutils.spec.
+
+- Mention elfutils-rpmlintrc as a Source.
+
+- Add rpmlintrc for
+  libdebuginfod1-dummy.s390x: E: shlib-policy-name-error (Badness: 10000) libdebuginfod1
+  which is expected as libdebuginfod1 and it's dummy library do share equal
+  soname.
+- Update to version 0.182:
+  backends: Support for tilegx has been removed.
+  config: New /etc/profile.d files to provide default $DEBUGINFOD_URLS.
+  debuginfod: More efficient package traversal, tolerate various errors
+    during scanning, grooming progress is more visible and
+    interruptible, more prometheus metrics.
+  debuginfod-client: Now supports compressed (kernel) ELF images.
+  libdwfl: Add ZSTD compression support.
+
+- Creatu dummy subpackages that can be used for build of packages
+  that are in bootstrap cycle.
+- Add Provides for real packages.
+
+- Update to version 0.181:
+  libelf: elf_update now compensates (fixes up) a bad sh_addralign for
+    SHF_COMPRESSED sections.
+  libdebuginfod: configure now takes --enable-libdebuginfod=dummy or
+  - -disable-libdebuginfod for bootstrapping.
+    DEBUGINFOD_URLS now accepts "scheme-free" urls
+    (guessing at what the user meant, either http:// or file://)
+  readelf, elflint: Handle aarch64 bti, pac bits in dynamic table and gnu
+    property notes.
+  libdw, readelf: Recognize DW_CFA_AARCH64_negate_ra_state. Allows unwinding
+    on arm64 for code that is compiled for PAC (Pointer
+    Authentication Code) as long as it isn't enabled
+- Drop upstream patch:
+  * 0001-tests-Add-GCOV-flags-when-necessary.patch
+
+- Remove cfi-fix.patch - should not be needed now.
+- Remove remove-run-large-elf-file.sh.patch as it now checks for memory
+  size.
+- Use autosetup.
+
+- Update to version 0.180:
+  elflint: Allow SHF_EXCLUDE as generic section flag when --gnu is given.
+  libdw, readelf: Handle GCC LTO .gnu.debuglto_ prefix.
+  libdw: Use correct CU to resolve file names in dwarf_decl_file.
+  libdwfl: Handle debugaltlink in dwfl_standard_find_debuginfo.
+  size: Also obey radix printing for bsd format.
+  nm: Explicitly print weak 'V' or 'T' and common 'C' symbols.
+- Add 0001-tests-Add-GCOV-flags-when-necessary.patch in order to fix
+  an unresolved symbol.
+- Enable LTO: boo#1138796 by adding -flto-partition=none and -Wno-error=stack-usage.
+
+- Update to version 0.179:
+  debuginfod-client: When DEBUGINFOD_PROGRESS is set and the program doesn't
+    install its own debuginfod_progressfn_t show download
+    progress on stderr.
+    DEBUGINFOD_TIMEOUT is now defined as seconds to get at
+    least 100K, defaults to 90 seconds.
+    Default to $XDG_CACHE_HOME/debuginfod_client.
+    New functions debuginfod_set_user_data,
+    debuginfod_get_user_data, debuginfod_get_url and
+    debuginfod_add_http_header.
+    Support for file:// URLs.
+  debuginfod: Uses libarchive directly for reading rpm archives.
+    Support for indexing .deb/.ddeb archives through dpkg-deb
+    or bsdtar.
+    Generic archive support through -Z EXT[=CMD]. Which can be
+    used for example for arch-linux pacman files by using
+  - Z '.tar.zst=zstdcat'.
+    Better logging using User-Agent and X-Forwarded-For headers.
+    More prometheus metrics.
+    Support for eliding dots or extraneous slashes in path names.
+  debuginfod-find: Accept /path/names in place of buildid hex.
+  libelf: Handle PN_XNUM in elf_getphdrnum before shdr 0 is cached
+    Ensure zlib resource cleanup on failure.
+  libdwfl: dwfl_linux_kernel_find_elf and dwfl_linux_kernel_report_offline
+    now find and handle a compressed vmlinuz image.
+  readelf, elflint: Handle PT_GNU_PROPERTY.
+  translations: Updated Ukrainian translation.
+
+- Re-add libelf1 to baselibs.conf: we still generate a
+  libelf-devel-32bit, which is only installable if libelf1-21bit
+  also exists.
+
+- Exclude debuginfod sub-packages and move them to elfutils-debuginfod.
+
+- Avoid double-shipping libdebuginfo.so.1 in two different
+  subpackages. Fixup RPM group.
+
+- Split libdebuginfod1 into libdebuginfod1 and debuginfod-client.
+  Add Requires for these packages.
+
+- Rename debuginfod-client package to libdebuginfod1 in
+  order to fulfil SLPP violation.
+
+- Fix variable references in specfile
+
+- Use %fillupdir macros for proper sysconfig export.
+
+- Update to version 0.178:
+  debuginfod: New server, client tool and library to index and fetch
+    ELF/DWARF files addressed by build-id through HTTP.
+  doc: There are now some manual pages for functions and tools.
+  backends: The libebl libraries are no longer dynamically loaded through
+    dlopen, but are now compiled into libdw.so directly.
+  readelf: -n, --notes now takes an optional "SECTION" argument.
+  - p and -x now also handle section numbers.
+    New option --dyn-sym to show just the dynamic symbol table.
+  libcpu: Add RISC-V disassembler.
+  libdw: Abbrevs and DIEs can now be read concurrently by multiple
+    threads through the same Dwarf handle.
+  libdwfl: Will try to use debuginfod when installed as fallback to
+    retrieve ELF and DWARF debug data files by build-id.
+- remove dwelf_elf_e_machine_string.patch.
+- remove unused libebl-plugins and libebl-devel subpackages
+- new subpackages debuginfod-client, debuginfod-client-devel and
+  debuginfod added
+- main package binaries are explicitely listed and man pages
+  for the binaries are included
+
+- Add remove-run-large-elf-file.sh.patch in order to remove
+  running run-large-elf-file.sh (it hit OOM).
+
+- disable-tests-with-ptrace.patch: Remove, set XFAIL_TESTS instead
+- dwelf_elf_e_machine_string.patch: Avoid spurious failure
+
+- Modernize specfile and metadata.
+
+- Update to version 0.177:
+  elfclassify: New tool to analyze ELF objects.
+  readelf: Print DW_AT_data_member_location as decimal offset.
+    Decode DW_AT_discr_list block attributes.
+  libdw: Add DW_AT_GNU_numerator, DW_AT_GNU_denominator and DW_AT_GNU_bias.
+  libdwelf: Add dwelf_elf_e_machine_string.
+    dwelf_elf_begin now only returns NULL when there is an error
+    reading or decompressing a file. If the file is not an ELF file
+    an ELF handle of type ELF_K_NONE is returned.
+  backends: Add support for C-SKY.
+- remove fix-bsc-1110929.diff and gcc9-tests-Don-t-printf-a-known-NULL-symname.patch
+- Use %make_build
+
+- Disable LTO (boo#1138796).
+
+- Update License tag to GPL-3.0-or-later, as requested by legal
+  review.
+
+- Add fix-bsc-1110929.diff [bsc#1110929]
+
+- Add gcc9-tests-Don-t-printf-a-known-NULL-symname.patch in order to
+  fix boo#1120864.
+
+- Add elfutils.keyring and verify signature.
+
+- Update to version 0.176
+  build: Add new --enable-install-elfh option.
+    Do NOT use this for system installs (it overrides glibc elf.h).
+  backends: riscv improved core file and return value location support.
+  Fixes CVE-2019-7146, CVE-2019-7148, CVE-2019-7149, CVE-2019-7150,
+    CVE-2019-7664, CVE-2019-7665
+
+- Update to version 0.175
+  readelf: Handle mutliple .debug_macro sections.
+    Recognize and parse GNU Property, NT_VERSION and
+    GNU Build Attribute ELF Notes.
+  strip: Handle SHT_GROUP correctly.
+    Add strip --reloc-debug-sections-only option.
+    Handle relocations against GNU compressed sections.
+  libdwelf: New function dwelf_elf_begin.
+  libcpu: Recognize bpf jump variants BPF_JLT, BPF_JLE, BPF_JSLT
+    and BPF_JSLE.
+  backends: RISCV handles ADD/SUB relocations.
+    Handle SHT_X86_64_UNWIND.
+  Fixes CVE-2018-18310, CVE-2018-18520 and CVE-2018-18521.
+- remove disable-backtrace-dwarf-test.patch patch - the test
+  works now
+
+- Add disable-backtrace-dwarf-test.patch in order to work around:
+  https://sourceware.org/bugzilla/show_bug.cgi?id=23673.
+
+- Update to version 0.174
+  libelf, libdw and all tools now handle extended shnum and
+  shstrndx correctly.
+  elfcompress: Don't rewrite input file if no section data needs
+    updating. Try harder to keep same file mode bits
+    (suid) on rewrite.
+  strip: Handle mixed (out of order) allocated/non-allocated
+    sections.
+  unstrip: Handle SHT_GROUP sections.
+  backends: RISCV and M68K now have backend implementations to
+    generate CFI based backtraces.
+
+- Don't make elfutils recommend elfutils-lang as elfutils-lang
+  already supplements elfutils.
+
+- Fix typo in the recommends name bsc#1104264
+
+- Update to version 0.173
+  More fixes for crashes and hangs found by afl-fuzz. In particular various
+  functions now detect and break infinite loops caused by bad DIE tree cycles.
+  readelf: Will now lookup the size and signedness of constant value types
+    to display them correctly (and not just how they were encoded).
+  libdw: New function dwarf_next_lines to read CU-less .debug_line data.
+    dwarf_begin_elf now accepts ELF files containing just .debug_line
+    or .debug_frame sections (which can be read without needing a DIE
+    tree from the .debug_info section).
+    Removed dwarf_getscn_info, which was never implemented.
+  backends: Handle BPF simple relocations.
+    The RISCV backends now handles ABI specific CFI and knows about
+    RISCV register types and names.
+- add cfi-fix.patch: make build green on arm target
+
+- Update to versio 0.172
+  No functional changes compared to 0.171.
+  Various bug fixes in libdw and eu-readelf dealing with bad DWARF5 data.
+  Thanks to running the afl fuzzer on eu-readelf and various testcases.
+
+- disable-tests-with-ptrace.patch: Rediff
+
+- Update to version 0.171
+  DWARF5 and split dwarf, including GNU DebugFission, are supported now.
+  Data can be read from the new DWARF sections .debug_addr, .debug_line_str,
+  .debug_loclists, .debug_str_offsets and .debug_rnglists.  Plus the new
+  DWARF5 and GNU DebugFission encodings of the existing .debug sections.
+  Also in split DWARF .dwo (DWARF object) files.  This support is mostly
+  handled by existing functions (dwarf_getlocation*, dwarf_getsrclines,
+  dwarf_ranges, dwarf_form*, etc.) now returning the data from the new
+  sections and data formats.  But some new functions have been added
+  to more easily get information about skeleton and split compile units
+  (dwarf_get_units and dwarf_cu_info), handle new attribute data
+  (dwarf_getabbrevattr_data) and to keep references to Dwarf_Dies
+  that might come from different sections or files (dwarf_die_addr_die).
+  Not yet supported are .dwp (Dwarf Package) and .sup (Dwarf Supplementary)
+  files, the .debug_names index, the .debug_cu_index and .debug_tu_index
+  sections. Only a single .debug_info (and .debug_types) section are
+  currently handled.
+  readelf: Handle all new DWARF5 sections.
+  - -debug-dump=info+ will show split unit DIEs when found.
+  - -dwarf-skeleton can be used when inspecting a .dwo file.
+    Recognizes GNU locviews with --debug-dump=loc.
+  libdw: New functions dwarf_die_addr_die, dwarf_get_units,
+    dwarf_getabbrevattr_data and dwarf_cu_info.
+    libdw will now try to resolve the alt file on first use of
+    an alt attribute FORM when not set yet with dwarf_set_alt.
+    dwarf_aggregate_size() now works with multi-dimensional arrays.
+  libdwfl: Use process_vm_readv when available instead of ptrace.
+  backends: Add a RISC-V backend.
+  There were various improvements to build on Windows.
+  The sha1 and md5 implementations have been removed, they weren't used.
+- Remove patches: elfutils-0.170-Wpackednotaligned.patch,
+  elfutils-0.170-stripnothing.patch, gcc8-disable-test.patch
+- make package with V=1 to print verbose command line
+
+- Add gcc8-disable-test.patch in order to fix boo#1084637: temporarily
+  disable a test-case.
+
+- disable-tests-with-ptrace.patch: Rediff
+
+- Update to version 0.170
+  libdw: Added new DWARF5 attribute, tag, character encoding, language code,
+    calling convention, defaulted member function and macro constants
+    to dwarf.h.
+  New functions dwarf_default_lower_bound and dwarf_line_file.
+  dwarf_peel_type now handles DWARF5 immutable, packed and shared tags.
+  dwarf_getmacros now handles DWARF5 .debug_macro sections.
+  strip: Add -R, --remove-section=SECTION and --keep-section=SECTION.
+  backends: The bpf disassembler is now always build on all platforms.
+- Includes changes in 0.169
+  backends: Add support for EM_PPC64 GNU_ATTRIBUTES.
+    Frame pointer unwinding fallback support for i386, x86_64, aarch64.
+  translations: Update Polish translation.
+- Remove obsolete 0001-backends-Add-support-for-EM_PPC64-GNU_ATTRIBUTES.patch
+  and ppc-machine-flags.patch
+- Add elfutils-0.170-stripnothing.patch to robustify test and avoid a FAIL.
+- Add elfutils-0.170-Wpackednotaligned.patch to fix build with GCC 8.
+  (boo#1084637)
+
+- Use %license (boo#1082318)
+
+- Restore obsolete on libebl.
+
+- Update package descriptions.
+- Rename libebl1 to libebl-plugins as these are not linked,
+  but dlopened using their unversioned libebl_$ARCH.so name.
+- Have libelf1 require libebl-plugins (libebl.a, which does the
+  dlopen call, is staticly built into libelf1). This is necessary
+  for pahole to display its results. [boo#1049871]
+
+- ppc-machine-flags.patch: support EM_PPC machine flags
+- disable-tests-with-ptrace.patch: disable more tests
+
+- Update Git-Clone URL
+
+- Add 0001-backends-Add-support-for-EM_PPC64-GNU_ATTRIBUTES.patch
+  unconditionally in the spec file. As we can't support binary diff,
+  a newly added test-case is removed from the patch.
+
+- Add 0001-backends-Add-support-for-EM_PPC64-GNU_ATTRIBUTES.patch:
+  fix .gnu.attributes checking on ppc64{,le}.
+
+- Add missing ldconfig calls for libasm1
+
+- make tests pass when user does not want debuginfo (boo#1031556)
+
+- Update to version 0.168:
+  libelf: gelf_newehdr and gelf_newehdr now return void *.
+  libdw: dwarf.h corrected the DW_LANG_PLI constant name (was DW_LANG_PL1).
+  readelf: Add optional --symbols[=SECTION] argument to select section name.
+- Includes changes from 0001-Add-GCC7-Wimplicit-fallthrough-support-fixes.patch
+  and 0001-ar-Fix-GCC7-Wformat-length-issues.patch.
+- Remove elfutils-0.137-dwarf-header-check-fix.diff which is no longer
+  required after a debugedit fix.
+
+- Add 0001-Add-GCC7-Wimplicit-fallthrough-support-fixes.patch: fix
+  new warning introduced in GCC 7.
+- Add 0001-ar-Fix-GCC7-Wformat-length-issues.patch: fix -Wformat-length
+  warning introduced in GCC 7.
+
+- Update to version 0.167:
+  libasm: Add eBPF disassembler for EM_BPF files.
+  backends: Add m68k and BPF backends.
+  ld: Removed.
+  dwelf: Add ELF/DWARF string table creation functions. dwelf_strtab_init,
+    dwelf_strtab_add, dwelf_strtab_add_len, dwelf_strtab_finalize,
+    dwelf_strent_off, dwelf_strent_str and dwelf_strtab_free.
+  Support compressed sections from binutils 2.27.
+- Remove patch elfutils-0.166-elfcmp-comp-gcc6.patch: included upstream.
+
+- disable-tests-with-ptrace.patch: disable tests that use ptrace when
+  running under qemu-linux-user
+
+- Update to version 0.166:
+  + config: The default program prefix for the installed tools is now
+  eu-. Use configure --program-prefix="" to not use a program
+  prefix.
+  + Various bugfixes.
+- Drop elfutils-0.164-dt-ppc-opt.patch and
+  elfutils-0.164-gcc6.patch (merged upstream)
+- Add patch elfutils-0.166-elfcmp-comp-gcc6.patch: fix
+  self-comparison error with GCC 6.
+- Changes from 0.165:
+  + Add eu-elfcompress
+  + Add pkg-config files for libelf and libdw.
+
+-  add elfutils-0.164-gcc6.patch
+
+- rename dt-ppc-opt.patch as elfutils-0.164-dt-ppc-opt.patch
+  and add reference to upstream commit id
+
+- dt-ppc-opt.patch: add support for DT_PPC_OPT
+
+- Update to version 0.164
+  Drop the following patches, fixed upstream:
+  * elfutils-portability-0.163.patch
+  * elfutils-revert-portability-scanf.patch
+  * elfutils-uninitialized.diff
+  * libebl-prototype-fix.diff
+  Changelog:
+  - strip, unstrip:
+  * Handle ELF files with merged strtab/shstrtab tables.
+  * Handle missing SHF_INFO_LINK section flags.
+  - libelf:
+  * Use int64_t for offsets in libelf.h instead of loff_t.
+  - libdw:
+  * dwarf.h Add preliminary DWARF5 DW_LANG_Haskell.
+  - libdwfl:
+  * dwfl_standard_find_debuginfo now searches any subdir of the binary
+    path under the debuginfo root when the separate debug file couldn't
+    be found by build-id.
+  * dwfl_linux_proc_attach can now be called before any Dwfl_Modules
+    have been reported.
+- Implement %check
+
+- Update to version 0.163
+  Drop patch elfutils-fix-dir-traversal-vuln-in-ar-extraction.patch
+  Drop patch elfutils-0.148-dont-crash.diff (fixed by 9ceebe69)
+  Drop patch elfutils-portability-0.161.patch
+  Add patch elfutils-portability-0.163.patch
+  Changelog:
+  0.163:
+  - Bug fixes only, no new features.
+  0.162:
+  - libdw: Install new header elfutils/known-dwarf.h.
+    dwarf.h Add preliminary DWARF5 constants DW_TAG_atomic_type,
+    DW_LANG_Fortran03, DW_LANG_Fortran08. dwarf_peel_type now also
+    handles DW_TAG_atomic_type.
+  - addr2line: Input addresses are now always interpreted as hexadecimal
+    numbers, never as octal or decimal numbers.
+    New option -a, --addresses to print address before each entry.
+    New option -C, --demangle to show demangled symbols.
+    New option --pretty-print to print all information on one line.
+  - ar: CVE-2014-9447 Directory traversal vulnerability in ar extraction.
+  - backends: x32 support.
+
+- Make ebl modversion predictable to allow build-compare (bnc#916043)
+
+- CVE-2014-9447: elfutils: Directory traversal vulnerability (bnc#911662)
+  Add patch: elfutils-fix-dir-traversal-vuln-in-ar-extraction.patch
+
+- Update to version 0.161
+  + libdw: New function dwarf_peel_type. dwarf_aggregate_size now uses
+    dwarf_peel_type to also provide the sizes of qualified types.
+    dwarf_getmacros will now serve either of .debug_macro and
+    .debug_macinfo transparently.  New interfaces
+    dwarf_getmacros_off, dwarf_macro_getsrcfiles,
+    dwarf_macro_getparamcnt, and dwarf_macro_param are available
+    for more generalized inspection of macros and their parameters.
+    dwarf.h: Add DW_AT_GNU_deleted, DW_AT_noreturn, DW_LANG_C11,
+    DW_LANG_C_plus_plus_11 and DW_LANG_C_plus_plus_14.
+- Remove merged patches
+  + elfutils-robustify.patch
+  + elfutils-no-po-test-build.diff
+  + elfutils-check-for-overflow-before-calling-malloc-to-uncompress-data.patch
+- Refreshed patch (from Fedora sources)
+  + elfutils-portability.patch > elfutils-portability-0.161.patch
+- Add a lang subpackage
+
+- Update homepage URL and improve RPM group classification
+
elisa
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * Fix shortcut not working under non English locale (kde#424890)
+  * ViewSelector: don't overlap icons with scrollbar when being icon-only (kde#448066)
+  * Let clicking systray icon raise Elisa to the foreground (kde#430547)
+  * Fix single track insert when playlist is shuffled (kde#442272)
+  * Make more use of Kirigami stuff (kde#448461)
+  * Port Playlist inlinemessages to PassiveNotification (kde#447607)
+  * Fix metadata not updating when track is opened from Files-browser (kde#448043)
+  * Fix metadata view not updating when switching tabs (kde#436405)
+  * Fixes issue of metadata/lyrics not updating when switching tracks (kde#436405)
+  * Give Sort button an icon (kde#448097)
+  * MediaTrackMetadataView: Round folder icon size to nearest real size (kde#448272)
+  * Use standard icon and text for close/ok button on metadata window (kde#448210)
+  * Changed clear playlist icon to "undo" icon (kde#447826)
+  * Refactor and fix opening playlist files (kde#441544)
+  * Implement dropping music files from file manager onto Playlist (kde#404712)
+  * BUG 445357 Use media-default-album instead of media-optical-audio (kde#445357)
+
eventviews
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Port to setFilterRegularExpression
+  * Fix some compile error against qt6
+  * Use new akonadi calendar install include
+  * Fix ecm_set_disabled_deprecation_versions
+  * Fix install headers
+  * Fix build with GCC 12 (standard attributes in middle of decl-specifiers)
+  * Adapt build system for building against qt6
+  * Port deprecated methods
+  * Make it compile on freebsd
+  * Modernize code
+  * Fix more prefixes on dependencies
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+  * Do not merge release/21.12 .gitlab-ci.yml
+  * not necessary to use I18N_NOOP here, i18n(..) is enough
+
exec-maven-plugin
+- Upgrade to upstream version 3.0.0
+  * Bug Fixes
+    + Resolving "target" dir via "${project.build.directory}", so
+    to make sure it can be resolved correctly within multi-module
+    builds and if another name than "target" has been configured
+    [#124]
+    + Ensure mojo descriptors are extracted after compilation #123
+    + Argument file for modulepath is generated wrongly when paths
+    contains spaces #115
+    + java.lang.String cannot be cast to
+    org.codehaus.mojo.exec.Modulepath #75
+  * Enhancement
+    + Resolves #152 - Adds option to redirect program output of
+    exec:exec to the maven logger. #153
+    + Program output can be difficult to trace and may be jumbled
+    with Maven logs when running Maven with multiple threads #152
+    + Fix type in Property.java #147
+    + Correct spelling and remove redundant "small" #142
+    + Fix typo #140
+    + <timeout> configuration parameter #128
+    + Methodhandles #119
+    + Introduce Mock Repository Manager #117
+    + Improved docs about <environmentVariables/> config of
+    exec:exec goal #104
+    + Add CodeTriage badge to mojohaus/exec-maven-plugin #96
+    + [Enhancement] Support for JPMS module path for exec:java #90
+- Removed patch:
+  * exec-maven-plugin-1.6.0-Port-to-Maven-3.patch
+    + not needed any more with this version
+
exempi
+- Add CVE-2018-12648.patch to fix a NULL pointer dereference issue
+  (CVE-2018-12648, boo#1098946).
+
+- Extend descriptions.
+
+- Update to 2.4.5:
+  * Fix a buffer overflow in the PSD parser. (CVE-2018-7730 bnc#1085295)
+  * Fix a buffer overflow in the TIFF parser. (CVE-2018-7728 bnc#1085297)
+  * Fix a buffer overflow in PostScript parser. (CVE-2018-7729 bnc#1085296)
+  * Fix a null dereference in WEBP parser. (CVE-2018-7731 bnc#1085294)
+  * Properly initialize pointers in WEBP.
+  * Fix an infinite loop in RIFF parser.
+  * Fix an infinite loop in QuickTime parser.
+  * Fix an infinite loop in ASF parser.
+  * Adjust minimum version for gcc in documentation.
+  * Fix a buffer overrun, memcpy() on overlapping regions, use after free in
+    the exception handling.  Fix a fatal assert with corrupt WEBP.
+  * Fix a crash on a corrupt file.
+  * Upgrade XMPCore to Adobe XMP CC 2014.12.
+  * New flag to optimize layout on MPEG4 files.
+  * GoPro MPEG4 video files support.
+  * Improved JPEG support.
+  * iXML support in WAVE files.
+  * Several bugs and memory leaks fixes.
+  * Changes from Adobe XMP CC 2013.06.
+  * Pluggable file handlers (not exposed yet in Exempi)
+  * Support for Exif 2.3 properties
+  * New RIFF file handler
+  * Better Postscript support.
+  * Lot of bug fixes.
+  * Now require (partial) C++11 support to compile (gcc 4.4.7 tested)
+  * WebP format handler (contributed: Frankie Dintino, The Atlantic)
+  * Several API improvements
+  * Fix potential crash with corrupt TIFF file.
+  * Fix header to pass -Wstrict-prototypes
+
+- use individual libboost-*-devel packages instead of boost-devel
+
+- Add gpg signature
+- Cleanup spec file with spec-cleaner
+
+- Update to version 2.2.2:
+  + Public header cleanup and documentation update.
+  + Update Doxygen config.
+  + fdo#73058: Add missing include for MacOS.
+  + fdo#72810: Fix typo in date test in MP3 handler.
+  + fdo#83313: Fix crash on invalid Exif (from Samsung).
+  + Fix valgrind testing for xmpcore.sh.
+  + Fix delete / delete[] mismatch in ID3_Support.hpp.
+- Add baselibs.conf to Source to comply with current rules in
+  Factory.
+
+- Update to version 2.2.1:
+  + fdo#54011: Use POSIX API for files on MacOS.
+  + fdo#58175: Replace OS X FlatCarbon headers.
+  + Added a manpage for exempi(1).
+  + Added the -n option to the command line for arbitrary
+    namespaces.
+
+- fix build under qemu
+
+- Update to version 2.2.0:
+  + New 'exempi' command line tool.
+  + Upgrade XMPCore to Adobe XMP 5.1.2
+  - Quicktime support now works without Quicktime.
+  - Reconciliation with ID3v2.
+  - "Blessed" 64-bits support (we already had it in exempi).
+  - Slight change in the way XMP are written for MWG compliance.
+  - Fixed a serious bug with RIFF.
+  - Change in the way local text encoding is dealt with.
+  - Alternative languages behave slightly differently by changing
+    how the default language property is managed.
+  - Probably a bunch of bugs fixed that I don't know about.
+  + Update unit tests.
+  - Refactor the fixtures.
+  + Use automake silent rules instead of shave. (build only)
+  + "make dist" generate a bzip2 archive as well. (build only)
+  + Remove some obsolete warning flags. (build only)
+  + Build xmpcommandtool
+  + Several new APIs.
+  + Bug fixes: fdo#37747.
+- Drop exempi-no-shave.patch: shave is not used upstream anymore.
+- Drop libtool BuildRequires, autoreconf call and
+  - -disable-silent-rules that were used because of patch above.
+- Create a tools subpackage for new exempi command line tool.
+- Change group of libexempi3 from "Development/Libraries/C and C++"
+  to System/Libraries.
+- Use V=1 during the build to get a verbose build.
+
+- use original tar
+
exiv2-0_26
+- add CVE-2021-29473.patch (CVE-2021-29473, bsc#1186231):
+  avoid out-of-bounds read in Exiv2:Jp2Image:doWriteMetadata
+- add CVE-2019-17402.patch (CVE-2019-17402, bsc#1153577):
+  improper validation of the total size to the offset and size leads to a crash in Exiv2::getULong in types.cpp
+- add CVE-2019-13109.patch (CVE-2019-13109, bsc#1142677):
+  denial of service in PngImage:readMetadata
+- add CVE-2018-20099.patch (CVE-2018-20099, bsc#1119559):
+  fix infinite loop in Exiv2::Jp2Image::encodeJp2Header
+  this includes CVE-2018-20098, bsc#1119560
+- add CVE-2018-20097.patch (CVE-2018-20097, bsc#1119562):
+  avoid null pointer dereference in TiffParserWorker::findPrimaryGroups
+- add CVE-2018-17581.patch (CVE-2018-17581, bsc#1110282):
+  avoid recursion in CiffDirectory::readDirectory()
+- add CVE-2021-32815.patch (CVE-2021-32815, bsc#1189337):
+  avoid assertion failure in crwimage
+
+- add CVE-2021-34334.patch (CVE-2021-34334, bsc#1189338)
+
+- add CVE-2019-13111.patch (CVE-2019-13111, bsc#1142679)
+- add CVE-2021-29463.patch (CVE-2021-29463, bsc#1185913)
+- add webp-alpha-detection.patch
+- add improve-pngchunk-bounds-checking.patch
+
+- add exiv2 0.26 library for compatibility (jsc#PED-1393)
+
+- add CVE-2021-37621.patch (CVE-2021-37621, bsc#1189333)
+- add CVE-2021-32617.patch (CVE-2021-32617, bsc#1186192)
+- add CVE-2020-19716.patch (CVE-2020-19716, bsc#1188645)
+- add CVE-2019-14368.patch (CVE-2019-14368, bsc#1143278)
+- add CVE-2019-20421.patch (CVE-2019-20421, bsc#1161901)
+
+- add CVE-2018-10772.patch (CVE-2018-10772, bsc#1092096)
+- add CVE-2018-18915.patch (CVE-2018-18915, bsc#1114690)
+- add CVE-2021-37620.patch (CVE-2021-37620, bsc#1189332)
+- add CVE-2021-29470.patch (CVE-2021-29470, bsc#1185447)
+
+- add CVE-2018-5772.patch (CVE-2018-5772, bsc#1076579)
+- add CVE-2018-8976.patch (CVE-2018-8976, bsc#1086810)
+- add CVE-2018-8977.patch (CVE-2018-8977, bsc#1086798)
+- add CVE-2020-18898.patch (CVE-2020-18898, bsc#1189780)
+- add CVE-2021-31291.patch (CVE-2021-29457 and CVE-2021-31291, bsc#1185002 and bsc#1188733)
+- add CVE-2021-31292.patch (CVE-2021-31292, bsc#1188756)
+- add CVE-2021-37618.patch (CVE-2021-37618, bsc#1189330)
+- add CVE-2021-37619.patch (CVE-2021-37619, bsc#1189331)
+- add CVE-2020-18899.patch (CVE-2020-18899, bsc#1189636)
+
+- add 0001-Avoid-null-pointer-exception-due-to-NULL-return-valu.patch (bsc#1142684, CVE-2019-13114):
+  * fixes null-pointer dereference in http.c causing denial of service
+- add 0001-IptcData-printStructure-Remove-buffer-overrun.patch  (bsc#1088424, CVE-2018-9305):
+  * fixes an out-of-bounds read in IptcData::printStructure in iptc.c
+- add 0001-Fix-SEGV-in-DataValue-Copy.patch (bsc#1109299, CVE-2018-17282):
+  * fixes null pointer dereference in Exiv2:DataValue:copy in value.cpp
+- add 0001-PSD-Use-Safe-add-for-preventing-overflows-in-PSD-fil.patch,
+  0002-PSD-enforce-Length-of-image-resource-section-file-si.patch (CVE-2018-19108, bsc#1115364):
+  * fixes denial of service in Exiv2::PsdImage::readMetadata
+- add 0001-Fix-561.-Use-proper-counter-for-the-idx-variable.patch (CVE-2018-19607, bsc#1117513):
+  * fixes a denial of service (NULL pointer dereference and application crash)
+
+- update to latest 0.26 branch:
+  * Includes fix for CVE-2019-14982 (bsc#1146294)
+  * Fixes CVE-2018-12264, CVE-2018-12265 (bsc#1097599)
+  * Fixes CVE-2017-9239 (bsc#1040973): null pointer dereference in doWriteImage
+  * Fixes CVE-2018-17229 (bsc#1109175): (Heap buffer overflow in Exiv2::d2Data)
+  * Fixes CVE-2018-17230 (bsc#1109176): (heap-based buffer overflow in Exiv2::ul2Data)
+  * Fixes CVE-2017-1000126 (Stack out of bounds read in webp parser) (bsc#1068873)
+
+- Fix build on python3 only system by making sure we use
+  python3 when building
+
+- update to latest 0.26 branch:
+  * obsoletes 0001-Use-more-GNUInstallDirs.patch
+  d4e4288d839d0d9546a05986771f8738c382060c.patch
+  gcc-version-check.patch
+  7f5b0778fa301b68c1c88e3820ec3afbd09dd0a5.patch
+  fix-crash.patch
+  * adds exiv2-update-to-0.26-branch.patch
+  * Fixes CVE-2017-14864 (bsc#1060995),
+  CVE-2017-14862 (bsc#1060996), CVE-2017-14859 (bsc#1061000)
+  CVE-2017-14860 (bsc#1048883), CVE-2017-11337 (bsc#1048883),
+  CVE-2017-11338 (bsc#1048883), CVE-2017-11339 (bsc#1048883),
+  CVE-2017-11340 (bsc#1048883), CVE-2017-11553,
+  CVE-2017-12955 (bsc#1054593), CVE-2017-12956,
+  CVE-2017-12957, CVE-2017-11683, CVE-2017-11592,
+  CVE-2017-11591 (bsc#1050257), CVE-2018-11531 (bsc#1095070),
+  CVE-2019-13110 (bsc#1142678)
+
+- split developer documentation into separate package
+
+- add 0001-Use-more-GNUInstallDirs.patch (bsc#938600)
+- add d4e4288d839d0d9546a05986771f8738c382060c.patch (
+    CVE-2017-14864 bsc#1060995,
+    CVE-2017-14862 bsc#1060996,
+    CVE-2017-14859 bsc#1061000)
+
+- Add fix-crash.patch to prevent crashes in gwenview with certain
+  images (boo#1051782)
+- Update source tarball to the fixed upstream re-release and remove
+  the workaround in the spec file
+- Replace gcc-version-check.patch with the version committed
+  upstream
+
+- Fix baselibs.conf
+
+- Update to version 0.26
+  * See http://www.exiv2.org/changelog.html
+- Add gcc-version-check.patch to fix build on Tumbleweed
+- Dropped the following upstreamed patches:
+  * exiv2-cmake-libsuffix.patch
+  * exiv2_r3889_r3890_fix_boo964344.diff
+
+- add exiv2_r3889_r3890_fix_boo964344.diff (taken from revisions linked
+  in http://dev.exiv2.org/issues/1106) to fix crash in darktable (boo#964344)
+
+- Adjust RPM groups
+- Put manpage in proper subpackage
+
+- readd parallel-build-dep.patch
+
+- Update to version 0.25
+  * exivsimple has array index errors when stripping quotes form
+    trivial input strings
+  * Use SVN eol-style LF on all files
+  * Access violation on IptcData::operator[] when key is invalid
+  * PNG images with tiff tags throw exceptions
+  * Plasma kde crashes when specific jpeg is on the Desktop
+  * TIFF parser,Binary array elements should be decoded using the
+    Makernote's endianness, not that of the image
+  * Coverity scan : Issue CID 981992 , 981993
+  * Wrong key name in output of addmodel sample
+  * Printing tags does not honor multi-byte label widths correctly
+  * Wrong ApertureValue written
+  * pyexiv2 fails on cifs shares on an Ubuntu client
+  * TIFF parser,Parse TIFF PageNumber
+  * Add new sample applications exifdata and exivvalue
+  * Add option -K Key (--key Key) to specify one or more keys to
+    output
+  * "exiv2 -eX" followed by "exiv2 -iX" produces invalid XMP
+    metadata packet
+  * Sony NEX Lens Information
+  * Handle Pentax makernotes in samsung-rebranded cameras
+  * Olympus XZ-1 FocusDistance incorrect
+  * Support Panasonic Makernote
+  * detection of Pentax DA 35/2.4 lens
+  * Canon EOS M EF-M lenses
+  * Lens matching on Canon
+  * Tamron 18-270 is not detected anymore
+  * Wrong aperture for Tamron 70-300?
+  * Recognize Samsung NX 10mm Fisheye
+  * Pentax/Sigma 24-70mm F2.8 IF EX DG HSM data
+  * See also http://www.exiv2.org/changelog.html
+- Dropped the following upstreamed patches:
+  * fix-overflow-in-info-tags-r3264.patch
+  * fix-video-timescale-handling.patch
+  * parallel-build-dep.patch
+  * fix-parallel-build.patch
+
+- Switch to cmake build system: there are various code snips that
+  use variables that are only defined in the cmake build system
+  (e.g. src/utils.cpp uses EXV_HAVE_UNISTD_H to include unistd.h,
+  which is not done with configure. With gcc5 this results now in
+  a failure, as unistd.h is no longer implicit).
+- Add exiv2-cmake-libsuffix.patch: Install the library to lib64 on
+  the respective archs.
+
+- add fix-video-timescale-handling.patch: Fix crash when scanning mp4 videos.
+
+- add parallel-build-dep.patch: Fix build dependencies
+
+- fix a Buffer Overflow in INFO tags of RIFFVIDEO.CPP
+  (fix-overflow-in-info-tags-r3264.patch) (CVE-2014-9449).
+
extra-cmake-modules
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * ECMAddQtDesignerPlugin: use correct plugin IID
+  * ECMAddQch: support doc linking also against Qt6 docs
+  * KDEPackageAppTemplates: add "_kapptemplate" postfix to target names
+  * Fix compatibility with newer Gradle provided with Qt 5.15.8
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * CMakeLists.txt cmake_minimum_required should be first line of CMakeLists.txt file
+  * Remove Jenkins CI leftover
+  * Use correct SPDX license identifier for CC0
+  * FindXCB: remove Xprint
+  * FindXCB: remove XEvIE
+  * Mark translation fetching as deprecated
+  * Fix compatibility with newer Gradle provided with Qt 5.15.8
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * KDEInstallDirsCommon.cmake http://www.x86-64.org/documentation/abi.pdf does not work
+  * Add ZSHAUTOCOMPLETEDIR to KDEInstallDirs
+  * Fix ECMQmlModule for static plugins
+  * Watch for language changes to load the new appropiate qm files
+
extra-cmake-modules:doc
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * ECMAddQtDesignerPlugin: use correct plugin IID
+  * ECMAddQch: support doc linking also against Qt6 docs
+  * KDEPackageAppTemplates: add "_kapptemplate" postfix to target names
+  * Fix compatibility with newer Gradle provided with Qt 5.15.8
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * CMakeLists.txt cmake_minimum_required should be first line of CMakeLists.txt file
+  * Remove Jenkins CI leftover
+  * Use correct SPDX license identifier for CC0
+  * FindXCB: remove Xprint
+  * FindXCB: remove XEvIE
+  * Mark translation fetching as deprecated
+  * Fix compatibility with newer Gradle provided with Qt 5.15.8
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * KDEInstallDirsCommon.cmake http://www.x86-64.org/documentation/abi.pdf does not work
+  * Add ZSHAUTOCOMPLETEDIR to KDEInstallDirs
+  * Fix ECMQmlModule for static plugins
+  * Watch for language changes to load the new appropiate qm files
+
extra166y
+- Some classes were built with higher bytecode level
+
+- Build with source level 8
+
ezmorph
+- Build with source and target levels 8
+
+- Do not build against the log4j12 packages
+
falkon
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Falkon is now released with other KDE Gear.
+
felix-gogo-command
+- Remove forcing of maven.compiler.release, since it is not needed
+  any more
+
felix-gogo-runtime
+- Rewrite the build system to ant so that we can eventually avoid
+  build cycles with maven-plugin-bundle built against
+  felix-bundlerepository
+
felix-osgi-compendium
+- Fix lack of variable expansion in dependencies that created
+  unresolvable require.
+
+- Build with java source and target levels 8
+
felix-osgi-foundation
+- Build with java source and target level 8
+
felix-scr
+- Update to version 2.1.16
+- Modified patch:
+  * osgi-metadata.patch ->
+    0001-Use-import-package-instead-of-embedding-dependencies.patch
+  + Don't embed dependencies, use import-package instead
+- Added patch:
+  * 0002-Drop-the-dependencies-on-kxml-xpp3.patch
+    + Drop dependencies on kxml and xpp, use the system SAX
+    implementation instead
+
felix-shell
+- Rewrite the build system to ant so that we can eventually avoid
+  build cycles with maven-plugin-bundle built against
+  felix-bundlerepository
+
+- Build against OSGi R7 APIs
+
felix-utils
+- Update to upstream release 1.11.4
+- Added patch:
+  * 0000-Port-to-osgi-cmpn.patch
+    + Migrate away from the old felix-osgi implementation
+
fence-agents
+- Update to version 4.12.1+git.1677142927.bf55c675:
+  Include IBM Cloud VPC fence agent (jsc#PED-3626)
+  * fence_scsi: fix registration handling if ISID conflicts ISID (Initiator Session ID) belonging to I_T Nexus changes for RHEL based on the session ID. This means that the connection to the device can be set up with different ISID on reconnects.
+  * fence_amt/fence_ipmilan/fence_ironic: use shlex instead of pipes when available, as pipes is deprecated and will be removed in Python 3.13
+  * fence_vmware_soap: set login_timeout lower than default pcmk_monitor_timeout (20s) to remove tmp dirs on fail
+  * fencing: add plug_separator to default DEPENDENCY_OPT
+  * fence_virt: fix man page spelling (#522)
+  * fence_scsi: skip key generation during validate-all action
+  * [virt] fix clang build
+  * [virt] fix cpg plugin build
+  * [virt] update man page to cover all serial listener configs
+  * [virt] update man page for serial listener in serial mode
+  * [virt] fix serial debug output
+  * [virt] add debug print for static map check
+  * [virt] Clarify usage of ip= for vsock listener
+  * [virt] fix tcp plugin to properly pass info to acl check
+  * [virt] drop last qmf bits (rhel6 era)
+  * [virt] allow groups to only specify vm_name without UUID
+  * [virtd] add support for named groups
+  * fence_virtd: add info about using multiple uuid/ip entries for groups
+  * fence_wti: increase login timeout to avoid random timeouts
+  * fence_virtd: set secure file permissions for fence_virtd.conf and key file if they are not mode 600
+  * fencing: add plug_separator parameter to be able to specify one that isnt part of the plug name(s)
+  * build: dont rm PKG_CHECK_VAR.m4 when running maintainer-clean
+  * fence_vmware_soap: set default login timeout less than Pacemakers default timeout to remove tmp dirs
+  * fence_virtd: add link and non-user socket example to man page
+  * fence_ibm_powervs: improve defaults based on testing
+  * fence_lpar: only output additional error output on DEBUG level
+  * fence_virt: add note that reboot-action doesnt power on nodes that are powered off
+  * fencing: source_env(): dont process empty lines
+  * fence_ecloud: new fence agent
+  * fence_sbd: improve error handling
+  * configure: check for google-auth instead of deprecated oauth2client
+  * fence_ibm_vpc: add token cache support
+  * build: add FENCETMPDIR for state files
+  * build: make xml-check: ignore detected paths in *_file parameters not matching saved metadata
+  * fence_gce: add httplib2 to try/except: pass
+  * configure/spec: cleanup and fixes
+  * fence_gce: Add user agent to API requests (#491)
+  * fence_ibm_powervs: add support for proxy, private API servers and get token via API key (#490)
+  * fence_ibm_vpc: add proxy support
+  * fence_zvmip: show unable to connect error instead of full stacktrace, e.g. when not using --ssl for SSL devices
+  * Mid: fence_scsi,fence_mpath: Add suppress-errors option. (#484)
+  * fence_gce: Make zone optional for get_nodes_list (#487)
+  * fence_apc/fence_ilo_moonshot: add missing "import logging"
+  * fence_gce: inform that SSLError might be caused by old versions of httplib2
+  * fence_ibm_vpc: remove unused instance parameter and make limit optional
+  * all agents: unify ssl parameters to avoid having to use --ssl when using --ssl-secure/--ssl-insecure for some agents
+  * fence_apc.py compatibility for Firmware major release 7 workaround #475
+  * fence_lpar: fix missing import logging, use fail_usage
+  * fence_raritan: Also allow pure port number, not only system1/outletX string (#473)
+  * fence_cdu: add 8i support (#471)
+  * fence_zvmip: add --disable-ssl
+  * fencing: add ability to set bool parameters to 0 or false
+  * Fix typo in fence_virtd.service
+  * fence_gce: Add timeouts and failure options (#458)
+  * fence_zvm: deprecate agent
+  * fence_openstack: fix issues with new clouds.yaml/openrc parameters - hardcoded clouds.yaml paths to work like the openstack cli client   (used by the resource agents)
+  * fence_openstack: add support for reading config from clouds.yaml and openrc
+  * fencing: add source_env()
+  * fence_kubevirt: take default namespace from context
+  * build: fix parallel build of lib/
+  * fence_openstack: relax ssl cacert default
+  * - spec: dont use commas in license
+  * fence_lpar: Support comanaged LPARs
+  * fence_ibmz: add option --load-on-activate
+  * fence_openstack: add --ssl-insecure
+  * spec: fix python3-suds dependency having changed name on opensuse 16+
+  * fencing: encode instead of failing for chinese or other non-utf8 character sets
+  * fence_aliyun: Optimize log output (#449)
+  * fence_zvmip: use ssl by default
+  * fence_zvmip: add ssl/tls support
+  * configure: fix --with-agents to not match *virt in regex
+  * fence_vmware_soap: Use --login-timeout option (#447)
+  * fence_kubevirt: set default power-timeout to 40s
+  * fence_kubevirt: Fix kubevirt VM status
+  * fence_kdump: fix typo
+  * fence_raritan_px3: new fence agent (#425)
+  * fence_amt_ws: fix --boot-option (choices are uppercased while getting parsed)
+  * fence_gce: add plugzonemap parameter
+  * fence_gce: Adds existing operation checks and multiple plug support (#400)
+  * azure_fence: fix support for sovereign clouds and MSI for new versions of azure libraries (#439)
+  * fence_cyberpower_ssh: new fence agent (#437)
+  * fence_amt_ws: fix "or" causing dead code
+  * fence_kubevirt: make apiversion a parameter
+  * fence_ibm_vpc/fence_ibm_powervs: new fence agents
+  * fence_kdump: properly support -v[X] and -vvv (and combinations)
+  * fence_mpath/fence_scsi: use store path detected by configure
+  * fence_kubevirt: add --ssl-insecure parameter
+  * fence_kdump: accept message from multiple addresses (useful for RRP clusters) (#374)
+  * fence_pve: Replace `nodename` with `pmx-node` in fence_pve.py (matching original intent) (#424)
+  * spec: add dependency to new split packages for Fedora 35+
+  * log exceptions to be more detailed when failing
+  * Mid: fence_sbd: A warning message is output when disable-timeout is enabled.
+  * spec: export PYTHON to avoid configure ignoring it
+  * build: expose delay-check to be able to skip the other tests when debugging
+  * fence-kubevirt: Add fence-kubevirt declaration for rpm creation
+  * fence_kubevirt: Fix accept header param to openshift client
+- Don’t use python-oauth2client, which is deprecated
+  (gh#ClusterLabs/fence-agents#495).
+- Remove python2 stuff from spec file
+- remove patches included by update:
+  * 0001-fence_gce-Add-timeouts-and-failure-options-458.patch
+  * 0001-fence_gce-Make-zone-optional-for-get_nodes_list-487.patch
+  * 0001-fix_support_for_sovereign_clouds_and_MSI-439.patch
+
ffado
-- Update to release 2.4.3
-
-- Replace pkgconfig(libxml++-2.6) with pkgconfig(libxml++-3.0)
-  BuildRequires.
-
-- Update to release 2.4.1
-- Removed uneeded and incorporated patches:
-  libffado-SConstruct-py3.patch, ffado-gcc6.patch and byteswap.patch
-- Upstream changes:
-  * Fix some python syntax which was not compatible with python3.
-  These were missed during the preparation of FFADO 2.4.0.
-  * Modify the SCons build system to allow for scons running under
-  python3.
-  * Merge distribution patches provided by package maintainers.
-  * Address some difficulties experienced by package maintainers
-  when compiling FFADO.
-  * Improve the output of ffado-diag.
-
-- byteswap.patch: ensure byte swap macros are available for all components
-
-- Add reproducible.patch to always build with SSE2,
-  independent of build system CPU (boo#1100677)
-
-- Update to release 2.4.0 and fix build against glibc-2.27
-  see boo#1079938.
-- Removed patches fixed upstream:
-  ffado_SConstruct_powerpc_update.patch and sigev.patch.
-- Rebased libffado-SConstruct-py3.patch partially fixed upstream.
-- Added ffado-nosys.patch for missing import sys in SConstruct.
-- Rebased ffado-gcc6.patch, partially fixed upstream.
-- Upstream changes:
-  * Numerous build system and code improvements to support
-  architectures such as MIPS, x32 and various PowerPC flavours.
-  * A large number of fixes for newer versions of gcc
-  (particularly versions 6 and 7).
-  * Initial support for the optional TCO module of the
-  RME Fireface-800.
-  * Expanded ffado-mixer support for the Phase88 device.
-  * Initial work to make ffado-mixer compatible with
-  python3/pyqt5.
-  * Start work towards compatibility with scons3.
-
+- Update to bugfix version 2.2.1
+- Fixes compilation failures when DEBUG=no is specified
+- Upstream changes for 2.2.0:
+  * Many bugs fixed
+    Mixer, router and monitor support for Saffire Pro 14
+    Mixer and router support for Presonus Firestudio Tube,
+    Presonus Firestudio Project, and M-Audio Profire 2626
+    Support Echo Audio AudioFire12 with firmware versions 5.0 and
+    later (addresses ticket 360)
+    Echo Audio device mixer additions:
+    hide SPDIF mode switch on AudioFire12
+    digital interface switch on AudioFire8 and Pre8
+    phantom power switch for AudioFire4 (addresses ticket 364)
+    playback routing for AudioFire2/4 (addresses ticket 335)
+  * Presonus device mixer additions:
+    better support the FP10 (formerly known as the Firepod)
+    implement support for the Firebox and Inspire1394
+  * M-Audio mixer additions:
+    improve support for the Ozonic
+    add support for Firewire Solo (ticket 336), Audiophile, 410, 1814
+    and ProjectMix I/O
+  * Device-specific mixer for Yamaha GO44 and GO46 interfaces added
+  * RME Fireface 400/800 improvements:
+    mixer and device settings can now be saved to and restored from
+    device flash clock source selection made more consistent
+  * DICE EAP / RME Matrix mixer enhancements:
+    "per output" view with mono/stereo control saving of mixer
+    settings to file
+    more consistent cooperation with jackd when sample rate is changed
+  * Audio streaming support added or refined for additional MOTU
+  interfaces:
+    Traveller mk 3
+    Ultralite mk 3
+    Ultralite hybrid (using firewire interface only)
+    4pre
+- Known issues:
+  * Saffire Pro 40 at 96 kHz fails to start most of the time
+  (ticket 326)
+  * Saffire Pro 24 and Pro 40 MIDI problems (tickets 372 and 375)
+  * Saffire Pro 24 and Pro 40 lack an ADAT/SPDIF switch
+  * Only mixer control is supported on M-Audio 1814 and M-Audio,
+  ProjectMix
+  * M-Audio Audiophile, 410 and 1814 require startup workaround.
+  See http://sourceforge.net/p/ffado/mailman/message/30807938
+  * M-Audio Audiophile, 410 and 1814 will only work with FFADO when
+  loaded with the latest firmware
+
+- own /usr/lib/udev directory to avoid buildrequiring udev
+
+- Move udev rules to /usr/lib/udev for openSUSE 12.3 or later.
+
+- Update to 2.1.0 version:
+  * Significantly improved support for the new "juju" firewire stack
+    found in newer kernels
+  * Support for JACK freewheeling mode and set-buffer-size operation
+  * Lower CPU usage
+  * udev rules included in FFADO to give user access to audio device files
+  * More stable streaming
+  * Fix crash when realtime system clock was set
+  * Fix race conditions and invalid memory accesses on shutdown
+  * Fixes for clean compilation on recent gcc versions (up to 4.7)
+  * ffado-diag enhanced to aid debugging efforts
+  * Many bugs fixed
+- Remove patchs merged on upstream release:
+  * ffado-gcc47.patch
+  * libffado-bswap.patch
+- Do not use and include ChangeLog in the package because the svn repo is down
+  and this file could not be update
+- Remove useless conditional macros
+
+- fix ppc64 build
+
+- Add ffado-gcc47.patch: Fix build with gcc 4.7.
+
+- Added "Recommends: ffado-mixer" to the ffado rpm.
+
+- Update to ffado-svn revision 2040 to fix bnc#747391 & bnc#736115
+- Upstream changes, see /usr/share/doc/packages/ffado/ChangeLog
+
+- adding -fPIC on arm (fixes build)
+
+- move doc generation into 2nd spec file
+
+- Fix some rpmlint errors
+
+- remove qt dependency, splitted into ffado-mixer spec file
+
+- Update to version 2.0.1
+- Upstream changes :-
+  Make it work on the new firewire-stack.
+  Of course some more fixes went into the package. But its mostly
+  intended for distributors so they can finally deprecate/disable the
+  old firewire stack in kernels.
+  For more changelog and instructions please look back at the 2.0.0
+  release announcement http://www.ffado.org/?q=release/2.0.0
+
+- Update to svn 1856.
+- Upstream changes : Make it easier for distributions to define
+  their own additional built-flags.
+  Numerous bug fixes, see ChangeLog for details.
+
+- Created package ffado version 2.0.0
+
ffmpegthumbs
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix build with FFmpeg 5 (kde#448776)
+  * Add CI
+
filelight
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * port to native windows api
+  * Add windows installer to appstream artifacts
+  * Use ecm_set_disabled_deprecation_versions
+  * add keyword "drive"
+  * add keywords to desktop file
+  * Kdelibs4ConfigMigrator will be removed in qt6
+  * Add qt6 CI support
+  * Now Qt6Core5Compat is not necessary
+  * Adapt build system for building against qt6
+  * Fix compile error against qt6
+  * Reverse "next" and "previous" icons in RTL mode
+
fipscheck
+- Remove #include of unused fips.h to fix build with OpenSSL 1.1.1
+  (bsc#1149792)
+  * add fipscheck-fips.h_not_needed.patch
+
+- Port to OpenSSL 1.1 (bsc#1042649)
+  Adds openssl-1_1-port.patch
+
+- Set RPM groups anew. Drop implicit cleaning parts.
+
+- add baselibs.conf
+
+- updated to 1.4.1
+  - added manpages
+  - fipscheck/fipshmac: Add -s option to specify the hmac suffix
+  - fipshmac: Add '-d' option to specify where to put the .hmac files
+  - various bugfixes
+
+- license update: BSD-2-Clause
+  See LICENSE
+
+- imported a generic fips helper to verify fips modules, linked
+  to openssl.
+
flac
+- Fix out of bound write in append_to_verify_fifo_interleaved_
+  (CVE-2021-0561 bsc#1196660):
+  libFlac-Exit-at-EOS-in-verify-mode.patch
+
+- Fix memory leak (CVE-2020-0487 bsc#1180112):
+  stream_decoder.c-Fix-a-memory-leak.patch
+
+- Fix out-of-bounds access (CVE-2020-0499 bsc#1180099):
+  libFLAC-bitreader.c-Fix-out-of-bounds-read.patch
+
+- Fix memory leak in read_metadata_vorbiscomment_() function
+  (CVE-2017-6888, bsc#1091045):
+  flac-CVE-2017-6888.patch
+
+- Update to version 1.3.2
+  * Fix undefined behaviour using GCC/Clang UBSAN (erikd).
+  * General hardening via fuzz testing with AFL (erikd and
+    others).
+  * General code improvements (lvqcl, erikd and others).
+  * Add FLAC in MP4 specification docs (Ralph Giles).
+  * Fix some cppcheck warnings (erikd).
+  * Assume all currently used OSes support SSE2.
+  flac:
+  * Fix potential infinite loop on flac-to-flac conversion
+    (erikd).
+  * Add WAVEFORMATEXTENSIBLE to WAV (as needed) when
+    decoding (lvqcl).
+  * Only write vorbis-comments if they are non-empty.
+  * Error out if decoding RAW with bits != (8|16|24).
+  metaflac:
+  * Add --scan-replay-gain option.
+  libraries:
+  * CPU detection cleanup and fixes (Julian Calaby, erikd
+    and lvqcl).
+  * Fix two stream decoder bugs (Max Kellermann).
+  * Fix a NULL dereference bug (on a malformed file).
+  * Changed the LPC order guess for a slight compression
+    improvement, particularly for classical music
+    (Martijn van Beurden).
+  * Improved encoding speed on older Intel CPUs.
+  * Fixed a seeking bug when decoding certain files
+    (Miroslav Lichvar).
+  * Put an upper bound (32768) on the number of seek
+    points.
+  * Fix potential memory leaks.
+  * Support 64bit brword/bwword allowing
+    FLAC__BYTES_PER_WORD to be set to 8 (disabled by
+    default).
+  * Fix an out-of-bounds heap read.
+- Refreshed flac-cflags.patch
+
+- Drop patch that should be upstreamed first, otherwise we will
+  have to keep it ofrever:
+  * flac-ocloexec.patch
+- Drop wrong patch:
+  * flac-fix-pkgconfig.patch
+    + If using this change you get assert.h include overriden in your
+    project by the one from FLAC/ which is not what upstream desired
+    If packages fail to build they should fix their include
+
+- Build documentation as noarch
+
+- Cleanup spec file with spec-cleaner
+- Update url
+- Remove no longer needed patches
+  * flac-fix-CVE-2014-8962.patch
+  * flac-fix-CVE-2014-9028.patch
+  * 0001-getopt_long-not-broken-here.patch
+- Remove following as benefit of using openssl is small
+  * 0001-Allow-use-of-openSSL.patch
+- Add flac-cflags.patch
+- Use doxygen to build documentation
+- Split documentation to separate package
+- Update to 1.3.1
+  * Improved decoding efficiency of all bit depths but especially
+    so for 24 bits for IA32 architecture (lvqcl and Miroslav Lichvar).
+  * Faster encoding using SSE and AVX (lvqcl).
+  * Fixed bartlett, bartlett_hann and triangle functions.
+  * New apodization functions partial_tukey and punchout_tukey for
+    improved compression (Martijn van Beurden).
+  * Retuned compression presets to incorporate new apodization
+    functions (Martijn van Beurden).
+  * Fix -Wcast-align warnings on armhf architecture (Erik de
+    Castro Lopo).
+  * Help output documentation improvements.
+  * I/O buffering improvements on Windows to reduce disk
+    fragmentation when writing files.
+  * Only write vorbis-comments if they are non-empty.
+  * Fix symbol visibility in XMMS plugin.
+  * Many fixes and improvements across all the build systems.
+  * Fix CVE-2014-9028 (heap write overflow) and CVE-2014-8962
+    (heap read overflow)
+
+- A couple of security fixes:
+  * flac-fix-CVE-2014-8962.patch:
+    arbitrary code execution by a stack overflow (CVE-2014-8962,
+    bnc#906831)
+  * flac-fix-CVE-2014-9028.patch:
+    Heap overflow via specially crafted .flac files (CVE-2014-9028,
+    bnc#907016)
+
+- Update to final upstream release 1.3.0
+  * No user-visible changes
+- More robust make install call
+
flatpak
+- Update to version 1.14.4 (bsc#1209410, bsc#1209411):
+  + Security fixes:
+  - Escape special characters when displaying permissions and
+    metadata, preventing malicious apps from manipulating the
+    appearance of the permissions list using crafted metadata
+    (CVE-2023-28101).
+  - If a Flatpak app is run on a Linux virtual console
+    (tty1, tty2, etc.), don't allow copy/paste via the TIOCLINUX
+    ioctl (CVE-2023-28100).
+    Note that this is specific to virtual consoles: Flatpak is
+    not vulnerable to this if run from a graphical terminal
+    emulator such as xterm, gnome-terminal or Konsole.
+  + Other bug fixes:
+  - Translation update: pl
+- Changes from version 1.14.3:
+  + Bug fixes:
+  - When splitting an upgrade into two steps (download without
+    installing, and then upgrade without allowing further
+    downloads) like GNOME Software does, if an app is marked EOL
+    and superseded by a replacement, don't remove the superseded
+    app in the first step, which would result in the replacement
+    incorrectly not being installed
+  - Fix a crash when --socket=gpg-agent is used
+  - Fix a crash when listing apps if one of them is broken or
+    misconfigured
+  - If an app has invalid syntax in its overrides or metadata,
+    mention the filename in the error message
+  - Unset $GDK_BACKEND for apps, ensuring GTK apps with
+  - -socket=fallback-x11 can work
+  - Never try to export a parent of reserved directories as a
+  - -filesystem, for example /run, which would prevent the app
+    from starting
+  - Never try to export a --filesystem below /run/flatpak or
+    /run/host, which could similarly prevent the app from starting
+  - The above change also fixes apps not starting if a
+  - -filesystem is a symlink to the root directory
+  - Show a warning when the --filesystem exists but cannot be
+    shared with the sandbox
+- Changes from version 1.14.2:
+  + Bug fixes:
+  - Display the intended messages for `flatpak repair`
+  - Exporting an app to an existing repository on a CIFS
+    filesystem now works as intended
+  - Unset $GIO_EXTRA_MODULES for apps, avoiding misbehaviour in
+    some GLib apps when set to a path on the host
+  - Unset $XKB_CONFIG_ROOT for apps, avoiding crashes in GTK and
+    Qt apps under Wayland when this variable is set to a path not
+    available in the sandbox
+  - Unset $KRB5CCNAME for apps
+  - When using the fish shell, avoid duplicate XDG_DATA_DIRS
+    entries if the profile script is sourced more than once
+  + Internal changes:
+  - The INFO log level is now treated the same as the DEBUG log
+    level by `flatpak -v`, to make backports from 1.15.x simpler
+
fltk
+- explicitly pass -fPIC and -pie via CFLAGS and LDFLAGS to make /usr/bin/fluid
+  an position-independent executable. fltk by default passed -fPIC but not
+  - pie, which breaks our gcc-PIE profile. (bsc#1184122).
+
+- added xcursor dependency [bsc#1077881]
+
+- Trim description, drop TM/R marks according to guidelines.
+
+- Drop patch fltk-1.3.2-do_not_add_unneeded_extra_dependencies.patch
+  as upstream closed the ticked stating it is wrong
+- Add patch fltk-1.3.4-fltk_config.patch
+
+- Explicitly package %{_docdir}/fltk-devel in order to fix build
+  with RPM 4.13.0.
+
+- updated to 1.3.4: see CHANGES
+- remove fltk-1.3.3-do-not-use-internal-ABI.patch (upstreamed)
+
+- Add fltk-1.3.3-do-not-use-internal-ABI.patch: do not use internal
+  function Fl_XFont_On_Demand::value(), which changes ABI based on
+  the configuration. Add a fl_core_font() getter for the same.
+
+- Update to version 1.3.3
+  +Very much changes; please have a look on CHANGES file
+- Remove fltk-1.3.2-underlinking.patch; merged upstream
+
+- Correct -devel package dependencies
+  * /usr/include/FL/x*.H needs x11 headers
+  * /usr/include/FL/gl*.H needs gl headers.
+
+- added a fltk-devel-static subpackage to transport libfltk*.a
+  as needed by Documentation:Tools/flpsed.
+
fmpp
+- Build with source and target levels 8
+- Modified patch:
+  * fmpp-0.9.16-build.xml.patch
+    + Allow specifying the source and target levels on command-line
+
frameworkintegration
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * port to standard C++ smart pointers where possible
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- No code change since 5.93.0
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add Linux Qt6 CI
+  * Install plugin in kf<version>
+  * Fix wrong porting of KNSCore::Engine::configSearchLocations (kde#448237)
+  * Change build system for building against qt6
+- Drop 0001-Fix-wrong-porting-of-KNSCore-Engine-configSearchLoca.patch
+  Merged upstream
+
freemarker
+- Modified patch:
+  * javacc-7.patch
+    + fix build with javacc 7.0.11
+
+- Update to v2.3.31
+- Update patches:
+  * enable-jdom.patch
+  * javacc-7.patch
+  * jsp-api.patch
+  * jython-compatibility.patch
+  * no-javarebel.patch
+- Remove unneeded patch:
+  * fix-javadoc-encoding.patch
+- Package the manual. Add build dependency on
+  docbook5-xsl-stylesheets
+
+- On supported platforms, avoid building with OpenJ9, in order to
+  prevent build cycles
+
freetype2
+- disable brotli linkage / WOFF2 support for now to keep dependencies
+  as before.
+
+- Added patches:
+  * CVE-2022-27404.patch
+    + fixes bsc#1198830, CVE-2022-27404: Buffer Overflow
+  * CVE-2022-27405.patch
+    + fixes bsc#1198832, CVE-2022-27405: Segmentation Fault
+  * CVE-2022-27406.patch
+    + fixes bsc#1198823, CVE-2022-27406: Segmentation violation
+
+- Update to version 2.10.4
+  * Fix a heap buffer overflow has been found  in the handling of
+    embedded PNG bitmaps, introduced in FreeType version 2.6
+    (CVE-2020-15999 bsc#1177914)
+  * Minor improvements to the B/W rasterizer.
+  * Auto-hinter support for Medefaidrin script.
+  * Fix various  memory leaks (mainly  for CFF) and other  issues that
+    might cause crashes in rare circumstances.
+
+- Update to version 2.10.2
+  * Support for WOFF2 fonts, add BR on pkgconfig(libbrotlidec)
+  * Function `FT_Get_Var_Axis_Flags' returned random data for Type 1
+    MM fonts.
+  * Type 1 fonts with non-integer metrics are now supported by the new
+    (CFF) engine introduced in FreeType 2.9.
+  * Drop support for Python 2 in Freetype's API reference generator
+  * Auto-hinter support for Hanifi Rohingya
+  * Document the `FT2_KEEP_ALIVE' debugging environment variable.
+
+- Use the compiler default C std, since 2012 gcc defaults
+  have changed, we now only need to get rid of ANSIFLAGS, override
+  that variable instead.
+
+- Update to version 2.10.1
+  * The bytecode hinting of OpenType variation fonts was flawed, since
+    the data in the `CVAR' table wasn't correctly applied.
+  * Auto-hinter support for Mongolian.
+  * The handling of  the default character in PCF fonts as  introduced
+    in version 2.10.0 was partially broken, causing premature abortion
+    of charmap iteration for many fonts.
+  * If  `FT_Set_Named_Instance' was  called  with  the same  arguments
+    twice in a row, the function  returned an incorrect error code the
+    second time.
+  * Direct   rendering   using  FT_RASTER_FLAG_DIRECT   crashed   (bug
+    introduced in version 2.10.0).
+  * Increased  precision  while  computing  OpenType  font   variation
+    instances.
+  * The  flattening  algorithm of  cubic  Bezier  curves was  slightly
+    changed to make  it faster.  This can cause  very subtle rendering
+    changes, which aren't noticeable by the eye, however.
+  * The  auto-hinter  now  disables hinting  if there  are blue  zones
+    defined for a `style' (i.e., a certain combination of a script and
+    its related typographic features) but the font doesn't contain any
+    characters needed to set up at least one blue zone.
+- Add tarball signatures and freetype2.keyring
+
+- Update to version 2.10.0
+  * A bunch of new functions has been added to access and process
+    COLR/CPAL data of OpenType fonts with color-layered glyphs.
+  * As a GSoC 2018 project, Nikhil Ramakrishnan completely
+    overhauled and modernized the API reference.
+  * The logic for computing the global ascender, descender, and
+    height of OpenType fonts has been slightly adjusted for
+    consistency.
+  * `TT_Set_MM_Blend' could fail if called repeatedly with the same
+    arguments.
+  * The precision of handling deltas in Variation Fonts has been
+    increased.The problem did only show up with multidimensional
+    designspaces.
+  * New function `FT_Library_SetLcdGeometry' to set up the geometry
+    of LCD subpixels.
+  * FreeType now uses the `defaultChar' property of PCF fonts to set
+    the  glyph for  the undefined  character  at glyph  index 0  (as
+    FreeType already does for all other supported font formats).  As
+    a consequence, the order of glyphs of a PCF font if accessed
+    with  FreeType can be different now compared to previous
+    versions.
+    This change doesn't affect PCF font access with cmaps.
+  * `FT_Select_Charmap' has been changed to allow  parameter value
+    `FT_ENCODING_NONE', which is valid for BDF, PCF, and Windows FNT
+    formats to access built-in cmaps that don't have a predefined
+    `FT_Encoding' value.
+  * A previously reserved field in the `FT_GlyphSlotRec' structure
+    now holds the glyph index.
+  * The usual round of fuzzer bug fixes to better reject malformed
+    fonts.
+  * `FT_Outline_New_Internal' and `FT_Outline_Done_Internal' have
+    been removed.These two functions were public by oversight only
+    and were never documented.
+  * A new function `FT_Error_String' returns descriptions of error
+    codes if configuration macro FT_CONFIG_OPTION_ERROR_STRINGS is
+    defined.
+  * `FT_Set_MM_WeightVector' and `FT_Get_MM_WeightVector' are new
+    functions limited to Adobe MultiMaster fonts to directly set and
+    get the weight vector.
+
+- Remove old ppc64 parts in spec file
+- Refresh patches:
+  + bugzilla-308961-cmex-workaround.patch
+  + don-t-mark-libpng-as-required-library.patch
+  + enable-long-family-names-by-default.patch
+- Enable subpixel rendering with infinality config:
+  + enable-subpixel-rendering.patch
+  + enable-infinality-subpixel-hinting.patch
+
+- Re-enable freetype-config, there is just too many fallouts.
+
+- Update to version 2.9.1
+  * Type 1 fonts containing flex features were not rendered
+    correctly (bug introduced in version 2.9).
+  * CVE-2018-6942: Older FreeType versions can crash with certain
+    malformed variation fonts.
+  * Bug fix: Multiple calls to `FT_Get_MM_Var' returned garbage.
+  * Emboldening of bitmaps didn't work correctly sometimes, showing
+    various artifacts (bug introduced in version 2.8.1).
+  * The auto-hinter script ranges have  been updated for Unicode 11.
+    No support for new scripts have been added, however,  with the
+    exception of Georgian Mtavruli.
+- freetype-config is now deprecated by upstream and not enabled
+  by default.
+- Drop upstreamed patches:
+  * bnc1079600.patch
+  * psaux-flex.patch
+  * 0001-src-truetype-ttinterp.c-Ins_GETVARIATION-Avoid-NULL-.patch
+  * 0001-truetype-Better-protection-against-invalid-VF-data.patch
+
+- Add bnc1079600.patch: Fix several integer overflow issues in
+  truetype/ttinterp.c (bsc#1079600)
+
+- Refresh spec-file via spec-cleaner.
+- Add shell script freetype2.sh in separate package
+  freetype2-profile-tti35 in order to be able to set TrueType
+  interpreter version 35 (boo#1084085).
+
+- Added patch:
+  * enable-long-family-names-by-default.patch
+    + Define PCF_CONFIG_OPTION_LONG_FAMILY_NAMES to obtain 2.7.1
+    behaviour
+
+- Added patches:
+  * 0001-src-truetype-ttinterp.c-Ins_GETVARIATION-Avoid-NULL-.patch
+    + Upstream fix for bsc#1079603: Avoid NULL reference in
+    src/truetype/ttinterp.c
+  * 0001-truetype-Better-protection-against-invalid-VF-data.patch
+    + Upstream fix for bsc#1079601: Protection against invalid VF
+    data
+
+- Add psaux-flex.patch to fix a regression in Type1 rendering
+
+- Update to version 2.9
+  * Advance width values of variation fonts were often wrong.
+  * More fixes for variation font support; you should update to
+    this version if you want to support them.
+  * As a GSoC project, Ewald Hew extended the new (Adobe) CFF
+    engine to handle Type 1 fonts also, thus greatly improving
+    the rendering of this format. This is the new default.
+  * A new function, `FT_Set_Named_Instance', can be used to set
+    or change the current named instance.
+  * Starting with this FreeType version, resetting variation
+    coordinates will return to the currently selected named
+    instance. Previously, FreeType returned to the base font
+    (i.e., no instance set).
+  * Some fuzzer fixes to better reject malformed fonts.
+
+- Update to version 2.8.1
+  * B/W  hinting   of  TrueType   fonts  didn't  work   properly  if
+    interpreter version 38 or 40 was selected.
+  * Some severe  problems within the handling  of TrueType Variation
+    Fonts were found and fixed.
+  * Function `FT_Set_Var_Design_Coordinates' didn't correctly handle
+    the case with less input coordinates than axes.
+  * By default,  FreeType  now offers  high  quality  LCD-optimized
+    output  without resorting to ClearType techniques of resolution
+    tripling and filtering.  In this method,  called Harmony,  each
+    color channel is generated separately  after shifting the glyph
+    outline,  capitalizing on the fact  that the color grids on LCD
+    panels  are  shifted  by  a third  of  a pixel.  This output is
+    indistinguishable from ClearType with a light 3-tap filter.
+  * Using the  new function `FT_Get_Var_Axis_Flags',  an application
+    can access the `flags' field  of a variation axis (introduced in
+    OpenType version 1.8.2)
+  * FreeType  now synthesizes  a  missing Unicode  cmap for  (older)
+    TrueType fonts also if glyph names are available.
+  * The warping option  has moved  from `light'  to `normal' hinting
+    where  it replaces  the original hinting algorithm.  The `light'
+    mode is now always void of any hinting in x-direction.
+
+- Update to version 2.8
+  * Support for OpenType Variation Fonts is now complete. The last
+    missing part was handling the `VVAR' and `MVAR' tables, which is
+    available with this release.
+  * A new  function `FT_Face_Properties' allows the  control of some
+    module  and   library  properties  per  font.    Currently,  the
+    following properties can be  handled: stem darkening, LCD filter
+    weights, and the random seed for the `random' CFF operator.
+  * The PCF change to show more `colourful' family names (introduced
+    in version 2.7.1) was too radical; it can now be configured with
+    PCF_CONFIG_OPTION_LONG_FAMILY_NAMES   at   compile   time.    If
+    activated, it can  be switched off at run time  with the new pcf
+    property  `no-long-family-names'.  If  the `FREETYPE_PROPERTIES'
+    environment variable is available, you can say
+    FREETYPE_PROPERTIES=pcf:no-long-family-names=1
+  * Support  for  the  following  scripts  has  been  added  to  the
+    auto-hinter.
+    Adlam, Avestan, Bamum, Buhid, Carian, Chakma, Coptic, Cypriot,
+    Deseret, Glagolitic, Gothic, Kayah, Lisu, N'Ko, Ol Chiki, Old
+    Turkic, Osage, Osmanya, Saurashtra, Shavian, Sundanese, Tai
+    Viet, Tifinagh, Unified Canadian Syllabics, Vai
+  * `Light' auto-hinting  mode no  longer uses TrueType  metrics for
+    TrueType  fonts.   This bug  was  introduced  in version  2.4.6,
+    causing   horizontal  scaling   also.    Almost  all   GNU/Linux
+    distributions (with Fedora as  a notable exception) disabled the
+    corresponding patch for good reasons; chances are thus high that
+    you won't notice a difference.
+  * If a TrueType font gets loaded with FT_LOAD_NO_HINTING, FreeType
+    now scales  the font linearly  again (bug introduced  in version
+    2.4.6).
+  * Fixed CVE-2017-8105,  CVE-2017-8287:  Older   FreeType  versions
+    have out-of-bounds  writes  caused  by  heap-based  buffer  overflows
+    related to Type 1 fonts. (boo#1035807, boo#1036457)
+- See https://sourceforge.net/projects/freetype/files/freetype2/2.8/ for
+  the complete changelog.
+
+- Update to version 2.7.1:
+  * IMPORTANT CHANGES
+    + Support for the new CFF2 font format as introduced with
+    OpenType 1.8 has been contributed by Dave Arnolds from Adobe.
+    + Preliminary support for variation fonts as specified in
+    OpenType 1.8 (in addition to the already existing support for
+    Adobe's MM and Apple's GX formats). Dave Arnolds contributed
+    handling of advance width change variation; more will come in
+    the next version.
+  * IMPORTANT BUG FIXES
+    + Handling of raw CID fonts was partially broken (bug introduced
+    in 2.6.4).
+  * MISCELLANEOUS
+    + Some limits for TrueType bytecode execution have been tightened
+    to speed up FreeType's handling of malformed fonts, in
+    particular to quickly abort endless loops.
+    + The number of twilight points can no longer be set to an
+    arbitrarily large value.
+    + The total number of jump opcode instructions (like JMPR) with
+    negative arguments is dynamically restricted; the same holds
+    for the total number of iterations in LOOPCALL opcodes.
+    + The dynamic limits are based on the number of points in a glyph
+    and the number of CVT entries. Please report if you encounter a
+    font where the selected values are not adequate.
+    + PCF family names are made more `colourful'; they now include the
+    foundry and information whether they contain wide characters.
+    For example, you no longer get `Fixed' but rather `Sony Fixed'
+    or `Misc Fixed Wide'.
+    + A new function `FT_Get_Var_Blend_Coordinates' (with its alias
+    name `FT_Get_MM_Blend_Coordinates') to retrieve the normalized
+    blend coordinates of the currently selected variation instance
+    has been added to the Multiple Masters interface.
+    + A new function `FT_Get_Var_Design_Coordinates' to retrieve the
+    design coordinates of the currently selected variation instance
+    has been added to the Multiple Masters interface.
+    + A new load flag `FT_LOAD_BITMAP_METRICS_ONLY' to retrieve bitmap
+    information without loading the (embedded) bitmap itself.
+    + Retrieving advance widths from bitmap strikes (using
+    `FT_Get_Advance' and `FT_Get_Advances') have been sped up.
+    + The usual round of fuzzer fixes to better reject malformed
+    fonts.
+- Drop freetype2-bitmap-foundry.patch, merged upstream.
+
+- update to version 2.7:
+  * IMPORTANT CHANGES
+    + As announced earlier, the 2.7.x series now uses the new subpixel
+    hinting  mode as  the  default, emulating  a  modern version  of
+    ClearType.
+    This change inevitably leads to different rendering results, and
+    you   might   change   the   `TT_CONFIG_OPTION_SUBPIXEL_HINTING'
+    configuration option to  adapt it to your taste (or  use the new
+    `FREETYPE_PROPERTIES'    environment    variable).    See    the
+    corresponding entry  below for  version 2.6.4, which  gives more
+    information.
+    + A new option  `FT_CONFIG_OPTION_ENVIRONMENT_PROPERTIES' has been
+    introduced.   If  set (which  is  the  default), an  environment
+    variable  `FREETYPE_PROPERTIES' can  be used  to control  driver
+    properties.  Example:
+    FREETYPE_PROPERTIES=truetype:interpreter-version=35 \
+    cff:no-stem-darkening=1 \
+    autofitter:warping=1
+    This allows to select, say, the subpixel hinting mode at runtime
+    for a given application.  See file `ftoption.h' for more.
+  * IMPORTANT BUG FIXES
+    + After  loading a  named instance  of  a GX  variation font,  the
+    `face_index'  value  in  the returned  `FT_Face'  structure  now
+    correctly holds the named instance  index in the upper 16bits as
+    documented.
+  * MISCELLANEOUS
+    + A new macro `FT_IS_NAMED_INSTANCE' to  test whether a given face
+    is a named instance.
+    + More fixes to GX font handling.
+    + Apple's   `GETVARIATION'  bytecode   operator  (needed   for  GX
+    variation font support) has been implemented.
+    + Another round  of fuzzer fixes,  mainly to reject  invalid fonts
+    faster.
+    + Handling of raw CID fonts  was broken (bug introduced in version
+    2.6.4).
+    + The smooth rasterizer has been streamlined  to make it faster by
+    approx. 20%.
+    + The `ftgrid'  demo program now  understands command  line option
+    `-d' to give start-up design coordinates.
+    + The `ftdump' demo program has  a new command line option `-p' to
+    dump TrueType bytecode instructions.
+- removed freetype2-subpixel.patch in favor of above
+  FREETYPE_PROPERTIES environment variable
+
+- Update to version 2.6.5:
+  + Compilation works again  on Mac OS X (bug introduced in version
+    2.6.4).
+  + The new  subpixel hinting  mode is now  disabled by  default; it
+    will  be enabled  by default  in the  forthcoming 2.7.x  series.
+    Main reason for reverting this feature is the principle of least
+    surprise: a  sudden change in  appearance of all fonts  (even if
+    the rendering improves  for almost all recent  fonts) should not
+    be expected in a new micro version of a series.
+- Rebase freetype2-subpixel.patch.
+
+- Upadte to version 2.6.4:
+  * A new subpixel hinting mode, which is now the default rendering
+    mode for TrueType fonts. It implements (almost everything of)
+    version 40 of the bytecode engine. The existing code base in
+    FreeType (the `Infinality code') was stripped to the bare
+    minimum and all configurability removed in the name of speed
+    and simplicity. The configurability was mainly aimed at legacy
+    fonts like Arial, Times New Roman, or Courier. [Legacy fonts
+    are fonts that modify vertical stems to achieve clean
+    black-and-white bitmaps.] The new mode focuses on applying a
+    minimal set of rules to all fonts indiscriminately so that
+    modern and web fonts render well while legacy fonts render
+    okay. Activation of the subpixel hinting support can be
+    controlled with the `TT_CONFIG_OPTION_SUBPIXEL_HINTING'
+    configuration option at compile time: If set to value 1, you
+    get the old Infinality mode (which was never the default due to
+    its slowness). Value 2 activates the new subpixel hinting mode,
+    and value 3 activates both. The default is value 2. At run
+    time, you can select the subpixel hinting mode with the
+    `interpreter-version' property (provided you have compiled in
+    the corresponding hinting mode); see `ftttdrv.h' for more.
+  * Support for the following scripts has been added to the
+    auto-hinter: Armenian, Cherokee, Ethiopic, Georgian, Gujarati,
+    Gurmukhi, Malayalam, Sinhala, Tamil.
+- Rebase freetype2-subpixel.patch.
+
+- Update to version 2.6.3
+  * IMPORTANT CHANGES
+  - Khmer,  Myanmar, Bengali,  and Kannada  script support  has been
+    added to the auto-hinter.
+  * MISCELLANEOUS
+  - Better  support of  Indic  scripts like  Devanagari  by using  a
+    top-to-bottom hinting flow.
+  - All  FreeType macros  starting  with two  underscores have  been
+    renamed to  avoid a violation of  both the C and  C++ standards.
+    Example: Header  macros of the  form `__FOO_H__' are  now called
+    `FOO_H_'.  In most cases,  this should be completely transparent
+    to the user.   The exception to this  is `__FTERRORS_H__', which
+    must be  sometimes undefined by  the user to get  FreeType error
+    strings:  Both this  form and  the new  `FTERRORS_H_' macro  are
+    accepted for backwards compatibility.
+  - Minor improvements mainly to the Type 1 driver.
+  - The  new CFF  engine now  supports all  Type 2  operators except
+    `random'.
+  - The macro `_STANDALONE_', used for  compiling the B/W and smooth
+    rasterizers  as   stand-alone  modules,  has  been   renamed  to
+    `STANDALONE_', since macro names starting with an underscore and
+    followed by an uppercase letter are reserved in both C and C++.
+  - Function  `FT_Library_SetLcdFilterWeights'  now  also  activates
+    custom LCD filter weights (instead of just adjusting them).
+  - Support for  `unpatented hinting'  has been  completely removed:
+    Consequently,  the two  functions `FT_Face_CheckTrueTypePatents'
+    and  `FT_Face_SetUnpatentedHinting'  now  return  always  false,
+    doing nothing.
+
+- Update to version 2.6.2
+  * IMPORTANT CHANGES
+  - The auto-hinter now supports stem darkening, to be controlled by
+    the    new   `no-stem-darkening'    and   `darkening-parameters'
+    properties.   This is  an  experimental  feature contributed  by
+    Nikolaus Waxweiler, and  the interface might change  in a future
+    release.
+  - By default, stem darkening is now switched off (for both the CFF
+    engine and the  auto-hinter).  The main reason is  that you need
+    linear  alpha  blending  and  gamma correction  to  get  correct
+    rendering results, and  the latter is not yet  available in most
+    freely  available  rendering  stacks like  X11.   Applying  stem
+    darkening without proper gamma correction  leads to far too dark
+    rendering results.
+  - The   meaning  of   `FT_RENDER_MODE_LIGHT'  has   been  slightly
+    modified.   It  now  essentially  means `no  hinting  along  the
+    horizontal  axis'; in  particular,  no change  of glyph  advance
+    widths.  Consequently, the auto-hinter  is used for all scalable
+    font  formats  except  for  CFF.    It  is  planned  that  other
+    font-specific rendering engines (TrueType, Type 1) will follow.
+  * MISCELLANEOUS
+  - The default  LCD filter  has been changed  to be  normalized and
+    color-balanced.
+  - For    better    compatibility   with    FontConfig,    function
+    `FT_Library_SetLcdFilter'  accepts   a  new   enumeration  value
+    `FT_LCD_FILTER_LEGACY1'   (which  has   the   same  meaning   as
+    `FT_LCD_FILTER_LEGACY').
+  - A large number of bugs have been detected by using the libFuzzer
+    framework,  which should  further  improve  handling of  invalid
+    fonts.  Thanks again to Kostya Serebryany and Bungeman!
+  - `TT_CONFIG_OPTION_MAX_RUNNABLE_OPCODES',  a   new  configuration
+    option, controls the maximum number of executed opcodes within a
+    bytecode program.  You don't want to change this except for very
+    special  situations (e.g.,  making a  library fuzzer  spend less
+    time to handle broken fonts).
+  - The smooth renderer has been made faster.
+
+- Update to version 2.6.1
+  * IMPORTANT BUG FIXES
+  - It turned  out that for CFFs  only the advance widths  should be
+    taken from the  `htmx' table, not the side  bearings.  This bug,
+    introduced in  version 2.6.0, makes  it necessary to  upgrade if
+    you are using  CFFs; otherwise, you get cropped  glyphs with GUI
+    interfaces like GTK or Qt.
+  - Accessing Type 42 fonts returned  incorrect results if the glyph
+    order of the embedded TrueType font differs from the glyph order
+    of the Type 42 charstrings table.
+  * IMPORTANT CHANGES
+  - The header  file layout  has been  changed (again),  moving  all
+    header files except `ft2build.h' into a subdirectory tree.
+    Doing so  reduces the  possibility of  header file  name clashes
+    (e.g., FTGL's  `FTGlyph.h' with FreeType's `ftglyph.h')  on case
+    insensitive file systems like Mac OS X or Windows.
+    Applications  that  use  (a)  the  `freetype-config'  script  or
+    FreeType's `freetype2.pc' file for pkg-config to get the include
+    directory  for the  compiler,  and (b)  the  documented way  for
+    header inclusion like
+    [#]include <ft2build.h>
+    [#]include FT_FREETYPE_H
+    ...
+    don't need any change to the source code.
+  - Simple access  to named instances  in GX variation fonts  is now
+    available (in addition to the  previous method via FreeType's MM
+    interface).   In  the `FT_Face'  structure,  bits  16-30 of  the
+    `face_index' field hold the current named instance index for the
+    given face  index, and bits  16-30 of `style_flags'  contain the
+    number of  instances for  the given face  index.  `FT_Open_Face'
+    and friends also understand the  extended bits of the face index
+    parameter.
+    You need to enable  TT_CONFIG_OPTION_GX_VAR_SUPPORT for this new
+    feature.  Otherwise, bits  16-30 of the two fields  are zero (or
+    are ignored).
+  - Lao script support has been added to the auto-hinter.
+  * MISCELLANEOUS
+  - The auto-hinter's Arabic script support has been enhanced.
+  - Superscript-like and  subscript-like glyphs  as used  by various
+    phonetic alphabets like the IPA  are now better supported by the
+    auto-hinter.
+  - The TrueType bytecode interpreter now runs slightly faster.
+  - Improved support for builds with cmake.
+  - The  function  `FT_CeilFix'  now   always  rounds  towards  plus
+    infinity.
+  - The  function  `FT_FloorFix'  now always  rounds  towards  minus
+    infinity.
+  - A  new load  flag `FT_LOAD_COMPUTE_METRICS'  has been  added; it
+    makes FreeType  ignore pre-computed  metrics, as needed  by font
+    validating  or  font  editing  programs.  Right  now,  only  the
+    TrueType  module supports  it  to ignore  data  from the  `hdmx'
+    table.
+  - Another round of bug fixes  to better handle broken fonts, found
+    by Kostya Serebryany <kcc@google.com>.
+- Dropping upstreamed patch Dont-use-hmtx-table-for-LSB.patch.
+
+- Add Dont-use-hmtx-table-for-LSB.patch: Fixes gnu#45520, cut off
+  fonts in gtk and qt. Taken from upstream git.
+
+- Update to version 2.6
+  * Thread safety improvements
+  * Thai script support has been added to the auto-hinter.
+  * Arabic script support has been added to the auto-hinter.
+  * Following OpenType version 1.7,  advance widths and side bearing
+    values in  CFFs (wrapped  in an SFNT  structure) are  now always
+    taken from the `hmtx' table.
+  * Following OpenType  version 1.7, the  PostScript font name  of a
+    CFF font (wrapped in an SFNT structure) is now always taken from
+    the `name'  table.  This is  also true for  OpenType Collections
+    (i.e., TTCs using  CFFs subfonts instead of TTFs),  where it may
+    have a significant difference.
+  * Fonts natively hinted for  ClearType are now supported, properly
+    handling selector index 3 of the INSTCTRL bytecode instruction.
+  * Major improvements to the GX TrueType variation font handling.
+
+- Merge with the version 2.5.5 from openSUSE:Factory
+- Removed patches:
+  * CVE-2014-9656.patch
+  * CVE-2014-9657.patch
+  * CVE-2014-9658.patch
+  * CVE-2014-9659.patch
+  * CVE-2014-9660.patch
+  * CVE-2014-9661.patch
+  * CVE-2014-9662.patch
+  * CVE-2014-9663.patch
+  * CVE-2014-9664.patch
+  * CVE-2014-9665.patch
+  * CVE-2014-9666.patch
+  * CVE-2014-9667.patch
+  * CVE-2014-9668.patch
+  * CVE-2014-9669.patch
+  * CVE-2014-9670.patch
+  * CVE-2014-9671.patch
+  * CVE-2014-9672.patch
+  * CVE-2014-9673.patch
+  * CVE-2014-9674.patch
+  * CVE-2014-9675.patch
+  - Integrated in the 2.5.5 release
+- Modified patches:
+  * don-t-mark-libpng-as-required-library.patch
+  * bugzilla-308961-cmex-workaround.patch
+  * freetype2-subpixel.patch
+  * freetype2-bitmap-foundry.patch
+  * overflow.patch
+  - Adapt to the new version of sources
+
+- Modified patch:
+  * CVE-2014-9671.patch
+  - Adapt the code to correspond to the current git master of
+    freetype2 (fixes bsc#933247)
+
+- Enable the bz2 compression in freetype2
+- Remove patch overflow.patch from freetype2.spec where it is not
+  applied.
+- Run spec-cleaner on the spec file.
+
+- fixed vulnerabilities (bnc#916847, bnc#916856, bnc#916857,
+  bnc#916858, bnc#916859, bnc#916860, bnc#916861, bnc#916862,
+  bnc#916863, bnc#916864, bnc#916865, bnc#916867, bnc#916868,
+  bnc#916870, bnc#916871, bnc#916872, bnc#916873, bnc#916874,
+  bnc#916879, bnc#916881)
+  - CVE-2014-9656.patch
+  - CVE-2014-9657.patch
+  - CVE-2014-9658.patch
+  - CVE-2014-9659.patch
+  - CVE-2014-9660.patch
+  - CVE-2014-9661.patch
+  - CVE-2014-9662.patch
+  - CVE-2014-9663.patch
+  - CVE-2014-9664.patch
+  - CVE-2014-9665.patch
+  - CVE-2014-9666.patch
+  - CVE-2014-9667.patch
+  - CVE-2014-9668.patch
+  - CVE-2014-9669.patch
+  - CVE-2014-9670.patch
+  - CVE-2014-9671.patch
+  - CVE-2014-9672.patch
+  - CVE-2014-9673.patch
+  - CVE-2014-9674.patch
+  - CVE-2014-9675.patch
+
+- Update to version 2.5.5
+  * IMPORTANT BUG FIXES
+  - Handling of  uncompressed PCF files works again (bug
+    introduced in version 2.5.4).
+- Drop freetype2-2.5.3-fix-pcf.patch, merged upstream
+
+- Update to version 2.5.4
+  * IMPORTANT BUG FIXES
+  - A variant of vulnerability CVE-2014-2240 was identified
+    (cf.  http://savannah.nongnu.org/bugs/?43661) and fixed
+    in  the new CFF driver.  All users should upgrade.
+  - The new auto-hinter code using HarfBuzz crashed for some
+    invalid fonts.
+  - Many fixes to better protect against malformed input.
+  * IMPORTANT CHANGES
+  - Full auto-hinter support of the Devanagari script.
+  - Experimental auto-hinter support of the Telugu script.
+  - CFF stem darkening behaviour can now be controlled at
+    build time using the eight macros
+    CFF_CONFIG_OPTION_DARKENING_PARAMETER_{X,Y}{1,2,3,4}    .
+  - Some fields in the `FT_Bitmap'  structure have been changed
+    from signed to unsigned type, which better reflects
+    the actual usage. It is also an additional means to
+    protect against malformed input. This change doesn't break
+    the ABI; however, it might cause compiler warnings.
+  * MISCELLANEOUS
+  - Improvements to  the auto-hinter's algorithm to recognize
+    stems and local extrema.
+  - Function `FT_Get_SubGlyph_Info' always returned an error
+    even in case of success.
+  - Version  2.5.1 introduced major bugs in the cjk part of
+    the auto-hinter, which are now fixed.
+  - The `FT_Sfnt_Tag' enumeration values have been changed to
+    uppercase,  e.g.  `FT_SFNT_HEAD'. The lowercase variants
+    are deprecated. This is for orthogonality with all other
+    enumeration (and enumeration-like) values in FreeType.
+  - `cmake' now supports builds of FreeType as an OS X framework
+    and for iOS.
+  - Improved project files for vc2010,
+    introducing a property file
+  - The documentation generator for the API reference has been
+    updated to produce  better HTML code (with proper  CSS).
+    At the same time, the documentation got a better structure.
+  - The FT_LOAD_BITMAP_CROP flag is obsolete; it is not used
+    by any driver.
+  - The TrueType DELTAP[123] bytecode instructions now work in
+    subpixel hinting mode as described in the ClearType
+    whitepaper (i.e., for touched points in the
+    non-subpixel direction).
+  - Many small improvements to the internal arithmetic routines.
+- Rebase don-t-mark-libpng-as-required-library.patch,
+  bugzilla-308961-cmex-workaround.patch, freetype2-subpixel.patch,
+  freetype2-bitmap-foundry.patch and overflow.patch
+- Add freetype2-2.5.3-fix-pcf.patch from upstream to resolve
+  http://savannah.nongnu.org/bugs/?43774, "Freetype 2.5.4 does not
+  load ungzipped PCF fonts"
+
fwupd
+- Change version 1.8.6:
+  + Fix compiling error when building s390x ppc64le
+  - add %ifnarch conditional to spec file
+  + Recover one changelog unexpectedly removed when first pushing
+    fwupd-1.8.6 to 15-SP5
+  - Thu Feb 24 06:29:53 UTC 2022 - jlee@suse.com
+  - Add fwupd-bsc1193921-nvme-ignore-non-PCI-NVMe-devices.patch
+    to ignore non-PCI NVMe devices (bnc#1193921)
+
geronimo-specs
+- On supported platforms, avoid building with OpenJ9, in order to
+  prevent build cycles.
+
+- Set version for the specs comming from tag 1_1_1 in order to
+  avoid unexpanded version macros in pom files.
+
gimp
+- Add gimp-CVE-2022-32990.patch: fix crash in
+  gimp_layer_invalidate_boundary (boo#1201192 CVE-2022-32990).
+
+- Add gimp-CVE_2022-30067.patch: fix out of memory when reading
+  XCF (boo#1199653 CVE-2022-30067).
+- Set LD_PRELOAD=/usr/lib64/libgomp.so.1 for ppc64le and aarch64,
+  to avoid "load error: cannot allocate memory in static TLS block"
+  when building.
+
+- Update to 2.10.30
+  - Core:
+  - Do not follow subpixel font rendering choice from system
+    settings for text layer rendering. These systems are useful
+    for GUI rendering on a screen of a specific type and pixel
+    order. Yet when rendering an image which can be zoomed in or
+    out, showed on various screens or even printed, subpixel font
+    rendering doesn't make sense.
+  - Rewrite the core selection drawing logics so that it works on
+    macOS Big Sur and over. This is a backport (adapted to GTK+2)
+    of the fix brought in GIMP 2.99.8 for Wayland and macOS.
+  - Ignore MakerNote metadata tag at export and only store the
+    tags that go in it, hence avoiding partial invalid metadata.
+  - Color picking from Colors dockable can now use the
+    Freedesktop portal.
+  - On Windows, move from GetICMProfile() to
+    WcsGetDefaultColorProfile() because the former is broken in
+    Windows 11.
+  - Plug-ins:
+  - metadata-viewer: improve how XMP tags with multiple values
+    are handled and shown (now each value on a separate line for
+    better readability).
+  - metadata-editor:
+  * XMP array tags of type BAG and SEQ are now on separate
+    lines.
+  * Comparing XMP tags with equivalent IPTC tags with multiple
+    values, each value is compared individually, instead of
+    comparing the list as a whole.
+  - Many robustness improvements and other fixes to the metadata
+    plug-ins.
+  - AVIF: prefer AOM encoder for export.
+  - PSD:
+  * Skip sanity check for mask of rendered layers as some layer
+    mask have invalid dimensions in such cases. They will now
+    be loaded correctly.
+  * Fixed loading of CMYK PSD files without alpha.
+  * Fixed loading of CMYK images without layers.
+  * Fixed loading of merged image of a 16 bit per channel RGBA
+    PSD file with the alpha channel opaque.
+  - PBM: large file export now always works and does not depend
+    anymore on the platform's long int size.
+  - Screenshot:
+  * GNOME shell implementation dropped because the D-Bus API
+    has been restricted to core components for security
+    reasons, thus our plug-in was failing.
+  * KDE portal moved as last fallback after the X
+    implementation (when running on X) and Freedesktop portal,
+    because KDE is also starting to block API calls for
+    security reasons.
+- drop 0001-Issue-6210-Subpixel-font-rendering-system-settings-s.patch
+  included in update
+
+- Add upstream patch (GIMP issue #6210)
+  + 0001-Issue-6210-Subpixel-font-rendering-system-settings-s.patch
+    Fix issue where the textool produces false color artifacts
+    when using font anti-aliasing and system is set to subpixel
+    rendering.
+
+- gimp-tips no longer has translations
+
+- Update to 2.10.28
+  - Core:
+  - Dashboard now has memory support in OpenBSD.
+  - Default shortcuts Shift+[ and ] for tool size changed to {
+    and }.
+  - Performance improvements for GIMP on macOS Big Sur: these
+    improvements were actually already applied in our macOS
+    packages since GIMP 2.10.22, but were applied upstream
+    directly only now.
+  - User Interface:
+  - Dark theme: improve accessibility of GtkRadioButton by adding
+    a white border on mouse-hover.
+  - Gray theme: set light background for selected text in Layers
+    and Paths dockable dialogs to make text visible.
+  - Dark, Gray and Light themes: remove 3D shadow box around eye
+    and link toggles in Layers, Channels, and Paths dockable
+    dialog tree views.
+  - Plug-ins:
+  - Improved DDS support and fix some red/blue bit swap for
+    RGB10A2 DDS.  The plug-in version is incremented so that it
+    is able to catch and correct previously incorrect RGB10A2
+    images exported by older versions of our plug-in.
+  - DDS files with "L16" - a 16 bit luminance channel - are now
+    loaded in 16-bit.
+  - DICOM images:
+  * Support for planar configuration.  Support for deprecated
+  * big endian transfer.
+  - TIFF images:
+  * Thumbnail storing now done by storing the thumbnail as the
+  * second
+    page in the file (through Exiv2) and setting metadata
+    "Exif.Thumbnail.NewSubfileType" to 1 (reduced resolution
+    image) instead of storing the thumbnail as a subifd. This
+    was done because of a Windows bug locking TIFF files with
+    thumbnail stored as subfid.
+  * Symmetrically, loading will ignore pages marked as "reduced
+    resolution image" (i.e. it will consider them as
+    thumbnails), as well as try to guess if a page (without
+    subfile type) is a thumbnail when it meets following
+    criteria: second page with YCbCr PhotometricInterpretation,
+    old style jpeg compression while the first page has a
+    different PhotometricInterpretation or compression.
+  - Script-fu:
+  - New (dir-make "/dir/name" mode) function to create a
+    directory.
+  - Build:
+  - Fix uninstalled white-border prelight file.
+  - On Windows, *.rs file extension is not associated with SUN
+    Raster images anymore. The reason is that this file extension
+    is mostly used for Rust code files nowadays. If Windows could
+    detect file formats with "magic numbers" (i.e. byte
+    identifiers), it would not be a problem, but since it relies
+    apparently only the extension, it's better to remove this
+    association.
+  - Oppositely on Linux and other Unix-like systems using desktop
+    files, add the image/x-sun-raster MimeType which was
+    forgotten (there, detection should be fine and not depend on
+    file extension).
+  - gimp30-tips.mo is not installed anymore (only used during the
+    build to generate gimp-tips.xml with multiple language
+    support).
+  - --enable-check-update now has an "auto" value, which is the
+    new default. It is equivalent to "yes" for Windows and macOS
+    and "no" in all other cases.
+  - New unit test to check that localizations listed in the
+    installer script match available po files in
+    po-windows-installer/.
+  - "msys*" host value now detected as Windows builds.
+  - Bumping minimum GEGL to version 0.4.32.
+
+- Remove obsolete translation-update-upstream support
+  (jsc#SLE-21105).
+
+- Move rpm macros.gimp from /etc/rpm to %{_rpmmacrodir}.
+
+- Update to 2.10.24
+  - Core:
+  - Ignore Pentax and PentaxDng metadata at export because they are
+    unsupported.
+  - DBus calls (remote file open, typically with double click on file
+    browser; and remote command run) are now processed after all command
+    line files (in case of calls during startup) and in the call order
+    (FIFO) for consistency. Some timeout has also been added to not spam
+    the core process with non-processable DBus calls during startup.
+  - Display profile name in "Color space" field of Image Properties and
+    improve ellipsis & wrap on dialog fields whose contents' size is not
+    controllable together with better dialog size management.
+  - Fix stack overflow when loading very large XCF files on Windows.
+  - Point snapping now works outside the canvas. This is used for snap
+    to guides, grid and vectors. Snap to grid only works off-canvas when
+    "Show All" is enabled because off-canvas grid is not visible
+    otherwise, though snap to guide and vectors will always work
+    off-canvas.
+  - Libgimp:
+  - Various metadata improvements:
+  * Improve reading of iptc tags that appear more than once.
+  - Plug-ins:
+  - JPEG export will better advertize when metadata export fails,
+    possibly with relevant error message. Image export would not fail,
+    but at least we make the person aware metadata is not properly
+    exported.
+  - More robust TIFF import and export:
+  * Better handling of Exif.Thumbnail.* tags on export.
+  * Import now ignores TIFF pages with invalid directory (rather than
+    freezing and output an error to warn of possible data loss).
+  * Import attempts to count the directories by reading them when the
+    headers does not announce any directory, which allows to salvage
+    images with improper header. Also if reading of a directory fail,
+    we now output a message to warn of possible data loss.
+  * Fixed loading 2 and 4-bit TIFF images in grayscale and indexed.
+  * Improve support of ExtraSamples fields with non-conformant TIFF
+    files.
+  * Improve loading of multi page tiffs with linear TRC.
+  * More safety checks as a result of fuzz-testing.
+  * Improve loading of MinIsWhite and MinIsBlack images.
+  - GeoTIFF tag support added (recognized and stored into image
+    parasites at import, then exported back when TIFF format is used)
+    with appropriate "Save GeoTIFF data" checkbox (checked by default)
+    to disable GeoTIFF metadata export when not desired.
+  - The metadata viewer and editor got a big cleaning and refactoring
+    pass, as well as various fixes and several improvements:
+  * Fix handling of IPTC tags which can appear more than once (such as
+    "Keywords") in both the viewer and editor.
+  * Always read both the IPTC and XMP equivalent tags in the editor,
+    instead of assuming they are necessarily the same.
+  * More IPTC equivalents of XMP tags added:
+    + Iptc.Application2.LocationName <=> Xmp.iptc.Location
+    + Iptc.Application2.BylineTitle <=> Xmp.photoshop.AuthorsPosition
+    + Iptc.Application2.CountryCode <=> Xmp.iptc.CountryCode
+    + Iptc.Application2.Writer <=> Xmp.photoshop.CaptionWriter
+  * The editor now properly saves IPTC tags.
+  * Improve UTF-8 conversion to avoid double string conversion (hence
+    actually breaking encoding).
+  * Use proper unit abbreviations and proper label casing.
+  * GPS data is now properly formatted with better precision and with
+    translatable string parts and tooltips are added to explain how to
+    correctly edit GPS data (latitude, longitude, altitude).
+    Also seconds part of latitude/longitude is now saved with more
+    precision and altitude details now switch from .1m to .10m.
+  * Better error reporting when the editor fails to write a tag, with
+    proper GUI error, so that such error do not go unseen.
+  * Better error handling when closing the editor or viewer too, and
+    improve error handling when the calendar dialog fails.
+  * Use a logging domain for debugging-only messages which pollutes
+    the output.
+  * Xmp.iptc.CreatorContactInfo/Iptc4xmpCore:* override the shorter
+    forms Xmp.iptc.Ci* if both are present, since the longer form is
+    more common.
+  * Improve saving of XMP metadata.
+  * And more bug fixes and refactoring steps to get rid of duplicate
+    code.
+  - PNG will now prompt only for layer offset different from zero. Some
+    software were always setting an offset of 0 (e.g.: POV-Ray v3.7) so
+    GIMP would unecessarily prompt the user until now for PNG created by
+    such software.
+  - BMP:
+  * allow loading of BMP images with incorrect BI_BITFIELDS
+    compression.
+  * support loading more bit depth such as 24bpp images.
+  - file-darktable:
+  * support updated Lua API of darktable 3.6 and beyond;
+  * Adding environment contents to debugging output when
+    DARKTABLE_DEBUG env variable is set.
+  - PDF import:
+  * New option to reverse order of layer.
+  * Support fractional DPI (allowing accurate page dimensions).
+  - DDS:
+  * Set blue channel of BC5 dds images to 0 instead of 255.
+  * Fix DDS BC5 compression/decompression with Red and Blue swapped.
+    We detect images created by an older GIMP on loading and swap the
+    channels back.
+  - HEIF:
+  * Removes the "HDR" mention on HEIF 10/12-bit export because high
+    bit depth does not necessarily means HDR.
+  * Runtime detection of HEIC and AVIF file formats (depending on
+    available encoders and decoders), which allows afterwards update
+    of the dependency, but also allows usage for a single format (e.g.
+    for distributions which want to support only AVIF).
+  * With libheif 1.10, visually lossless export is possible for
+    10/12 bit depths too
+  - PSD:
+  * More flexible reading of layer mask record size, skipping invalid
+    or unsupported mask info size, hence allowing us to load more PSD
+    files (at least the part of a PSD we support instead of failing
+    the whole import altogether).
+  - G3 fax images:
+  * Improve error handling when loading.
+  * Be more forgiving on bad lines which were quite frequent on older
+    fax images, allowing to salvage some old images.
+- Drop 0001-app-make-gegl-introspect-an-optional-operation-depen.patch
+- Drop libheif-avif-only.patch
+
+- Recurse directories when looking for python plugins
+  (boo#1180362).
+
+- Make graphviz/dot only required for runtime debugging an
+  optional dependency, fixes bsc#1180614:
+  * 0001-app-make-gegl-introspect-an-optional-operation-depen.patch
+- Cleanup spec file, remove Leap 42.x parts
+
+- Added python-xml as recommend dependency. (bsc#1180363)
+
+- updates to buildrequires
+  - synced required versions with configure.ac
+  - convert more buildrequires to pkgconfig() versions
+- enable libheif on Tumbleweed, since we have the version in TW
+  with avif support, but not actual HEIF support unless libheif
+  from packman is used.
+- added libheif-avif-only.patch:
+  libheif based exporter will only offer the formats supported by
+  the installed libheif (via runtime check)
+
+- Change macro defined to test whether to build python plugin from
+  _with_python2 to _with_python_plugin since the complementary
+  variable _without_python2 is already defined as `true` for
+  openSUSE:Factory project wide (to disable building python2
+  modules when using single-spec); this re-enables the python
+  plugin for openSUSE Tumbleweed.
+
+- Update to version 2.10.22:
+  - Core:
+  - Verbose version information (`gimp-2.10 -v` on command line,
+    or debug output) now displays Flatpak related information
+    when available. This is especially useful for debugging (such
+    as the exact Flatpak build hash, the runtime version, the
+    installed Flatpak extensions, permissions, etc.).
+  - OpenCL settings has now been moved to the Playground tab in
+    Preferences.
+  - On stable builds, "Playground" tab is now visible in
+    Preferences if any of the experimental features has been
+    enabled, even without the CLI option `--show-playground`.
+  - Tools:
+  - "gegl:matting-levin" now the default engine of Foreground
+    Select tool (when present, as it is an optional feature) as
+    it performs a lot better.
+  - GEGL operations now display a "Sample merged" checkbox in
+    Tool Options. This will be used when the operation allows to
+    pick a color (hence one can pick from the edited layer or
+    from visible data).
+  - "Sample merged" now defaults to being activated in Color
+    Picker and GEGL tools as it seems the less confusing for
+    beginners who don't know of the option yet (according to a
+    small poll we ran).
+  - User interface:
+  - In GimpSpinButton, don't propagate Enter key-press events if
+    updating the spin-button's value in response changes the
+    entered text. This prevents confirming dialogs when hitting
+    Enter after entering a math expression in size entries,
+    updating their value instead.  Likewise, don't propagate
+    Escape key-press events if a new value was entered, and
+    restore the original value instead.
+  - GimpMemSizeEntry improved to show appropriate binary prefixes
+    (kibibyte, mebibyte and gibibyte) instead of decimal ones, to
+    round properly when using higher units, and to not lose
+    accuracy when possible when displaying in higher units.
+  - Several of the biggest pages of the Preferences dialog are
+    now scrollable, allowing the dialog to fit on smaller
+    displays.
+  - Plug-ins:
+  - Add a new GIMP_EXPORT_NEEDS_CROP export capability, which
+    causes gimp_export_image() to crop the exported image content
+    to the image bounds; this is useful for formats that support
+    layers, but have no concept of global image bounds, hence
+    cropping is the only way to enforce the image bounds.  When
+    showing the export dialog, give an option to either crop the
+    layers to the image bounds, or to resize the image to fit the
+    layers.
+  - Content type `image/webp` is now recognized (and not only
+    `image/x-webp` as both seem to be in used and this format is
+    unfortunately not yet listed in IANA media types (so various
+    content types are in use, no clear standard apparently).
+  - DDS import is now a bit more permissive, allowing to load
+    some files with invalid header flags regarding compression,
+    while we are able to know the right compression from other
+    flags. This allows to recover invalid DDS files exported by
+    other software.
+  - JPEG detection improved to be more generic and reliable.
+  - HEIF support improvements:
+  - AVIF importing and exporting added (requires libheif
+    1.8.0+)
+  - 10/12-bit importing and exporting now available for
+    HEIC/AVIF
+  - NCLX color profile import (link with LittleCMS)
+  - Metadata support when importing
+  - "Lossless" option is now called "Nearly lossless (YUV420
+    format)" because this is actually what it is, hence
+    previous naming was misleading.
+  - TIFF support improvements:
+  - Add an option to crop the layers to the image bounds when
+    exporting individual layers (using GIMP_EXPORT_NEEDS_CROP),
+    since TIFF has no concept of global image bounds otherwise.
+    Cropping is enabled by default.
+  - TIFF export will not override "DocumentName" metadata tag
+    anymore.
+  - Stop writing file paths into TIFF DocumentNames as file
+    paths can contain confidential information such as
+    usernames and directory structures, making the previous
+    behaviour a potential privacy and security risk.
+  - Fix a file descriptor leak case which may have prevented a
+    file from being opened on Windows.
+  - Multiple improvements in the PSP import plug-in:
+  - support reading raster layers of PSP version > 6,
+  - support reading 16-bit integer PSP files,
+  - support reading grayscale and indexed PSP files,
+  - support PSP images with zero-length layer names,
+  - fix wrong layer offset of layers,
+  - fix reading layer names with high bit ASCII characters,
+  - fix incorrect loading of PSP images with uncompressed
+    channel data,
+  - fix reading of creator block data of PSP images,
+  - better error messages describing yet unsupported features,
+  - improve reader stability by always using the block/chunk
+    length.
+  - Spyrogimp now works on Grayscale images and clutters less the
+    undo history.
+  - "Orientation" metadata is now reset whether you accepted to
+    rotate the image or not when importing an image.
+  - XPM does not export a "None" (transparent) color when unused.
+  - BMP always include color masks when exporting BMP with color
+    space info, as mandated by BITMAPV5HEADER specification.
+  - Debugging:
+  - Add progressive performance logs: progressive logs contain
+    complete information after each recorded sample, by writing
+    partial address maps at each sample, containing all new
+    addresses introduced by the sample.  This allows recording
+    complete logs even in cases where they can't be properly
+    terminated, such as when GIMP crashes or freezes in the
+    middle of the log.  Progressive logs are disabled by default,
+    since they potentially increase the sampling cost. They can
+    be enabled through a toggle in the log file-dialog, or
+    through GIMP_PERFORMANCE_LOG_PROGRESSIVE environment
+    variable.  Performance log viewer can now process progressive
+    performance logs too.
+  - Allow controlling performance-log parameters through the UI.
+  - Bug fixes: #2275, #2668, #2874, #3481, #3868, #4061, #4155,
+    [#4328], #4505, #4536, #4560, #4816, #5043, #5069, #5208, #5219,
+    [#5226], #5232, #5274, #5275, #5357, #5358, #5472, #5530, #5584,
+    [#5592], #5623, #5630, #5651
+
+- Make python 2 conditional, and disable on SLE/Leap (bsc#1082699).
+
+- Solve the libexecdir problem a different way.
+
+- Fixes for %_libexecdir changing to /usr/libexec(bsc#1174075)
+
+- Update to version 2.10.20:
+  * Tool-group menus can now expand on hover
+  * Non-destructive cropping now available by cropping the canvas
+    rather than actual pixels
+  * Better PSD support: exporting of 16-bit files now available,
+    reading/writing channels in the right order
+  * On-canvas controls for the Vignette filter
+  * New filters: Bloom, Focus Blur, Lens Blur, Variable Blur
+  * Blending options now built into filter dialogs
+  * Over 30 bugfixes
+
+- disable update check
+
+- Update to version 2.10.18:
+  https://www.gimp.org/news/2020/02/24/gimp-2-10-18-released/
+  - Core:
+  - In gimp:replace, when compositing the same content over itself,
+    i.e., when the input and aux buffers share the same storage and
+    same tile alignment, pass the input buffer directly as output,
+    instead of doing actual processing. In particular, this happens
+    when processing a pass-through group outside of its actual bounds.
+  - In gimp_gegl_apply_cached_operation(), use gint64 for storing the
+    total and processed pixel counts used for reporting progress, to
+    avoid overflowing when applying an operation to a large image.
+  - In GimpFilterTool and gimp_drawable_apply_operation(), use
+    gimp_drawable_filter_set_add_alpha() to add an alpha channel when
+    applying an operation that specifies "needs-alpha" to a drawable
+    that can have alpha.
+  - In GimpFilterTool, move all the drawable-filter option setup to a
+    new gimp_filter_tool_update_filter() function, and call it
+    whenever the drawable-filter's options need to be updated. This
+    avoids duplicating logic in various places.
+  - Improve the efficiency of decoding RLE data when loading ABR
+    brushes, by reading entire scanlines into a buffer all-at-once,
+    instead of reading the stream byte-by-byte.
+  - GIMP now optionally phones home to find out if there's a new
+    version available and then tells the user if there is one indeed.
+    It also keeps track of the installer revision and then warns if
+    there's a newer installer available. This can be disabled in
+    Preferences. In that case, users still have the option to manually
+    check for an update via the About dialog. The feature can be
+    disabled entirely with the '--disable-check-update' configure
+    switch.
+  - Tools:
+  - New 3D Transform tool where you can set vanishing point, camera's
+    focal length, and the move and rotate layer, selection, path, or
+    image in 2.5 space. With the "Unified interaction" option enabled,
+    all three interaction modes of the grid (camera, move, and rotate)
+    are available simultaneously. In this mode, the inner and outer
+    regions of the item are used for moving and rotation,
+    respectively, and the vanishing point is controlled through
+    through a handle.
+  - Transform tools now respect the Clip option and update the canvas
+    preview accordingly.
+  - New "Composited preview" option allows respecting layer's blending
+    mode and position in the layer stack rather than rendering it as
+    an overlay on top of the overall layer stack. This simplifies
+    creating complex layer compositions greatly. The option requires
+    mipmaps to be used and thus is disabled by default. It also comes
+    with an experimental "Synchronous preview" suboption to render the
+    composited preview synchronously. This reduces the lag for
+    painting the preview, but can harm responsiveness for bigger
+    images, where rendering the preview is slow.
+  - Add a new "Preview linked items" option to the transform-grid
+    tools. When this option is enabled, together with composited
+    previews, the transform preview includes all linked layers and
+    channels when transforming a layer/channel. Paths are currently
+    unsupported.
+  - New widget called GimpPivotSelector, a 3x3 grid of toggle buttons,
+    is now used for selecting a natural pivot position (e.g. for a
+    transform) relative to an item: its center, its corners, and the
+    midpoints of its edges. Currently used in Rotate and 3D Transform
+    tools.
+  - Add "Show all" support to the Bucket Fill tool in line-art mode
+  - Color picker and sample points now support displaying vlaues in
+    Yu'v' (CIE 1976 UCS) color space.
+  - The Symmetry Painting dock now has an "Enable reflection" option
+    that allows painting patterns resembling a kaleidoscope.
+  - Transform clipping is temporarily disabled for layer groups. No
+    preview other than 'Adjust' works anyway. This will be fixed later
+    on.
+  - Construct a box-filtered mipmap hierarchy for the original brush
+    on-demand, and the closest mipmap is used as the resampling source
+    for downscaled brushes, significantly improving the output
+    quality.
+  - Now that painting is done in a separate thread, the display update
+    rate has a far smaller impact on it. Increase the GimpDisplay
+    update rate, which handles image updates, to 60 FPS, and the
+    GimpDrawTool update rate to 120 FPS. In particular, the latter
+    change makes the brush outline motion much smoother.
+  - In the Airbrush tool, increase the maximal stamp FPS from 15 to
+    60, and change the corresponding maximal Rate value from 150 to
+    100. This technically affects tool presets, but we'll live.
+  - Add a new "Snap brush outline to stroke" toggle to the "Image
+    Windows" preferences page. When enabled, the brush outline in
+    paint tools snaps to the individual dabs while painting, which is
+    how it worked before version 2.10.16. Disable the option by
+    default.  This seems to be what most other programs are doing, and
+    it does give paitning a smoother feel.
+  - The Warp Transform tool now respects settings for painting tools:
+    showing the brush outline, snapping to dabs, and showing the paint
+    tool cursor.
+  - User interface:
+  - Add new Symbolic-High-Contrast and Symbolic-Inverted-High-Contrast
+    themes, which are automatically-generated high-contrast variants
+    of the (original) Symbolic theme.  The contrast factor is settable
+    in the makefile, and is currently at 1.5 for both themes.
+  - Rename tools/invert-svg to tools/svg-contrast, which now takes a
+    contrast-factor argument, and adjusts the input SVG contrast,
+    instead of just inverting it.  Note that we can still use the tool
+    to invert icons, using a contrast of -1.
+  - Allow horizontal scrollbars in all the Preferences dialog tree-
+    views, so that they don't limit the minimal width of the dialog
+    (in particular, the UI- and icon-theme tree-views may contain
+    arbitrarily-long paths).
+  - Draw a border around the color FG/BG color areas as a pair of
+    black and white rectangles instead of letting GTK do this. This
+    imporoves the legibility of borders, especially in dark themes.
+  - Tools are now logically grouped in the toolbox by default. Users
+    can customize the groups to their liking or disable this feature
+    altogether in the Preferences dialog (Interface / Toolbox page).
+  - New opt-out compact style for sliders with revamped interaction.
+    The widget uses a narrower layout, and the different
+    upper/lower-half behavior is gone. Instead, the behavior depends
+    on the mouse button and modifier used:
+  - left-click is used for absolute adjustment,
+  - Shift + left-click + drag changes value in small increments,
+  - Ctrl + left-click + drag changes value in large increments,
+  - middle-click enables numeric input mode;
+  - right-click enables numeric input mode and selects the value.
+  - The "You can drop dockable dialogs here" message is gone from the
+    toolbox for good. Instead, highlight dockable areas when a user
+    starts dragging a dockable dialog, and intensify the highlight as
+    the dialog goes over a dockable area.
+  - Consolidate UI for merging down and anchoring layers: As they are
+    both mutually exclusive and serve an almost identical purpose, the
+    "Merge down" and "Anchor Layer" are given mutually exclusive
+    visibility in menus, and the anchor button is replaced with a
+    merge down button in the Layers dockable whenever there is no
+    active floating selection. Modifier keys are available:
+  - Shift: merge layer group
+  - Ctrl: merge visible layers
+  - Ctrl + Shift: merge visible layers from last used values
+  - Tools:
+  - In GimpPaintTool, when not snapping brush outline to stroke, make
+    sure to properly snap the cursor position to 15-degree angle
+    multiples in line mode, not only when painting the line, but also
+    during motion.
+  - Plug-ins:
+  - Add naive support for CMYK 8-bit PSD files
+  - In plug_in_compat.pdb, when wrapping an op node inside a graph,
+    set the op node as the graph node's underlying operation. This
+    allows gimp_gegl_apply_operation() to perform certain
+    optimizations.
+  - The Spyrogimp plugin now features a Visual tab where the inner
+    mechanics of a spirograph is abstracted away, and you operate on
+    amount of petals etc. The plugin now also allows saving a pattern
+    as a path rather than rendering it to a layer as a bitmap.
+  - Improve the loading speed for PSD files, mostly by eliminating
+    excessive copies.
+  - Filters:
+  - Don't disable gegl:color-to-alpha (which has "needs-alpha") when
+    the drawable doesn't have an alpha channel, if one can be added.
+  - Don't disable color-to-alpha for grayscale drawable, since the
+    operation is applicable to grayscale images (in particular, it
+    doesn't add color where there was none), and since GIMP no longer
+    distinguishes between layers and channels according to the
+    drawable format when updating the filters actions.
+  - Updated translations
+  - Bug fixes #4643, #4634 #4172, #4194, #4205, #4218, #2543, #4185,
+    [#4246], #2794, #4209, #4278, #4372, #4187, #4392, #2674, #4338,
+    [#2862], #4203, #4204, #4354, #1266, #4584, #4174, #4285, #4366,
+    [#1975], #4605
+
+- Fix build for %arm and ppc64 by adding '-lm' to LDFLAGS
+
+- bump babl and gegl deps to match configure script
+
+- Update to version 2.10.14:
+  https://www.gimp.org/news/2019/10/31/gimp-2-10-14-released/
+  + Core:
+  - New "Selected areas continue outside the image" toggle option
+    to the "Feather Selection" dialog.
+  - New "Allow editing on non-visible layers" setting in
+    Preferences to allow painting, transforming, and selecting on
+    layers with toggled off visibility.
+  - XCF loading a bit more resilient to corruption: it doesn't
+    stop any more at the first layer or channel error; instead it
+    tries to load more layers/channels to salvage as much data as
+    possible from a corrupted XCF file.
+  - In gimp:gradient, fix dithering to correspond to how we
+    actually round float values to 8-bit. In particular, this
+    avoids introducing noise when a component is fixed at 0 or 1
+    along a segment.
+  - New "Show All" view mode allowing to show pixels outside the
+    canvas boundary.
+  - New "Show Canvas Boundary" option to render a dotted line
+    around the canvas boundary.
+  - New "Keep Padding in "Show All" Mode" option, also available
+    as a default option via Preferences, to preserve the padding
+    color instead of displaying the checkerboard.
+  - Several features updated to react as expected when run
+    out-of-canvas: color-picking, canvas grid, transform tools,
+    bucket fill, and more.
+  - Loaded images' pixel density will now default to 72 PPI when
+    no explicit resolution information was stored in the imported
+    file.  Newly created images' default pixel density will
+    continue to be based on the default image template (with
+    value 300 PPI if it has not be changed), yet not loaded
+    images anymore. 72 PPI is the common default in most software
+    (and in standards such as Exif) so it makes sense we stick to
+    it, only for loaded images.
+  + Tools:
+  - Free Select tool: fast copy|cut-paste modifiers (Alt +
+    Ctrl|Shift) are now working even when the selection is not
+    committed. Starting a fast copy|cut-paste will automatically
+    close the polygon and commit the selection, accelerating fast
+    usage of free selections.
+  - Foreground Select tool: new "Grayscale" Preview Mode. Also, a
+    color selector for "Color" preview (original preview mode)
+    now available, to select any color and opacity for the
+    preview.
+  - Add a new "Image" transform type to the transform tools, in
+    addition to the existing "Layer", "Selection", and "Path"
+    transform types.  The "Image" mode transforms the entire
+    image, rather than a single item. In tools with a preview,
+    the preview shows the transformed image projection.  The
+    clipping mode controls how the canvas is clipped during the
+    transform; in particular, the ADJUST clipping mode resizes
+    the canvas to fit its transformed size.
+  - In GimpFilterTool, add a new "clipping" option, which can be
+    either Adjust or Clip.  This option is controllable for
+    layers, when there's no selection mask.  When set to Adjust,
+    which is used by default, the filter's output may extent past
+    the drawable's boundary, and the drawable will be resized to
+    match the output when committed.
+  - Gradient tool: offest support in shaped gradients
+  + Plug-ins:
+  - Simple 8-bit port of filters to GEGL: nl-filter, film,
+    fractal-explorer, flame, blinds, jigsaw, gradient-flare,
+    checkerboard, tile-small, curve-bend, sample-colorize,
+    map-object, lighting, grid, despeckle, sphere-designer,
+    contrast-retinex, hot, sparkle, cml-explorer, destripe,
+    twain, animation-optimize, depth-merge, warp, imagemap,
+    gimpressionist
+  - Port of filters to GEGL with float support: van-gogh-lic.
+  - Add color profile support for HEIF (only when libheif 1.4.0
+    is available).
+  - TIFF import will now ask (in interactive mode) how to process
+    unspecified TIFF channels: non-premultiplied (used to be the
+    default) alpha, premultiplied alpha, or just import as
+    generic channel.
+  - HEIF export now improved with same profile logics as JPEG or
+    WebP (it can actually export higher bit-depth data, so
+    profile logics should be the one as in PNG, but we only
+    support 8 bpc HEIF for the time being).
+  - HEIF export dialog now has a "Save color profile" checkbox
+    allowing to not export with a profile when needed (needs
+    libheif 1.4.0 or higher).
+  - PDF exporting: text layers in layer groups are now exported
+    as proper text.
+  - Cleaned up the file-dds GUI, removed the "Advanced" expander.
+  - gimptool external tool now install plug-ins into subfolders
+    (this is not mandatory in GIMP 2.10 yet, unlike future GIMP
+    3, but is already the recommended folder structure for
+    plug-ins).
+  - 3 procedures ("color-decode-ycocg",
+    "color-decode-ycocg-scaled" and "color-decode-alpha-exp")
+    removed from file-dds plug-in because they are hacks which
+    should stay internal to the plug-in and are semantically wrong
+    because colors in drawables are never in such formats.
+  + Filters:
+  - New "Normal Map" filter to generate normal maps from height
+    maps in the Generic section.
+  - Replace old filters with GEGL operation counterparts:
+    edge-neon (gegl:edge-neon), contrast-normalize
+    (gegl:stretch-contrast), oilify (gegl:oilify)
+  - Add gegl:bayer-matrix and gegl:linear-sinusoid to Filters ->
+    Render -> Pattern.
+  - Add gegl:newsprint to Filters -> Distorts.
+  - Add gegl:mean-curvature-blur to Filters -> Blur.
+  + Performance:
+  - Add an active-thread variable to the dashboard's misc group,
+    showing the number of active worker threads.
+  - Reduce time complexity of layer-group translation. When
+    translating a layer group, avoid separately updating the
+    original area of the child layers before translating them (as
+    per the fix to issue #3484), as this results in quadratic
+    time complexity w.r.t. to the maximal subgroup nesting level.
+    Instead, simply defer the updating of the group's offset
+    until *after* translating the child layers, so that their
+    original area isn't clipped by the parent, while their new
+    area is still properly updated even if the parent's size
+    changes.
+  + User interface:
+  - Many mnemonics added in various dialogs.
+  - Add a gimp-rotate-image-arbitrary action, and a corresponding
+    "Image -> Transform -> Arbitrary Rotation..." menu entry,
+    which activates the rotate tool in image mode (similarly to
+    the corresponding action for layers).
+  - On Windows, minimized GIMP window is now deiconified when
+    GIMP is run again (clicking its shortcut or otherwise).
+  + Preferences:
+  - New "Swap compression" option: explicit control over the
+    tile-swap compression algorithm in GEGL. "Best performance"
+    is used by default, "Balanced", "Best compression", and
+    "None" (disables compression) are available.
+  + Devel docs:
+  - Update the libgimpconfig and libgimpbase docs.
+  - Update docs with missing symbols and types.
+  - New docs for structs and enums.
+  + Debugging:
+  - New mnemonic-clashes tool to help looking for mnemonic
+    clashes.
+  + Updated translations.
+
+- Update to version 2.10.12:
+  + Core:
+  - Add an "Incremental" option to the Dodge/Burn tool, which,
+    similarly to the Paintbrush, Pencil, and Eraser tools,
+    applies the effect incrementally as the pointer moves.
+  - Curves now have a concept of smooth vs corner points: smooth
+    points produce a smooth curve, while corner points produce a
+    sharp curve (previously, all points were smooth).
+  - Search the user font directory path on Windows (since Windows
+    10, non-admin users have the ability to install fonts). This
+    is only a temporary hack until fontconfig adds proper
+    upstream support.
+  - In gimp_brush_core_get_paint_buffer(), when allocating a new
+    paint buffer, clear the old buffer *before* allocating the
+    new one, to reduce the amount of simultaneously allocated
+    memory.
+  - In GimpPaintbrush, avoid refilling the paint buffer at each
+    dab if the paint color/pixmap hasn't changed, hence allowing
+    faster painting in some specific cases.
+  - Add hygon cpu detection and enable MMX/SSE support.
+  - Add a GimpSymmetry::get_transform() virtual function and a
+    corresponding gimp_symmetry_get_transform() function which
+    return the brush transform corresponding to a given symmetry
+    stroke in terms of the rotation angle and reflection flag (in
+    contrast to gimp_symmetry_get_operation() which returns the
+    same transforation in terms of a GeglNode). This allows us to
+    simplify, fix (artifact bugs, etc.), and improve the
+    painting-code performance for several symmetry painting
+    cases.
+  - New gimp-brush-pipe-spacing parasite set by core code to
+    preserve GIH brush's spacing across reloads.
+  - Add a new Offset filter tool, as a front-end to gimp:offset.
+    The tool replaces, and provides the same interface as the
+    drawable-offset dialog while also providing live preview and
+    on-canvas interaction.
+  + Plug-ins:
+  - Exported profile and data format strategy updated in several
+    file plug-ins.
+  - When not saving a profile, we always export as sRGB data, as
+    most viewers would not display the image properly otherwise.
+  - When saving a profile:
+    . If a profile was manually assigned, we always export to the
+    assigned format, hence pixel data is converted accordingly,
+    whatever the work format.
+  - If no profile was assigned:
+    . If the export format support high-bit depth, we export the
+    work format as-is.
+    . If the export format is 8-bit max, we convert the work
+    format to sRGB, except if the work format is 8-bit linear.
+  + The following plug-ins were updated: JPEG, PNG, TIFF and WebP.
+  + Tools:
+  - Add input/output spin-buttons to the Curves tool, which allow
+    setting the selected point's coordinates numerically. When
+    the image precision is greater than 8-bpc, use a 0.00-100.00
+    range for the point-coordinate spin-buttons instead of a
+    0-255 range.
+  - In the Curves tool, allow changing the curve's point types
+    (cf. new curve corner points in Core section). Corner points
+    are displayed with a diamond shape instead of a circle.
+  - Free Select tool now creates a selection as soon as the
+    polygon is closed. This selection is updated when the
+    polygon, or the relevant tool-options, change, similarly to
+    GimpRectangleSelectTool.
+  - Derive GimpEraser from GimpPaintbrush, instead of directly
+    from GimpBrushCore. This allows GimpEraser to reuse the
+    paint-buffer content across dabs, improving performance.
+  - Allow moving an intersecting pair of guides with the Move tool.
+  + User interface:
+  - In GimpCurveView, when dragging an existing curve point,
+    don't immediately move the point to the cursor position upon
+    button press, but rather move it relative to its current
+    position as the cursor moves. This allows selecting a point
+    without moving it, and adjusting its position more easily.
+  - When the cursor hovers above a point in GimpCurveView, or
+    when dragging a point, have the coordinate indicator show the
+    point's position, rather than the cursor's.
+  - In GimpCurveView, when holding down Ctrl while
+    adding/dragging a point, snap the y-coordinate to the
+    original curve (at the start of the drag). This is
+    particularly useful for adding points along the curve.
+  - In GimpDashboard, don't show legend for groups with no meter.
+  - Add a tile-alloc-total variable to the dashboard's memory and
+    misc groups, showing the total amount of memory used by the
+    tile allocator.
+  - Add a "Save Keyboard Shortcuts Now" button to the Configure
+    Keyboard Shortcuts dialog.
+  + Updated translations.
+
+- No more need pkgconfig(glib-2.0) >= 2.56.0 for build.
+  pkgconfig(glib-2.0) >= 2.54.2 is enough.
+
+- Update to version 2.10.10:
+  - Core:
+  - Add gimp-scratch allocator, a fast memory allocator (on the
+    order of magnitude of alloca()), suitable for small (up to a
+    few megabytes), short-lived (usually, bound to the current
+    stack-frame) allocations.  Unlike alloca(), gimp-scratch
+    doesn't use the stack, and is therefore safer, and will also
+    serve bigger requests, by falling-back to malloc().
+  - In gimp_drawable_transform_buffer_affine(), avoid modifying
+    the clipping mode when transforming layer masks, since this
+    function is used (among other things) to transform layer
+    masks together with their layer, in which case they should
+    use the same clipping mode as the layer. This fixes a
+    regression introduced by commit 2ae823ba, causing layer masks
+    to be transformed with a mismatched clipping mode during
+    layer transforms, leading to discrepencies between the
+    transformed layer and the transformed mask.
+  - Moved swap/cache and temporary files out the GIMP user config
+    dir and added new config file substitutions ${gimp_cache_dir}
+    and ${gimp_temp_dir}.
+  - Pass the GEGL tile-cache size, swap path, and thread-count to
+    plug-ins as part of their config, and have libgimp set the
+    plug-in's GeglConfig accordingly upon initialization.
+  - Layer groups are now rendered in bigger chunks rather than
+    tile-by-tile (which used to pretty much eliminate
+    multithreading for groups), which improves the rendering
+    speed.
+  - Make saving/exporting files more robust to errors. In
+    particular if an error occurs during the process (be it a
+    bug, a memory error, or anything else), GIMP won't overwrite
+    anymore any existing file with incomplete contents, so that
+    you won't end up with no valid files at all.
+  - Fix a regression on support of various graphics tablet.
+  - Remove the "Edit -> Fade..." feature: it makes GIMP use two
+    buffers instead of one (east into system resources), it's
+    broken in 2.10, and we can make the UX better for filters.
+  - New generic canvas modifier 'Alt + middle click' allowing to
+    pick layers by clicking on pixels. The available layers will
+    be looped through (starting from the upper one) while Alt key
+    is hold and the picked layer name will be temporarily
+    displayed in the status bar.
+  - When clearing a channel, do nothing if the channel is already
+    empty; otherwise, align the cleared rectangle to the channel
+    buffer's tile grid, so that all affected tiles are dropped,
+    rather than zeroed.  Furthermore, only update the affected
+    region of the channel.
+  - Brush and pattern saving logics has been moved to core code
+    (instead of plug-in).
+  - Clipboard brushes and pattern can now be duplicated.
+  - Parametric brushes are now 32-bit float to avoid
+    posterization on large brushes.  Note: raster brushes are
+    still 8-bit and plug-ins only have access to 8-bit versions
+    of high-precision brushes/patterns. New API will be required
+    to handle high-precision data.
+  - On-canvas preview while editing a color in the colormap of an
+    indexed image.
+  - User interface:
+  - Enabled HiDPI/Retina support for the GTK2/OSX build, fixes
+    blurry icons.
+  - Add a tooltip to the "better compression" checkbox in save
+    dialog to make it clearer it does not mean that the file size
+    is necessarily smaller in every cases. In particular some
+    best/worst case are possible when an algorithm less efficient
+    in general may end up better on a particular image.
+  - Add basic support for cursors with a scale factor of 2 for
+    HiDPI (artwork to be updated).
+  - Foreground and background color icons, as well as color
+    history will now display out-of-gamut warning on indexed
+    images for colors outside of the palette, as well as on
+    grayscale images, for non-gray colors.
+  - Pack color picker and hexadecimal entry on same line in Color
+    dock.
+  - Add an "Open as Image" button to the brushes dialog.
+  - Usability:
+  - Attempting to transform locked layers or paint on them now
+    results in blinking around the status bar (where the warning
+    message is displayed) and around the toolbar where lock
+    toggles are. The same applies to attempting to move a
+    selection where there is none — GIMP will blink around the
+    toolbar where the moving target (layer, selection, path) is
+    chosen.
+  - GIMP now allows selecting default export file type for new
+    projects.  The choice is limited to PNG, JPEG, WebP, PSD,
+    ORA, TIFF, BMP.
+  - GimpSpinScale widget now has an optional feature to constrain
+    the value to integer when dragging with a pointer (even if
+    the scale allows for fractional numbers), set with new
+    function gimp_spin_scale_set_constrain_drag().  This is
+    useful for settings where fractional numbers are technically
+    possible, yet most common use case are with integers (such as
+    pixel sizes, angles in degrees, etc.) so you want the easy
+    interface to be constrained. Fractional numbers are still
+    settable, for instance by keyboard edit; and arrow
+    incrementation won't drop fraction parts.  This is currently
+    only activated for brush options in paint tools.
+  - Tools:
+  - In scale tool, scale around center even when using numeric
+    input.
+  - New algorithm in the Bucket Fill tool when selecting the
+    affected area "Fill by line art detection", based off the
+    G'Mic algorithm for "smart colorization":
+    https://hal.archives-ouvertes.fr/hal-01891876 In a few words,
+    it identifies painted pixels (either based on grayscale or
+    opacity values) and tries to close line arts to allow filling
+    even with not perfectly closed zones; the second step of the
+    algorithm will flood the colors under line art pixels to
+    prevent "holes" in the filling.  It is possible to control a
+    max size (in pixels) for the flooding, as well as max length
+    of closing segments and splines.
+  - The Bucket Fill tool got new interaction allowing to hold the
+    click and move the mouse to fill based on several seed zones
+    (for "Fill by line art detection" as well as "Fill similar
+    colors"). You can now cancel the fill in progress with right
+    click as in other tools.
+  - The Bucket Fill tool now allows color picking with
+    ctrl-click, same as every painting tool. It will pick either
+    the foreground or background color depending on the selected
+    Fill Type. The ctrl-alt modifier combination is also possible
+    to pick the non-Fill Type color.
+  - In the Bucket Fill tool, the Alt modifier will now switch to
+    "FG color fill" when "Pattern fill" was set (instead of doing
+    nothing).
+  - In the Unified Transform tool, default to preserving aspect
+    ratio when scaling up or down.
+  - In the Healing tool, "Sample merged" now also work for the
+    target pixels, allowing to draw in empty layers.
+  - Selection by color is now parallelized, hence improving speed
+    of the Select by Color tool (and any other processing which
+    may share this piece of code now or in the future).
+  - Add "Constrain handles" and "Around center" options to the
+    perspective-transform tool's GUI, which are similar to the
+    corresponding options of the unified-transform tool.
+  - Improve color picking on indexed image to always select an
+    indexed color corresponding to the picked pixel in the
+    colormap.
+  - Plug-ins:
+  - file-pdf-save GUI now clearly indicates the order the layers
+    will be used to make multi-page PDFs.
+  - Add DDS loading/exporting plug-in originally developed by
+    Shawn Kirst and Arne Reuter.
+  - Rename the Guillotine plug-in to Slice Using Guides.
+  - Add a new option saving a color profile when exporting PNG,
+    JPEG, TIFF.  Always save it when exporting to PSD.
+  - Remove the "Advanced" expanders from the PNG and TIFF export
+    dialogs.
+  - Full rewrite of the Spyrogimp plug-in with much more options
+    and better interaction.
+  - Indexed TIFF with alpha channel now supported.
+  - Filters:
+  - Add on-canvas GUI (simple lines) for circular, linear, and
+    zoom motion blur.
+  - Help:
+  - Link to the bugtracker directly from the Help menu, also link
+    to the wiki and the roadmap. Remove the link to currently
+    disabled registry.gimp.org.
+  - Translations:
+  - Czech, Danish, French, Italian, Japanese, Marathi, Polish,
+    Russian, Spanish, Swedish, Ukrainian.
+
+- bsc#1130407: Remove dependency on JasPer.
+  OpenJPEG is actually used.
+
+- Update to vesion 2.10.8:
+  +Core:
+  - Use adaptive chunk size in GimpProjectio nwhen rendering the
+    projection asynchronously, rather than using a fixed chunk size.
+    This provides a better trade-off between throughput and
+    responsiveness dynamically, based on how fast the processing is.
+  +Tools:
+  - In all selection tools, show error on attempt to
+    subtract-from/intersect-with empty selection.
+  - Fix text along path not working with vertical text.
+  - Fix Text tool's frame position when undoing a move operation.
+  - Streamline Text tool's drawing blocking/unblocking logic.
+  - When moving a text layer using the text tool (through alt-drag),
+    don't change the layer's box mode to "fixed", which is unnecessary,
+    since the layer's size isn't affected.
+  - Transform and deformation operations now maintain color for fully
+    transparent pixels, making unerase and curves manipulation of alpha
+    channel more reliable.
+  - All transform tools now apply changes when you asve or export/overwrite
+    an image without pressing Enter first to confirm changes.
+  - Heal, Dodge/Burn, Smudge and Convovle tools now adjust the processed
+    buffer and mask_buffer regions according to the changes made to the
+    application region, as calculated by intersecting it with the
+    drawable and mask extents. This fixes wrong application position
+    when painting on a drawable whose origin is above/to the left of the
+    image's origin, and there's a selection active.
+  +Plug-ins:
+  - Port all plug-ins to the new iterator API in GEGL.
+  - Improve automatic detection of HEIC/HEIF files.
+  - Improve RawTherapee discovery by looking up registry key (should
+    become useful with RawTherapee 5.5 and more).
+  +Usability:
+  - Compatibility information in the Save dialog is now more understandable.
+    The minimum GIMP version for the XCD file is always written down when it
+    is GIMP 2.8 or over. The list of features warranting the minimum version
+    is now listed in an expander container rather than as tooltip, which
+    makes it more discoverable. The warning on compression is now displayed
+    as its own text under the checkbox and not as additional text to the minimum    GIMP version label.
+  +CLI:
+  - New self-explanatory --enable-win32-debug-console CLI option
+  +Translations:
+  - Updated translations: Danish, Dutch, Finnish, German, Hungarian,
+    Italian, Polish, Portugese (Brazil), Spanish, Swedish, Ukranian.
+
+- pkgconfig(glib-2.0) >= 2.56.0 is needed.
+
+- Update to version 2.10.6:
+  + Core:
+  - Render drawable previews asynchronously.
+  - Merge the file view filter and file format lists in
+    GimpFileDialog. The presence of 2 lists was very confusing.
+  - DLL search priority is now updated before running a plug-in
+    on Windows, depending on the executable bitness. This gets
+    rid of one of the last remnant of DLL hell in GIMP, which was
+    when running 32-bit plug-ins from a 64-bit build of GIMP.
+  + Filters:
+  - New "Little Planet" (gegl:stereographic-projection) filter.
+  - New "Long Shadow" (gegl:long-shadow) filter.
+  + Tools:
+  - Halt the Measure tool after straightening.
+  - Add an "orientation" option to the measure tool,
+    corresponding to the "orientation" property of
+    GimpToolCompass (i.e., it controls the orientation against
+    which the angle is measured, when not in 3-point mode.) The
+    orientation is "auto" by default, so that the angle is always
+    <= 45 deg.  Note that the "orientation" option affects the
+    tool's "straighten" function, so that the layer is rotated
+    toward the current orientation.
+  - Text layers can now represent vertical texts, with 4
+    variants: left-to-right and right-to-left lines, and forcing
+    all characters to be upright or following Unicode's vertical
+    orientation property. See also:
+    https://www.unicode.org/reports/tr50/
+    http://www.unicode.org/Public/UCD/latest/ucd/VerticalOrientation.txt
+  + User Interface:
+  - The Dashboard dockable dialog now has an "async" field to the
+    dashboard's "misc" group, showing the number of async
+    operations currently in the "running" state.
+  - New Preferences option to enable/disable layer-group
+    previews, since these can get quite time-expensive.
+  + Updated translations.
+
+- fix build error for Leap 42.3
+- add missing requires
+
+- bump versions in BR according to the configure.ac
+- move library requires in libgimp to %requires_ge and also force
+  the libgegl update
+
+- update to 2.10.4 bug fix release
+  Core:
+  - Remove gimp_display_shell_draw_background() and all clipping
+    hacks for drawing the canvas background. This optimizes away
+    one entire step of drawing of image size, for each expose.
+  - Font loading does not block startup anymore. Only consequence
+    is that the Text tool may not be usable immediately if fonts
+    are not fully loaded yet (and will output an appropriate error
+    if you do so). All non-text related activities can be performed
+    right away.
+  - Change of the URL from bugzilla to gitlab where appropriate.
+  - New tool option manager to better keep track of user context
+    and paint options in a consistent manner.
+  User Interface:
+  - The Dashboard dockable dialog now has a 'Memory' group that
+    shows memory-usage information: the currently used memory size,
+    the available physical memory size, and the total physical
+    memory size.  It can also show the tile-cache size, for
+    comparison against the other memory stats. Note that the
+    upper-bound of the meter is the physical memory size, so the
+    memory usage may be over 100% when GIMP uses the swap.
+  - The Dashboard dockable dialog now has "read" and "written"
+    fields in the dashboard swap group, which report the total
+    amount of data read-from/written-to the tile swap, respetively.
+    Additionally, the swap busy indicator (used as the meter's LED)
+    has been improved, so that it's active whenever data has been
+    read-from/written-to the swap during the last sampling
+    interval, rather than at the point of sampling.
+  - Fonts can now be tagged. The user interface is the same as for
+    brushes, patterns etc.
+  - Some icons fixed: larger spacing between broken chains and
+    gimp-tool-ellipse-select made symmetrical.
+  Usability:
+  - When a plug-in cannot be applied to an image because of
+    mismatch in image types (e.g. layer has no alpha or image is
+    greyscale), GIMP now displays a message listing supported image
+    types for this plug-in.
+  Tools:
+  - The Measurement tool now has an "Auto straighten" option
+    allowing to rotate the active drawable (layer, channel…) so
+    that the measurement line is used as horizon. As other
+    transform tools, the feature will work on linked drawables as
+    well.
+  - The Smudge tool now paints correctly on images with a color
+    profile other than the GIMP's built-in one.
+  Build:
+  - Installer: set compatibility options to run Python plugins in
+    HiDPI-aware mode.
+  - Put back compatibility DLLs for really old plugins.
+  - Install binary tool `gimp-test-clipboard` on the system to
+    allow people to help us debug clipboard bugs.
+  - --enable-bundled-mypaint-brushes renamed
+  - -enable-relocatable-bundle and also make WMF fonts looked up
+    on the runtime prefix of GIMP (instead of the build-time path)
+    when this build option was set.
+  Plug-ins:
+  - gimptool-2.0 binary now accepts source files with non-standard
+    extensions if it can try to guess appropriate language from the
+    compiler being used. It will also properly quote arguments for
+    shell usage.
+  - Run explicitly Python 2 as Python plug-in interpreter to
+    prevent breakage on systems where Python 3 is the default.
+  - raw_input()'s argument in Python console is now optional, and
+    input() support has been added.
+  File Formats:
+  - The PSD loader now provides an option to load "merged",
+    pre-composited version of the images that becomes available
+    when a PSD file was saved with "Maximize Compatibility" option
+    enabled in Photoshop. This is useful when loading PSD files
+    that use features that GIMP doesn't currently support, and
+    therefore can't render correctly, such as adjustment layers.
+    When loading the merged image version, we avoid loading certain
+    additional data from the file, such as channels, paths, and
+    guides, while still loading metadata. This option is currently
+    exposed as an additional file type ("Photoshop image
+    (merged)"), which has to be explicitly selected from the
+    file-type list when opening the image.
+  - Embedding GIMP's built-in sRGB color profile to exported files
+    is now optional. The default choice can be set in the
+    Preferences dialog.
+  Translations:
+  - Updated translations: Catalan, Czech, Danish, Dutch, Finnish,
+    Greek, Hungarian, Italian, Latvian, Polish, Romanian, Russian,
+    Spanish, Swedish, Ukrainian.
+
+- update to 2.10.2 bugfix release
+- drop gimp-Fix-reference-to-gegl-0.3.patch
+  + Core:
+  - Discard fonts which fail to load and popup an info dialog to allow
+    people debug their fonts.
+  - New API to suppress updates in UI until plug-ins are done
+    introducing changes.
+  - New API to calculate histograms in separate threads, with possible further
+    extension to handle similar cases elsewhere in GIMP.
+  - Tool options are now properly saved and reloaded per-device at
+    startup.
+  + Plug-ins:
+  - New plug-in for importing and exporting HEIF images.
+  - Enable visibility of rasterized vector layer from PSD.
+  - Single-window screenshots in Windows fixed to correctly snap a
+    window even when it is partly off-screen or covered by another
+    window or when display scaling is not set to 100%.
+  + Filters:
+  - New Spherize filter to wrap an image around a spherical cap
+  - New Recursive Transform filter to create Droste effect.
+  + Usability:
+  - Warn users, when alpha-only painting has no effect. E.g. when target
+    drawable doesn't have an alpha channel, or the alpha channel is locked.
+  - Make the splash texts dynamic, so they are larger on larger splashes.
+  - Mention pressing Enter to complete Foreground selection in the status bar.
+  - Make sure that clicking outside any selection prevents Rectangle Select
+    and Ellipse Select tools from creating empty selections.
+  - Improve mouse wheel zooming behavior to keep the same point
+    centered under the pointer even if the image is completely visible
+    in the canvas.
+  - Add "View -> Center Image in Window" (Shift+J) as a quick way to
+    center the image at any zoom level.
+  + Translations:
+  - Updated translations: Catalan, Danish, Dutch, French, German, Greek,
+    Hungarian, Icelandic, Italian, Latvian, Polish, Russian, Spanish,
+    Swedish, Ukrainian.
+  - New translation of Windows installer: Chinese (Taiwan)
+  + Build:
+  - Add a --with-bug-report-url configure option allowing packagers to
+    set the address of their own bug tracker. This address will be the
+    one opened by the debug dialog for reporting bugs.
+  - Add a flatpak manifest for the gtk3-port branch.
+  - Remove the possibility to disable script-fu.
+  - Add a --with-icc-directory configure option to customize the color
+    profile directory. By default, it is set to the common path
+    /usr/share/color/icc.
+  + Documentation:
+  - Updating the description of the XCF format "devel-docs/xcf.txt", for
+    third-party readers wishing to support GIMP 2.10 XCF files.
+  - Add documentation skeletons for all enums in libgimpbase/, there is
+    much room for improvement.
+
+- Add gimp-Fix-reference-to-gegl-0.3.patch: gimp.pc: Fix reference
+  to gegl-0.3 - we require and build for gegl-0.4 now.
+
+- Update BuildRequires versions to be consistent with configure
+  script.
+
+- let libgimp-2_0-0 require libbabl-0_1-0 >= 0.1.46 to enforce updating
+  to the required version.
+
+- libbabl is required in version 0.1.46+
+
+- add BR for gdk-pixbuf-loader-rsvg to enable svg icons
+- enable jpeg2000 support: new BR pkgconfig(libopenjp2)
+- enable webp support: new BR pkgconfig(libwebp) >= 0.6.0
+- enable OpenEXR support: new BR pkgconfig(OpenEXR)
+- enable email support: new BR/R for xdg-utils for xdg-email
+- set LC_ALL/LANG in %prep and %build to silence warnings about
+  encoding of the translations
+- make sure we can see the compiler cmdlines by disabling the
+  silent rules
+
+- Update to version 2.10.0:
+  + Image processing nearly fully ported to GEGL, allowing high bit
+    depth processing, multi-threaded and hardware accelerated pixel
+    processing, and more.
+  + Color management is a core feature now, most widgets and
+    preview areas are color-managed.
+  + Many improved tools, and several new and exciting tools, such
+    as the Warp transform, the Unified transform and the Handle
+    transform tools.
+  + On-canvas preview for all filters ported to GEGL.
+  + Improved digital painting with canvas rotation and flipping,
+    symmetry painting, MyPaint brush support.
+  + Support for several new image formats added (OpenEXR, RGBE,
+    WebP, HGT), as well as improved support for many existing
+    formats (in particular more robust PSD importing).
+  + Metadata viewing and editing for Exif, XMP, IPTC, and DICOM.
+  + Basic HiDPI support: automatic or user-selected icon size.
+  + New themes for GIMP (Light, Gray, Dark, and System) and new
+    symbolic icons meant to somewhat dim the environment and shift
+    the focus towards content (former theme and color icons are
+    still available in Preferences).
+  + And more, better, more, and even more awesome!
+- Drop gimp-gegl03-buildfix.patch: Fixed upstream, following this
+  drop libtool BuildRequires and no longer pass autoreconf.
+- Replace pkgconfig(gegl-0.3) with gegl-0.4) BuildRequires.
+- Add gcc-c++, gegl, glib-networking, pkgconfig(gexiv2),
+  pkgconfig(liblzma), pkgconfig(libmypaint),
+  pkgconfig(mypaint-brushes-1.0) and pkgconfig(poppler-data)
+  BuildRequires: New dependencies.
+
+- Add gimp-gegl03-buildfix.patch: Port to gegl-03, patch taken from
+  debian.
+- Following the above port, replace pkgconfig(gegl-0.2) with
+  pkgconfig(gegl-0.3) BuildRequires and add libtool BuildRequires:
+  and pass autoreconf as the above patch touches the buildsystem.
+
+- Run spec-cleaner, modernize spec, drop Obsoletes for versions
+  no longer supported.
+
+- Don't build with webkit1, as it is no longer maintained and has
+  plenty of security bugs.  This disables the GIMP's built-in help
+  browser; it will use an external browser when configured this way.
+  This works around a number of security vulnerabilities in Webkit1:
+  https://bugzilla.suse.com/show_bug.cgi?id=923223
+  https://bugzilla.suse.com/show_bug.cgi?id=906375
+  https://bugzilla.suse.com/show_bug.cgi?id=906374
+  https://bugzilla.suse.com/show_bug.cgi?id=906373
+  https://bugzilla.suse.com/show_bug.cgi?id=1034856
+  https://bugzilla.suse.com/show_bug.cgi?id=871792
+  https://bugzilla.suse.com/show_bug.cgi?id=879607
+  https://bugzilla.suse.com/show_bug.cgi?id=892084
+
+- drop mypaint until it is in Factory.
+
+- update to 2.8.22
+- drop upstream patches - now in the the source
+- drop gimp-fix-PDF-Import-filter-crash.patch
+- drop gimp-bgo773233-CVE-2007-3126.patch
+- conditionalize mypaint support
+- full change log:
+  https://git.gnome.org/browse/gimp/plain/NEWS?h=GIMP_2_8_22
+
+- Build with libmypaint support.
+
+- Add gimp-bgo773233-CVE-2007-3126.patch: Gimp 2.3.14 allows
+  context-dependent attackers to cause a denial of service (crash)
+  via an ICO file with an InfoHeader containing a Height of zero
+  (bgo#773233, CVE-2007-3126).
+- Add gimp-fix-PDF-Import-filter-crash.patch: Fix a crash in PDF
+  Import filter when importing large image PDF or specifying high
+  resolution (bgo#593576).
+
+- Add conditional gimp-help-browser Obsoletes for Tumbleweed and
+  Leap newer than 42.x.
+
+- Remove --with-pic, this is only for static libs.
+- Trim description on non-main subpackages.
+
+- update to 2.8.20
+- Core:
+  - Avoid D-Bus error message when built without D-Bus support
+  - fix OS X min required conditional in gimpimagewindow.c
+  - Saving to existing .xcf.bz and .xcf.gz files didn't truncate them
+  and could lead to unnecessarily large files
+  - Text layer created by gimp-text-fontname doesn't respect border
+  when resized
+  - avoid seeking when saving XCF files to prevent corruption with
+  file network shares (fixed since 2014, but not mentioned in NEWS yet)
+  GUI:
+  - Flow on Paint Dynamics editor dialog: the 'y' axis is indicating
+  'Rate' instead 'Flow'
+  - Vertical ruler shows artifacts if the status bar isn't showing
+  - Tablet stylus misbehaves when crossing the edge of a dock in
+  multi-window-mode
+  - Disable the new "automatic window tabbing" feature introduced on macOS
+  Sierra
+  - Improve the visiblity of slider handles with dark themes
+  - Make it harder to switch to renaming if selecting already selected
+  items in resource lists
+  Tools:
+  - make toggling to color picker mode of paint tools more robust
+  Libgimp:
+  - call gimp_file_entry_set_filename() with filename encoding
+  Plug-ins:
+  - Prevent the Python console from closing by the Escape key
+  - Help browser does not launch on OS X
+  - Filter 'Edge Detect/Difference of Gaussians' returns empty image
+  - only use -xobjective-c for compile commands
+  - mkgen.pl: fix calls to write_file() routine to write to current
+  directory
+  - When printing, the images are composed onto a white background to
+  prevent printing a black box instead of a transaprent image
+  - Fix color visison deficiency display filters to apply gamma
+  correction directly
+  Updated Translations:
+  - Catalan  - Czech  - Danish  - Finnish  - French  - German
+  - Greek  - Hungarian  - Icelandic  - Italian  - Polish
+  - Portuguese  - Slovak  - Slovenian  - Scottish Gaelic
+  - Spanish  - Swedish
+  General:
+  - Bug fixes
+
+- Replace -devel BuildRequires for their pkgconfig version aligned
+  with what configure looks for:
+  - babl-devel for pkgconfig(babl).
+  - gegl-devel for pkgconfig(gegl-0.2).
+  - libpng-devel for pkgconfig(libpng).
+  - libpoppler-glib-devel for pkgconfig(poppler-glib).
+  - xorg-x11-libXfixes-devel for pkgconfig(xfixes).
+  - xorg-x11-libXpm-devel for pkgconfig(xpm).
+  - zlib-devel for pkgconfig(zlib).
+- Add an explicit pkgconfig(cairo-pdf) BuildRequires: configure
+  checks for it (full pdf support).
+- Run spec-cleaner: drop obsolete clean, modernise macros.
+- No longer depend on libwebkit-devel for Tumbleweed and pass
+  - -disable-webkit to configure for Tumbleweed.
+
+- update to 2.8.18
+- Drop gimp-Multiple-Use-After-Free.patch - upstreamed
+  +Core: - Initialize fontconfig cache in separate thread to keep GUI
+  responsive on first startup
+  - Properly recognize layer masks as deactivated, e.g. for moving layers
+  - Create $XDG_DATA_HOME if it doesn't exist
+  - (CVE-2016-4994) Multiple Use-After-Free when parsing XCF channel
+  and layer properties
+  - Fix progress access to prevent crash on rapid sequence of commands
+  - Fix crash in gimp-gradient-segment-range-move
+  +GUI:
+  - Disable color picker buttons on OS X to prevent a GUI lockup
+  - Disable "new-style" full-screen mode on OS X to prevent a crash
+  - Pulsing progress bar in splash screen to indicate unknown durations
+  - Fix gamut warning color for lcms display filter
+  - Fix unbolding of bold font on edit
+  - Prevent accidental renaming of wrong adjacent item
+  +Installer:
+  - Change compression settings to decrease size by 20%
+  - Add Catalan, Danish, French, Dutch
+  +Plug-ins:
+  - Fix crash on sRGB JPEG image drag & drop
+  - Fix ambiguous octal-escaped output of c-source
+  - Fix KISS CEL export
+  - Fix progress bar for file-compressor
+  - Make Script-Fu regex match return proper character indexes for
+  Unicode characters
+  - Fix Script-Fu modulo for large numbers
+  +General:
+  - Documentation updates
+  - Bug fixes
+  - Translation updates
+
+- Fix CVE-2016-4994 (boo#986021, bgo#767873):
+  + Add gimp-Multiple-Use-After-Free.patch: Multiple Use-After-Free
+    when parsing XCF channel and layer properties.
+
+- Explcitly declare the libgimp version in Requires, so upgrades
+  bring in the updated libraries as well. Makes the upgrade from
+  2.8.x > 2.8.16 seamless and avoids an error on start.
+
+- update to version 2.8.16
+- fix a couple of rpmlint warnings
+  +Core:
+  - Seek much less when writing XCF
+  - Don't seek past the end of the file when writing XCF
+  - Windows: call SetDLLDirectory() for less DLL hell
+  - Fix velocity parameter on .GIH brushes
+  - Fix brokenness while transforming certain sets of linked layers
+  +GUI:
+  - Always show image tabs in single window mode
+  - Fix switching of dock tabs by DND hovering
+  - Don't make the scroll area for tags too small
+  - Fixed a crash in the save dialog
+  - Fix issue where ruler updates made things very slow on Windows
+  +Plug-ins:
+  - Fix several issues in the BMP plug-in
+  - Make Gfig work with the new brush size behavior again
+  - Fix font export in the PDF plug-in
+  - Support layer groups in OpenRaster files
+  - Fix loading of PSD files with layer groups
+  + General:
+  - OSX build system fixes
+  - Bug fixes
+  - Translation updates
+
+- Replace liblcms-devel BuildRequires with pkgconfig(lcms2): gimp
+  has been ported to lcms2 since version 2.8.8.
+
glassfish-annotation-api
+- Build with source/target levels 8
+
glassfish-dtd-parser
-  the dependency chain.
+  the dependency chain. (jsc#SLE-23217)
glassfish-jax-rs-api
+- Change the tarball location, since the old location does not work
+  any more
+- Clean the spec file a bit
+
glassfish-jsp
+- Build with java source and target levels 8
+
glassfish-transaction-api
+- Specify specMode=javaee to be able to use newer
+  spec-version-maven-plugin
+
+- Build with target source and target levels 8
+
glib2
+- Update to version 2.70.5:
+  Bugs fixed: glgo#GNOME/GLib#2620, glgo#GNOME/GLib!2537,
+  glgo#GNOME/GLib!2555
+
+- Split gtk-docs from -devel package, these are not needed
+  during building projects using glib2
+- Use _multibuild as the meson buildprocess is very awkward
+  regarding the documentation - builds single-jobs only and
+  twice (again during %install). This way the rest of distribution
+  waiting for glib2-devel to be available is not blocked by this
+
+- Update to version 2.70.4:
+  + Bugs fixed: glgo#GNOME/GLib!2462 “Fix memory leak in
+    gio/gdbusauthmechanismsha1.c” to glib-2-70.
+  + Updated translations.
+
+- Update to version 2.70.3:
+  + Several important fixes to FD handling in gspawn.
+  + Several important fixes to GDBus message and GVariant parsing
+    of invalid data.
+  + Fix potential data loss due to missing fsync when saving files
+    on btrfs.
+  + Bugs fixed: glgo#GNOME/GLib#2503, glgo#GNOME/GLib#2506,
+    glgo#GNOME/GLib#2557, glgo#GNOME/GLib#2572,
+    glgo#GNOME/GLib#2580, glgo#GNOME/GLib!2394,
+    glgo#GNOME/GLib!2415, glgo#GNOME/GLib!2437,
+    glgo#GNOME/GLib!2444, glgo#GNOME/GLib!2455.
+  + Updated translations.
+
+- Update to version 2.70.2:
+  + Fix use of the default log writer with journald namespaces
+  + Fix hang in `dbus-daemon` under `GTestDBus` when
+    `G_MESSAGES_DEBUG=all` is set
+  + Speed up `g_canonicalize_filename()` to avoid pathogenic cases
+    with `..`
+  + Fix URI for pcre subproject as it’s moved upstream
+  + Fix storing GSettings dictionaries on macOS
+  + Speed up ‘remove dot segments’ algorithm in `GUri` to avoid
+    pathogenic cases with `..`
+  + Fix infinite loops in D-Bus message parsing for truncated
+    inputs
+  + Improve correctness of version information returned by
+    `g_get_os_info()` for Windows 10/Server 2019+
+  + Bugs fixed: glgo#GNOME/GLib#2400, glgo#GNOME/GLib#2426,
+    glgo#GNOME/GLib#2528, glgo#GNOME/GLib#2530,
+    glgo#GNOME/GLib#2537, glgo#GNOME/GLib#2541,
+    glgo#GNOME/GLib!2312, glgo#GNOME/GLib!2313,
+    glgo#GNOME/GLib!2314, glgo#GNOME/GLib!2316,
+    glgo#GNOME/GLib!2320, glgo#GNOME/GLib!2335,
+    glgo#GNOME/GLib!2337, glgo#GNOME/GLib!2340,
+    glgo#GNOME/GLib!2344, glgo#GNOME/GLib!2356,
+    glgo#GNOME/GLib!2359, glgo#GNOME/GLib!2361,
+    glgo#GNOME/GLib!2363, glgo#GNOME/GLib!2366,
+    glgo#GNOME/GLib!2375, glgo#GNOME/GLib!2383.
+  + Updated translations.
+
+- Stop passing fam=true to meson and drop gamin-devel
+  BuildRequires, following upstream default. Following this, drop
+  libgio-fam sub-package.
+
+- Update to version 2.70.1:
+  + Fix network changes not being signalled from NetworkManager.
+  + Fix build when building with --fatal-meson-warnings.
+  + Bugs fixed: glgo#GNOME/GLib#2505, glgo#GNOME/GLib!2245,
+    glgo#GNOME/GLib!2253, glgo#GNOME/GLib!2256,
+    glgo#GNOME/GLib!2259, glgo#GNOME/GLib!2262,
+    glgo#GNOME/GLib!2271, glgo#GNOME/GLib!2276,
+    glgo#GNOME/GLib!2300, glgo#GNOME/GLib!2301,
+    glgo#GNOME/GLib!2302, glgo#GNOME/GLib!2304.
+- Refresh patches with quilt.
+
+- Update to version 2.70.0:
+  + Bug fixed: ci: Replace FreeBSD 11 with FreeBSD 13.
+  + Updated translations.
+
+- Remove obsolete translation-update-upstream support
+  (jsc#SLE-21105).
+
+- desktop-file-utils: add Pantheon desktop environment
+
+- Update to version 2.69.3:
+  + g_settings_schema_key_range_check() misbehaves for int versus
+    bool.
+  + Compiling anything with GCC <4.6 spews deprecation warnings.
+  + `g_invoke_closure` bindings API break..
+  + GPowerProfileMonitorPortal does not notice initial
+    power-saver-enabled status.
+  + doc: Explicitly said, that no null term. is needed.
+  + ci: Use C.UTF-8 locale on FreeBSD 12.
+  + gio: Fix conditions in memory-monitor test.
+  + Updated translations.
+
+- Update to version 2.69.2:
+  + The `DBUS_SESSION_BUS_ADDRESS` environment variable is once
+    more not used if the process is `AT_SECURE`
+    (setuid/setgid/setcap); this change was previously applied and
+    then reverted because it broke gnome-keyring
+  + Add `g_test_fail_printf()`, `g_test_skip_printf()`,
+    `g_test_incomplete_printf()` helper functions for printing
+    messages when tests end prematurely
+  + Add portal implementation of `GPowerProfileMonitor`
+  + Various bugs fixed
+  + Updated translations.
+
+- Update to version 2.69.1:
+  + Support categories in desktop notifications (`GNotification`)
+  + Add `GPowerProfileMonitor` for monitoring when to use less
+    power (due to being on battery power, electricity being
+    expensive or high-carbon, etc.)
+  + Allow static names to be set for `GSource`s to avoid
+    unnecessary string copies
+  + Various bugs fixed
+  + Updated translations.
+
+- Update to version 2.69.0:
+  + Fix a crash in `GKeyFile` when parsing a file which contains
+    translations using a `GKeyFile` instance which has loaded
+    another file previously.
+  + Ensure `dlerror()` is used with locking as it’s not thread-safe
+    in some libc implementations.
+  + Drop internal libpcre copy in favour of a subproject from
+    wrapdb.
+  + Optimise grefcount atomic operations.
+  + Fix `g_date_time_format()` return value encoding if `LC_TIME`
+    is not a UTF-8 locale but other locale settings are.
+  + Set app name in freedesktop.org notifications with
+    `GNotification`.
+  + Add PKCS#11 flags to `GTlsPasswordFlags`.
+  - Drop -Dinternal_pcre=false meson parameter: follow upstreams
+    build recipe changes.
+
+- Update to version 2.68.4:
+  + Various bugfixes and backports from master.
+  + Updated translations.
+- Drop 63e7864.patch: fixed upstream.
+
+- Add 63e7864.patch: Fix build with glibc 2.34: use 3 parameters
+  for close_range (boo#1189088).
+
+- Drop patches fixed upstream on SLE and Leap 15.4:
+  + glib2-add-support-for-slim-timezone-format.patch
+  + glib2-fix-6-days-until-the-end-of-the-month.patch
+  + glib2-CVE-2021-27218.patch
+  + glib2-CVE-2021-27219-add-g_memdup2.patch
+
+- Silence output in libgio-2_0-0 post scriptlet in case the
+  ENV-mimeapps.list files do not exist: we are ready to create them
+  in this case. An error message is only confusing.
+
+- Update to version 2.68.3:
+  + Bugs fixed:
+  - testfilemonitor test leaks ip_watched_file_t struct
+  - GFile: `g_file_replace_contents()` reports
+    `G_IO_ERROR_WRONG_ETAG` when saving from a symlink
+  - Backport !2128 “inotify: Fix a memory leak” to glib-2-68
+  - Backport !2136 “tlscertificate: Avoid possible invalid read”
+    to glib-2-68
+  - Backport !2138 “glocalfileoutputstream: Fix ETag check when
+    replacing through a symlink” to glib-2-68.
+
+- Update to version 2.68.2:
+  + Fix building third-party projects against GLib on CentOS 7.
+  + Bugs fixed:
+  - json-glib does not build with glib 2.68.1.
+  - gmacros: check that __cplusplus or _MSC_VER is defined.
+  - gmacros: missing check if __STDC_VERSION__ is defined.
+  - Backport !2078 “gthreadedresolver: don't ignore flags in
+    lookup_by_name_with_flags” to glib-2-68.
+
+- Update to version 2.68.1:
+  + Fix a crash in `GKeyFile` when parsing a file which contains
+    translations using a `GKeyFile` instance which has loaded
+    another file previously.
+  + Pin GIO DLL in memory on Windows.
+  + Updated translations.
+
+- Update to version 2.68.0:
+  + Bugs fixed:
+  - build: Drop gconstructor_as_data_h usage from
+    glib-compile-schemas.
+  - glib.supp: Generalize some suppressions.
+  - gbytesicon: Fix error in g_bytes_icon_new() documentation.
+  - glocalfileoutputstream: Tidy up error handling.
+  - tests: Fix copy/paste error in queue test.
+
+- Update to version 2.67.6:
+  + Fix a security issue when using `g_file_replace()` with
+    `G_FILE_CREATE_REPLACE_DESTINATION`.
+  + Disallow operations on the empty path with
+    `g_file_new_from_path()`.
+  + Various fixes for GLib when building with clang-cl on Windows.
+  + Updated translations.
+
+- Update to version 2.67.5:
+  + Fix more issues with `glib_typeof` macro from 2.67.3–2.67.4.
+  + Fix regression with some FD mappings passed to
+    `g_subprocess_launcher_spawnv()` caused by changes for #2097 in
+    GLib 2.67.4.
+  + Fix detection of `str[n]casecmp()` when building with
+    `clang-cl`.
+  + Use zlib from subproject if configured with
+    `wrap_mode=forcefallback`.
+  + Updated translations.
+
+- Add glib2-CVE-2021-27218.patch: g_byte_array_new_take takes a
+  gsize as length but stores in a guint, this patch will refuse if
+  the length is larger than guint. (bsc#1182328,
+  glgo#GNOME/glib!1944)
+
+- Add glib2-CVE-2021-27219-add-g_memdup2.patch: g_memdup takes a
+  guint as parameter and sometimes leads into an integer overflow,
+  so add a g_memdup2 function which uses gsize to replace it.
+  (bsc#1182362, glgo#GNOME/glib!1927, glgo#GNOME/glib!1933,
+  glgo#GNOME/glib!1943)
+
+- Update to version 2.67.4:
+  + Add a `g_string_replace()` function.
+  + Add `G_DBUS_SERVER_FLAGS_AUTHENTICATION_REQUIRE_SAME_USER` flag
+    to simplify the common case for writing a D-Bus authentication
+    observer, allowing most uses of `GDBusAuthObserver` to be
+    dropped.
+  + Add a new `g_spawn_with_pipes_and_fds()` variant which supports
+    renumbering FDs.
+  + Add new g_memdup2() API to replace g_memdup(), which is
+    vulnerable to a silent integer truncation and heap overflow
+    problem if not used carefully.
+  + Fix various regressions caused by rushed security fixes in
+    2.66.6.
+  + Fix a silent integer truncation when calling
+    g_byte_array_new_take() for byte arrays bigger than G_MAXUINT.
+  + Fix `g_utf8_strdown()` to fix some issues in Turkish.
+  + Updated translations.
+
+- Update to version 2.67.3:
+  + Add new `g_memdup2()` API to replace `g_memdup()`, which is
+    vulnerable to a silent integer truncation and heap overflow
+    problem if not used carefully.
+  + Add new `g_dbus_object_path_escape()` and
+    `g_dbus_object_path_unescape()` APIs to provide one way of
+    escaping arbitrary bytestrings for use in D-Bus object paths.
+  + Use `bash-completion.pc` (if available) to provide the path to
+    install completion files into.
+  + Fix support for public/private trigraphs in `glib-mkenums`.
+  + Add `glib_debug` configure option to allow disabling debug
+    infrastructure in builds with debug symbols enabled.
+  + Fix a regression where `PATH` would always be searched when
+    using `g_spawn()`, even when it wasn’t supposed to.
+  + Override `gio-querymodules` in Meson when used as a submodule.
+  + Updated translations.
+- Rebase glib2-dbus-socket-path.patch.
+
+- Update to version 2.67.2:
+  + Add `gio launch` command to execute programs.
+  + Fix unused parameter warnings in code generated by
+    `gdbus-codegen`.
+  + Officially deprecate `to-pixdata` option for
+    `glib-compile-resources`, in favour of simply embedding more
+    modern image formats in linked-in `GResource` files.
+  + Support querying and running UWP applications on Windows.
+  + Support `gio trash --restore` and `gio trash --list` commands.
+  + No longer read environment variables for GIO module locations
+    when running as setuid.
+  + More progress on fixing compiler warnings.
+  + `GKeyFile` performance improvements.
+  + Improve UDP socket behaviour on Windows.
+  + Add `-Dtests` meson configure option for disabling tests
+    entirely.
+- Changes from version 1.67.1:
+  + Deprecate `g_time_zone_new()` in favour of
+    `g_time_zone_new_identifier()`, which makes error checking
+    easier.
+  + Remove `volatile` from various public APIs, including
+    `G_DEFINE_*`. You should adjust your code to not use `volatile`
+    for atomic variables, `GOnce` variables, or mostly anything.
+  + Support passing file handles to `gdbus` command line tool.
+  + Add `g_assert_cmpstrv()` test convenience function.
+  + Changes to the behaviour of the `G_URI_FLAGS_SCHEME_NORMALIZE`
+    scheme normalization flag in `GUri`.
+  + Add new `--run-prefix` and `--skip-prefix` options to GTest, to
+    allow running or skipping test suites by prefix.
+  + Fix thread-safety of `GBinding`.
+  + Updated translations.
+- Rebase glib2-bgo569829-gettext-gkeyfile.patch,
+  glib2-fate300461-gettext-gkeyfile-suse.patch,
+  glib2-dbus-socket-path.patch and
+  glib2-gdbus-codegen-version.patch.
+
+- Update to version 2.66.7:
+  + Fix various regressions caused by rushed security fixes in
+    2.66.6.
+  + Fix a silent integer truncation when calling
+    `g_byte_array_new_take()` for byte arrays bigger than
+    `G_MAXUINT`.
+  + Disallow using currently-undefined D-Bus connection or server
+    flags to prevent forward-compatibility problems with new
+    security-sensitive flags likely to be released in GLib 2.68.
+  + Bugs fixed: glgo#GNOME/GLib!1933, glgo#GNOME/GLib!1943,
+    glgo#GNOME/GLib!1944, glgo#GNOME/GLib!1945.
+
+- disable irrelevant warnings
+- use macros in spec file
+- simplify trigger code
+
+- Update to version 2.66.6:
+  + Fix various instances within GLib where `g_memdup()` was
+    vulnerable to a silent integer truncation and heap overflow
+    problem (glgo#GNOME/GLib#2319).
+
+- Update to version 2.66.5:
+  + Fix some issues with handling over-long (invalid) input when
+    parsing for `GDate`.
+  + Don’t load GIO modules or parse other GIO environment variables
+    when `AT_SECURE` is set (i.e. in a setuid/setgid/setcap
+    process). GIO has always been documented as not being safe to
+    use in privileged processes, but people persist in using it
+    unsafely, so these changes should harden things against
+    potential attacks at least a little. Unfortunately they break a
+    couple of projects which were relying on reading
+    `DBUS_SESSION_BUS_ADDRESS`, so GIO continues to read that for
+    setgid/setcap (but not setuid) processes. This loophole will be
+    closed in GLib 2.70 (see issue #2316), which should give
+    modules 6 months to change their behaviour.
+  + Fix `g_spawn()` searching `PATH` when it wasn’t meant to.
+  + Bugs fixed: bgo#2168, bgo#2210, bgo#2305, glgo#GNOME/GLib!1820,
+    glgo#GNOME/GLib!1824, glgo#GNOME/GLib!1831,
+    glgo#GNOME/GLib!1836, glgo#GNOME/GLib!1864,
+    glgo#GNOME/GLib!1872, glgo#GNOME/GLib!1913,
+    glgo#GNOME/GLib!1922.
+- Rebase/refresh patches:
+  + glib2-dbus-socket-path.patch
+  + glib2-fate300461-gettext-gkeyfile-suse.patch
+  + glib2-gdbus-codegen-version.patch
+  + glib2-suppress-schema-deprecated-path-warning.patch
+  + glib2-bgo569829-gettext-gkeyfile.patch
+
+- Update to version 2.66.4:
+  + Fix some issues in parsing floating point seconds in
+    `GDateTime`
+  + Fix some issues in handling invalid UTF-8 when parsing for
+    `GDate`
+  + Bugs fixed: glgo#GNOME/GLib#2264, glgo#GNOME/GLib!1774,
+    glgo#GNOME/GLib!1790, glgo#GNOME/GLib!1793,
+    glgo#GNOME/GLib!1799, glgo#GNOME/GLib!1805.
+
+- Add requires(post) libgio-2_0-0 to glib2-tools: ensures
+  glib-compile-schema to be functional when the file trigger fires,
+  by explicitly requesting the correct library to be present for
+  the post script. (boo#1178713).
+
+- Update to version 2.66.3:
+  + Fix awkward bug with `GPollFD` handling in some situations.
+  + Fix sending FDs attached to very large D-Bus messages.
+  + Bugs fixed: glgo#GNOME/GLib#1592, glgo#GNOME/GLib!1720,
+    glgo#GNOME/GLib!1721, glgo#GNOME/GLib!1723,
+    glgo#GNOME/GLib!1727, glgo#GNOME/GLib!1736.
+
+- add %license COPYING
+- add %doc README.md
+- rename -tests to -tests-devel
+
+- Add patches to support for slim format of timezone (bsc#1178346):
+  + glib2-add-support-for-slim-timezone-format.patch: basic support
+    for slim format (glgo#GNOME/glib!1533).
+  + glib2-fix-6-days-until-the-end-of-the-month.patch: fix DST
+    incorrect end day when using slim format
+    (glgo#GNOME/glib!1683).
+
+- Enable building of documentation:
+  + Toggle gtk_doc from bcond_with to bcond_without.
+  + Use sed to replace gtk-doc version in
+    docs/reference/meson.build with 1.32.
+
+- Update to version 2.66.2:
+  + Important and time-critical fix to DST transitions which will
+    happen in Europe on 2020-10-25 on distributions which use the
+    ‘slim’ tzdata format (which is now the default in tzdata/tzcode
+    2020b).
+  + Further timezone handling changes to restore support for
+    changing the timezone when `/etc/localtime/` changes.
+  + Fix deadlock on Windows when `G_SLICE` is set in the
+    environment.
+  + Fix UTF-8 validation when escaping URI components.
+  + Updated translations.
+
+- Update to version 2.66.1:
+  + A performance problem where timezones were reloaded from disk
+    every time a `GTimeZone` was created has been fixed, but this
+    means that changes to `/etc/localtime` will not take effect
+    until a process restarts; future changes in a subsequent 2.66.x
+    release will improve this.
+  + Security fix for incorrect scope/zone ID parsing in URIs.
+  + Updated translations.
+
+- Update to version 2.66.0:
+  + * Bugs fixed:
+  - Missing tab in makefile rule.
+  - guri: Fix user passed to g_uri_split_with_user() not being
+    NULL'd.
+  + Updated translations.
+
+- Update to version 2.65.3:
+  + Fixes to the new `statx()` calls — note that since GLib 2.65.2
+    uses `statx()` (if available) instead of
+    `stat()`/`fstat()`/`lstat()`/`fstatat()`, syscall sandboxing
+    for third party applications might need to be updated.
+  + Updated translations.
+
+- Update to version 2.65.2:
+  + Support `statx()` and `G_FILE_ATTRIBUTE_TIME_CREATED`.
+  + Fix deadlock in `g_subprocess_communicate_async()`.
+  + Add `%f`/microsecond placeholder support to
+    `g_date_time_format()`.
+- Changes from version 2.65.1:
+  + Add `GUri` API for parsing, building and representing URIs
+    according to [RFC 3986](https://tools.ietf.org/html/rfc3986).
+  + Fix handling of xattr data with embedded nuls.
+  + Add `g_file_set_contents_full()` which gives more control over
+    fsyncs.
+  + Add a `x-gvfs-notrash` option to disable trash on certain
+    mounts.
+  + Support ‘slim’ TZif files generated with `zic -b slim`.
+  + Support emitting profiling marks from `GMainContext` to sysprof
+    capture files.
+  + Accept IPv6 zone IDs in `g_hostname_is_ip_address()`.
+  + Updated translations.
+- Rebase glib2-gdbus-codegen-version.patch.
+- Build without gtk-doc: it would require a not yet released
+  version of gtk-doc.
+
+- Update to version 2.64.6:
+  + Bugs fixed: glgo#GNOME/GLib#2194, glgo#GNOME/GLib#2209,
+    glgo#GNOME/GLib!1633, glgo#GNOME/GLib!1634,
+    glgo#GNOME/GLib!1656, glgo#GNOME/GLib!1659,
+    glgo#GNOME/GLib!1666, glgo#GNOME/GLib!1672.
+  + Updated translations.
+
+- Update to version 2.64.5:
+  + Fix deadlock in `g_subprocess_communicate_async()`.
+  + Bugs fixed: glgo#GNOME/GLib!1519, glgo#GNOME/GLib!1520,
+    glgo#GNOME/GLib!1565, glgo#GNOME/GLib!1608,
+    glgo#GNOME/GLib!1618, glgo#GNOME/GLib!1621.
+
+- Update to version 2.64.4:
+  + Bugs fixed:glgo#GNOME/GLib#2140, glgo#GNOME/GLib!1507,
+    glgo#GNOME/GLib!1523, glgo#GNOME/GLib!1547.
+  + Updated translations.
+
+- Update to version 2.64.3:
+  + Stability improvements for various unit tests.
+  + Bugs fixed: glgo#GNOME/GLib#1954, glgo#GNOME/GLib#2094,
+    glgo#GNOME/GLib!1470, glgo#GNOME/GLib!1471,
+    glgo#GNOME/GLib!1473, glgo#GNOME/GLib!1478,
+    glgo#GNOME/GLib!1483, glgo#GNOME/GLib!1484,
+    glgo#GNOME/GLib!1486, glgo#GNOME/GLib!1495,
+    glgo#GNOME/GLib!1501.
+  + Updated translations.
+
+- Update to version 2.64.2:
+  + Bugs fixed: glgo#GNOME/GLib#2067, glgo#GNOME/GLib#2081,
+    glgo#GNOME/GLib!1421, glgo#GNOME/GLib!1438,
+    glgo#GNOME/GLib!1424, glgo#GNOME/GLib!1428,
+    glgo#GNOME/GLib!1429, glgo#GNOME/GLib !1431,
+    glgo#GNOME/GLib!1432, glgo#GNOME/GLib!1435,
+    glgo#GNOME/GLib!1447.
+  + Updated translations.
+
+- Update to version 2.64.1:
+  + Fix memory monitor tests to only be installed if
+    installed-tests are enabled, and to be skipped if
+    GObject-Introspection is too old.
+  + Bugs fixed: glgo#GNOME/GLib#1986, glgo#GNOME/GLib#1988,
+    glgo#GNOME/GLib!1407, glgo#GNOME/GLib!1412.
+  + Updated translations.
+
+- Update to version 2.64.0:
+  + Use `posix_spawn()` to speed up launching test D-Bus instances.
+  + Bugs fixed: glgo#GNOME/GLib#1783, glgo#GNOME/GLib#2049,
+    glgo#GNOME/GLib!1384, glgo#GNOME/GLib!1386,
+    glgo#GNOME/GLib!1387, glgo#GNOME/GLib!1388,
+    glgo#GNOME/GLib!1389.
+  + Updated translations.
+
+- Update to version 2.63.6:
+  + Fix potential relative read when calling g_printerr(), which
+    could lead to a denial of service from a setuid-root process
+    being used to block access to the TTY for another user.
+  + Fix SOCKS proxy resolver sometimes not being used when
+    resolving addresses via Happy Eyeballs (CVE-2020-6750).
+  + Several other Happy Eyeballs fixes for address resolution.
+  + Various race fixes in `GDBusConnection` and its unit tests.
+  + Fix a race condition with D-Bus name ownership.
+  + Drop `gio-launch-desktop` helper application in favour of
+    calling `sh` directly.
+  + Fix win32 exception handling with C# exceptions.
+  + Fix thread safety of `GUnixMountMonitor`.
+  + Additional fixes to new thread pool attribute behaviour from
+    GLib 2.63.4 to check if sched_setattr() is allowed by system
+    policies before depending on it.
+  + Fix memory leaks and corruption when freeing `GSource`s while
+    freeing a `GMainContext`.
+  + Drop inappropriate installation of object manager example
+    documentation.
+  + Varioius other bugs and fixes.
+  + Updated translations.
+
+- Update to version 2.63.5:
+  + Fix behaviour of `g_file_move()` fallback code to not follow
+    symlinks.
+  + Rename `--glib-min-version` argument of `gdbus-codegen` to
+    `--glib-min-required`.
+  + Add gtk-doc checks to CI and fix a number of documentation
+    issues.
+  + Add a debug message if `g_setenv()` or `g_unsetenv()` are used
+    after any threads have been spawned — this will be upgraded to
+    a warning in future.
+  + Skip memory monitor tests if xdg-desktop-portal or dbusmock are
+    not available.
+  + Change the `libmount` configure option from a boolean to a
+    Meson `feature`.
+  + Do not return `target-uri` from `g_file_peek_path()` when
+    called on trash/recent files.
+  + Drop new TLS certificate API for PKCS #11 backed certificates,
+    as the implementation is not ready yet (this is not an API
+    break as the API was added earlier in the 2.63 cycle).
+  + Updated translations.
+  + For changes from earlier in the dev cycle see the NEWS file.
+- Rebase glib2-gdbus-codegen-version.patch.
+
+- Update to version 2.62.6:
+  + This is expected to be the final release in the 2.62.x stable
+    series; maintenance effort will shift to the newer 2.64.x
+    stable series now.
+  + Fix SOCKS5 username/password authentication.
+  + Exception handling fixes on Windows.
+  + Bugs fixed: glgo#GNOME/GLib#1986, glgo#GNOME/GLib#1988,
+    glgo#GNOME/GLib#2049, glgo#GNOME/GLib!1378,
+    glgo#GNOME/GLib!1380, glgo#GNOME/GLib!1393,
+    glgo#GNOME/GLib!1394, glgo#GNOME/GLib!1411.
+  + Updated translations.
+
+- Update to version 2.62.5:
+  + Fix potential relative read when calling g_printerr(), which
+    could lead to a denial of service from a setuid-root process
+    being used to block access to the TTY for another user.
+  + Fix SOCKS proxy resolver sometimes not being used when
+    resolving addresses via Happy Eyeballs (CVE-2020-6750).
+  + Several other Happy Eyeballs fixes for address resolution.
+  + Fix parsing of full Julian day range from `$TZ` environment
+    variable.
+  + Several race condition/crash fixes.
+  + Bugs fixed: glgo#GNOME/GLib#1919, glgo#GNOME/GLib#1995,
+    glgo#GNOME/GLib#1999, glgo#GNOME/GLib!1323,
+    glgo#GNOME/GLib!1331, glgo#GNOME/GLib!1352,
+    glgo#GNOME/GLib!1361, glgo#GNOME/GLib!1365,
+    glgo#GNOME/GLib!1370, glgo#GNOME/GLib!1371.
+  + Updated translations.
+
+- No longer recommend -lang: supplements are in use
+
+- Update to version 2.62.4:
+  + Apply recursion depth limits to variants in D-Bus messages.
+  + Bugs fixed: glgo#GNOME/GLib#1938, glgo#GNOME/GLib!1240,
+    glgo#GNOME/GLib!1257, glgo#GNOME/GLib!1266,
+    glgo#GNOME/GLib!1276, glgo#GNOME/GLib!1290.
+
+- Update to version 2.62.3:
+  + Use `poll()` in `g_spawn_sync()` rather than `select()`, which
+    is subject to FD limits.
+  + Fix undefined behaviour with `g_utf8_find_prev_char()`.
+  + Bugs fixed: glgo#GNOME/GLib#954, glgo#GNOME/GLib#1318,
+    glgo#GNOME/GLib#1897, glgo#GNOME/GLib#1903,
+    glgo#GNOME/GLib#1916, glgo#GNOME/GLib#1917,
+    glgo#GNOME/GLib!1174, glgo#GNOME/GLib!1184,
+    glgo#GNOME/GLib!1194, glgo#GNOME/GLib!1203,
+    glgo#GNOME/GLib!1207, glgo#GNOME/GLib!1215,
+    glgo#GNOME/GLib!1219, glgo#GNOME/GLib!1222,
+    glgo#GNOME/GLib!1228.
+
+- Re-enable systemtap, and require systemtap-headers and
+  systemtap-dtrace, rather than systemtap-sdt-devel, to avoid build
+  cycle (boo#1145438).
+- Own /usr/share/systemtap{|tapset} directories, since we no
+  longer have systemtap-sdt-devel in BuildRequires.
+- Disable lto if systemtap is enabled: build fails otherwise.
+
+- Update to version 2.62.2:
+  + Bugs fixed:
+  - glgo#GNOME/GLib#1896: Use after free when calling
+    g_dbus_connection_flush_sync() in a dedicated thread.
+  - glgo#GNOME/GLib!1154: Backport glgo#GNOME/GLib!1152
+    “gwinhttpvfs: Handle g_get_prgname() returning NULL” to
+    glib-2-62.
+  - glgo#GNOME/GLib!1156: Backport glgo#GNOME/GLib!1146 Solaris
+    fixes to glib-2-62.
+
+- Update to version 2.62.1:
+  + Fix regression in g_file_copy() when passing
+    `G_FILE_COPY_TARGET_DEFAULT_PERMS` flag; the destination
+    permissions would be private rather than following the process’
+    umask.
+  + Several `GDateTime` parsing fixes.
+  + Always build the tests if installed-tests are enabled, so that
+    the tests can actually be installed.
+  + Bugs fixed: glgo#GNOME/GLib#174, glgo#GNOME/GLib#1865,
+    glgo#GNOME/GLib#1875, glgo#GNOME/GLib#1887,
+    glgo#GNOME/GLib#1888, glgo#GNOME/GLib!1021,
+    glgo#GNOME/GLib!1094, glgo#GNOME/GLib!1101,
+    glgo#GNOME/GLib!1102, glgo#GNOME/GLib!1103,
+    glgo#GNOME/GLib!1127, glgo#GNOME/GLib!1128,
+    glgo#GNOME/GLib!1140, glgo#GNOME/GLib!1141,
+    glgo#GNOME/GLib!1142.
+  + Updated translations.
+
+- Update to version 2.62.0:
+  + Fix new `GFileInfo` APIs to work when
+    `G_FILE_ATTRIBUTE_TIME_MODIFIED_USEC` was not queried.
+  + Bugs fixed: glgo#GNOME/GLib#487, glgo#GNOME/GLib!1084,
+    glgo#GNOME/GLib!1086,glgo#GNOME/GLib!1087.
+
+- Update to version 2.61.3:
+  + Support setting thread name on BSD systems.
+  + Install previously-uninstalled headers for public
+    `GNativeSocketAddress` object.
+  + Very initial support for Windows apps (UWP).
+  + Add various new valgrind suppressions to `glib.supp`.
+  + Bugs fixed: glgo#GNOME/GLib!83, glgo#GNOME/GLib!512,
+    glgo#GNOME/GLib!873, glgo#GNOME/GLib!905, glgo#GNOME/GLib!1057,
+    glgo#GNOME/GLib!1309, glgo#GNOME/GLib!1620,
+    glgo#GNOME/GLib!1761, glgo#GNOME/GLib!1803,
+    glgo#GNOME/GLib!1819, glgo#GNOME/GLib!1852,
+    glgo#GNOME/GLib!1854, glgo#GNOME/GLib!1860,
+    glgo#GNOME/GLib!1863, glgo#GNOME/GLib!1867,
+    glgo#GNOME/GLib!1870, glgo#GNOME/GLib!1879,
+    glgo#GNOME/GLib!1880, glgo#GNOME/GLib!1881,
+    glgo#GNOME/GLib!1002, glgo#GNOME/GLib!1011,
+    glgo#GNOME/GLib!1015, glgo#GNOME/GLib!1016,
+    glgo#GNOME/GLib!1017, glgo#GNOME/GLib!1023,
+    glgo#GNOME/GLib!1026, glgo#GNOME/GLib!1027,
+    glgo#GNOME/GLib!1031, glgo#GNOME/GLib!1032,
+    glgo#GNOME/GLib!1033, glgo#GNOME/GLib!1034,
+    glgo#GNOME/GLib!1036, glgo#GNOME/GLib!1037,
+    glgo#GNOME/GLib!1044, glgo#GNOME/GLib!1049,
+    glgo#GNOME/GLib!1050, glgo#GNOME/GLib!1054,
+    glgo#GNOME/GLib!1057, glgo#GNOME/GLib!1059,
+    glgo#GNOME/GLib!1066, glgo#GNOME/GLib!1068,
+    glgo#GNOME/GLib!1071, glgo#GNOME/GLib!1074,
+    glgo#GNOME/GLib!1075.
+
+- Update to version 2.61.2:
+  + Add various new array functions (#236, #269, #373).
+  + Rework how D-Bus connections are closed/unreffed when
+    `g_test_dbus_down()` is called. Tests which leak a
+    `GDBusConnection` may now time out and abort, rather than
+    silently leaking. (#787)
+  + Add a deprecation macro for GLib macros, and use it;
+    third-party uses of long-deprecated GLib macros may now start
+    causing warnings. (#1060).
+  + Deprecate `GTime` and `GTimeVal`, and various functions which
+    use them. Use `GDateTime` and `guint64` UNIX timestamps
+    instead.
+  + Stop using `G_DISABLE_DEPRECATED` to allow disabling
+    deprecation warnings; third-party code should now be using
+    `GLIB_VERSION_{MIN_REQUIRED, MAX_ALLOWED}` to control symbol
+    usage.
+  + Improve `GNetworkMonitor` detection of offline states (#1788).
+  + Fix CVE-2019-12450, wide permissions of files when copying
+    using GIO.
+- Changes from version 2.61.1:
+  + Upgrade to Unicode Character Database v12.1.
+  + Improve network availability detection with NetworkManager to
+    treat lower levels of connectivity as having reduced
+    availability.
+- Changes from version 2.61.0:
+  + Add coloured output support to `gdbus introspect.
+  + Updated translations.
+
+- Update to version 2.60.7:
+  + Bugs fixed: glgo#GNOME/GLib#1819, glgo#GNOME/GLib#1847,
+    glgo#GNOME/GLib!1012, glgo#GNOME/GLib!1013,
+    glgo#GNOME/GLib!1061, glgo#GNOME/GLib!1065,
+    glgo#GNOME/GLib!1081.
+
+- Update to version 2.60.6:
+  + Fix various bugs with use of the `GKeyfileSettingsBackend`
+    within flatpaks (glgo#GNOME/GLib!984, glgo#GNOME/GLib!985,
+    glgo#GNOME/GLib#1825).
+  + Bugs fixed: glgo#GNOME/GLib!993, glgo#GNOME/GLib!984,
+    glgo#GNOME/GLib!985.
+- Drop glib2-keyfile-handle-filename-being-null.patch: Fixed
+  upstream.
+
+- Add glib2-keyfile-handle-filename-being-null.patch: key file:
+  Handle filename being NULL (glgo#GNOME/GLib!1825,
+  glgo#GNOME/GLib#984).
+
+- Update to version 2.60.5:
+  + Fix implicit use of the `GKeyfileSettingsBackend`.
+  + Fix opening a URI using the ‘Open URI’ portal.
+  + Bugs fixed: glgo#GNOME/GLib!910, glgo#GNOME/GLib!949,
+    glgo#GNOME/GLib!956, glgo#GNOME/GLib!958, glgo#GNOME/GLib!969,
+    glgo#GNOME/GLib!977.
+
+- Update to version 2.60.4:
+  + Fixes to improved network status detection with NetworkManager.
+  + Leak fixes to some `glib-genmarshal` generated code.
+  + Further fixes to the Happy Eyeballs (RFC 8305) implementation.
+  + File system permissions fix to clamp down permissions in a
+    small time window when copying files (CVE-2019-12450).
+  + Bugs fixed: glgo#GNOME/GLib#1755, glgo#GNOME/GLib#1788,
+    glgo#GNOME/GLib#1792, glgo#GNOME/GLib#1793,
+    glgo#GNOME/GLib#1795, glgo#GNOME/GLib!865, glgo#GNOME/GLib!878.
+
+- Set umask to 022 before running glib-compile-schemas
+  (boo#1131761).
+
+- Update to version 2.60.3:
+  + * Various fixes to small key/value support in `GHashTable`.
+  * Bugs fixed:
+  - Critical in g_socket_client_async_connect_complete.
+  - New GHashTable implementation confuses valgrind.
+  - test_month_names: assertion failed.
+  - GNetworkAddressAddressEnumerator unsafely modifies cache in
+    GNetworkAddress.
+  - Leaks in gsocketclient.c connection code.
+  - glib/date test fails.
+  - GDB pretty-printer for GHashTable no longer works
+  + Updated translations.
+
+- Move glib2.macros to %_rpmmacrodir. /etc is for the system admin.
+
+- Update to version 2.60.2:
+  + Fix crash when displaying notifications on macOS.
+  + Improve network status detection with NetworkManager.
+  + Bugs fixed: glgo#GNOME/GLib!790, glgo#GNOME/GLib!793,
+    glgo#GNOME/GLib!803.
+  + Updated translations.
+
+- Use FAT LTO objects in order to provide proper static library (boo#1133129).
+
+- Update to version 2.60.1:
+  + Fix documentation for `gdbus-tool wait` to use correct units.
+  + Bugs fixed: glgo#GNOME/GLib#1709, glgo#GNOME/GLib#1725,
+    glgo#GNOME/GLib#1737, glgo#GNOME/GLib!711, glgo#GNOME/GLib!722,
+    glgo#GNOME/GLib!727, glgo#GNOME/GLib!729, glgo#GNOME/GLib!758,
+    glgo#GNOME/GLib!775.
+  + Updated translations.
+- Drop upstream fixed patch:
+  0001-Handle-an-UNKNOWN-NetworkManager-connectivity-as-NONE.patch.
+
+- Add patch submitted upstream to handle an UNKNOWN NM connectivity
+  the same as a NONE value. This partly fixes boo#1103678
+  (packagekit reports the network as available on a computer
+  without network connectivity which makes plasma-pk-update start
+  an update check which obviously fails).
+  * 0001-Handle-an-UNKNOWN-NetworkManager-connectivity-as-NONE.patch
+
+- Update to version 2.60.0:
+  + Further fixes to the Happy Eyeballs (RFC 8305) implementation.
+  + Add support for the XDG trash portal.
+  + Bugs fixed: glgo#GNOME/GLib#1653, glgo#GNOME/GLib#1658,
+    glgo#GNOME/GLib#1668, glgo#GNOME/GLib#1675,
+    glgo#GNOME/GLib#1676, glgo#GNOME/GLib#1679,
+    glgo#GNOME/GLib#1693, glgo#GNOME/GLib#1697,
+    glgo#GNOME/GLib#1698, glgo#GNOME/GLib!276, glgo#GNOME/GLib!639,
+    glgo#GNOME/GLib!666, glgo#GNOME/GLib!674, glgo#GNOME/GLib!676,
+    glgo#GNOME/GLib!677, glgo#GNOME/GLib!686, glgo#GNOME/GLib!688,
+    glgo#GNOME/GLib!689, glgo#GNOME/GLib!691, glgo#GNOME/GLib!692,
+    glgo#GNOME/GLib!696, glgo#GNOME/GLib!698, glgo#GNOME/GLib!699,
+    glgo#GNOME/GLib!702, glgo#GNOME/GLib!703.
+  + Updated translations.
+
+- Update to version 2.59.2:
+  + Fix check on GDBusMessage size when reading it.
+  + Add async GIO API: g_file_query_default_handler_async(),
+    g_app_info_launch_uris_async().
+  + Fix some bugs in the Happy Eyeballs implementation.
+  + Install a new generated header with enum types for Unicode
+    enums.
+  + Support the XDG trash portal.
+  + Bugs fixed: glgo#GNOME/GLib#1224, glgo#GNOME/GLib#1249,
+    glgo#GNOME/GLib#1347, glgo#GNOME/GLib#1376,
+    glgo#GNOME/GLib#1642, glgo#GNOME/GLib#1646,
+    glgo#GNOME/GLib#1649, glgo#GNOME/GLib#1673,
+    glgo#GNOME/GLib!276, glgo#GNOME/GLib!481, glgo#GNOME/GLib!585,
+    glgo#GNOME/GLib!593, glgo#GNOME/GLib!609, glgo#GNOME/GLib!619,
+    glgo#GNOME/GLib!622, glgo#GNOME/GLib!626, glgo#GNOME/GLib!627,
+    glgo#GNOME/GLib!629, glgo#GNOME/GLib!630.
+  + Updated translations.
+
+- BuildIgnore glib2-devel: since we have to require gtk-doc in
+  order to produce the doc, we gained an implicit dependency on
+  ourselves. The gtk-doc dependency is correct, but glib happens
+  to be buildable without this dependency too.
+- Rework the check section to be in an own if/endif block so that
+  spec-cleaner is not getting confused by it.
+
+- Conditionalize enabling of systemtap, default disabled: it
+  creates a build loop.
+
+- Update to version 2.59.1:
+  + Autotools support is gone.
+  + g_format_size() now uses a no-break space to separate digits
+    and units; translations will need to be updated accordingly.
+  + New g_queue_clear_full() API.
+  + Fix argument quoting on win32 when spawning subprocesses.
+  + Allow polling more than 64 handles on win32 using g_poll().
+  + Tag various tests as ‘flaky’. These are no longer run routinely
+    on our upstream CI machines, and downstream packagers may want
+    to not run them (or not treat those test failures as package
+    build failures) on their test machines either. They are in the
+    `flaky` test suite.
+  + Add overlay support to g_resources_get_info().
+  + Support defaults and locks in the keyfile GSettings backend.
+    This will be used for flatpaks.
+  + Accept unquoted strings in the keyfile GSettings backend to
+    simplify things for sysadmins.
+  + Update our contribution guidelines (`CONTRIBUTING.md`).
+  + Add writev() and writev_all() APIs to GOutputStream and
+    GPollableOutputStream, and provide implementations of them for
+    many subclasses.
+  + Many more bugs fixed, see package NEWS file for full list.
+  + Updated translations.
+- Remove conditionals for meson build, use meson unconditionally
+  following upstreams removal of autotools.
+- Add new glib2-tests subpackage.
+
+- Update to version 2.59.0:
+  + This will be the last development release with autotools
+    support. As our Meson support has been around since 2.56.x, and
+    was used to release tarballs in 2.58.x, the next development
+    release (2.59.1) will drop autotools as used to build GLib. The
+    macros installed for other packages to use will remain.
+  + Add `G_TEST_OPTION_ISOLATE_DIRS` to redirect `XDG_*_HOME` to a
+    temporary directory for each unit test.
+  + Support `Property.EmitsChangedSignal` annotations in
+    `gdbus-codegen`.
+  + Add `g_assert_cmpvariant()` API for unit tests.
+  + Hide bind mounts from GIO mount listings.
+  + Automatically realign data passed to
+    `g_variant_new_from_bytes()` or `g_variant_new_from_data()` if
+    it is not correctly aligned. This prevents misaligned accesses
+    on architectures which don’t support them. Callers should still
+    aim to correctly align data to get higher performance.
+  + Support `ld -b binary` (on platforms which support it; i.e.
+    Linux) to provide large pre-compiled `GResource` resources with
+    a fast compilation time.
+  + Unconditionally install GLib m4 macros, so that projects which
+    depend on GLib and which still build using autotools can
+    continue to build even once GLib has ported entirely to Meson.
+  + Various fixes to the Meson build.
+  + Drop Python 2 support and require Python 3.4+. See discussion
+    on https://mail.gnome.org/archives/desktop-devel-list/2018-July/msg00004.html.
+  + `GHashTable` performance and memory improvements for common
+    cases. See
+    https://hpjansson.org/blag/2018/07/24/a-hash-table-re-hash/.
+  + Add flags that allow a `GApplication` to signal and replace a
+    currently running other instance of the same `GApplication`.
+    This will be used for app upgrades with flatpak.
+  + Autostart xdg-desktop-portal when using the network monitor and
+    proxy monitor portal backends.
+  + Add a g_task_set_name() API to allow `GTask`s to be described;
+    useful for debugging.
+  + Enable FreeBSD CI on every commit for upstream GLib.
+  + Various GVariant, GMarkup and GDBus fuzzing fixes, including
+    buffer overflow fixes.
+  + Various fixes to eliminate thread races, found by thread
+    sanitizer (tsan).
+  + Deprecate TLS/DTLS rehandshaking, as it has been removed from
+    the protocol in TLS 1.3.
+  + Support reading arguments from a file with `glib-mkenums`,
+    which is useful for long argument lists due to having deeply
+    nested build directories, on systems with a low limit on the
+    command line length.
+  + Make `g_environ_*()` case-insensitive on Windows, as the
+    environment itself is case-insensitive on Windows.
+  + Add Application Layer Protocol Negotiation (ALPN) support to
+    `GTlsConnection` and `GDtlsConnection`, so that higher layer
+    protocols can be negotiated when setting up a TLS connection,
+    without additional round trips and latency. This is needed for
+    eventual HTTP/2 support.
+  + Add support for TPM keys in PEM files when loading TLS
+    certificates.
+  + Add a `GRecMutexLocker` auto-pointer wrapper for `GRecMutex`.
+  + Many more bugs fixed, see package NEWS file for full list.
+  + Updated translations.
+
+- Update to version 2.58.3:
+  + Fix GVariant tests on i686.
+  + Fix crashes caused by filtering of mounts.
+  + Bugs fixed: glgo#gnome/GLib#1626, glgo#gnome/GLib#1637,
+    glgo#gnome/GLib#1645, glgo#gnome/GLib!558, glgo#gnome/GLib!577,
+    glgo#gnome/GLib!578.
+
+- Update to version 2.58.2:
+  + Fix calling gdbus-codegen with --interface-info-{header,body}.
+  + Fix parsing month names in certain locales with
+    g_date_set_parse().
+  + Fix ^*ay handling in g_variant_iter_loop().
+  + Various buffer overflow fixes in GMarkup/GVariant/GDBus.
+  + A huge number of fixes to the Meson build.
+  + Prevent bind mounts being advertised as mounts.
+  + Fix cross-compilation of 2.58.x releases with autotools.
+  + Bugs fixed: glgo#gnome/GLib!527, glgo#gnome/GLib#1605,
+    glgo#gnome/GLib#1271, glgo#gnome/GLib#1546,
+    glgo#gnome/GLib#1527, glgo#gnome/GLib!406, glgo#gnome/GLib!334,
+    glgo#gnome/GLib#1528, glgo#gnome/GLib#1539,
+    glgo#gnome/GLib#1536, glgo#gnome/GLib#1544,
+    glgo#gnome/GLib#1562, glgo#gnome/GLib!367, glgo#gnome/GLib!416,
+    glgo#gnome/GLib#1572, glgo#gnome/GLib#1522,
+    glgo#gnome/GLib#1576, glgo#gnome/GLib!407,
+    glgo#gnome/GLib#1582, glgo#gnome/GLib!428,
+    glgo#gnome/GLib#1588, glgo#gnome/GLib!462,
+    glgo#gnome/GLib!238, glgo#gnome/GLib!312, glgo#gnome/GLib#1520,
+    glgo#gnome/GLib!403, glgo#gnome/GLib#1543,
+    glgo#gnome/GLib!414, glgo#gnome/GLib!409, glgo#gnome/GLib!400,
+    glgo#gnome/GLib!430, glgo#gnome/GLib!437, glgo#gnome/GLib#1337,
+    glgo#gnome/GLib!542, glgo#gnome/GLib#1343, glgo#gnome/GLib!471,
+    glgo#gnome/GLib!544, glgo#gnome/GLib#945, glgo#gnome/GLib#1014,
+    glgo#gnome/GLib#656, glgo#gnome/GLib#1313, glgo#gnome/GLib!346.
+  + Updated translations.
+- Drop upstream fixed patches:
+  + 0001-gvariant-Fix-checking-arithmetic-for-tuple-element-e.patch
+  + 0002-gvarianttype-Impose-a-recursion-limit-of-64-on-varia.patch
+  + 0003-gvariant-Check-array-offsets-against-serialised-data.patch
+  + 0004-gvariant-Check-tuple-offsets-against-serialised-data.patch
+  + 0005-gvariant-Limit-GVariant-strings-to-G_MAXSSIZE.patch
+  + 0006-gdbusmessage-Validate-type-of-message-header-signatu.patch
+  + 0007-gdbusmessage-Improve-documentation-for-g_dbus_messag.patch
+  + 0008-gdbusmessage-Clarify-error-returns-for-g_dbus_messag.patch
+  + 0009-gdbusmessage-Fix-a-typo-in-a-documentation-comment.patch
+  + 0008-gdbusmessage-Clarify-error-returns-for-g_dbus_messag.patch
+  + 0009-gdbusmessage-Fix-a-typo-in-a-documentation-comment.patch
+  + 0010-gdbusmessage-Check-for-valid-GVariantType-when-parsi.patch
+  + 0011-gvariant-Clarify-internal-documentation-about-GVaria.patch
+  + 0012-tests-Tidy-up-GError-handling-in-gdbus-serialization.patch
+  + 0013-tests-Use-g_assert_null-in-gdbus-serialization-test.patch
+  + 0014-gutf8-Add-a-g_utf8_validate_len-function.patch
+  + 0015-glib-Port-various-callers-to-use-g_utf8_validate_len.patch
+
+- Add patchset to fix gvariant parsing issues. (bsc#1111499).
+  0001-gvariant-Fix-checking-arithmetic-for-tuple-element-e.patch
+  0002-gvarianttype-Impose-a-recursion-limit-of-64-on-varia.patch
+  0003-gvariant-Check-array-offsets-against-serialised-data.patch
+  0004-gvariant-Check-tuple-offsets-against-serialised-data.patch
+  0005-gvariant-Limit-GVariant-strings-to-G_MAXSSIZE.patch
+  0006-gdbusmessage-Validate-type-of-message-header-signatu.patch
+  0007-gdbusmessage-Improve-documentation-for-g_dbus_messag.patch
+  0008-gdbusmessage-Clarify-error-returns-for-g_dbus_messag.patch
+  0009-gdbusmessage-Fix-a-typo-in-a-documentation-comment.patch
+  0010-gdbusmessage-Check-for-valid-GVariantType-when-parsi.patch
+  0011-gvariant-Clarify-internal-documentation-about-GVaria.patch
+  0012-tests-Tidy-up-GError-handling-in-gdbus-serialization.patch
+  0013-tests-Use-g_assert_null-in-gdbus-serialization-test.patch
+  0014-gutf8-Add-a-g_utf8_validate_len-function.patch
+  0015-glib-Port-various-callers-to-use-g_utf8_validate_len.patch
+
+- Update to version 2.58.1:
+  + Fix to a regression in listing GIcon fallbacks.
+  + Changes to pkg-config paths to helper programs when building
+    with autotools: paths are now absolute with reference to the
+    .pc file’s ${prefix}.
+  + Fix installation path of glib-gettextize helper on Meson.
+  + Fix autostarting xdg-desktop-portal.
+  + Various fixes to the network monitor.
+  + Various compilation fixes on macOS (generally older versions
+    and older compilers).
+  + Bugs fixed: glgo#GNOME/glib!318, glgo#GNOME/glib#1513,
+    glgo#GNOME/glib#1521, glgo#GNOME/glib!321,
+    glgo#GNOME/glib#1518, glgo#GNOME/glib#1509,
+    glgo#GNOME/glib!288, glgo#GNOME/glib!298, glgo#GNOME/glib!295,
+    glgo#GNOME/glib!294, glgo#GNOME/glib!290, glgo#GNOME/glib#1488,
+    glgo#GNOME/glib#1506.
+  + Updated translations.
+
+- Update to version 2.58.0:
+  + Fix cancellation of g_subprocess_communicate_async() calls
+    (glgo#GNOME/glib!266.
+  + Expose GSettings schema directory in gio-2.0.pc as `schemasdir`
+    (glgo#GNOME/glib!274).
+  + Support v3 of the xdg-desktop-portal network monitor API
+    (glgo#GNOME/glib!265,  glgo#GNOME/glib!279).
+  + Bugs fixed: glgo#GNOME/glib!266, glgo#GNOME/glib!279,
+    glgo#GNOME/glib!265, glgo#GNOME/glib!274, glgo#GNOME/glib!239.
+  + Updated translations.
+- Set URL tag to https://wiki.gnome.org/Projects/GLib: Glib's wiki
+  page.
+- Conditionalize meson use while disabling it: use of Meson is
+  still not recommended by upstream, plus openQA is having failures
+  where Glib seems to be the one to blame.
+
+- Update to 2.57.3:
+  + No visible changes for the user.
+- Add:
+  + meson BuildRequires and replace configure/make/make_install
+    with meson/meson_build/meson_install macros to follow upstream
+    build system port to Meson.
+  + gtk-doc and m4 BuildRequires while dropping gtk-doc.m4: now
+    there is no pre-built API documentation so gtk-doc and m4
+    packages are build requirements now.
+- Drop automake and libtool BuildRequires and autoreconf call: they
+  are no longer needed after switching to Meson build system.
+
+- BuildIgnore shared-mime-info: we don't need this while building
+  glib2.
+
+- Update to version 2.57.2:
+  + Require pcre 8.31 and meson 0.47.0.
+  + Bugs fixed: bgo#742456, bgo#795569, bgo#796341,
+    glgo#GNOME/glib#786, glgo#GNOME/glib#903, glgo#GNOME/glib#927,
+    glgo#GNOME/glib#976, glgo#GNOME/glib#1013,
+    glgo#GNOME/glib#1175, glgo#GNOME/glib#1360,
+    glgo#GNOME/glib#1447, glgo#GNOME/glib#1407,
+    glgo#GNOME/glib#1455, glgo#GNOME/glib#1459.
+  + Security fixes:
+  - Fix NULL pointer dereference in
+    g_markup_parse_context_end_parse() (boo#1107121
+    glgo#GNOME/glib#1364 glgo#GNOME/glib#1461 CVE-2018-16428)
+  - Fix out-of-bounds read in g_markup_parse_context_parse()
+    (boo##1107116 glgo#GNOME/glib#1361 glgo#GNOME/glib#1462
+    CVE-2018-16429)
+  + Updated translations.
+- Drop glib2-gsettings-overrides-per-session.patch: fixed upstream.
+
+- Update to version 2.57.1:
+  + New API: g_hash_table_steal_extended and G_GNUC_NO_INLINE.
+  + Bugs fixed: bgo#668132, bgo#736741, bgo#748620, bgo#784995,
+    bgo#788771, bgo#788773, bgo#789968, bgo#794325, bgo#795152,
+    bgo#795165, bgo#795180, bgo#795302, bgo#795376, bgo#795544,
+    bgo#795735, bgo#795802, bgo#795960, bgo#796138, bgo#796139,
+    bgo#796164, bgo#796186, bgo#796328.
+  + Updated translations.
+- Drop:
+  + Posttrans section, and sed and coreutils PreReq aimed at
+    pristine openSUSE releases <= 10.3.
+  + Conditionalized python BuildRequires aimed at pristine openSUSE
+    releases <= 1130.
+- Enable building of systemtap tracing support to improve Glib
+  problems diagnosability (bsc#1090047).
+
+- Update to version 2.56.2:
+  + Support version 2 of the NetworkMonitor portal interface.
+  + Bugs fixed: bgo#740791, bgo#755721, bgo#773435, bgo#793727,
+    bgo#794380, bgo#794801, bgo#795138, bgo#795234, bgo#795406,
+    bgo#795429, bgo#795711, bgo#795735, bgo#795802,
+    glgo#GNOME/glib2#1240, glgo#GNOME/glib2#1401,
+    glgo#GNOME/glib2#1452, glgo#GNOME/glib2#1458.
+  + Updated translations.
+- Drop glib2-codegen-headers.patch: Fixed upstream.
+- Refresh patches with quilt.
+
+- Add glib2-codegen-headers.patch: gdbus-codegen: Fix header
+  include in the body file (bgo#795802).
+
+- Update to version 2.56.1:
+  + Bugs fixed: bgo#793400, bgo#793578, bgo#793645, bgo#794194,
+    bgo#794473, bgo#794506, bgo#794528, bgo#794606, bgo#794686.
+  + Updated translations.
+- Refresh following patches with quilt:
+  + glib2-bgo569829-gettext-gkeyfile.patch.
+  + glib2-dbus-socket-path.patch.
+  + glib2-fate300461-gettext-gkeyfile-suse.patch.
+  + glib2-gsettings-overrides-per-session.patch.
+
+- Unconditionally enable translation-update-upstream: on
+  Tumbleweed, this results in a NOP and for Leap in SLE paid
+  translations being used (boo#1086036).
+
+- Update to version 2.56.0:
+  + Bugs fixed: bgo#672777, bgo#732184, bgo#733338, bgo#742124,
+    bgo#749206, bgo#768507, bgo#791457, bgo#793272, bgo#793300,
+    bgo#793399, bgo#793555, bgo#793565, bgo#793578, bgo#793597,
+    bgo#793635, bgo#793880, bgo#794180.
+  + Updated translations.
+
+- Modernize spec-file by calling spec-cleaner
+
+- Update to version 2.55.2:
+  + GFile now has API to get the path without copying.
+  + A network monitor implementation for Windows has been added.
+  + Bugs fixed: bgo#520116, bgo#584284, bgo#605700, bgo#658713,
+    bgo#685442, bgo#723003, bgo#749583, bgo#757284, bgo#760324,
+    bgo#761102, bgo#767976, bgo#770335, bgo#772989, bgo#790698,
+    bgo#791015, bgo#791622, bgo#792050, bgo#792217, bgo#792338,
+    bgo#792351, bgo#792364, bgo#792370, bgo#792410, bgo#792432,
+    bgo#792455, bgo#792499, bgo#792516, bgo#792777, bgo#792780,
+    bgo#792856, bgo#792862, bgo#792903, bgo#793006, bgo#793026,
+    bgo#793074.
+  + Updated translations.
+
+- Update to version 2.55.1:
+  + Build:
+  - The --enable-rebuilds configure option has been removed.
+  - The --with-charsetalias-dir configure option has been added.
+  + GList and GSList now have autoptr support.
+  + The gsettings list-schemas command has gained a --print-paths
+    option.
+  + Bugs fixed: bgo#346816, bgo#508976, bgo#562334, bgo#662802,
+    bgo#684282, bgo#692034, bgo#694723, bgo#697715, bgo#701156,
+    bgo#720380, bgo#724383, bgo#724412, bgo#724794, bgo#732003,
+    bgo#734479, bgo#737677, bgo#741167, bgo#748534, bgo#749527,
+    bgo#749652, bgo#754634, bgo#756011, bgo#761102, bgo#773980,
+    bgo#776147, bgo#776195, bgo#777075, bgo#779413, bgo#780309,
+    bgo#780893, bgo#782057, bgo#784995, bgo#786796, bgo#788806,
+    bgo#788936, bgo#790416, bgo#790588, bgo#790697, bgo#790785,
+    bgo#790829, bgo#790830, bgo#790837, bgo#790839, bgo#790877,
+    bgo#790894, bgo#790896, bgo#790914, bgo#790934, bgo#790948,
+    bgo#791036, bgo#791128, bgo#791221, bgo#791235, bgo#791267,
+    bgo#791296, bgo#791318, bgo#791325, bgo#791334, bgo#791337,
+    bgo#791342, bgo#791460, bgo#791532, bgo#791622, bgo#791720,
+    bgo#791744, bgo#791745, bgo#791906, bgo#792064, bgo#792098,
+    bgo#792099, bgo#792129, bgo#792322, bgo#792324.
+  + Updated translations.
+- Rebase glib2-gdbus-codegen-version.patch.
+- Drop glib2-gtester-report-py3.patch: fixed upstream.
+- Drop glib2-gmain-partial-revert.patch: fixed upstream.
+
+- Update to version 2.55.0:
+  + New API:
+  - g_clear_handle_id, to simplify removing sources from the
+    default mainloop.
+  - g_file_load_bytes, to make it more convenient to load files
+    into GBytes.
+  + Bugs fixed: bgo#330458, bgo#483341, bgo#569375, bgo#573251,
+    bgo#629347, bgo#630983, bgo#632953, bgo#636210, bgo#656502,
+    bgo#661442, bgo#668035, bgo#670139, bgo#677233, bgo#679347,
+    bgo#679467, bgo#689323, bgo#691436, bgo#695681, bgo#705331,
+    bgo#706667, bgo#711809, bgo#722256, bgo#723655, bgo#723743,
+    bgo#725014, bgo#727346, bgo#730296, bgo#731625, bgo#731705,
+    bgo#737278, bgo#738176, bgo#740223, bgo#740791, bgo#740826,
+    bgo#742548, bgo#742997, bgo#745723, bgo#749371, bgo#751738,
+    bgo#752239, bgo#752240, bgo#753459, bgo#753521, bgo#754026,
+    bgo#756009, bgo#756103, bgo#756128, bgo#756430, bgo#756470,
+    bgo#756588, bgo#760022, bgo#760109, bgo#760716, bgo#765063,
+    bgo#765552, bgo#767215, bgo#767239, bgo#769674, bgo#769846,
+    bgo#770459, bgo#773355, bgo#774083, bgo#776562, bgo#777308,
+    bgo#777310, bgo#777956, bgo#779182, bgo#779501, bgo#780202,
+    bgo#780296, bgo#781598, bgo#781867, bgo#783210, bgo#783270,
+    bgo#783825, bgo#786737, bgo#786785, bgo#787271, bgo#787485,
+    bgo#787551, bgo#787581, bgo#787671, bgo#787731, bgo#788138,
+    bgo#788270, bgo#788368, bgo#788384, bgo#788385, bgo#788401,
+    bgo#788467, bgo#788488, bgo#788489, bgo#788561, bgo#788594,
+    bgo#788705, bgo#788766, bgo#788772, bgo#788863, bgo#788880,
+    bgo#788927, bgo#788936, bgo#788948, bgo#788975, 7889bgo#78,
+    bgo#788989, bgo#788990, bgo#789087, bgo#789170, bgo#789245,
+    bgo#789444, bgo#789637, bgo#789681, bgo#789723, bgo#789755,
+    bgo#789820, bgo#790015, bgo#790030, bgo#790093, bgo#790126,
+    bgo#790147, bgo#790157, bgo#790272, bgo#790275, bgo#790310.
+  + Updated translations.
+- Switch libmount-devel by its pkgconfig counterpart as configure
+  only looks for this module.
+- Add libgio-2_0-0 for the rpmlintrc shlib-fixed-dependency warning
+  filter. And add 2 extra filters:
+  + non-conffile-in-etc warning for zzz-gilb2.csh, zzz-glib2.sh and
+    macros.glib2 files.
+  + env-script-interpreter warning for gdbus-codegen,
+    glib-genmarshal nad glib-mkenums files.
+
+- Update to version 2.54.3:
+  + Bugs fixed: bgo#691436, bgo#761102, bgo#776147, bgo#779182,
+    bgo#782057, bgo#785113, bgo#788990, bgo#789637, bgo#789894,
+    bgo#790030, bgo#790093, bgo#790126, bgo#790829, bgo#790934,
+    bgo#791235, bgo#791267, bgo#791296, bgo#791325, bgo#791334,
+    bgo#791337, bgo#791720, bgo#791744, bgo#791754, bgo#791906.
+  + Updated translations.
+- Drop glib2-gtester-report-py3.patch: Fixed upstream.
+- Add glib2-gmain-partial-revert.patch: gmain: Partial revert of
+  recent wakeup changes to gmain.c (bgo#761102).
+
+- Add glib2-gsettings-overrides-per-session.patch: gsettings
+  default value can be overridden depending on session
+  (bgo#746592 bsc#1070090).
+
+- Add glib2-gtester-report-py3.patch: gtester-reporter fails to
+  run with python3 (bgo#791296, boo#1071378).
+
+- Switch to python3:
+  + Pass --with-python=/usr/bin/python3 to configure.
+  + Replace python-base and python-xml BuildRequires with their
+    python3 equivalents python3-base and python3-xml.
+  + Replace the -devel package's python-xml requires with
+    python3-xml.
+
+- Update to version 2.54.2:
+  + Bugs fixed: bgo#780296.
+  + Updated translations.
+
+- Install dummy *-mimeapps.list files to prevent dead symlinks
+  (bsc#1061599).
+
+- Update to version 2.54.1:
+  + Bugs fixed: bgo#786737, bgo#787551, bgo#783270, bgo#783210,
+    bgo#781867.
+  + Updated translations.
+
+- Avoid running fdupes across hardlink boundaries.
+  Replace some old RPM macros.
+- Update RPM groups and package summaries.
+
+- Update to version 2.54.0:
+  + Bugs fixed: bgo#780861, bgo#786983, bgo#787109, bgo#787123,
+    bgo#787146.
+  + Updated translations.
+
+- Update to version 2.53.7:
+  + Bugs fixed: bgo#736710, bgo#785260, bgo#786456, bgo#786555,
+    bgo#786580, bgo#786807.
+  + Updated translations.
+
+- Ignore errors in postun of gio-fam: when uninstalling the entire
+  glib stack, we can end up with the -tools package no longer being
+  functional. As nothing will read the cache, we can accept that.
+
+- Update to version 2.53.6:
+  + Bugs fixed: bgo#766358, bgo#783270, bgo#785955, bgo#786060,
+    bgo#786360, bgo#786452, bgo#786460, bgo#786462, bgo#786463.
+  + Updated translations.
+
+- Update to version 2.53.5:
+  + Bugs fixed: bgo#695573, bgo#725950, bgo#731703, bgo#769135,
+    bgo#779332, bgo#779607, bgo#784000, bgo#784815, bgo#784965,
+    bgo#784995, bgo#785113, bgo#785130, bgo#785438, bgo#785468,
+    bgo#785520, bgo#785577.
+  + Updated translations.
+- Rebase glib2-suppress-schema-deprecated-path-warning.patch.
+
+- Update to version 2.53.4:
+  + Unicode support has been updated to Unicode 10.0.0.
+  + glib-genmarshal and glib-mkenums have been rewritten in python.
+    Every effort has been made to keep compatibility. Please report
+    problems related to these tools.
+  + GLib can now be built with meson. Autotools are still
+    supported.
+  + Bugs fixed: bgo#722047, bgo#733821, bgo#773842, bgo#779332,
+    bgo#780095, bgo#780634, bgo#783841, bgo#784000, bgo#784020,
+    bgo#784037, bgo#784433, bgo#784456, bgo#784528, bgo#784579,
+    bgo#784581, bgo#784739, bgo#784792.
+  + Updated translations.
+
+- Update to version 2.53.3:
+  + Bugs fixed: bgo#658446, bgo#661926, bgo#674885, bgo#775593,
+    bgo#776169, bgo#776333, bgo#776504, bgo#777307, bgo#778422,
+    bgo#781301, bgo#782336, bgo#782996, bgo#783061, bgo#783130,
+    bgo#783193, bgo#783201, bgo#783340, bgo#783350, bgo#783392,
+    bgo#783593.
+  + Updated translations.
+
+- Update to version 2.53.2:
+  + A few new number parsing functions have been added. These have
+    better error handling than the existing ones.
+  + glib-mkenums now supports /*< private >*/ and /*< public >*/.
+  + GSettings now consider XDG_DATA_HOME in addition to
+    XDG_DATA_DIRS.
+  + Bugs fixed: bgo#674885, bgo#698064, bgo#732000, bgo#734946,
+    bgo#741335, bgo#748263, bgo#776876, bgo#777030, bgo#780300,
+    bgo#780309, bgo#781755, bgo#781826, bgo#781830, bgo#781847,
+    bgo#781867, bgo#782068, bgo#782075, bgo#782089, bgo#782162,
+    bgo#782237, bgo#782311, bgo#782628.
+  + Updated translations.
+
+- Add file triggers to libgio-2_0-0: whenever a package installs a
+  schema file to /usr/share/glib-2.0/schemas, the trigger will
+  automaticlaly fire, making it no longer a problem for packagers
+  to forget doing it.
+- Require glib2-tools by libgio-2_0-0: it contains the tools for
+  the file trigger. Historically, every package installing schemas
+  already had to require the -tools package in order to be
+  functional.
+- Change the macros %glib2_gsettings_schema_{requires,post,postun}
+  to be no-op fuctions. The macros are no longer needed with the
+  file trigger. Removing the macro would break a big number of
+  packages though.
+
+- Update to version 2.53.1:
+  + The gdbus tool gained a wait command.
+  + g_unix_signal_source_new support SIGWINCH now.
+  + There are now g_enum_to_string and g_flags_to_string functions.
+  + A new function to instantiate objects:
+    g_objet_new_with_properties.
+  + Parameter and related APIs have been deprecated.
+  + Bugs fixed: bgo#447907, bgo#668962, bgo#669355, bgo#674885,
+    bgo#698064, bgo#709865, bgo#725894, bgo#734946, bgo#741229,
+    bgo#745971, bgo#755046, bgo#761102, bgo#761889, bgo#766660,
+    bgo#769534, bgo#772221, bgo#775879, bgo#776169, bgo#777961,
+    bgo#778049, bgo#778207, bgo#780066, bgo#780095, bgo#780306,
+    bgo#780310, bgo#780384, bgo#780441, bgo#780634, bgo#780908,
+    bgo#780924.
+  + Updated translations.
+- Drop
+  glib2-gmain-only-signal-GWakeup-right-before-or-during-a-b.patch:
+  fixed upstream.
+
+- Update to version 2.52.3:
+  + Bugs fixed: bgo#781301, bgo#781601, bgo#781867, bgo#783130,
+    bgo#783193, bgo#783201.
+- Drop
+  glib2-gmain-only-signal-GWakeup-right-before-or-during-a-b.patch:
+  Fixed upstream.
+
+- Add
+  glib2-gmain-only-signal-GWakeup-right-before-or-during-a-b.patch:
+  Fix event loop thread wakeup issue (bgo#761102).
+
+- Remove version string from files generated by gdbus-codegen
+  to avoid needless republishing of pkgs depending on glib2-devel
+  added glib2-gdbus-codegen-version.patch
+
+- Update to version 2.52.2:
+  + Bugs fixed: bgo#734946, bgo#761102, bgo#780300, bgo#780309,
+    bgo#781298.
+  + Updated translations.
+
+- Update to version 2.52.1:
+  + Bugs fixed: bgo#674885, bgo#698064, bgo#725894, bgo#734946,
+    bgo#755046, bgo#775879, bgo#777961, bgo#778049, bgo#778207,
+    bgo#778287, bgo#779409, bgo#780066, bgo#780095, bgo#780306,
+    bgo#780310, bgo#780384, bgo#780441, bgo#780471, bgo#780924.
+  + Updated translations.
+
+- Update to version 2.52.0:
+  + gdatetime test fails with tzdata 2017a (bgo#779799).
+  + Add missing attributes to two functions (bgo#780032).
+  + gio/fam: Remove leftover debug print (bgo#780144).
+  + Updated translations.
+- Drop glib2-remove_fam_debug_print.patch: fixed upstream.
+
+- Update to version 2.51.5:
+  + OS X implementations of GContentType and GAppInfo have been
+    added.
+  + Bugs fixed: bgo#673047, bgo#734946, bgo#747146, bgo#769983,
+    bgo#777203, bgo#778515, bgo#779456.
+  + Updated translations.
+
+- Update to version 2.51.4:
+  + Memory leak fixes.
+  + Fix the released tarball.
+- Drop glib2-fix-broken-configure.patch: Fixed upstream.
+
+- Update to version 2.51.3:
+  + Bugs fixed: bgo#771997, bgo#778422, bgo#778581, bgo#778801,
+    bgo#778991, bgo#779183.
+  + Updated translations.
+- Add glib2-fix-broken-configure.patch: Workaround broken tarball
+  released by upstream, allows autoreconf to complete.
+
+- Update to version 2.51.2:
+  + Minimal support for UUIDs has been added.
+  + A new file attribute, G_FILE_ATTRIBUTE_RECENT_MODIFIED has been
+    added to improve sorting of recent files.
+  + Bugs fixed: bgo#639078, bgo#777135, bgo#777307, bgo#777481,
+    bgo#777493, bgo#777507, bgo#777592, bgo#778002, bgo#778096.
+  + Updated translations.
+
+- Update to version 2.51.1:
+  + glib-compile-resources grew a --generate-phony-targets flag.
+  + GLib now installs a valgrind suppressions file for GLib and
+    GIO.
+  + Bugs fixed: bgo#642026, bgo#666114, bgo#729730, bgo#730932,
+    bgo#735731, bgo#736810, bgo#762283, bgo#767609, bgo#767952,
+    bgo#769745, bgo#770175, bgo#770646, bgo#772160, bgo#772989,
+    bgo#773823, bgo#774086, bgo#774368, bgo#774421, bgo#774520,
+    bgo#775309, bgo#775468, bgo#775510, bgo#775517, bgo#775621,
+    bgo#775765, bgo#775913, bgo#776198, bgo#776586, bgo#777077.
+  + Updated translations.
+- Drop glib2-fix-notify-id-FDO-notification-backend.patch and
+  glib2-Add-missing-check-for-termios_h.patch: fixed upstream.
+
+- Update to version 2.51.0:
+  + glib-genmarshal and glib-mkenums have gained --output options
+    for better build system integration.
+  + New API: g_utf8_make_valid.
+  + Bugs fixed: bgo#591603, bgo#610969, bgo#772160, bgo#772221,
+    bgo#773303.
+  + Updated translations.
+
+- Update to version 2.50.3:
+  + Bugs fixed: bgo#775309, bgo#775468, bgo#775517, bgo#775765.
+  + Updated translations.
+- Drop glib2-Add-missing-check-for-termios_h.patch and
+  glib2-fix-notify-id-FDO-notification-backend.patch: Fixed
+  upstream.
+- Conditionally apply translations-update-upstream BuildRequires
+  and macro for non-openSUSE only.
+
+- Replace dbus-1-x11 Requires of libgio-2_0-0 to dbus-launch:
+  openSUSE provides two implementations of dbus-launch (with and
+  without X interaction). For glib, it does not matter which one is
+  being used (boo#1020651).
+
+- Add glib2-Add-missing-check-for-termios_h.patch: Add missing
+  check for termios.h. Check for termios.h is missing and passwords
+  in the new gio tool are echoed in the terminal consequently,
+  which is really bad! (bgo#775517).
+- Add glib2-fix-notify-id-FDO-notification-backend.patch: Fixed
+  notify id in FDO notification backend (bgo#775765).
+
+- Update to version 2.50.2:
+  + Bugs fixed: bgo#767882, bgo#769135, bgo#769630, bgo#772054,
+    bgo#773303, bgo#773344.
+  + Updated translations.
+
+- Update to version 2.50.1:
+  + Update Unicode support to Unicode 9.0.0.
+  + Bugs fixed: bgo#662946, bgo#771591, bgo#772054, bgo#772255,
+    bgo#772269, bgo#772297, bgo#772511.
+  + Updated translations.
+
+- Update to version 2.50.0:
+  + bgo#771438: Turn on libmount by default on linux.
+  + Fix the annotation for g_log_variant.
+  + Updated translations.
+- Add libmount-devel BuildRequires: follow upstreams recommendation
+  to use libmount on Linux.
+
+- Update to version 2.49.7:
+  + Add g_log_variant, binding-friendly api for structured logging.
+  + Bugs fixed: bgo#646926.
+  + Updated translations.
+
+- Update to version 2.49.6:
+  + The gsettings commandline tool now has a describe command.
+  + Bugs fixed: bgo#745754, bgo#769076, bgo#770372.
+  + Updated translations.
+
+- Update to version 2.49.4:
+  + Structured logging:
+  - Drop libsystemd dependency.
+  - Document that g_test_expect_message does not work with
+    structured logs.
+  + Use libmount for unix mount support.
+  + Add an async variant of g_app_info_launch_default_for_uri.
+  + Bugs fixed: bgo#522053, bgo#682794, bgo#744456, bgo#766370,
+    bgo#767240, bgo#768198, bgo#768453, bgo#768752, bgo#769027,
+    bgo#769029, bgo#769042, bgo#769087, bgo#769089, bgo#769104,
+    bgo#769139, bgo#769238, bgo#769245, bgo#769507, bgo#769785,
+    bgo#769995.
+  + Updated translations.
+- Drop pkgconfig(libsystemd) BuildRequires following upstream
+  changes.
+- Drop glib2-add-g_autoptr-support.patch,
+  glib2-gmessages-support-NULL.patch,
+  glib2-gvariant-Avoid-anonymous-struct.patch: Fixed upstream.
+
+- Add glib2-add-g_autoptr-support.patch: gobject: add g_autoptr
+  support for GTypeModule, fix build of gobject-introspection
+  (bgo#769033).
+- Add glib2-gmessages-support-NULL.patch: Don't crash wayland
+  session. The new g_log_structured have some bugs.. (bgo#769087).
+- Add glib2-gvariant-Avoid-anonymous-struct.patch: Fix c++
+  building, patch from upstream git.
+
+- Update to version 2.49.4:
+  + Change the just-introduced structured logging API. The
+    arguments of g_log_structured() had to be reordered to enable
+    an implementation within the limits of what the standards
+    guarantee about var args.
+  + Bugs fixed: bgo#744456, bgo#768936, bgo#768963, bgo#768968.
+  + Updated translations.
+
+- Update to version 2.49.3:
+  + GLib has a structured logging API, g_log_structured, with
+    support for writing to the systemd journal. It also supports
+    colored output in terminals.
+  + Some new GBytes API has been added:
+  - g_key_file_load_from_bytes.
+  - g_compute_hmac_for_bytes.
+  + Stack-allocated GVariantBuilder and GVariantDict objects can
+    now be initialized with G_VARIANT_BUILDER_INIT and
+    G_VARIANT_DICT_INIT.
+  + gio:
+  - Add a way to register handlers for custom uri schemes.
+  - Add a G_FILE_ATTRIBUTE_FILESYSTEM_REMOTE attribute to have
+    these heuristics in a single place.
+  - Include a gio tool that makes the functionality of the
+    various gvfs commandline tools available in a single place.
+  - Add portal support to g_app_info_launch_default_for_uri.
+  - Add portal support to GNetworkMonitor.
+  - Add portal support to GProxyResolver.
+  - Add portal support to g_application_send_notification.
+  + Bugs fixed: bgo#547200, bgo#662802, bgo#723506, bgo#725902,
+    bgo#728207, bgo#729914, bgo#744456, bgo#744678, bgo#746685,
+    bgo#747134, bgo#750257, bgo#753231, bgo#754012, bgo#760115,
+    bgo#760423, bgo#761102, bgo#765338, bgo#766370, bgo#766899,
+    bgo#766933, bgo#767765, bgo#767880, bgo#767887, bgo#767949,
+    bgo#768029, bgo#768119, bgo#768357, bgo#768498, bgo#768504,
+    bgo#768549, bgo#768551, bgo#768560, bgo#768780, bgo#768806.
+  + Updated translations.
+- Add pkgconfig(libsystemd) BuildRequires: Configure looks for it.
+
+- Update to version 2.49.2:
+  + GMainContext and GTask have gained more systemtap probes.
+  + Bugs fixed: bgo#673101, bgo#700756, bgo#730187, bgo#755439,
+    bgo#759813, bgo#761810, bgo#767172, bgo#767218, bgo#767245,
+    bgo#767824.
+  + Updated translations.
+
+- Update to version 2.49.1:
+  + GDesktopAppInfo now allows bus activation with dashes. This is
+    not technically allowed per the Desktop Entry specification,
+    but it happens in the wild. Rather than forcing people to go
+    through another traumatic desktop file rename, accept it and
+    translate - to _.
+  + The support for giving names to threads has been improved.
+    Thread names are now supported on Solaris as well, and the
+    Linux support no longer uses prctl() but the pthread api.
+  + GIO resources can now be overridden at runtime, using the
+    G_RESOURCE_OVERLAYS environment variable.
+  + gdbus-codegen can now generate autocleanup definitions for the
+    types it generates. Use the --c-generate-autocleanup option to
+    control this.
+  + Bugs fixed: bgo#665446, bgo#742898, bgo#749583, bgo#755898,
+    bgo#760186, bgo#764163, bgo#764415, bgo#765173, bgo#765668,
+    bgo#765710, bgo#765712, bgo#765861, bgo#765900, bgo#765924,
+    bgo#765991, bgo#766092, bgo#766211, bgo#766407, bgo#766570.
+  + Updated translations.
+
+- Update to version 2.48.2:
+  + Bugs fixed: bgo#547200, bgo#673101, bgo#700756, bgo#725902,
+    bgo#728207, bgo#730187, bgo#746685, bgo#750257, bgo#753231,
+    bgo#755439, bgo#760115, bgo#760423, bgo#761810, bgo#766211,
+    bgo#766899, bgo#766933, bgo#767172, bgo#767218, bgo#767824,
+    bgo#767949, bgo#768453, bgo#768504, bgo#768551, bgo#768560,
+    bgo#768806, bgo#769027.
+  + Updated translations.
+
+- Update to GNOME 3.20.2  Fate#318572
+
+- Update to version 2.48.1:
+  + Bugs fixed: bgo#731988, bgo#747107, bgo#747478, bgo#748474,
+    bgo#748530, bgo#748806, bgo#749606, bgo#758174, bgo#758738,
+    bgo#762994, bgo#763379, bgo#763821, bgo#764092, bgo#764574,
+    bgo#764575, bgo#764685, bgo#764754, bgo#765959, bgo#765990.
+  + Updated translations.
+
+- Update to GNOME 3.20  Fate#318572
+- Remove patches: glib2-dbus-object-manager-ref.patch,
+  glib2-trash-on-other-partitions.patch,
+  glib2-bnc873225-add-get-default-value.patch,
+  glib2-missing-annotations.patch.
+
+- baselibs.conf: also add the pkgconfig file to the -32bit package
+  (boo#973217).
+
+- Update to version 2.48.0:
+  + A minor build fix in the name of determinism.
+  + A few coverity fixes.
+  + bgo#763617: giotypefuncs.c: Sort _get_type functions in the 'C'
+    locale.
+  + Updated translations.
+
+- Update to version 2.47.92:
+  + gdbus-codegen now supports g_autoptr().
+  + g_get_user_runtime_dir() now reliably returns an existing
+    directory.
+  + g_array_remove_range() can now remove 0 items from the end of
+    an array.
+  + Many fixes for Windows.
+  + Documentation improvements.
+  + Other small bugfixes.
+  + Bugs fixed: bgo#724847, bgo#743933, bgo#756706, bgo#757506,
+    bgo#760694, bgo#762202, bgo#762637, bgo#762748, bgo#762937,
+    bgo#763339, bgo#763344, bgo#763379.
+  + Updated translations.
+
+- Include the glibconfig.h in the baselibs glib2-devel-xxbit
+  package, as it contains the architecture specific configuration
+  (bsc#970694).
+
+- Follow the freedesktop conventions for the mime handler
+  associations. The created link is gnome specific, so make it
+  specific (gnome-mimeapps.list). This prevents association
+  problems in Plasma 5 (boo#966739)
+  https://specifications.freedesktop.org/mime-apps-spec/mime-apps-spec-latest.html
+
+- Update to version 2.47.6:
+  + Windows support:
+  - Fixes and improvements to the GSettings registry backend.
+  - Handle readability and writability of registry keys.
+  - Use Unicode registry APIs.
+  + Bugs fixed: bgo#760852, bgo#744772, bgo#761126, bgo#747927,
+    bgo#761337, bgo#744570, bgo#761504, bgo#761550, bgo#761843,
+    bgo#744570, bgo#744772, bgo#747927, bgo#760852, bgo#761126,
+    bgo#761337, bgo#761504, bgo#761550, bgo#761843.
+  + Updated translations.
+
+- Fix default mime handler associtations: since GLIB 2.42, the file
+  in question is no longer defaults.list (too unspecific), but is
+  called mimeapps.list. Touch and link the right files.
+
+- Update to version 2.47.5:
+  + The system copy of PCRE is now used by default to implement
+    GRegex. Configure with --with-pcre=internal if a system PCRE
+    version is unavailable or undesired.
+  + Interfaces for DTLS support have been added. A new version of
+    glib-networking will also be required.
+  + GDBusMethodInvocation now drops replies if the sender set the
+    NO_REPLY_EXPECTED flag.
+  + Several GApplication fixes, including fixes for commandline
+    arguments in interpreted languages on Windows.
+  + Bugs fixed: bgo#624186, bgo#734095, bgo#735754, bgo#748064,
+    bgo#752240, bgo#755421, bgo#756875, bgo#759554, bgo#760199,
+    bgo#760215, bgo#760683.
+  + Updated translations.
+
+- Update to version 2.47.4:
+  + gapplication: Acquire the main context before running.
+  + Enable contenttype test on W32, tweak it to pass (mostly).
+  + xdgmime Finer handling for cases where mmap() is not available.
+  + Add GParamSpec object ref management annotations.
+  + file monitors: reorder some code to avoid segfault.
+  + glib-compile-resources: do not leak c_name.
+  + macros: add G_GNUC_CHECK_VERSION() for compiler checks.
+  + GApplication: destroy the impl on shutdown.
+  + Stop supporting non-POSIX getpwuid_r, getgrgid_r.
+  + glib.py: Fix Python 3 TypeError in gdb pretty-printers.
+  + W32: fix uninitialized var in g_app_info_get_all_for_type.
+  + Add missing checks for gnulib vasnprintf().
+  + glibconfig.h.win32.in: remove G_CAN_INLINE.
+  + GDBusProxy: Fix a memory leak during initialization.
+  + Bugs fixed: bgo#752983, bgo#735696, bgo#735696, bgo#710243,
+    bgo#756214, bgo#758823, bgo#758553, bgo#578363, bgo#757299,
+    bgo#728099, bgo#757372, bgo#756475, bgo#749092, bgo#759408,
+    bgo#759134, bgo#757374, bgo#758641.
+  + Updated translations.
+
+- Update to version 2.47.3:
+  + The inline cleanup in the last release accidentally removed
+    three symbols from libglib-2.0.so. It is unlikely that this
+    will have caused any problems because these symbols were only
+    backup symbols for definitions exported as inlines in the
+    header files, but ABI is ABI. This release corrects only this
+    problem.
+
+- Update to version 2.47.2:
+  + We have formalised the assumption that all compilers that are
+    interested in support 'static inline' and simplified the macros
+    around this considerably.  Please watch for and report
+    unintentional fallout.
+  + New API: hardware-assisted helpers for overflow-checked integer
+    math.
+  + Bugs fixed: bgo#696324, bgo#719966, bgo#752837, bgo#755364,
+    bgo#756134, bgo#756179, bgo#756988, bgo#757294, bgo#757374,
+    bgo#757451, bgo#757628, bgo#757693, bgo#757742, bgo#758181.
+  + Updated translations.
+
+- Update to version 2.47.1:
+  + GDesktopAppInfo no longer sets the DISPLAY environment variable
+    when launching apps. This is now done in the GAppLaunchContext
+    implementations when appropriate.
+  + Bugs fixed: bgo#664740, bgo#687223, bgo#692085, bgo#697907,
+    bgo#735754, bgo#737116, bgo#743011, bgo#749161, bgo#749314,
+    bgo#751924, bgo#752240, bgo#752837, bgo#753310, bgo#753935,
+    bgo#754855, bgo#754983, bgo#754994, bgo#755083, bgo#755351,
+    bgo#755355, bgo#755374, bgo#755496, bgo#755609, bgo#755766,
+    bgo#755795, bgo#755961, bgo#756053, bgo#756054, bgo#756077,
+    bgo#756099, bgo#756139, bgo#756179, bgo#756251, bgo#756255,
+    bgo#756316, bgo#756382, bgo#756477, bgo#756550, bgo#756875,
+    bgo#756952.
+  + Updated translations.
+
+- Update to version 2.46.2:
+  + Varioius small fixes, with a focus on win32.
+  + The docs should now be complete when doing non-srcdir builds.
+  + Bugs fixed: bgo#687223, bgo#754983, bgo#754994, bgo#755609,
+    bgo#756179, bgo#756382, bgo#757628.
+
+- Add glib2-remove_fam_debug_print.patch: remove debug output
+  "II 1" from the fam monitor (boo#951221, bgo#756879).
+
+- Update to version 2.46.1:
+  + Remove system_header pragma (should fix lack of warnings with
+    things like g_return_if_fail).
+  + Move GStrv typedef (and auto-cleanup) from libgobject to
+    libglib.
+  + Fix order of trashing files to be closer to what is required in
+    the specification. Namely, trashinfo files are written first.
+    This should fix issues with the gvfs trash backend failing to
+    correctly read the info for recently trashed files (preventing
+    'restore').
+  + Tweak mime logic to return text/plain on all empty files
+    instead of returning application/octet-stream. This includes
+    files that have extensions that imply that they may be other
+    types of files, which is a slight change of behaviour with
+    respect to old GLib versions.
+  + Many win32 fixes.
+  + Many docs fixes.
+  + Bugs fixed: bgo#735754, bgo#743011, bgo#749161, bgo#751924,
+    bgo#752837, bgo#753310, bgo#755083, bgo#755351, bgo#755355,
+    bgo#755496, bgo#755795, bgo#756179, bgo#756251, bgo#756255.
+  + Updated translations.
+
+- Update to version 2.46.0:
+  + Disable runtime-deprecation warnings.
+  + Fix marshalling of flags on bigendian 64bit architectures.
+  + Updated translations.
+
+- Update to version 2.45.8:
+  + Utf8 validation and utf8-to-ucs4 conversion are faster.
+  + Small speedups to property change notification.
+  + Various other small optimizations for GQuark, GData.
+  + Bugs fixed: bgo#696426, bgo#735429, bgo#738504, bgo#742903,
+    bgo#748633, bgo#754431, bgo#754560, bgo#754582, bgo#754601,
+    bgo#754636, bgo#754788, bgo#754831, bgo#754924, bgo#754986.
+  + Updated translations.
+
+- Update to version 2.45.7:
+  + Add G_FILE_ATTRIBUTE_STANDARD_IS_VOLATILE for use by
+    non-POSIX-like backends (e.g. cloud storage).
+  + GFileMonitor: Make the inotify backend work with atomic renames
+    again.
+  + GSettings: change notification is again working
+    unconditionally.
+  + GListStore has a sort function now.
+  + Test infrastructure:
+  - Tests are now required to have unique names.
+  - TAP support has been improved.
+  - A macro for asserting that two memory regions have identical
+    content has been added.
+  + Bugs fixed: bgo#708525, bgo#742849, bgo#744060, bgo#747364,
+    bgo#749492, bgo#752769, bgo#753745, bgo#754152, bgo#754211,
+    bgo#754264, bgo#754283, bgo#754284, bgo#754286, bgo#754307.
+  + Updated translations.
+
+- Add zsh completion for gsettings from (source gsettings.zsh).
+  https://github.com/jmatsuzawa/zsh-comp-gsettings (MIT license).
+
+- Update to version 2.45.6:
+  + Fix a test failure and a build failure.
+
+- Update to version 2.45.5:
+  + GNetworkMonitor now provides information about metered
+    networks.
+  + g_mem_set_vtable has been deprecated; it has not been working
+    for quite a while. The recommendation is to use valgrind, or
+    replace malloc itself.
+  + Bugs fixed: bgo#656325, bgo#741779, bgo#741822, bgo#742386,
+    bgo#743018, bgo#750282, bgo#751358, bgo#751592, bgo#751598,
+    bgo#751610, bgo#751751, bgo#752210, bgo#752656, bgo#752767,
+    bgo#753278, bgo#753285.
+  + Updated translations.
+
+- Update to version 2.45.4:
+  + Bugs fixed: bgo#727829, bgo#741901, bgo#746339, bgo#747676,
+    bgo#748610, bgo#749911, bgo#749912, bgo#750625, bgo#750807,
+    bgo#751160, bgo#751672, bgo#751731, bgo#751737, bgo#751798,
+    bgo#752089, bgo#752293.
+  + Updated translations.
+
+- Update to version 2.45.3:
+  + Improve performance of g_signal_handler_disconnect for signals
+    with many handlers.
+  + GDBus has gained a new call flag to allow interactive
+    authorization.
+  + GSettings:
+  - New API: g_settings_schema_list_keys.
+  - Deprecated: g_settings_list_keys.
+  + OS X:
+  - Implement GNotification.
+  - Bump the OS X requirement to 10.9.
+  + Windows:
+  - Add registry reading API.
+  - Reimplement GAppInfo using registry information.
+  + Bugs fixed: bgo#666831, bgo#728489, bgo#730168, bgo#733325,
+    bgo#734888, bgo#737009, bgo#738185, bgo#738504, bgo#739122,
+    bgo#739424, bgo#739616, bgo#740308, bgo#740516, bgo#741788,
+    bgo#745013, bgo#747146, bgo#747941, bgo#748727, bgo#749693,
+    bgo#750203, bgo#750322, bgo#750344, bgo#750369, bgo#750386,
+    bgo#750399, bgo#750573, bgo#750918, bgo#751122, bgo#479730.
+  + Updated translations.
+
+- Update to version 2.45.2:
+  + Improve error reporting in glib-compile-schemas.
+  + Add introspection annotations to GListStore.
+  + Bugs fixed: bgo#696749, bgo#723394, bgo#724113, bgo#725981,
+    bgo#733325, bgo#744895, bgo#747882, bgo#748534, bgo#748612,
+    bgo#748614, bgo#748834, bgo#749079, bgo#749080, bgo#749180,
+    bgo#749352, bgo#749353.
+  + Updated translations.
+
+- Update to version 2.45.1:
+  + The GSettings schema compiler, glib-compile-schemas has been
+    changed to reject schema xml that has duplicate <summary> or
+    <description> elements. Such elements typically occur when
+    translations are merged into the schema, with xml:lang
+    attributes. This is not the correct way to translate schemas.
+    Instead keep the translations in the .mo file and set the
+    gettext-domain attribute on the <schemalist> element.
+  + The file monitoring infrastructure has been rewritten, and all
+    backends have seen major improvements.
+  + The inotify backend is reporting events with less delay (no
+    event will be delayed more than 10ms) and wakeups due to file
+    monitoring have been significantly reduced. A CHANGES_DONE
+    event will also be sent when new files appear.
+  + The poll implementation is now using the thread default main
+    context.
+  + The fam implmentation is now running in the worker thread.
+  + The fen implementation has been removed, since it was
+    unmaintained.
+  + The GSettings schema compiler, glib-compile-schemas, is more
+    strict about rejecting schemas with xml:lang style merged
+    translations.
+  + Schema translations should be done by specifying the gettext
+    domain in the xml, and keeping the translations in gettext. To
+    avoid breaking already-installed schemas, this change is only
+    taking effect when you use the --strict option.
+  + The hardcoded 10-thread limit of GTask's thread pool has been
+    removed, since it was prone to causing deadlocks. The thread
+    pool is now allowed to grow dynamically and will shrink back
+    over time.
+  + GSimpleAsyncResult has been deprecated in favor of GTask.
+  + The algorithm used by GAppInfo to find default handlers for
+    mime types has been tweaked to prefer apps that handle the
+    specific subtype over default handlers for a generic supertype.
+  + Bugs fixed: bgo#627285, bgo#631597, bgo#661767, bgo#687223,
+    bgo#711547, bgo#719966, bgo#726447, bgo#728663, bgo#728669,
+    bgo#730188, bgo#733325, bgo#738207, bgo#739850, bgo#741791,
+    bgo#744282, bgo#745255, bgo#745745, bgo#745821, bgo#746749,
+    bgo#746753, bgo#747209, bgo#747349, bgo#747363, bgo#747472,
+    bgo#747541, bgo#747772, bgo#748019, bgo#748177.
+  + Updated translations.
+
+- Update to version 2.44.1:
+  + Don't redefine typedefs to avoid build problems on OpenBSD.
+  + Improve the default application algorithm.
+  + Bump the number of children a GType can have.
+  + Various testsuite improvements.
+  + Updated translations.
+
+- Update to version 2.44.0:
+  + gsocket: Document FD ownership with g_socket_new_from_fd()
+    (bgo#730188).
+  + Updated translations.
+
+- Update to version 2.43.92:
+  + GUnixMountMonitor now properly supports multiple main contexts
+  + Many documentation improvements and cleanups.  We are now
+    approaching a point where the documentation is 100% complete
+    and the xml will build without warnings. This will probably be
+    enabled by default in the next cycle.
+  + New support for HTTP proxies in GIO.
+  + New GTask:completed property.
+  + Use "private" futexes in order to further improve the
+    performance of the contended case of GMutex and g_bit_lock().
+  + Bugs fixed: bgo#614684, bgo#730352, bgo#733876, bgo#741442,
+    bgo#742599, bgo#743636, bgo#743661, bgo#744722, bgo#745589,
+    bgo#745634.
+  + Updated translations.
+
+- Update to version 2.43.91:
+  + We have now added 'g_autofree' as a libgsystem-style
+    autocleanup macro that calls g_free() on the content of a local
+    variable when it leaves scope (working only on GCC and clang).
+  + GApplication now has an "is-busy" property, allowing one to
+    query the effective busy state.
+  + There have been various other bugfixes and cleanups.
+  + Bugs fixed: bgo#661554, bgo#744263, bgo#744565, bgo#744747,
+    bgo#744756, bgo#744830, bgo#744876, bgo#745239.
+  + Updated translations.
+
+- Update to version 2.43.90:
+  + New GSimpleIOStream class to construct a GIOStream from an
+    arbitrary GInputStream and GOutputStream.
+  + GApplication: new API for marking 'busy' state according to the
+    value of a boolean property on another object.
+  + GOptionGroup: add binding support (boxed type, annotation
+    fixes, etc.)
+  + Bugs fixed: bgo#739724, bgo#741024, bgo#741630, bgo#743349,
+    bgo#743990, bgo#744565.
+  + Updated translations.
+
+- Update to version 2.43.4:
+  + GType now has type declaration macros G_DECLARE_DERIVABLE_TYPE,
+    G_DECLARE_FINAL_TYPE and G_DECLARE_INTERFACE, which
+    significantly reduce the boilerplate needed for GObject types
+    and interfaces.
+  + g_autoptr and g_auto are macros for declaring variables with
+    automatic cleanup. They only work with gcc and clang.
+  + GListModel is a new interface that represents a dynamic list of
+    GObjects.
+  + GListStore is a GSequence-based implementation of GListModel.
+  + Support thread names on OS X.
+  + g_simple_action_set_state_hint: New function to set the state
+    hint of GSimpleActions.
+  + g_win32_check_windows_version: New function to check Windows
+    version.
+  + g_settings_schema_list_children and
+    g_settings_schema_key_get_name are new functions to complete
+    the GSettingsSchema API.
+  + Bugs fixed: bgo#389585, bgo#729351, bgo#736914, bgo#741807,
+    bgo#741895, bgo#742456, bgo#743508, bgo#743517, bgo#743521,
+    bgo#743596, bgo#743640, bgo#743827, bgo#743927, bgo#743936,
+    bgo#744012, bgo#744190.
+
+- Update to version 2.43.3:
+  + Add g_set_object() convenience function.
+  + GNetworkMonitor: check if NM is not running and don't crash.
+  + Fix some races with g_mkdir_with_parents.
+  + Fix some warnings in MSVC.
+  + Avoid use of G_STRLOC in G_OBJECT_WARN_INVALID_PSPEC in order
+    to save on static strings.
+  + Fix some content type vs. mime issues.
+  + Documentation improvements.
+  + Bugs fixed: bgo#719455, bgo#732439, bgo#734946, bgo#741589
+    bgo#741653, bgo#741654, bgo#741707, bgo#741788, bgo#742548
+    bgo#742851, bgo#742972, bgo#743014.
+  + Updated translations.
+
+- Update to version 2.43.2:
+  + New functions: g_strv_contains, g_network_address_new_loopback,
+    g_socket_send_messages.
+  + A new GNetworkMonitor implementation using NetworkManager
+    provides more detailed connectivity information.
+  + Bugs fixed: bgo#11059, bgo#664562, bgo#685880, bgo#712570,
+    bgo#719646, bgo#728928, bgo#732317, bgo#740814, bgo#740848,
+    bgo#741016, bgo#741226.
+  + Updated translations.
+
+- Update to version 2.43.1:
+  + GQueue now accepts NULL as a sibling in g_queue_insert_before()
+    and g_queue_insert_after().
+  + Bugs fixed: bgo#11059, bgo#726037, bgo#727988, bgo#729739,
+    bgo#733791, bgo#736286, bgo#736620, bgo#737150, bgo#737160,
+    bgo#738259, bgo#738551, bgo#738633, bgo#740157, bgo#740309,
+    bgo#740413.
+  + Updated translations.
+
+- Update to version 2.43.0:
+  + GObject gained a debug option to provide instance counts. To
+    use it, set GOBJECT_DEBUG=instance-count and call
+    g_type_get_instance_count().
+  + GOption now has a strict POSIX mode in which it stops parsing
+    arguments as soon as a non-option argument is encountered.
+  + Bugs fixed: bgo#354457, bgo#695082, bgo#723160, bgo#729739,
+    bgo#733338, bgo#736273, bgo#736284, bgo#736914, bgo#737259,
+    bgo#737338, bgo#737446, bgo#737451, bgo#737741, bgo#737869,
+    bgo#738374, bgo#738675.
+  + Updated translations.
+
+- Update to version 2.42.2:
+  + Bugs fixed: bgo#712570, bgo#719455, bgo#727829, bgo#734946,
+    bgo#741024, bgo#741654, bgo#741788, bgo#741807, bgo#742851,
+    bgo#743508, bgo#743936.
+  + Updated translations.
+
+- Update to version 2.42.1:
+  + This release disables deprecation warnings by default.
+  + Bugs fixed: bgo#728256, bgo#736806, bgo#737143, bgo#738170,
+    bgo#738197.
+  + Updated translations.
+
+- Update glib2-fate300461-gettext-gkeyfile-suse.patch: Initialize
+  variable has_gettext.
+
gmavenplus-plugin
+- Upgrade to version 1.13.1
+- Changes in 1.13.1
+  * Bugs
+    + [#203] Using bindAllProjectProperties and
+    bindSessionUserOverrideProperties together can cause an NPE.
+- Changes in 1.13.0
+  * Enhancements
+    + [#196] Add support for targetting Java 17.
+    + [#198] Add support for targetting Java 18.
+    + [#188/#193] Update Ant from 1.10.8 to 1.10.11.
+- Changes in 1.12.1
+  * Bugs
+    +  [#186] Certain AST transformations had classloader issues
+    because 1.12.0 was no longer setting the context classloader.
+  * Enhancements
+    + Update Jansi to 2.x.
+  * Potentially breaking changes
+    + The Jansi upgrade should generally be compatible, but could
+    cause issues with scripts that were using Jansi 1.x specific
+    classes.
+- Changes in 1.12.0
+  * Bugs
+    + [#183] The classloader project dependencies are loaded onto is
+    reused between modules, so each module was a superset of all
+    modules that preceded it. Also, the console, execute, and
+    shell mojos didn't pass the classloader to use into the
+    instantiated GroovyConsole/GroovyShell, so it accidentally was
+    using the plugin classloader, even when configured to use
+    PROJECT_ONLY classpath.
+  * Potentially breaking changes
+    + This should be a non-breaking change (except for unusual
+    situations that were relying on the previous incorrect
+    behavior). However, since it's a significant change, I'm
+    bumping the version by more than just the patch version.
+  * Notes
+    + This potentially runs slower than before, since a new
+    classloader is instantiated each execution, rather than
+    resuing the same classloader, so the classes referenced will
+    have to be reinitialized.
+- Changes in 1.11.1
+  * Bugs
+    + Fixes IllegalArgumentException when consoleScript parameter
+    was loaded from POM rather than command line property.
+- Changes in 1.11.0
+  * Enhancements
+    + Change JDK compatibility check to also account for Java 16.
+    + Some tweaks for Groovy 4 (most notably, invokedynamic is
+    enabled by default for Groovy 4 and cannot be disabled).
+    + New parameter (attachGroovyDocAnnotation) to enable attaching
+    GroovyDoc annotation.
+    + New parameter (parallelParsing) to enable parallel parsing
+    (enabled by default with Groovy 4).
+    + Remove previewFeatures parameter from stub generation goals,
+    since it's not used there.
+  * Potentially breaking changes
+    + If you were using the previewFeatures parameter without also
+    including a compilation goal that would make that config
+    valid, the build will fail because it's no longer a valid
+    parameter. The fix would be to move that configuration to the
+    appropriate execution(s).
+- Changes in 1.10.1
+  * Enhancements
+    + Ability to override classes used to generate GroovyDoc (#91)
+    + Ability to override GStringTemplates used for GroovyDoc (#105)
+    + Ability to bind overridden properties (by binding project
+    properties and/or session user properties) (#72)
+    + Ability to load a script when launching GroovyConsole (#165)
+- Changes in 1.10.0
+  * Enhancements
+    + Change default GroovyDoc jar artifact type to javadoc, so its
+    extension gets set to "jar" by the artifact handler instead of
+    "groovydoc" by the default handler logic which uses the type
+    for the extension in the case of unknown types (#151).
+  * Potentially breaking changes
+    + GroovyDoc jars and test GroovyDoc jars will now be of type
+    "javadoc" and have extension "jar".  Rather than type and
+    extension "groovydoc".  If you do not wish to transition to
+    this new behavior, set the new artifactType or
+    testArtifactType property to "groovydoc" to revert to the
+    previous behavior.
+  * Notes
+    + While the artifact type of GroovyDoc jars has changed, the
+    Maven classifier has not. It remains "groovydoc", and you can
+    still override that, just as before.
+- Changes in 1.9.1
+  * Enhancements
+    + Add a property to skip script execution (#162)
+- Changes in 1.9.0
+  * Enhancements
+    + Support for Java 14 (#152).
+    + Support for Java 15 (#153).
+    + Add skipBytecodeCheck property and parameter, so if a Java
+    version comes out the plugin doesn't recognize, you can use it
+    without having to wait for an update.
+    + Use groovy.ant.AntBuilder instead of groovy.util.AntBuilder
+    (if available).
+  * Potentially breaking changes
+    + maven.groovydoc.skip property was renamed to skipGroovydoc so
+    it matches the pattern of the other properties and won't seem
+    to imply it's a property for a standard Maven plugin.
+    + Using groovy.ant.AntBuilder instead of groovy.util.AntBuilder
+    (when available on classpath).
+    + Bundling Ant 1.10.7 instead of 1.10.5.
+    + Bundling Ivy 2.5.0 instead of 2.4.0.
+  * Notes
+    + Now officially requires Java 7 instead of 6. This is not a
+    breaking change, however, since this was actually already
+    required because of plexus-classworlds. This just wasn't
+    discovered until an enforcer rule was added to check bytecode
+    versions of dependencies.
+- Changes in 1.8.1
+  * Bugs
+    + #147 Change sourcesets internal storage from HashSet to
+    TreeSet, to avoid unpredictable Groovy compiler output on
+    certain filesystems.
+    + #145 Disable system exits by default, to avoid potential
+    thread safety issues.
+  * Potentially breaking changes
+    + #145 Changes the default of not allowing System.exits to
+    allowing them.
+- Changes in 1.8.0
+  * Enhancements
+    + Allow for invocation using only project classpath (#140).
+    This is accomplished with
+    <includeClasspath>PLUGIN_ONLY</includeClasspath>.
+  * Potentially breaking changes
+    + #140 If you were using useSharedClasspath before, you will
+    need to replace it with new values. In most cases, this would
+    be
+    +---------------------+--------------------+
+    | usedSharedClasspath | includeClasspath   |
+    +---------------------+--------------------+
+    | true                | PROJECT_AND_PLUGIN |
+    | false               | PROJECT_ONLY       |
+    +---------------------+--------------------+
+    + Another notable difference is that when using this new
+    configuration parameter in compile, compileTests,
+    generateStubs, or generateTestStubs goals, now also uses the
+    configurator to add the project dependencies to the classpath
+    with the plugin's dependencies. Previously, this only happened
+    in the goals other than the ones mentioned.
+- Changes in 1.7.1
+  * Bugs
+    + Fix that Groovy 3.0.0-alpha-5 was actually released as
+    3.0.0-beta-1 (#133)
+  * Enhancements
+    + Support Java preview features (#125)
+    + New goals to create GroovyDoc jars (#124)
+    + Use the new "groovy.console.ui.Console" package, if available,
+    fall back to "groovy.ui.Console" (#136)
+- Changes in 1.7.0
+  * Bugs
+    + #131 Fix executing script from URL in Groovy older than 1.7.0
+    + #120 Use unique configuration names for every mojo, so goals
+    don't conflict
+  * Enhancements
+    + #122 Support Java 13
+  * Potentially breaking changes
+    + #120 corrects an inadvertent breaking change made in 1.6.0
+    with #31/#58. Here are those changes: +--------------------------+----------------------+--------------------------+
+    | 1.5                      | 1.6                  | 1.7                      |
+    +-------------------------------------+--------------------------+----------------------+--------------------------+
+    | addStubSources                      | stubsOutputDirectory     | outputDirectory      | stubsOutputDirectory     |
+    | addTestStubSources                  | testStubsOutputDirectory | outputDirectory      | testStubsOutputDirectory |
+    | compileTests/testCompile            | testOutputDirectory      | outputDirectory      | testOutputDirectory      |
+    | generateStubs                       | stubsOutputDirectory     | outputDirectory      | stubsOutputDirectory     |
+    | generateTestStubs/testGenerateStubs | testStubsOutputDirectory | outputDirectory      | testStubsOutputDirectory |
+    | groovydocTests/testGroovydoc        | groovydocJavaSources     | groovydocJavaSources | testGroovydocJavaSources |
+    | removeStubs                         | stubsOutputDirectory     | outputDirectory      | stubsOutputDirectory     |
+    | removeTestStubs                     | testStubsOutputDirectory | outputDirectory      | testStubsOutputDirectory |
+    +-------------------------------------+--------------------------+----------------------+--------------------------+
+    + In addition, unused parameters have been removed:
+    = addSources
+  - > skipTests
+  - > testSources
+    = addStubSources
+  - > skipTests
+  - > sources
+  - > testSources
+    = addTestSources
+  - > outputDirectory
+  - > skipTests
+  - > sources
+    = addTestStubSources
+  - > sources
+  - > testSources
+    = compile
+  - > skipTests
+  - > testSources
+    = compileTests
+  - > sources
+    = console
+  - > skipTests
+    = execute
+  - > skipTests
+    = generateStubs
+  - > skipTests
+  - > testSources
+    = generateTestStubs
+  - > sources
+    = groovydoc
+  - > skipTests
+  - > testSources
+  - > testGroovyDocOutputDirectory
+    = groovydocTests
+  - > skipTests
+  - > sources
+    = removeStubs
+  - > skipTests
+  - > sources
+  - > testSources
+    = removeTestStubs
+  - > sources
+  - > testSources
+    = shell
+  - > skipTests
+    + Lastly, addTestStubSources and removeTestStubs now respect the
+    skipTests flag, for consistency.
+- Changes in 1.6.3
+  * Enhancements
+    + Ability to use Groovy from plugin dependencies (creates a
+    single classpath with plugin and project dependencies)
+    (#64 & #86)
+    + Support for Java 13 bytecode (#123)
+    + Log executed scripts (#119)
+    + Log message from exception cause (#112)
+- Changes in 1.6.2
+  * Bugs
+    + Fixed that could error saying no Groovy dependency when it
+    shouldn't because no Groovy sources exist (ef3a3d5).
+  * Enhancements
+    + Support for Java 10 bytecode (#104)
+    + Support for Java 11 bytecode (#106)
+- Changes in 1.6.1
+  * Bugs
+    + Fixed that was logging Groovy version as not supporting config
+    script if config script file didn't exist
+    + Fixed NPE when calling mojo without Groovy dependency
+    + Fixed that was logging compile classpath instead of test
+    classpath during test GroovyDoc generation
+- Changes in 1.6
+  * Bugs
+    + [38] - Compilation doesn't allow indy back far enough (thanks
+    for pointing this out Pascal Schumacher!)
+  * Enhancements
+    + [36] - Allow script files to be executed as filenames as well
+    as URLs (see Significant changes of note for an example)
+    + [41] - Verify Groovy version supports target bytecode (See
+    Potentially breaking changes for a description)
+    + [46] - Remove scriptExtensions config option
+    + [31/58] - Goals not consistantly named / IntelliJ improperly
+    adding stub directories to sources
+    + [61] - You can now skip Groovydoc generation with new
+    skipGroovyDoc property (Thanks rvenutolo!)
+    + [45] - GROOVY-7423 (JEP 118) Support (requires Groovy
+    2.5.0-alpha-1 or newer and enabled with new parameters boolean
+    property)
+  * Potentially breaking changes
+    + 46 will break your build if you are using scriptExtensions.
+    But the fix is simple, just the delete the configuration
+    option and GMavenPlus will automatically do the right thing.
+    + 41 will break your build if you were passing an invalid target
+    bytecode. GMavenPlus will no longer allow Groovy to silently
+    default to 1.4 or 1.5. It will verify that the bytecode is
+    supported by your Groovy version (that is, the option exists
+    in org.codehaus.groovy.control.CompilerConfiguration), and
+    fail if it isn't.
+    + 58 will require renaming goals testGenerateStubs to
+    generateTestStubs and testCompile to compileTests. IntelliJ
+    has hard-coded the goal names in their plugin, and these names
+    will make IntelliJ work with both GMaven and GMavenPlus.
+    + In order to support using the latest Maven plugins (and to
+    make GMavenPlus easier to maintain), GMavenPlus now requires
+    Java 6 or newer and Maven 3.0.1 or newer (previously was
+    Java 5 or newer and Maven 2.2.1 or newer).
+    + Due to an unintended side-effect of logging order change,
+    adding a GMavenPlus goal without Groovy dependency will fail
+    if there are no Groovy sources to use that goal with. If this
+    is an issue for you, please let me know, and I'll consider
+    reversing the order back.
+    + testStubsOutputDirectory and stubsOutputDirectory
+    inadvertently got renamed to outputDirectory, which conflicts
+    with the configuration in the compile and compileTests goals.
+    You may need to setup separate executions with separate
+    configurations for each if you need to set that configuration
+    option.
+  * Notes
+    + You can now use this syntax for executing scripts
+    <script>${project.basedir}/src/main/resources/groovyScripts/helloWorld.groovy</script>
+    in addition to the original style of
+    <script>file:///${project.basedir}/src/main/resources/groovyScripts/helloWorld.groovy</script>
+    + This will be the last release that doesn't follow semantic
+    versioning conventions.
+
gmetrics
+- Do not generate test stubs by gmavenplus-plugin, since we are not
+  building or running tests during build
+
gn
+- Bump Leap's GCC version to 12 to align with the other Chromium
+  tools
+- Exclude ppc - it doesn't build
+
gnome-shell
+- Update gs-fate318433-prevent-same-account-multi-logins.patch:
+  Fix no warning messages (bsc#1207323).
+
+- Add gnome-shell-Pass-cancellable-when-querying-file-info.patch:
+  Pass cancellable when querying file info
+  (bsc#1205518 glgo#GNOME/gnome-shell!2268)
+- Add gnome-shell-main-Leak-the-GJS-context-and-ShellGlobal.patch:
+  Leak the GJS context and ShellGlobal (bsc#1205518)
+
gnome-themes-standard
+- Remove the is_opensuse tag to close the gap between Leap and SLE
+  (bsc#1170757, jsc#SLE-11890).
+
+- Ensure gtk2-32bit engine has the proper supplements to be
+  automatically selected.
+
+- Update to version 3.22.3:
+  + Dark theme fix.
+  + Minor tweaks.
+
+- Update to version 3.22.2:
+  + Dark theme updates.
+  + Adwaita updates.
+- Modify fdupes following upstream changes.
+- Conditionally apply translations-update-upstream BuildRequires
+  and macro for non-openSUSE only.
+
+- Update to version 3.22.1:
+  + Gtk2 dark variant.
+  + Updated translations.
+
+- Update to GNOME 3.20.2 FATE#318572
+
+- Update to version 3.20.2:
+  + Scrollbar tweaks.
+  + Makefile updates.
+  + Updated translations.
+
+- Update to version 3.20:
+  + No changes.
+
+- Update to version 3.19.91:
+  + Updated gtk2 theme.
+- Drop gnome-themes-standard-gtk3-like-menubar.patch: fixed
+  upstream.
+
+- Add gnome-themes-standard-gtk3-like-menubar.patch: Make gtk2
+  menubar like gtk3 (bgo#747679).
+
+- Move gtk2 accessibility theme to a subpackage, which will be
+  suggested when main accessibility package and libgtk-2_0-0 are
+  installed.
+
+- Update to version 3.18.0:
+  + Updated translations.
+
+- Update to version 3.16.2:
+  + Updated translations.
+
+- Update to version 3.16.0:
+  + Updated translations.
+
+- Update to version 3.15.90:
+  + Drop metacity theme.
+  + Drop polari icon.
+
+- Update to version 3.15.2.2:
+  + HC: remove one more duplicate app icon.
+- Changes from version 3.15.2.1:
+  + Remove some HC app icons that are already shipped with apps.
+
+- Update to version 3.15.2:
+  + Update gtk2 theme (entries, spinbuttons, radios, checks...).
+  + Update HC icon names.
+  + Update gtk2 HC icons.
+
+- Update to version 3.14.2.3:
+  + HC: remove one more duplicate app icon.
+- Changes from version 3.14.2.2:
+  + Remove some HC app icons that already ship with apps.
+- Changes from version 3.14.2.1:
+  + Update gtk2 HC icons.
+
+- Drop creation of HighContrastInverse and LowContrast Icon theme
+  caches: there is no icon available in those sets (boo#906721).
+
+- Update to version 3.14.2:
+  + Update gtk2 theme (entries, spinbuttons, radios, checks...).
+  + Update HC icon names.
+
gnutls
+- FIPS: PBKDF2 additional requirements [bsc#1209001]
+  * Set the minimum output key length to 112 bits (FIPS 140-3 IG D.N)
+  * Set the minimum salt length to 128 bits (SP 800-132 sec. 5.1)
+  * Set the minimum iterations count to 1000 (SP 800-132 sec 5.2)
+  * Set the minimum passlen of 20 characters (SP SP800-132 sec 5)
+  * Add regression tests for the new PBKDF2 requirements.
+  * Add gnutls-FIPS-pbkdf2-additional-requirements.patch
+
+- libgnutls: Increase the limit of TLS PSK usernames from 128 to
+  65535 characters. [bsc#1208237, jsc#PED-1562]
+  * Upstream: https://gitlab.com/gnutls/gnutls/commit/f032324a
+  * Add gnutls-increase-TLS-PSK-username-limit.patch
+
+- FIPS: Fix pct_test() return code in case of error [bsc#1207183]
+  * Rebase with the upstream version: gnutls-FIPS-PCT-DH.patch
+
google-compute-engine
+- Don't enable and start google-network-daemon.service when it's
+  already installed (bsc#1169978)
+
+- Add gceosl-no-def-sysgrps.patch (bsc#1170719, bsc#1170720)
+  + Do not add the created user to the adm (CVE-2020-8903),
+    docker (CVE-2020-8907), or lxd (CVE-2020-8933) groups
+    if they exist (bsc#1173258)
+
+- Rename the sysctl file that applies the GCE network settings (bsc#1167810)
+  + The file 11-gce-network-security.conf applies network configuration
+    settings. Specifically the value for net.ipv4.conf.all.rp_filter is also
+    part of the system defaults in /usr/lib/sysctl.d/50-default.conf and thus
+    the default setting was applied, instead of the desired setting. As
+    50-default is processed after 11-gce-network-security.
+
+- Add gcei-waitlimit-dns.patch (bsc#1151398)
+  + Add a wait limit to retrying DNS resolution to avoid a forever loop
+
+- Fix file list
+  + On i586 Python code is also under _libdir thus creating a conflict between
+    the packages.
+
+- Add gcei_disableipv6.patch (bsc#1150058)
+  + Upstream introduced an interface named "DisableIpv6" but the
+    implementation was incomplete and the interface was missing for SUSE
+    distros
+
+- Fix install location of NSS and PAM shared libraries (bsc#1146172)
+- Switch RPM group for oslogin package from Hardware to System/Daemons
+
+- Add patch to normalize setup version of Python code
+  + gcei-normalize-python-version.patch
+- Fix file matching patterns in %files section for oslogin package
+
+- Update to version 20190801 (bsc#1144092, bsc#1144170)
+  + Google Compute Engine
+  * Re-enable boto config without plugin.
+  * Fix metadata script retrieval for python 2 and 3.
+  + Google Compute Engine OS Login
+  * Fix for 2FA on RHEL 8.
+- from version 20190730
+  + Google Compute Engine
+  * Support for Debian 10.
+  * New package versioning.
+  * Support for Google Private Access over IPv6.
+  * Support root disk expansion in RHEL 8 and Debian 10.
+  + Google Compute Engine OS Login
+  * Bug fixes for sudoers.
+  * Initial groups support (not yet enabled).
+- Add patch to explicitly link NSS and PAM shared
+  libraries against libboost_regex on SLE-12
+  + gcei-link-boost_regex.patch
+- Refresh patches for new version
+  + gcei-scripts-after-reg.patch
+- Set StandardOutput=journal+console in custom systemd service files
+  + google-optimize-local-ssd.service
+  + google-set-multiqueue.service
+- Stop installing configuration file for systemd-journald
+  + Logging is now configured through systemd service files
+- Update file matching patterns in %files section for new version
+
+- Update to version 20190522 (bsc#1136266, bsc#1136267)
+  + Google Compute Engine
+  * Fix guest attributes flow in Python 3.
+  + Google Compute Engine OS Login
+  * Update OS Login control file for FreeBSD support.
+- from version 20190521
+  + Google Compute Engine
+  * Retry download for metadata scripts.
+  * Fix script retrieval in Python 3.
+  * Disable boto config in Python 3.
+  * Update SSH host keys in guest attributes.
+  * Fix XPS settings with more than 64 vCPUs.
+
+- Update to version 20190416 (bsc#1128392, bsc#1134179)
+  + Google Compute Engine
+  * FreeBSD fixes: syslog socket location and OS detection.
+  * Upstart systems: only run startup scripts at boot.
+  + Google Compute Engine OS Login
+  * Fix pam_group ordering detection.
+  * Restart cron from the OS Login control file.
+  * Add PAM entry to su:account stack.
+- from version 20190315
+  + Google Compute Engine OS Login
+  * Fix alternate challenge section for two factor authentication.
+  * Fix FreeBSD compatibility issues in the control file.
+- from version 20190304
+  + Google Compute Engine
+  * Set oom_score_adjust for google_accounts_daemon.
+  + Google Compute Engine OS Login
+  * Use pam_group to provide users with default groups.
+  * Add compat.h to support FreeBSD.
+  * Exit immediately after a two factor authentication failure.
+  * Add support for Google phone prompt challenges.
+- Adjust paths for new upstream directory layout in %build and %install
+- Include systemd service file to run google_optimize_local_ssd command
+  + google-optimize-local-ssd.service
+- Include systemd service file to run google_set_multiqueue command
+  + google-set-multiqueue.service
+- Install journald configuration files into /usr/lib/systemd/journald.conf.d
+- Refresh patches for new version
+  + gcei-hide-py-deps.patch
+  + gcei-scripts-after-reg.patch
+  + gcei-set-run_dir.patch
+
+- Update to version 20190124 (bsc#1123671, bsc#1123672)
+  + Google Compute Engine
+  * Fix metadata script retrieval to support Python 3.
+
+- Remove dropped service from systemd setup macros (bsc#1122172)
+- Drop use of restart_on_update, force service restart with  -f option
+  on service_del_preun and service_del_postun
+- Detect and handle removed services in pre rather than post
+
+- Update to version 20181206 (bsc#1119029, bsc#1119110)
+  + Google Compute Engine
+  * Support enabling OS Login two factor authentication.
+  * Improve accounts support for FreeBSD.
+  + Google Compute Engine OS Login
+  * Support OS Login two factor authentication (Alpha).
+  * Improve SELinux support.
+- from version 20181023
+  + Google Compute Engine
+  * Fix: Update sudoer group membership without overriding local groups.
+- from version 20181018
+  + Google Compute Engine
+  * Fix: Remove users from sudoers group on account removal.
+
+- Remove conditions for distributions older than Leap 42.3 and SLE 12
+  + Delete init scripts google-accounts-daemon.suse,
+    google-clock-skew-daemon.suse, google-instance-setup.suse,
+    google-network-daemon.suse, google-shutdown-scripts.suse,
+    google-startup-scripts.suse
+- Fix build for distributions with gcc version less than 4.9
+  + Add new dependency on boost
+
+- Update to version 20181011
+  + Google Compute Engine
+  * Revert: Remove users from sudoers group on account removal.
+- from version 20181008
+  + Google Compute Engine
+  * Remove users from sudoers group on account removal.
+  * Remove gsutil dependency for metadata scripts.
+- from version 20180905
+  + Google Compute Engine
+  * Remove ntp package dependency.
+  * Support Debian 10 Buster.
+  * Restart the network daemon if networking is restarted.
+  * Prevent setup of the default ethernet interface.
+  * Accounts daemon verifies username is 32 characters or less.
+  + Google Compute Engine OS Login
+  * Add user name validation to pam modules.
+  * Return false on failed final load.
+  * Support FreeBSD.
+  * Support Debian 10 Buster.
+- from version 20180611
+  + Google Compute Engine
+  * Prevent IP forwarding daemon log spam.
+  * Make default shell configurable when executing metadata scripts.
+  * Rename distro directory to distro_lib.
+- Refresh patches for new version
+  + gcei-set-run_dir.patch
+
+- Ensure that google-ip-forwarding-daemon service and
+  google-network-setup are stopped and disabled
+  during upgrade
+- Ensure that google-network-daemon service is enabled
+  and started during upgrade
+
+- Add patch to set run_dir to /var/run (bsc#1097378, #1097616)
+  + gcei-set-run_dir.patch
+- Drop deleted patch from spec file
+  + gcei-lnx-distro-py3.patch
+
+- Remove gcei-lnx-distro-py3.patch
+  + Upstream intention is to depend on distro module from GitHub
+- Add dependency on python3-distro for SLE/Leap 15 and later
+
+- Add patch gcei-lnx-distro-py3.patch (bsc#1094074)
+
+- Update to version 20180510 (bsc#1092214)
+  + Prevent delay in configuring IP forwarding routes.
+  + Improve instance setup support for FreeBSD.
+- Include new google-network-daemon
+  + Add google-network-daemon.service activation in
+    %pre and %post sections
+  + Add google-network-daemon.suse init script for SysV
+- Stop shipping deprecated google-ip-forwarding-daemon service
+  + Remove google-ip-forwarding-daemon.service activation in
+    %pre and %post sections
+  + Drop google-ip-forwarding-daemon.suse from source distribution
+- Add missing association with "init" package for  %pre, %post,
+  %preun and %postun sections
+- Install google_oslogin_nss_cache binary into oslogin package
+
+- Update to version 20180504 (bsc#1092214)
+  + Create a new network daemon.
+  + Refactor the IP forwarding daemon and network setup.
+  + Improvements for using NSS cache in the accounts daemon.
+  + Include libnss cache as part of the OS Login package.
+- Refresh patches for new version:
+  + gcei-scripts-after-reg.patch
+
+- Update to version 20180227 (bsc#1066273)
+  + Add distro specific logic.
+  + Support SLES 11 and 12 in multi-nic setup.
+  + Fix boto config documentation.
+  + Add modprobe blacklist for nouveau and floppy modules.
+  + Fix irqbalance conflict in Debian package.
+  + Fix conflict with other applications that use curl and SSL.
+- Install new kernel module blacklist into /etc/modprobe.d.
+- Refresh patches for new version:
+  + gcei-hide-py-deps.patch
+
+- Update to version 20180129 (bsc#1078349, bsc#1079077)
+  + Improve rsyslog daemon reset when using the dhcp exit hook.
+  + The OS Login feature is generally available.
+  + Change the OS Login uid restriction to allow uid 1000.
+  + Close socket connections after requesting metadata.
+- From version 20171213
+  + Force IPv4 for Debian apt configs.
+
+- Update to version 20171129 (bsc#1070895, bsc#1070918)
+  + Generate SSH host keys when none are present.
+  + Improve logging when activating OS Login.
+  + Fix parsing logic for expiration time on SSH public keys.
+  + Fix home directory creation PAM config.
+
+- Change dependencies -init depends on -oslogin
+  + oslogin feature is now enabled by the initialization code
+    when appropriate
+- Do not start the oslogin feature upon package install
+
+- Fix build for SLES 11
+
+- Update to version 20171025 (bsc#1064356, bsc#1065308)
+  + Add apt configuration to prevent auto-removal of Google packages.
+  + Rename set_hostname to prevent naming conflicts.
+  + Remove logging when checking OS Login status.
+- From version 20171019
+  + Support the enable-oslogin metadata key for activating OS Login.
+  + Improve packaging to restart services.
+  + OS Login is available in Beta.
+  + Add status option to the OS Login control file.
+- From version 20171006
+  + Fix system hang during VM shutdown.
+  + JSON parser accepts string types for int64 values.
+- From version 20170921
+  + JSON parser casts uid and gid to unsigned integers.
+- From version 20170914
+  + Remove fstab barrier options in EL 7.
+  + Use curl to download metadata script files for SSL certificate validation.
+  + Use netifaces for retrieving MAC address names if the import exists.
+
+- Ship the udevrules with the -init package only
+
+- Fix baslibs.conf, use package, not files
+- Include rpmlintrc and baslibc.conf as source
+
+- Add gcei-scripts-after-reg.patch (bsc#1057671)
+
+- Update to version 20170829 (bsc#1049242, FATE#323757)
+  + Support oslogin feature
+  + Add rpmlintrc
+    ~ We ship pam and nss modules in -oslogin we do not want
+    to name the package according to the shared library naming policy
+  + Add baslibs.config
+    ~ Handle the nss and pam modules provided by oslogin properly
+- From version 20170718
+  + Allow nologin paths other than /sbin/nologin.
+  + Try to download GCS URLs with curl if gsutil is not installed.
+  + Fix control scripts to correctly restart sshd and nscd if they exist.
+  + Retry HTTP requests if error 500 is received.
+  + Move oslogin sudoers directory locations.
+- Setup for Python 3 build oSTW and SLE 15
+- Source package renamed to google-compute-engine
+  + Binary subpackages -init -oslogin
+
+- The startup script attempts a network connection, thus it must
+  run after network setup
+
+- Scripts that are one-shot should not be marked as "stop_on_removal"
+  as there is no process running (bsc#1017395)
+- One-shot scripts should not run with startproc
+
+- Update to version 20161213 (bsc#1015829, bsc#1016372)
+  + Remove gcei-handle-failed-open.patch included upstream
+  + Remove gcei-handle-missing-gsutil.patch included upstream
+  + Forward port gcei-hide-py-deps.patch
+  + Improved alias IP support
+- From 20161118
+  + Add support for alias IPs in the IP forwarding daemon.
+  + IP forwarding daemon adds back local routes after network restart.
+  + Account daemon removes expired key access without metadata change.
+  + Account daemon ignores SSH keys with non-ascii characters.
+  + Improved exception handling.
+  + Fix for syslog startup on systemd.
+  + Add a route to the metadata server to /etc/hosts.
+- From 20160930
+  + Provide a service to enable network interfaces on boot.
+  + Create a common library for inspecting network interfaces.
+  + Allow metadata script output that is not UTF-8.
+  + Fixed instance config file logic.
+  + Fixed accounts management Python 3 compatibility.
+  + Fixed IP forwarding Python 3 compatibility.
+  + Improved style consistency.
+  + Run a service on boot to enable additional network interfaces.
+  + Update dhclient-script on EL 6 to fix local routing.
+
+- Resolve description inaccuracy
+- Call %service_* just once, but with all args
+
+- Include in SLE 12 and SLE 11 (FATE#321748, FATE#321890, bsc#994943)
+
+- Update gcei-handle-failed-open.patch to match upstream PR
+
+- Add gcei-handle-failed-open.patch
+  * Do not exit with a traceback if the sudoers file cannot be written
+
+- Package the rsyslog config unconditionally, rsyslog also available on
+  SLE 11
+
+- Add sysvinit scripts for SUSE, upstream scripts are RHEL specific
+  * google-accounts-daemon.suse
+  * google-clock-skew-daemon.suse
+  * google-instance-setup.suse
+  * google-ip-forwarding-daemon.suse
+  * google-shutdown-scripts.suse
+  * google-startup-scripts.suse
+
+- Own the udev directories, fixes issue with SLE 12 build
+
+- Conflict with the previous generation of initialization code.
+  * According to upstream and update path is not supported and
+    has too many corner cases to reliably work. Thus running instances are
+    not expected to upgrade.
+
+- Initial build
+  - Version 20160803
+
google-gson
+  * Changes
+    + Make OSGi bundle's dependency on sun.misc optional.
+    + Deprecate Gson.excluder() exposing internal Excluder class.
+    + Prevent Java deserialization of internal classes.
+    + Improve number strategy implementation.
+    + Fix LongSerializationPolicy null handling being inconsistent
+    with Gson.
+    + Support arbitrary Number implementation for Object and Number
+    deserialization.
+    + Bump proguard-maven-plugin from 2.4.0 to 2.5.1.
+    + Don't exclude static local classes.
+    + Fix RuntimeTypeAdapterFactory depending on internal Streams
+    class.
+    + Improve Maven build.
+    + Make dependency on java.sql optional.
+  * Changes
+    + Fixed issue with recursive types.
+    + Better behaviour with Java 9+ and Unsafe if there is a
+    security manager.
+    + EnumTypeAdapter now works better when ProGuard has obfuscated
+    enum fields.
google-guice
+- Avoid using xmvn-resolve and xmvn-install in order to avoid
+  build cycles with new dependencies in dependent packages
+- Build only the NO_AOP version of the guice.jar and alias
+  accordingly so that it provides both
+
+- Modified patches:
+  * google-guice-throwingproviderbinder.patch
+    + do not add the override of virtual function
+  + build with source/target 8 so that the default override
+    from the interface can be used
+  * guice-4.1-javadoc.patch
+    + build javadoc with source level 8
+
+- Do not build against the compatibility guava20
+- Added patch:
+  * google-guice-throwingproviderbinder.patch
+    + fix a little glitch with default generic function in guava
+
google-http-java-client
+- Build with java source and target levels 8
+
google-oauth-java-client
+- Build with java source and target levels 8
+
gpars
+- Do not force building with java <= 15, since we now can run
+  gradle-bootstrap with Java 17 too
+
+- Build against the org.jboss.netty:netty artifact, since the compat
+  versions are not existing any more
+
+- Force building with java <= 15
+- Added patch:
+  * gpars-sourcetarget.patch
+    + build with source and target levels 8
+
gpaste
+- Update to 3.42.5:
+  * Fix some race conditions in history handling.
+  * Better fix crash when there is no history yet.
+  * Fix crash when there is no history yet.
+- Remove 1ec2699daa600e34d73b8d200dd7bb22f4eace27.patch.
+
+- Add 1ec2699daa600e34d73b8d200dd7bb22f4eace27.patch: Fix build
+  with meson 0.61 and newer.
+- Use ldconfig_scriptlets macro for post(un) handling.
+
gpsd
+- Update to version 3.25
+  * Have ubxtool "-w 0" run forever.
+  * Bump libgps version to 30.0
+  * Change fixsource_t, store server locally, make pointers const.
+  * Move gpsd_hexpack() to gps.h as gps_hexpack()
+  * Move gpsd_hexdump() to gps.h as gps_hexdump()
+  * Allow gpsctl -s/--ship to work without -f.
+  * Grab prRes and quality from u-blox 8+, into JSON, then into xgps.
+  * New GPSD-MIB, installed in share/mibs/gpsd.
+  * gpssnmp supports GPSD-MIB in pass and pass_persist modes
+  * Add decodes for NMEA $xxHDM, $xxROT and $xxXDR
+  * Add Magnetic Heading (mheading) and Rate of Rotation (rot) to
+    attitude_t
+  * Allow NTP time from gpsd://, tcp:// and udp:// sources
+  * Add the -B, --nobuffer, option to gpspipe.
+  * gpsd opens $RUNDIR/chrony.clk.XXX.sock to supply serial time to
+    chronyd.
+  * Add -g and --garmin options to gpxlogger for depth.
+  * Add -F and --filein options to gpxlogger to read GPSD JSON from a
+    file.
+- Update gpsd.keyring (DD3DD9BB -> 0C898D47)
+
gradle
+- Added patch:
+  * gradle-java17.patch
+    + Allow actually build gradle using Java 16+
+
+- Modify the launcher so that gradle can work with Java 17
+- Do not force building with java <= 15, since we now can run
+  gradle-bootstrap with Java 17 too
+
+- Build against jansi 2.x
+- Remove the jansi-native and hawtjni-runtime dependencies, since
+  jansi 2.x does not depend on them
+- Modified patch:
+  * 0013-Add-missing-transitive-dependencies.patch
+    + jansi does not have transitive dependencies any more
+- Added patch:
+  * gradle-jansi.patch
+    + port to use jansi 2.x
+
+- Force building with java <= 11
+
+- Fix build with maven-resolver 1.7.x
+- Modified patch:
+  * 0005-Port-to-Maven-3.3.9-and-Eclipse-Aether.patch
+    + package the new artifact maven-resolver-named-locks
+
+- Remove from build dependencies some artifacts that are not
+  needed
+
+- Modified patch:
+  * 0013-Add-missing-transitive-dependencies.patch
+    + Add osgi-compendium to the dependencies, since newer qute-bnd
+    uses it
+
+- Remove build requires that are not strictly needed
+
+- Do not build against the legacy guava20 package any more
+- Added patch:
+  * port-to-guava-30.patch
+    + Port gradle 4.4.1 to guava 30.1.1
+    + Set source level to 1.8, since guava 30 uses default
+    functions in interfaces, which is Java 8+ feature
+
grafana
+- Fix basic authentication bypass by updating the exporter toolkit
+  to version 0.7.3 (bsc#1208065, CVE-2022-46146).
+- Add:
+  * 0002-Update-exporter-toolkit-to-version-0.7.3.patch
+- Require Go 1.19 or newer (bsc#1208293, CVE-2022-41723)
+
+- Update to version 8.5.20:
+  * Security: SVG: Add dompurify preprocessor step
+    (bsc#1207749, CVE-2022-23552)
+  * Security: Snapshots: Fix originalUrl spoof security issue
+    (bsc#1207750, CVE-2022-39324)
+  * Security: Omit error from http response
+  * Bug fix: Email and username trimming and invitation validation
+
granatier
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add missing KCoreAddons link
+  * modernize code
+  * Make it compile against qt6
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+
grantlee-editor
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Use new akonadi calendar install include
+  * Use directly QT_VERSION
+  * Qt5::WebEngine doesn't exist in qt6 and it's not necessary
+    for qt5 build
+  * Adapt build system for building against qt6
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
grantlee5
+- Update to 5.3.1
+  * Use C++11 nullptr where appropriate
+  * Use QRandomGenerator instead of deprecated qRand
+  * Increase compatibility with Qt 6 APIs
+  * Add CMake option to build with Qt 6 - GRANTLEE_BUILD_WITH_QT6
+  * Support enum introspection on Q_GADGET
+  * filesizeformat implementation as well as localized filesize
+  * Make enums comparable with more operations
+  * Add "truncatechars" filter
+  * Fix concatenation of string lists
+- Refreshed patches:
+  * includes.diff
+  * grantlee-5.2.0-fix-ctest-ld-library-path.patch
+- Add patch to fix tests on i586 (gh#steveire/grantlee#85):
+  * fix-i586-precision.patch
+- Add keyring for GPG source verification
+
-- Update to 5.0.0 final:
-  * No changelog since rc1 provided
-
grantleetheme
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Fix depend when we build against qt6
+  * Make it compile against qt6
+  * Prepare to build against KF6::TextTemplate (in progress)
+  * Fix install headers
+  * Adapt build system for building against qt6
+  * Modernize code
+
graphite2
+- fixed license string [bsc#1207676]:
+  LGPL-2.1-or-later OR MPL-2.0 OR GPL-2.0-or-later
+
+- Use python3 everywhere
+- Drop fonttools test dep as it pulls TON of py3 packages
+
+- Update to 1.3.11:
+- removed patches (upstreamed or not needed)
+  * gcc8.patch (code commeted out)
+  * graphite-nonvoid-return.patch (code commented out)
+  * graphite2-python3_tests.patch (upstreamed)
+  * graphite2-python3_tests_cornercases.patch (upstreamed
+- refreshed patch
+  * link-gcc-shared.diff
+- fixes security issue: CVE-2018-7999 [bsc#1084850]
+  + graphite2-CVE-2018-7999.patch
+
+- gcc8.patch: return correct value from stream operator
+
+- Do not BR asciidoc as we do not install the generated html page
+
+- Make sure we switch to python3 only on SLE15+ and not on SLE12
+
+- Add patches to fix tests when using python3:
+  * graphite2-python3_tests.patch
+  * graphite2-python3_tests_cornercases.patch
+- Refresh all other patches
+- Use fancy name for downloaded tarball
+- Run spec-cleaner
+
+- Use %ctest macro
+- Update license string to lgpl2.1+ and mpl2.0+
+- Remove patch graphite2-CVE-2017-5436.patch
+- Update to 1.3.10:
+  * Upstream marks this as contianing various bugfixes without
+    any specific mentions
+
+- security update:
+  * CVE-2017-5436 [bsc#1035204]
+    + graphite2-CVE-2017-5436.patch
+
+- Version update to 1.3.9: fixes some bugs in the collision
+  avoidance and may give slightly improved results in some cases.
+
+- Version update to 1.3.8:
+  * Various bugfixes found by fuzzers
+
+- Update to 1.3.6
+  * This fixes a number of security related bugs. There are no feature
+    improvements or bug fixes in this release.
+
+- updated to 1.3.5 bnc#965803 CVE-2016-1521:
+  * Security bug fix
+  * Fix ARM misalignment problem
+  * Track latest cmake
+
+- Version update to 1.3.4:
+  * Fix Collision Kerning ignoring some diacritics
+  * Handle pass bits 16-31 to speed up fonts with > 16 passes
+  * Various minor fuzz bug fixes
+  * Make Coverity happy
+  * Add GR_FALLTHROUGH macro for clang c++11
+- Upstream moved to github
+
+- updated to 1.3.3
+  * Slight speed up in Collision Avoidance
+  * Remove dead bidi code
+  * Bug fixes
+    . Between pass bidi reorderings and at the end
+    . Decompressor fuzz bugs
+    . Other fuzz bugs
+
+- Version bump top 1.3.2:
+  * Remove full bidi. All segments are assumed to be single directioned.
+  * Bug fixes:
+    + Decompressor corner cases
+    + Various fuzz bugs
+
+- Version bump to 1.3.1:
+  * Deprecation warning: Full bidi support is about to be deprecated. Make
+    contact if this impacts you.
+  * Change compression block format slightly to conform to LZ4
+  * Handle mono direction text with diacritics consistently. Fonts
+    now see the direction they expect consistently and bidi now
+    gives expected results.
+  * Fixed lots of fuzz bugs
+  * Coverity cleanups
+  * Build now works for clang and/or asan and/or afl etc.
+
+- Version bump to 1.3.0:
+  * Various tweaks for the arabic fonts
+- Added patches:
+  * graphite-nonvoid-return.patch
+  * graphite2-1.2.0-cmakepath.patch
+- Removed patches:
+  * no-specific-nunit-version.diff
+  * soname.diff
+
+- Remove unnecessary utf-8  characters from the spec file
+
+- add link-gcc-shared.diff: link -lgcc_s to fix undefined symbols
+  on various ARM architectures
+
groovy
+- Added patch:
+  * 0001-illegal-reflective-access.patch
+    + Backport upstream changes solving illegal reflective access
+    + This fixes visibility errors with Java 16+
+
+- Do not force building with java <= 15, since we now can run
+  gradle-bootstrap with Java 17 too
+- Added patch:
+  * groovy-java17.patch
+    + Add the content of org.gradle.jvmargs to to the forked
+    jvm in root compileJava task
+    + Fixes build with Java 17
+
+- Added patch:
+  * groovy-2.4.21-jansi.patch
+    + port to build against jansi 2.4.0
+
+- Force building with JDK <= 15, since gradle does not work with
+  anything higher
+- Modified patch:
+  * groovy-source-levels.patch
+    + build the whole with java source and target levels 8
+- Added patch:
+  * groovy-ambiguous-functions-calls.patch
+    + resolve parameter ambiguities with recent Java versions
+
+- Remove a bogus dependency on old asm3
+
+- Do not start summaries with lower-case letter
+
groovy18
+- Added patches:
+  * groovy18-jansi.patch
+  - Fix build against jansi 2.4.0
+  * groovy18-jline2.patch
+  - Port to use jline 2.x instead of 1.x
+
+- Added patch:
+  * groovy18-nofork.patch
+    + do not fork the groovyc and java tasks in the ant build.xml
+    file, so that the ANT_OPTS are propagated to the tasks
+- Add opens of java.lang from java.base module to all unnamed
+  * fixes build with jdk17
+
+- Modified patch:
+  * groovy18-sourcetarget.patch
+    + Build with source and target levels 8
+- Added patches:
+  * groovy18-amgiguous-function-calls.patch
+    + Cast to Collection to help compiler to resolve ambiguities
+    with new JDKs
+  * groovy18-asm7.patch
+    + Remove dependency on the old asm3
+
growpart-generator
+- Get the parent device with lsblk
+- Improve the partition number extraction to work with device names
+  containing multiple numbers (bsc#1196101)
+
grub2
+- Make grub more robust against storage race condition causing system boot
+  failures (bsc#1189036)
+  * 0001-ieee1275-ofdisk-retry-on-open-and-read-failure.patch
+
gstreamer-devtools
+- Add patch to reduce the required meson version to 0.61.0 since
+  that's what we have in SLE 15:
+  * reduce-required-meson.patch
+
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+
+- Update to version 1.20.5:
+  + No major changes.
+
+- Update to version 1.20.4:
+  + No changes.
+
+- Update to version 1.20.3:
+  + No upstream changes available.
+
+- Update to version 1.20.1:
+  + meson: provide gobject-cast-checks, glib-checks and
+    glib-asserts options at top level as well
+
gstreamer-docs
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+
+- Update to version 1.20.5:
+  + No changelog provided by upstream.
+
+- Update to version 1.20.4:
+  + No changelog provided by upstream.
+
+- Update to version 1.20.3:
+  + No changelog provided by upstream.
+
+- Update to version 1.20.2:
+  + No changelog provided by upstream.
+
gstreamer-editing-services
+- Replace the dependency in the .pc file from python to python3
+
+- Add patch to reduce the required meson version to 0.61.0 since
+  that's what we have in SLE 15:
+  * reduce-required-meson.patch
+
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+- Add gst-editing-services-fix-pc-name.patch: pc file was renamed.
+- Replace pkgconfig(gst-validate-1.0) with
+  pkgconfig(gstreamer-validate-1.0) BuildRequires.
+
+- Update to version 1.20.5:
+  + Fix building ges with tools disabled
+  + Fix leaks and minor races in GES
+
+- Update to version 1.20.4:
+  + Deadlock in ges because of recursive gst_init() call.
+  + ges/gstframepositioner: don't create one compositor per frame
+    meta.
+  + nle: clear seek event properly.
+
+- Update to version 1.20.3:
+  + Update validate test scenarios for videoaggregator rounding
+    behaviour change
+
+- Update to version 1.20.2:
+  + License clarification: GES is released under the LGPL2+ license
+
gstreamer-plugins-good
+- Conflict with gstreamer-plugins-ugly < 1.22.0 to ensure we don't
+  have conflicts with gstreamer-plugins-ugly 1.20.1 since
+  libgstxingmux.so was moved from -ugly to -good (boo#1209541)
+
gstreamer-plugins-libav
+- Add patch to reduce the required meson version to 0.61.0 since
+  that's what we have in SLE 15:
+  * reduce-required-meson.patch
+
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+
+- Update to version 1.20.5:
+  + avdec_h265: Fix endless renegotiation with alternate
+    interlacing
+  + avviddec: Avoid flushing on framerate changes
+
+- Remove unused BuildRequire on yasm.
+
+- Update to version 1.20.4:
+  + avauddec:
+  - Fix regression with WMA files, would throw an error at EOS.
+  - Fix unnecessary reconfiguration if the audio layout isn't
+    specified.
+  + libav: Fix for APNG encoder property registration.
+  + Failure to decode end of WMA file.
+
+- Update to version 1.20.3:
+  + No Changes
+
+- Update to version 1.20.2:
+  + video decoders: fix frame leak on negotiation error
+  + Fix build on systems without C++ compiler
+  + avviddec: Remove vc1/wmv3 override (fixing crash with FFmpeg 5
+  + Segfaults on ASF/WMV files with FFMPEG 5.0+
+
gstreamer-plugins-rs
+- Increase constraints so it doesn't fail to build for lack of
+  disk space.
+
+- Disable the aws plugin in big endian architectures since it
+  requires the ring crate which doesn't support big endian systems
+  (see gh#briansmith/ring#1555). Fixes bsc#1208795
+
gstreamer-plugins-vaapi
+- Add patch to reduce the required meson version to 0.61.0 since
+  that's what we have in SLE 15:
+  * reduce-required-meson.patch
+
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+- Update options passed to meson to current standard.
+- Add new devel sub-package following upstream changes.
+
+- Update to version 1.20.5:
+  + vaapi:
+  - Prefix internal USE_X11 define to fix build with mesa 22.3.0
+  - libs: context: use queried value for attrib
+  + gstreamer-vaapi cannot be built without X11 with recent mesa
+
+- Remove unused buildrequires on yasm.
+- Add explicit buildrequires on glib, gmodule and x11.
+
+- Update to version 1.20.4:
+  + vaapi:
+  - Handle when no encoders/decoders available.
+  - Crash in gst_vaapidecode_class_init() when no
+    decoders/encoders available.
+
+- Pass package-origin='http://download.opensuse.org' to meson.
+- Drop unused ldconfig call from post(un), this is a plugin, not a
+  shared library.
+
+- Update to version 1.20.3:
+  + aapi: Do not disable the whole vpp when some va
+    operations not available
+  + vaapidecode, vaapipostproc: Disable DMAbuf from caps
+    negotiation
+  + scrambled video with some Intel graphics cards
+
+- Update to version 1.20.2:
+  + No changes
+
gstreamer-rtsp-server
+- Add patch to reduce the required meson version to 0.61.0 since
+  that's what we have in SLE 15:
+  * reduce-required-meson.patch
+
+- Update to version 1.22.0:
+  + Please see changes in gstreamer main package, major version
+    bump.
+
+- Update to version 1.20.5:
+  + rtsp-server: Free client if no connection could be created
+
+- Update to version 1.20.4:
+  + gst-rtsp-server: Fix pushing backlog to client.
+  + rtsp-server: stream: Don't loop forever if binding to the
+    multicast address fails.
+
+- Update to version 1.20.3:
+  + No changes.
+
+- Update to version 1.20.2:
+  + rtspclientsink: fix possible shutdown deadlock in
+    collect_streams()
+  + Minor spelling fixes
+
guava
+- Remove parent reference from ALL distributed pom files
+
+- Upgrade to guava 30.1.1
+  * fixes bsc#1179926, CVE-2020-8908: temp directory creation
+    vulnerability in Guava versions prior to 30.0
+- Removed patch:
+  * guava-25.0-java8compat.patch
+    + the compatibility is handled in the upstream code
+- Added patch:
+  * donotmock.patch
+    + patch @DoNotMock annotation occurrences in order to put them
+    in a format that our regex is able to identify and kill
+
guava20
+- Build with java source and target levels 8
+
+- Add bundle manifest to the guava jar so that it might be usable
+  from eclipse
+
gwenview5
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * Add a "Fit" button to the status bar (kde#441447)
+  * Fix Bug 445434: Gwenview crash when clicking "crop"
+    button (kde#445434)
+  * Add proper desktop file for importer (kde#446290)
+  * Use normal font size for sidebar text (kde#447287)
+  * Only switch to Qt::FastTransformation ("showing pixels")
+    at 500% zoom (kde#443010)
+  * Add "Print Preview" action (kde#236056)
+
hamcrest
+- Modified patch:
+  * hamcrest-1.3-build.patch
+    + Build with source/target levels 8
+- Added patch:
+  * hamcrest-matchers.patch
+    + Fix build with jdk17
+
-- Add obsoletes in core to fix updates. [bsc#1174544]
+- Add obsoletes in core to fix updates. [bsc#1174544]
+
hawtjni-maven-plugin
+- Upgrade to version 1.18
+- Added patch:
+  * use-commons-lang3.patch
+    + use commons-lang3 instead of the old commons-lang
+
+- Build with java source and target levels 8
+
hawtjni-runtime
+- Upgrade to version 1.18
+- Added patch:
+  * use-commons-lang3.patch
+    + use commons-lang3 instead of the old commons-lang
+
+- Build with java source and target levels 8
+
+- Use in the path of hawtjni-generator the asm-all.jar that is not
+  modular. This solves some problems with ASM version mismatch.
+
hdf5:openmpi2
-- Fix CVE-2021-37501 - overflow in calculation of data buffer due to bogus
-  input file (bsc#1207973).
-  https://github.com/HDFGroup/hdf5/issues/2458
-  https://github.com/HDFGroup/hdf5/pull/2459
-  Check-for-overflow-when-calculating-on-disk-attribute-data-size-2459.patch
-  Remove-duplicate-code.patch
-
-- Fix CVEs:
-  * CVE-2021-46244 (bsc#1195215)
-    Compound-datatypes-may-not-have-members-of-size-0.patch
-  * CVE-2018-13867 (bsc#1101906)
-    Validate-location-offset-of-the-accumulated-metadata-when-comparing.patch
-  * CVE-2018-16438 (bsc#1107069)
-    Make-sure-info-block-for-external-links-has-at-least-3-bytes.patch
-  * CVE-2020-10812 (bsc#1167400)
-    Hot-fix-for-CVE-2020-10812.patch
-  * CVE-2021-45830 (bsc#1194375)
-    H5O_fsinfo_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2019-8396 (bsc#1125882)
-    H5O__pline_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2018-11205 (bsc#1093663)
-    Pass-compact-chunk-size-info-to-ensure-requested-elements-are-within-bounds.patch
-  * CVE-2021-46242 (bsc#1195212)
-    When-evicting-driver-info-block-NULL-the-corresponding-entry.patch
-  * CVE-2021-45833 (bsc#1194366)
-    Report-error-if-dimensions-of-chunked-storage-in-data-layout-2.patch
-  * CVE-2018-14031 (bsc#1101475)
-    H5O_dtype_decode_helper-Parent-of-enum-needs-to-have-same-size-as-enum-itself.patch
-  * CVE-2018-17439 (bsc#1111598)
-    H5IMget_image_info-H5Sget_simple_extent_dims-does-not-exceed-array-size.patch
-- Fix an error message:
-    Fix-error-message-not-the-name-but-the-link-information-is-parsed.patch
-
hdf5:openmpi3
-- Fix CVE-2021-37501 - overflow in calculation of data buffer due to bogus
-  input file (bsc#1207973).
-  https://github.com/HDFGroup/hdf5/issues/2458
-  https://github.com/HDFGroup/hdf5/pull/2459
-  Check-for-overflow-when-calculating-on-disk-attribute-data-size-2459.patch
-  Remove-duplicate-code.patch
-
-- Fix CVEs:
-  * CVE-2021-46244 (bsc#1195215)
-    Compound-datatypes-may-not-have-members-of-size-0.patch
-  * CVE-2018-13867 (bsc#1101906)
-    Validate-location-offset-of-the-accumulated-metadata-when-comparing.patch
-  * CVE-2018-16438 (bsc#1107069)
-    Make-sure-info-block-for-external-links-has-at-least-3-bytes.patch
-  * CVE-2020-10812 (bsc#1167400)
-    Hot-fix-for-CVE-2020-10812.patch
-  * CVE-2021-45830 (bsc#1194375)
-    H5O_fsinfo_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2019-8396 (bsc#1125882)
-    H5O__pline_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2018-11205 (bsc#1093663)
-    Pass-compact-chunk-size-info-to-ensure-requested-elements-are-within-bounds.patch
-  * CVE-2021-46242 (bsc#1195212)
-    When-evicting-driver-info-block-NULL-the-corresponding-entry.patch
-  * CVE-2021-45833 (bsc#1194366)
-    Report-error-if-dimensions-of-chunked-storage-in-data-layout-2.patch
-  * CVE-2018-14031 (bsc#1101475)
-    H5O_dtype_decode_helper-Parent-of-enum-needs-to-have-same-size-as-enum-itself.patch
-  * CVE-2018-17439 (bsc#1111598)
-    H5IMget_image_info-H5Sget_simple_extent_dims-does-not-exceed-array-size.patch
-- Fix an error message:
-    Fix-error-message-not-the-name-but-the-link-information-is-parsed.patch
-
hdf5:openmpi4
-- Fix CVE-2021-37501 - overflow in calculation of data buffer due to bogus
-  input file (bsc#1207973).
-  https://github.com/HDFGroup/hdf5/issues/2458
-  https://github.com/HDFGroup/hdf5/pull/2459
-  Check-for-overflow-when-calculating-on-disk-attribute-data-size-2459.patch
-  Remove-duplicate-code.patch
-
-- Fix CVEs:
-  * CVE-2021-46244 (bsc#1195215)
-    Compound-datatypes-may-not-have-members-of-size-0.patch
-  * CVE-2018-13867 (bsc#1101906)
-    Validate-location-offset-of-the-accumulated-metadata-when-comparing.patch
-  * CVE-2018-16438 (bsc#1107069)
-    Make-sure-info-block-for-external-links-has-at-least-3-bytes.patch
-  * CVE-2020-10812 (bsc#1167400)
-    Hot-fix-for-CVE-2020-10812.patch
-  * CVE-2021-45830 (bsc#1194375)
-    H5O_fsinfo_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2019-8396 (bsc#1125882)
-    H5O__pline_decode-Make-more-resilient-to-out-of-bounds-read.patch
-  * CVE-2018-11205 (bsc#1093663)
-    Pass-compact-chunk-size-info-to-ensure-requested-elements-are-within-bounds.patch
-  * CVE-2021-46242 (bsc#1195212)
-    When-evicting-driver-info-block-NULL-the-corresponding-entry.patch
-  * CVE-2021-45833 (bsc#1194366)
-    Report-error-if-dimensions-of-chunked-storage-in-data-layout-2.patch
-  * CVE-2018-14031 (bsc#1101475)
-    H5O_dtype_decode_helper-Parent-of-enum-needs-to-have-same-size-as-enum-itself.patch
-  * CVE-2018-17439 (bsc#1111598)
-    H5IMget_image_info-H5Sget_simple_extent_dims-does-not-exceed-array-size.patch
-- Fix an error message:
-    Fix-error-message-not-the-name-but-the-link-information-is-parsed.patch
-
hidviz
+- Update to version 0.2
+  * fixed build with cmake 3.17
+  * imported libhidx directly into the sources (fixes a lot of
+    compilation issues)
+  * updated to QT6
+  * added a new icon
+- Drop hidviz-moc_policy.patch and hidviz-gcc11.patch (no longer
+  necessary)
+
hiredis
+- hiredis 1.1.0:
+  * better SSL convenience
+  * new async adapters
+  * can now return nan in addition to -inf and inf in a
+    REDIS_REPLY_DOUBLE. Applications that deal with RESP3 doubles
+    should make sure to account for this.
+
+    [boo#1191331]
http-builder
+- Build with source and target levels 8
+
+- Do not require gmavenplus-plugin, since it is only necessary to
+  generate test stubs, but we do not run tests during build
+
http-parser
+- move out from gyp
+- use correct SONAME
+- drop http-parser-gyp-sharedlib.patch
+- add makefile.patch
+
+- Update to version 2.7.1
+  * No changelog available
+
+- Update to 2.6.2
+  * No changelog available
+
+- Add baselibs.conf as source, in order to build
+  libhttp-parser-suse0 32-bit compatability lib.
+
+- Update to version 2.6.0
+  * No changelog available
+
+- Initial package (version 2.5.0) for build.opensuse.org
+
httpcomponents-client
+- Build with source/target levels 8
+
+- Update to version 4.5.12
+
httpcomponents-core
+- Build with source/target levels 8
+
+- Upgraded to version 4.4.13
+- Removed patch:
+  * 0001-Re-generated-expired-test-certificates.patch
+    + included in this version
+- Modified patch:
+  * httpcomponents-core-java8compat.patch
+    + rediffed to changed context
+
hunspell
+- requires english dictionary [bsc#1199209]
+
+- suggests english dictionary [bsc#1193627]
+
+- security update
+- added patches
+  fix CVE-2019-16707 [bsc#1151867], invalid read operation in SuggestMgr:leftcommonsubstring in suggestmgr.cxx
+  + hunspell-CVE-2019-16707.patch
+
+- Update to version 1.6.2:
+  * Command line tool:
+    + Added German translation
+    + Fixed bug with wrong output encoding, not respecting system
+    locale.
+
+- Update to version 1.6.1:
+  * Library changes:
+    + Performance improvements in suggest()
+    + Fixes regressions for Hungarian related to compounding.
+    + Fixes regressions for Korean related to ICONV.
+  * Command line tool:
+    + Added Tajik translation
+    + Fix regarding serching of OOo dicts installed in user folder
+  * Manpages:
+    + Fix microsoft-cp1251 to cp1251. Dicts should not use the
+    first.
+    + Typos.
+
+- Update to version 1.6.0:
+  * Changes in the library:
+    + Performance improvement in ngsuggest(), suggestions should be
+    faster.
+    + Revert MAXWORDLEN to 100 as in 1.3.3 for performance reasons.
+    + MAXWORDLEN can be set during build time with -D defines.
+    + Fix crash when word with 102 consecutive X is spelled.
+  * Changes in the command line tool:
+    + -D shows all loaded dictionares insted of only the first.
+    + -D properly lists all available dictionaries on Windows.
+
+- update to 1.5.4:
+  * fix API compatibility with 1.4
+
+- update to 1.5.0:
+  * Lot of stability fixes
+  * Fixed compilation errors on various systems (Windows, FreeBSD)
+  * Small performance improvement compared to 1.4.0
+  * API is same as 1.4.
+
+- Drop Requires: pkgconfig because this is already autodetected
+  by rpm. Use mode inheritance for defattr. Edit rpm group and
+  description a tiny bit.
+
+- Update baselibs.conf bnc#977784
+- Add conflicts to hunspell 1.4.0
+
+- Update to 1.4.1:
+  * Past begin() iterator decrement error
+  * VS Debug build threw error on decrement past begin.
+- Split shared library
+- Do not call autoreconf
+- Move manpages to corresponding packages
+
+- Update to 1.4.0
+  * New release that strips out fixed length buffers from large
+    parts of the library
+  * Note: dictmgr.hxx header is dropped
+- Drop upstreamed hunspell-grep2.24.patch
+
+- Version update to 1.3.4:
+  * Various updates to the buildsystem
+  * Various werror bugfixes
+  * Loads of coverity fixes
+- Add patch to build with grep 2.24:
+  * hunspell-grep2.24.patch
+- Remove upstreamed patch:
+  * hunspell-emacs-utf8.patch
+- Do not search for translations - broken automake from upstream
+  * Not worth fixing only bit italian and mostly hungarian translations
+    for cli anyway
+
icu4j
+- Upgrade to version 71.1
+  * Updates to CLDR 41 locale data with various additions and
+    corrections.
+  * Adds phrase-based line breaking for Japanese. Existing line
+    breaking methods follow standards and conventions for body text
+    but do not work well for short Japanese text, such as in titles
+    and headings. This new feature is optimized for these use
+    cases.
+  * Adds support for Hindi written in Latin letters (hi_Latn). The
+    CLDR data for this increasingly popular locale has been
+    significantly revised and expanded. Note that based on user
+    expectations, hi_Latn incorporates a large amount of English,
+    and can also be referred to as “Hinglish”.
+  * ICU 71 and CLDR 41 are minor releases, mostly focused on bug
+    fixes and small enhancements.
+  * Updates to the time zone data version 2022a. Note that pre-1970
+    data for a number of time zones has been removed, as has been
+    the case in the upstream tzdata release since 2021b.
+- Remove obsolete stuff from spec file
+- Reformat the changes file to fit to 67 chars width
+
+- Upgrade to verison 70.1
+- Modified patches:
+  * icu4j-66.1-java8compat.patch -> icu4j-70.1-java8compat.patch
+  * icu4j-jdk10plus.patch
+    + rediff to changed context
+  * improve-osgi-manifest.patch
+    + replace also DATAVERSION token during the build
+- Added patch:
+  * icu4j-javadoc.patch
+    + fix invalid html entities
+
+- Update to version 67.1
+  * Unicode 13 (ICU-20893, same as in ICU 66)
+    + Total of 5930 new characters
+    + 4 new scripts
+    + 55 new emoji characters, plus additional new sequences
+    + New CJK extension, first characters in plane 3: U+30000..U+3134A
+  * CLDR 37
+    + New language at Modern coverage: Nigerian Pidgin
+    + New languages at Basic coverage: Fulah (Adlam), Maithili,
+    Manipuri, Santali, Sindhi (Devanagari), Sundanese
+    + Region containment: EU no longer includes GB
+    + Unicode 13 root collation data and Chinese data for collation
+    and transliteration
+  * DateTimePatternGenerator now obeys the "hc" preference in the
+    locale identifier (ICU-20442)
+  * Various other improvements for ECMA-402 conformance
+  * Number skeletons have a new "concise" form that can be used in
+    MessageFormat strings (ICU-20418)
+  * Currency formatting options for formal and other currency
+    display name variants (ICU-20854)
+  * ListFormatter: new public API to select the style & type
+    (ICU-12863)
+  * ListFormatter now selects the proper “and”/“or” form for
+    Spanish & Hebrew (ICU-21016)
+  * Locale ID canonicalization upgraded to implement the complete
+    CLDR spec (ICU-20834, ICU-20272)
+  * LocaleMatcher: New option to ignore one-way matches
+    (ICU-20936), and other tweaks to the code (ICU-20916,
+    ICU-20917) and data (from CLDR)
+  * acceptLanguage() reimplemented via LocaleMatcher (ICU-20700)
+  * Data build tool: tzdbNames.res moved from the "zone_tree"
+    category to the "zone_supplemental" category (ICU-21073)
+
+- Version update to 66.1
+- Changed patches:
+  * icu4j-jdk10plus.patch
+  * improve-osgi-manifest.patch
+  * icu4j-63.1-java8compat.patch -> icu4j-66.1-java8compat.patch
+    + rediff to changed context
+
+- Remove build-dependency on java-javadoc, since it is not
+  necessary with this version.
+
-  properties.
+    properties.
incidenceeditor
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * KTimeZoneComboBox: fix support for floating events
+  * Fix compile error against qt6
+  * Remove unused include
+  * Use new akonadi calendar install include
+  * Link against KPIMTextEdit explicitly where it's used
+  * Fix install headers
+  * install version.h in module directly
+  * Use KDE_INSTALL_INCLUDEDIR_KF
+  * Adapt build system for building against qt6
+  * Fix more prefixes on dependencies
+  * Modernize code
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
installation-images:openSUSE
+- merge gh#openSUSE/installation-images#635
+- Include openssl hmac for SLE Micro (bsc#1208981)
+- 16.58.5
+
+- merge gh#openSUSE/installation-images#630
+- clean up Xorg config (bsc#1192678, bsc#1207516)
+- 16.58.4
+
+- merge gh#openSUSE/installation-images#629
+- adjust to sap-installation-wizard package changes (jsc#PED-3111)
+- 16.58.3
+
intel-media-driver
+- no longer set LIBVA_DRIVER_NAME=iHD; it's no longer needed;
+  implemented in libva meanwhile (boo#1209134)
+
isorelax
+- Build with java target and source version 1.8
+
itextpdf
-- Remove unneeded BuildRequires:  mvn(org.codehaus.mojo:buildnumber-maven-plugin)
+- Upgrade to version 5.5.13.3
+  * fixes CVE-2021-43113 and CVE-2020-28052
+- Removed patch:
+  * itextpdf-5.5.13.2-bouncycastle.patch
+    + not needed with this version
+
+- Upgrade to version 5.5.13.2
+- Removed patch:
+  * itextpdf-5.5.13.1-bouncycastle.patch
+    + Integrated upstream
+- Added patch:
+  * itextpdf-5.5.13.2-bouncycastle.patch
+    + fix build with bouncycastle 1.68
itinerary
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Add runtime requirement of ki18n-imports
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes to list here.
+- Use GCC 10 for building kate on Leap 15.
+
jackson
+- Remove all dependencies on asm3
+
+- Build with java source and target levels 1.8
+- Modified patch:
+  * jackson-sourcetarget.patch
+    + Do not hardcode source and target levels, so that they
+    can be overriden on command-line
+- Added patch:
+  * jackson-javaee.patch
+    + Set classpath correctly so that the project builds with
+    standalone JavaEE modules too
+
jackson-parent
+- Update to 2.13.0
+  * 2.13.0 (30-Sep-2021)
+    + Add 'mvnw' wrapper
+  * 2.12.0 (29-Nov-2020)
+    + #171: 'JsonSubType.Type' should accept array of names
+    + #173: Jackson version alignment with Gradle 6
+    + #174: Add '@JsonIncludeProperties'
+    + #175: Add '@JsonTypeInfo(use=DEDUCTION)'
+    + #177: Ability to use '@JsonAnyGetter' on fields
+    + #179: Add '@JsonKey' annotation
+    + #180: Allow repeated calls to
+    'SimpleObjectIdResolver.bindItem()' for same mapping
+    + #181: Add 'namespace' property for '@JsonProperty' (for
+    XML module)
+    + Add target 'ElementType.ANNOTATION_TYPE' for
+    '@JsonEnumDefaultValue' (was missing for some reason)
+  * 2.11.0 (26-Apr-2020)
+    + 'JsonPattern.Value.pattern' retained as "", never
+    (accidentally) exposed as 'null'
+
jakarta-commons-discovery
+- Build with source and target levels 8
+
+- Distribute commons-discovery as maven artifact
+
+- Added build support for Enterprise Linux.
+
-- merged with jpackage 1.7
-- update to 0.4
-
-- don't use icecream
-- use source="1.4" and target="1.4" for build with java 1.5
-
-- converted neededforbuild to BuildRequires
-
jakarta-commons-fileupload
+- Security fix: [CVE-2016-3092 and CVE-2023-24998, bsc#1208513, bsc#986359]
+  * Usage of vulnerable FileUpload package can result in denial of
+    service.
+  * Added jakarta-commons-fileupload-CVE-2016-3092.patch
+  * Added jakarta-commons-fileupload-CVE-2016-3092-2.patch
+
-- Move from jpackage-utils to javapackage-tools
-
jakarta-commons-modeler
+- Build with java source and target levels 8
+
+- Update to 2.0.1:
+  * Modeler 2.0.1 is binary and source compatible with Modeler 2.0
+  * Bugs fixed:
+  - ant jar in trunk fails
+  - MbeansDescriptorsDigesterSource.java is never build if just
+    setting commons-digester.jar property in build.properties
+  - ant.properties is missing from the Modeler jar
+  - mbeans-descriptors.dtd is missing from the Modeler jar and
+    binary distro
+- Clean spec file and rpm-lint warnings:
+  * License is marked as a license file
+  * Docs endlines are converted to UNIX.
+
-- Current version 1.1 from JPackage.org
-
-- Initial package created with version 1.1 (JPackage 1.5)
-
janino
+- Upgrade to version 3.1.6
+- Removed patch:
+  * janino-2.7.8-remove-nullanalysis-annotations.patch
+    + not needed any more
+- Build with source and target levels 8
+
jansi
+- Upgrade the latest upstream release 2.4.0
+  * Integrates jansi-native libraries
+  * Does not depend on jansi-native and hawtjni-runtime
+- Make the jansi package archful since it installs a native
+  library and jni jar
+- Added patch:
+  * jansi-jni.patch
+    + Give a possibility to load the native libjansi.so from
+    system
+
+- Build with java source and target levels 8
+
jansi-native
+- Build with java source and target levels 8
+
jarjar
+- Filter out the distributionManagement section from pom files,
+  since we use aliases and not relocations
+
-- Initial packaging for SUSE. Version 0.9 (jpp5)
-
jatl
+- Build with java source and target levels 8
+
java-11-openjdk
+- Remove the accessibility sub-package, since it was never really
+  working and creates another problems (bsc#1206549). It can
+  eventually be built as standalone if needed
+- Removed patches:
+  * jaw-jdk10.patch
+  * jaw-misc.patch
+  * jaw-nogtk.patch
+    + not needed after the removal of the accessibility sub-package
+
+- Upgrade to upstream tag jdk-11.0.18+10 (January 2023 CPU)
+  * CVEs
+    + CVE-2023-21835, bsc#1207246
+    + CVE-2023-21843, bsc#1207248
+  * Security fixes
+    + JDK-8286070: Improve UTF8 representation
+    + JDK-8286496: Improve Thread labels
+    + JDK-8287411: Enhance DTLS performance
+    + JDK-8288516: Enhance font creation
+    + JDK-8289350: Better media supports
+    + JDK-8293554: Enhanced DH Key Exchanges
+    + JDK-8293598: Enhance InetAddress address handling
+    + JDK-8293717: Objective view of ObjectView
+    + JDK-8293734: Improve BMP image handling
+    + JDK-8293742: Better Banking of Sounds
+    + JDK-8295687: Better BMP bounds
+  * Other changes
+    + JDK-4819544: SwingSet2 JTable Demo throws NullPointerException
+    + JDK-6782021: It is not possible to read local computer
+    certificates with the SunMSCAPI provider
+    + JDK-6829250: Reg test:
+    java/awt/Toolkit/ScreenInsetsTest/ScreenInsetsTest.java fails
+    in Windows
+    + JDK-7001973: java/awt/Graphics2D/CopyAreaOOB.java fails
+    + JDK-8022403: sun/java2d/DirectX/OnScreenRenderingResizeTest/
+    /OnScreenRenderingResizeTest.java fails
+    + JDK-8028998: [TEST_BUG] [macosx] java/awt/dnd/
+    /DropTargetEnterExitTest/MissedDragExitTest.java failed
+    + JDK-8029633: Raw inner class constructor ref should not
+    perform diamond inference
+    + JDK-8030121: java/awt/dnd/MissingDragExitEventTest/
+    /MissingDragExitEventTest.java fails
+    + JDK-8079267: [TEST_BUG] Test java/awt/Frame/MiscUndecorated/
+    /RepaintTest.java fails
+    + JDK-8129827: [TEST_BUG] Test java/awt/Robot/RobotWheelTest/
+    /RobotWheelTest.java fails
+    + JDK-8159599: [TEST_BUG] java/awt/Modal/
+    /ModalInternalFrameTest/ModalInternalFrameTest.java
+    + JDK-8169187: [macosx] Aqua: java/awt/image/multiresolution/
+    /MultiresolutionIconTest.java
+    + JDK-8172269: When checking the default behaviour for a scroll
+    tab layout and checking the 'opaque' checkbox, the area behind
+    tabs is not red.
+    + JDK-8178698: javax/sound/midi/Sequencer/MetaCallback.java
+    failed with timeout
+    + JDK-8193942: Regression automated test '/open/test/jdk/javax/
+    /swing/JFrame/8175301/ScaledFrameBackgroundTest.java' fails
+    + JDK-8194126: Regression automated Test '/open/test/jdk/javax/
+    /swing/JColorChooser/Test7194184.java' fails
+    + JDK-8198343: Test java/awt/print/PrinterJob/
+    /TestPgfmtSetMPA.java may fail w/o printer
+    + JDK-8199290: [TESTBUG]
+    sun.hotspot.WhiteBox$WhiteBoxPermission is not copied
+    + JDK-8202836: [macosx] test
+    java/awt/Graphics/TextAAHintsTest.java fails
+    + JDK-8206125: [windows] cannot pass relative path to
+  - -with-boot-jdk
+    + JDK-8210047: some pages contain content outside of landmark
+    region
+    + JDK-8211002: test/jdk/java/lang/Math/PowTests.java skips
+    testing for non-corner-case values
+    + JDK-8212096: javax/net/ssl/ServerName/
+    /SSLEngineExplorerMatchedSNI.java failed intermittently due
+    to SSLException: Tag mismatch
+    + JDK-8213239: Configure cannot handle command overrides with
+    arguments
+    + JDK-8215571: jdb does not include jdk.* in the default class
+    filter
+    + JDK-8217032: Check pandoc capabilities in configure
+    + JDK-8222091: Javadoc does not handle package annotations
+    correctly on package-info.java
+    + JDK-8222251: preflow visitor is not visiting lambda
+    expressions
+    + JDK-8226236: win32: gc/metaspace/
+    /TestCapacityUntilGCWrapAround.java fails
+    + JDK-8227179: Test for new gc+metaspace=info output format
+    + JDK-8227651: Tests fail with SSLProtocolException: Input
+    record too big
+    + JDK-8228672: [TESTBUG] gc/metaspace/TestSizeTransitions.java
+    fails on 32-bit platforms
+    + JDK-8233557: [TESTBUG] DoubleClickTitleBarTest.java fails on
+    macOs
+    + JDK-8233558: [TESTBUG] WindowOwnedByEmbeddedFrameTest.java
+    fails on macos
+    + JDK-8233565: [TESTBUG] NullModalityDialogTest.java fails on
+    MacOS
+    + JDK-8233648: [TESTBUG] DefaultMenuBarTest.java failing on
+    macos
+    + JDK-8239708: Split basics.m4 into basic.m4 and util.m4
+    + JDK-8240281: Remove failing assertion code when selecting
+    first memory state in SuperWord::co_locate_pack
+    + JDK-8242468: VS2019 build missing vcruntime140_1.dll
+    + JDK-8243565: some gc tests use 'test.java.opts' and not
+    'test.vm.opts'
+    + JDK-8243568: serviceability/logging/TestLogRotation.java uses
+    'test.java.opts' and not 'test.vm.opts'
+    + JDK-8244010: Simplify usages of
+    ProcessTools.createJavaProcessBuilder in our tests
+    + JDK-8244557: test/jdk/javax/swing/JTabbedPane/
+    /TestBackgroundScrollPolicy.java failed
+    + JDK-8247676: vcruntime140_1.dll is not needed on 32-bit
+    Windows
+    + JDK-8249694: java/lang/StringBuffer/HugeCapacity.java and
+    j/l/StringBuilder/HugeCapacity.java tests shouldn't be
+    @ignore-d
+    + JDK-8253877: gc/g1/TestGCLogMessages.java fails - missing
+    "Evacuation failure" message
+    + JDK-8254874: ZGC: JNIHandleBlock verification failure in
+    stack watermark processing
+    + JDK-8254976: Re-enable swing jtreg tests which were broken
+    due to samevm mode
+    + JDK-8255439: System Tray icons get corrupted when Windows
+    scaling changes
+    + JDK-8256109: Create implementation for NSAccessibilityButton
+    protocol
+    + JDK-8257679: Improved unix compatibility layer in Windows
+    build (winenv)
+    + JDK-8257722: Improve "keytool -printcert -jarfile" output
+    + JDK-8258005: JDK build fails with incorrect fixpath script
+    + JDK-8259485: Document need for short paths when building on
+    Windows
+    + JDK-8260272: bash configure --prefix does not work after
+    JDK-8257679
+    + JDK-8261336: IGV: enhance default filters
+    + JDK-8261445: Use memory_order_relaxed for os::random().
+    + JDK-8261758: [TESTBUG] gc/g1/TestGCLogMessages.java fails if
+    ergonomics detect too small InitialHeapSize
+    + JDK-8263326: Remove ReceiverTypeData check from
+    serviceability/sa/TestPrintMdo.java
+    + JDK-8263871: On sem_destroy() failing we should assert
+    + JDK-8264593: debug.cpp utilities should be available in
+    product builds.
+    + JDK-8264666: Change implementation of safeAdd/safeMult in the
+    LCMSImageLayout class
+    + JDK-8266082: AssertionError in Annotate.fromAnnotations with
+  - Xdoclint
+    + JDK-8266967: debug.cpp utility find() should print Java
+    Object fields.
+    + JDK-8268361: Fix the infinite loop in next_line
+    + JDK-8268860: Windows-Aarch64 build is failing in GitHub
+    actions
+    + JDK-8268893: jcmd to trim the glibc heap
+    + JDK-8269029: compiler/codegen/TestCharVect2.java fails for
+    client VMs
+    + JDK-8269873: serviceability/sa/Clhsdb tests are using a C2
+    specific VMStruct field
+    + JDK-8272123: Problem list 4 jtreg tests which regularly fail
+    on macos-aarch64
+    + JDK-8273236: keytool does not accurately warn about
+    algorithms that are disabled but have additional constraints
+    + JDK-8273553: sun.security.ssl.SSLEngineImpl.closeInbound also
+    has similar error of JDK-8253368
+    + JDK-8273578: javax/swing/JMenu/4515762/bug4515762.java fails
+    on macOS 12
+    + JDK-8273685: Remove jtreg tag manual=yesno for
+    java/awt/Graphics/LCDTextAndGraphicsState.java & show test
+    instruction
+    + JDK-8274029: Remove jtreg tag manual=yesno for  java/awt/
+    /print/Dialog/DialogOrient.java
+    + JDK-8274032: Remove jtreg tag manual=yesno for java/awt/print/
+    /PrinterJob/ImagePrinting/ImageTypes.java & show test UI
+    + JDK-8274296: Update or Problem List tests which may fail with
+    uiScale=2 on macOS
+    + JDK-8274456: Remove jtreg tag manual=yesno
+    java/awt/print/PrinterJob/PageDialogTest.java
+    + JDK-8274563: jfr/event/oldobject/TestClassLoaderLeak.java
+    fails when GC cycles are not happening
+    + JDK-8274597: Some of the dnd tests time out and fail
+    intermittently
+    + JDK-8275170: Some jtreg sound tests should be marked with
+    sound keyword
+    + JDK-8275535: Retrying a failed authentication on multiple
+    LDAP servers can lead to users blocked
+    + JDK-8276841: Add support for Visual Studio 2022
+    + JDK-8277159: Fix java/nio/file/FileStore/Basic.java test by
+    ignoring /run/user/* mount points
+    + JDK-8277497: Last column cell in the JTable row is read as
+    empty cell
+    + JDK-8277881: Missing SessionID in TLS1.3 resumption in
+    compatibility mode
+    + JDK-8277970: Test jdk/sun/security/ssl/SSLSessionImpl/
+    /NoInvalidateSocketException.java fails with "tag mismatch"
+    + JDK-8279066: entries.remove(entry) is useless in
+    PKCS12KeyStore
+    + JDK-8279695: [TESTBUG] modify compiler/loopopts/
+    /TestSkeletonPredicateNegation.java to run on C1 also
+    + JDK-8280158: New test from JDK-8274736 failed with/without
+    patch in JDK11u
+    + JDK-8280550: SplittableRandom#nextDouble(double,double) can
+    return result >= bound
+    + JDK-8280863: Update build README to reflect that MSYS2 is
+    supported
+    + JDK-8280890: Cannot use '-Djava.system.class.loader' with
+    class loader in signed JAR
+    + JDK-8280948: Write a regression test for JDK-4659800
+    + JDK-8280950: RandomGenerator:NextDouble() default behavior
+    non conformant after JDK-8280550 fix
+    + JDK-8281183: RandomGenerator:NextDouble() default behavior
+    partially fixed by JDK-8280950
+    + JDK-8281296: Create a regression test for JDK-4515999
+    + JDK-8281297: TestStressG1Humongous fails with
+    guarantee(is_range_uncommitted)
+    + JDK-8282046: Create a regression test for JDK-8000326
+    + JDK-8282276: Problem list failing two Robot Screen Capture
+    tests
+    + JDK-8282306: os::is_first_C_frame(frame*) crashes on invalid
+    link access
+    + JDK-8282345: handle latest VS2022 in abstract_vm_version
+    + JDK-8282402: Create a regression test for JDK-4666101
+    + JDK-8282640: Create a test for JDK-4740761
+    + JDK-8282642: vmTestbase/gc/gctests/LoadUnloadGC2/
+    /LoadUnloadGC2.java fails intermittently with exit code 1
+    + JDK-8282730: LdapLoginModule throw NPE from logout method
+    after login failure
+    + JDK-8282777: Create a Regression test for JDK-4515031
+    + JDK-8282778: Create a regression test for JDK-4699544
+    + JDK-8282857: Create a regression test for JDK-4702690
+    + JDK-8282936: Write a regression test for JDK-4615365
+    + JDK-8282937: Write a regression test for JDK-4820080
+    + JDK-8283199: Linux os::cpu_microcode_revision() stalls cold
+    startup
+    + JDK-8283422: Create a new test for JDK-8254790
+    + JDK-8284294: Create an automated regression test for RFE
+    4138746
+    + JDK-8284358: Unreachable loop is not removed from C2 IR,
+    leading to a broken graph
+    + JDK-8284521: Write an automated regression test for RFE
+    4371575
+    + JDK-8284690: [macos] VoiceOver : Getting
+    java.lang.IllegalArgumentException: Invalid location on
+    Editable JComboBox
+    + JDK-8284732: FFI_GO_CLOSURES macro not defined but required
+    for zero build on Mac OS X
+    + JDK-8284752: Zero does not build on Mac OS X due to missing
+    os::current_thread_enable_wx implementation
+    + JDK-8284771: java/util/zip/CloseInflaterDeflaterTest.java
+    failed with "AssertionError: Expected IOException to be
+    thrown, but nothing was thrown"
+    + JDK-8284884: Replace polling with waiting in
+    javax/swing/text/html/parser/Parser/8078268/bug8078268.java
+    + JDK-8284977: MetricsTesterCgroupV2.getLongValueEntryFromFile
+    fails when named value doesn't exist
+    + JDK-8285305: Create an automated test for JDK-4495286
+    + JDK-8285373: Create an automated test for JDK-4702233
+    + JDK-8285604: closed sun/java2d/GdiRendering/
+    /ClipShapeRendering.java failed with "Incorrect color ffeeeeee
+    instead of ff0000ff in pixel (100, 100)"
+    + JDK-8285617: Fix java/awt/print/PrinterJob/ImagePrinting/
+    /PrintARGBImage.java manual test
+    + JDK-8285698: Create a test to check the focus stealing of
+    JPopupMenu from JComboBox
+    + JDK-8285794: AsyncGetCallTrace might acquire a lock via
+    JavaThread::thread_from_jni_environment
+    + JDK-8285836: sun/net/www/http/KeepAliveCache/
+    /KeepAliveProperty.java failed with "RuntimeException: Failed
+    in server"
+    + JDK-8285921: serviceability/dcmd/jvmti/AttachFailed/
+    /AttachReturnError.java fails on Alpine
+    + JDK-8286624: Regression Test CoordinateTruncationBug.java
+    fails on OL8.3
+    + JDK-8286663: Resolve IDE warnings in WTrayIconPeer and
+    SystemTray
+    + JDK-8286772: java/awt/dnd/DropTargetInInternalFrameTest/
+    /DropTargetInInternalFrameTest.html times out and fails in
+    Windows
+    + JDK-8286872: Refactor add/modify notification icon (TrayIcon)
+    + JDK-8287076: Document.normalizeDocument() produces different
+    results
+    + JDK-8287091: aarch64 : guarantee(val < (1ULL << nbits))
+    failed: Field too big for insn
+    + JDK-8287425: Remove unnecessary register push for
+    MacroAssembler::check_klass_subtype_slow_path
+    + JDK-8287609: macOS: SIGSEGV at [CoreFoundation]
+    CFArrayGetCount / sun.font.CFont.getTableBytesNative
+    + JDK-8287724: Fix various issues with msys2
+    + JDK-8287826: javax/accessibility/4702233/
+    /AccessiblePropertiesTest.java fails to compile
+    + JDK-8287895: Some langtools tests fail on msys2
+    + JDK-8287896: PropertiesTest.sh fail on msys2
+    + JDK-8287902: UnreadableRB case in MissingResourceCauseTest is
+    not working reliably on Windows
+    + JDK-8287917: System.loadLibrary does not work on Big Sur if
+    JDK is built with macOS SDK 10.15 and earlier
+    + JDK-8288132: Update test artifacts in QuoVadis CA interop
+    tests
+    + JDK-8288302: Shenandoah: SIGSEGV in vm maybe related to jit
+    compiling xerces
+    + JDK-8288377: [REDO] DST not applying properly with zone id
+    offset set with TZ env variable
+    + JDK-8288445: AArch64: C2 compilation fails with
+    guarantee(!true || (true && (shift != 0))) failed: impossible
+    encoding
+    + JDK-8288599: com/sun/management/OperatingSystemMXBean/
+    /TestTotalSwap.java: Expected total swap size ... but
+    getTotalSwapSpaceSize returned ...
+    + JDK-8288985: P11TlsKeyMaterialGenerator should work with
+    ChaCha20-Poly1305
+    + JDK-8289043: C2: Vector constant materialization attempt
+    + JDK-8289146: containers/docker/TestMemoryWithCgroupV1.java
+    fails on linux ppc64le machine with missing Memory and Swap
+    Limit output
+    + JDK-8290207: Missing notice in dom.md
+    + JDK-8290209: jcup.md missing additional text
+    + JDK-8290451: Incorrect result when switching to C2 OSR
+    compilation from C1
+    + JDK-8290529: C2: assert(BoolTest(btest).is_canonical())
+    failure
+    + JDK-8290705: StringConcat::validate_mem_flow asserts with
+    "unexpected user: StoreI"
+    + JDK-8290711: assert(false) failed: infinite loop in
+    PhaseIterGVN::optimize
+    + JDK-8290781: Segfault at
+    PhaseIdealLoop::clone_loop_handle_data_uses
+    + JDK-8291459: JVM crash with GenerateOopMap::error_work(char
+    const*, __va_list_tag*)
+    + JDK-8291461: assert(false) failed: bad AD file
+    + JDK-8292083: Detected container memory limit may exceed
+    physical machine memory
+    + JDK-8292158: AES-CTR cipher state corruption with AVX-512
+    + JDK-8292541: [Metrics] Reported memory limit may exceed
+    physical machine memory
+    + JDK-8292682: Code change of JDK-8282730 not updated to
+    reflect CSR update
+    + JDK-8292778: EncodingSupport_md.c convertUtf8ToPlatformString
+    wrong placing of free
+    + JDK-8292866:
+    Java_sun_awt_shell_Win32ShellFolder2_getLinkLocation check
+    MultiByteToWideChar return value for failures
+    + JDK-8292887: Bump update version for OpenJDK: jdk-11.0.18
+    + JDK-8292899: CustomTzIDCheckDST.java testcase failed on AIX
+    platform
+    + JDK-8293044: C1: Missing access check on non-accessible class
+    + JDK-8293472: Incorrect container resource limit detection if
+    manual cgroup fs mounts present
+    + JDK-8293540: [Metrics] Incorrectly detected resource limits
+    with additional cgroup fs mounts
+    + JDK-8293578: Duplicate ldc generated by javac
+    + JDK-8293672: Update freetype md file
+    + JDK-8293816: CI: ciBytecodeStream::get_klass() is not
+    consistent
+    + JDK-8293826: Closed test fails after JDK-8276108 on aarch64
+    + JDK-8293828: JFR: jfr/event/oldobject/TestClassLoaderLeak.java
+    still fails when GC cycles are not happening
+    + JDK-8293834: Update CLDR data following tzdata 2022c update
+    + JDK-8293998: [PPC64] JfrGetCallTrace: assert(_pc != nullptr)
+    failed: must have PC
+    + JDK-8294138: [11u] Revert change from JDK-8210962 in basic.m4
+    + JDK-8294307: ISO 4217 Amendment 173 Update
+    + JDK-8294357: (tz) Update Timezone Data to 2022d
+    + JDK-8294578: [PPC64] C2: Missing is_oop information when
+    using disjoint compressed oops mode
+    + JDK-8294740: Add cgroups keyword to TestDockerBasic.java
+    + JDK-8295173: (tz) Update Timezone Data to 2022e
+    + JDK-8295288: Some vm_flags tests associate with a wrong BugID
+    + JDK-8295322: Tests for JDK-8271459 were not backported to 11u
+    + JDK-8295429: Update harfbuzz md file
+    + JDK-8295469: S390X: Optimized builds are broken
+    + JDK-8295554: Move the "sizecalc.h" to the correct location
+    + JDK-8295641: Fix DEFAULT_PROMOTED_VERSION_PRE=ea for -dev
+    + JDK-8295714: GHA ::set-output is deprecated and will be
+    removed
+    + JDK-8295723: security/infra/wycheproof/RunWycheproof.java
+    fails with Assertion Error
+    + JDK-8295872: [PPC64] JfrGetCallTrace: Need pc == nullptr
+    check before frame constructor
+    + JDK-8295952: Problemlist existing compiler/rtm tests also on
+    x86
+    + JDK-8296108: (tz) Update Timezone Data to 2022f
+    + JDK-8296239: ISO 4217 Amendment 174 Update
+    + JDK-8296480: java/security/cert/pkix/policyChanges/
+    /TestPolicy.java is failing
+    + JDK-8296485: BuildEEBasicConstraints.java test fails with
+    SunCertPathBuilderException
+    + JDK-8296496: Overzealous check in sizecalc.h prevents large
+    memory allocation
+    + JDK-8296632: Write a test to verify the content change of
+    TextArea sends TextEvent
+    + JDK-8296652: Restore windows aarch64 fixpath patch that was
+    removed in 8239708
+    + JDK-8296715: CLDR v42 update for tzdata 2022f
+    + JDK-8296957: One more cast in SAFE_SIZE_NEW_ARRAY2
+    + JDK-8297147: UnexpectedSourceImageSize test times out on slow
+    machines when fastdebug is used
+    + JDK-8297153: sun/java2d/DirectX/OnScreenRenderingResizeTest/
+    /OnScreenRenderingResizeTest.java fails again
+    + JDK-8297241: Update sun/java2d/DirectX/
+    /OnScreenRenderingResizeTest/OnScreenRenderingResizeTest.java
+    + JDK-8297481: Create a regression test for JDK-4424517
+    + JDK-8297656: AArch64: Enable AES/GCM Intrinsics
+    + JDK-8297804: (tz) Update Timezone Data to 2022g
+    + JDK-8298737: 8296772 backport to jdk11u caused build error on
+    sparc
+    + JDK-8299393: [11u] Remove designator
+    DEFAULT_PROMOTED_VERSION_PRE=ea for release 11.0.18
+    + JDK-8299439: java/text/Format/NumberFormat/CurrencyFormat.java
+    fails for hr_HR
+    + JDK-8299483: ProblemList java/text/Format/NumberFormat/
+    /CurrencyFormat.java
+    + JDK-8299616: [11u] Bootcycle build fails after JDK-8257679
+    backport
+
+- Fix jconsole.desktop icon
+
java-1_8_0-openj9
+- Update to OpenJDK 8u362 build 09 with OpenJ9 0.36.0 virtual
+  machine
+- Including Oracle January 2023 CPU changes
+  CVE-2023-21830 (bsc#1207249), CVE-2023-21843 (bsc#1207248)
+  * OpenJ9 changes, see
+    https://www.eclipse.org/openj9/docs/version0.36/
+
java-1_8_0-openjdk
+- Update to version jdk8u362 (icedtea-3.26.0)
+  * January 2023 CPU
+  * CVEs
+    + CVE-2023-21830, bsc#1207249
+    + CVE-2023-21843, bsc#1207248
+  * Security fixes
+    + JDK-8285021: Improve CORBA communication
+    + JDK-8286496: Improve Thread labels
+    + JDK-8288516: Enhance font creation
+    + JDK-8289350: Better media supports
+    + JDK-8293554: Enhanced DH Key Exchanges
+    + JDK-8293598: Enhance InetAddress address handling
+    + JDK-8293717: Objective view of ObjectView
+    + JDK-8293734: Improve BMP image handling
+    + JDK-8293742: Better Banking of Sounds
+    + JDK-8295687: Better BMP bounds
+  * New features
+    + Support for building with autoconf 2.71
+  * Import of OpenJDK 8 u362 build 09
+    + JDK-6885993: Named Thread: introduce print() and
+    print_on(outputStream* st) methods
+    + JDK-7124218: [TEST_BUG] [macosx] Space should select cell in
+    the JTable
+    + JDK-8054066: com/sun/jdi/DoubleAgentTest.java fails with
+    timeout
+    + JDK-8067941: [TESTBUG] Fix tests for OS with 64K page size.
+    + JDK-8071530: Update OS detection code to reflect Windows 10
+    version change
+    + JDK-8073464: GC workers do not have thread names
+    + JDK-8079255: [TEST_BUG] [macosx] Test closed/java/awt/Robot/
+    /RobotWheelTest/RobotWheelTest fails for Mac only
+    + JDK-8129827: [TEST_BUG] Test java/awt/Robot/RobotWheelTest/
+    /RobotWheelTest.java fails
+    + JDK-8148005: One byte may be corrupted by
+    get_datetime_string()
+    + JDK-8159599: [TEST_BUG] java/awt/Modal/ModalInternalFrameTest/
+    /ModalInternalFrameTest.java
+    + JDK-8159720: Failure of C2 compilation with tiered prevents
+    some C1 compilations
+    + JDK-8197859: VS2017 Complains about UINTPTR_MAX definition in
+    globalDefinitions_VisCPP.hpp
+    + JDK-8206456: [TESTBUG] docker jtreg tests fail on systems
+    without cpuset.effective_cpus / cpuset.effective_mems
+    + JDK-8221529: [TESTBUG] Docker tests use old/deprecated image
+    on AArch64
+    + JDK-8224506: [TESTBUG] TestDockerMemoryMetrics.java fails
+    with exitValue = 137
+    + JDK-8233551: [TESTBUG] SelectEditTableCell.java fails on MacOS
+    + JDK-8241086: Test runtime/NMT/HugeArenaTracking.java is
+    failing on 32bit Windows
+    + JDK-8253702: BigSur version number reported as 10.16, should
+    be 11.nn
+    + JDK-8255559: Leak File Descriptors Because of
+    ResolverLocalFilesystem#engineResolveURI()
+    + JDK-8265527: tools/javac/diags/CheckExamples.java fails after
+    JDK-8078024 8u backport
+    + JDK-8269039: Disable SHA-1 Signed JARs
+    + JDK-8269850: Most JDK releases report macOS version 12 as
+    10.16 instead of 12.0
+    + JDK-8270344: Session resumption errors
+    + JDK-8271459: C2: Missing NegativeArraySizeException when
+    creating StringBuilder with negative capacity
+    + JDK-8273176: handle latest VS2019 in abstract_vm_version
+    + JDK-8274563: jfr/event/oldobject/TestClassLoaderLeak.java
+    fails when GC cycles are not happening
+    + JDK-8274840: Update OS detection code to recognize Windows 11
+    + JDK-8275887: jarsigner prints invalid digest/signature
+    algorithm warnings if keysize is weak/disabled
+    + JDK-8280890: Cannot use '-Djava.system.class.loader' with
+    class loader in signed JAR
+    + JDK-8283277: ISO 4217 Amendment 171 Update
+    + JDK-8283903: GetContainerCpuLoad does not return the correct
+    result in share mode
+    + JDK-8284389: Improve stability of GHA Pre-submit testing by
+    caching cygwin installer
+    + JDK-8284622: Update versions of some Github Actions used in
+    JDK workflow
+    + JDK-8286582: Build fails on macos aarch64 when using
+  - -with-zlib=bundled
+    + JDK-8288928: Incorrect GPL header in pnglibconf.h (backport
+    of JDK-8185041)
+    + JDK-8289549: ISO 4217 Amendment 172 Update
+    + JDK-8292762: Remove .jcheck directories from jdk8u
+    subcomponents
+    + JDK-8293181: Bump update version of OpenJDK: 8u362
+    + JDK-8293461: Add a test for JDK-8290832
+    + JDK-8293828: JFR: jfr/event/oldobject/TestClassLoaderLeak.java
+    still fails when GC cycles are not happening
+    + JDK-8294307: ISO 4217 Amendment 173 Update
+    + JDK-8294357: (tz) Update Timezone Data to 2022d
+    + JDK-8294863: Enable partial tier1 testing in GHA for JDK8
+    + JDK-8295164: JDK 8 jdi tests should not use tasklist command
+    on Windows
+    + JDK-8295173: (tz) Update Timezone Data to 2022e
+    + JDK-8295288: Some vm_flags tests associate with a wrong BugID
+    + JDK-8295714: GHA ::set-output is deprecated and will be
+    removed
+    + JDK-8295723: security/infra/wycheproof/RunWycheproof.java
+    fails with Assertion Error
+    + JDK-8295915: Problemlist compiler/rtm failures specific to 8u
+    + JDK-8295950: Enable langtools/tier1 in GHA for 8u
+    + JDK-8296108: (tz) Update Timezone Data to 2022f
+    + JDK-8296239: ISO 4217 Amendment 174 Update
+    + JDK-8296555: Enable hotspot/tier1 for 64-bit builds in GHA
+    for 8u
+    + JDK-8296715: CLDR v42 update for tzdata 2022f
+    + JDK-8296959: Fix hotspot shell tests of 8u on multilib systems
+    + JDK-8297141: Fix hotspot/test/runtime/SharedArchiveFile/
+    /DefaultUseWithClient.java for 8u
+    + JDK-8297804: (tz) Update Timezone Data to 2022g
+    + JDK-8299439: java/text/Format/NumberFormat/CurrencyFormat.java
+    fails for hr_HR
+    + JDK-8299483: ProblemList java/text/Format/NumberFormat/
+    /CurrencyFormat.java
+    + JDK-8300178: JDK-8286496 causes build failure on older GCC
+    + JDK-8300225: JDK-8288516 causes build failure on Windows +
+    VS2010
+  * Bug fixes
+    + Don't run check-aes on Zero builds (pointless and slow)
+- Removed patch:
+  * java-1_8_0-openjdk-autoconf27.patch
+    + fixed upstream
+
java-cup
+- Modified patch:
+  * java-cup-classpath.patch
+    + use the java-cup name instead of the java_cup one
+- Regenerate the generated files with newer flex
+
+- Upgrade to recent git checkout providing 0.11 beta
+- Modified patches:
+  * java-cup-classpath.patch
+  * java-cup-no-classpath-in-manifest.patch
+  * java-cup-no-cup-no-jflex.patch
+    + rediff to the changed context
+- Removed patch:
+  * java-cup-lr_parser-constructor.patch
+    + integrated upstream
+- Added patch:
+  * java-cup-java8.patch
+    + replace java 10+ constructs in order to be able to build
+    with java 8
+- Fetch sources using source service
+- Do not run git during the build
+
-- Build using gcj (for proper bootstrap of openjdk)
-
-- Initial packaging of java-cup-bootstrap 0.11 in SUSE (from jpp5)
-
javacc
+- Added patches:
+  * 0001-Generate-max.-one-deprecated-annotation-per-method.patch
+  * 0002-Fix-annotations-for-JavaCharStream.patch
+    + Fix regression where duplicate @Deprecated annotations were
+  generated
+
+- Update to version 7.0.11
+  * Modifications in version 7.0.11
+  - #193 : Code error in class RCharacterList.SortDescriptors():
+    fixed
+  * Modifications in version 7.0.10
+  - #183 : Lookahead is broken since 7.0.5 (introduced in commit
+    fbac68f)
+  * Modifications in version 7.0.9
+  - pom.xml : change deployment on OSS to automatic release
+  - documentation : fix broken links
+  * Modifications in version 7.0.8
+  - #175 : Doesn’t work in Turkish Locale
+  - #73 : javacc/c++: invalid lookahead processing: missing one
+    lookahead to get rid of the conflict
+  * Modifications in version 7.0.7
+  - JavaCC.jj : remove unused c++ declaration blocs tokens
+  - #172 : add a specific ‘-version’ command line argument
+  * Modifications in version 7.0.6
+    The following changes are not upward compatible with the
+    previous 7.0.5 version but have a very little impact on
+    existing grammars. Main advantage is to prepare a more smooth
+    upgrade with the upcoming javacc-8.0.0 major release.
+  - C++ generation: renaming the option TOKEN_EXTENDS by
+    TOKEN_SUPER_CLASS
+  - C++ generation: renaming the option TOKEN_INCLUDES by
+    TOKEN_INCLUDE
+  - C++ generation: renaming the option PARSER_INCLUDES by
+    PARSER_INCLUDE
+  - C++ generation: renaming the option TOKEN_MANAGER_INCLUDES by
+    TOKEN_MANAGER_INCLUDE
+  * Modifications in version 7.0.5
+  - #42: new README.md file.
+  - #71: Add support for Java7 language features.
+  - #75: Allow empty type parameters in Java code of grammar files.
+  - #77: javacc.org is out of date.
+  - #92: Avoid warning of unused import in generated
+    ParserTokenManager.
+  - #99: LookaheadSuccess creation performance improved.
+    Removing IDE specific files. Declare trace_indent only if debug
+    parser is enabled. CPPParser.jj grammar added to grammars.
+    Build with Maven is working again.
+    —WARNING—WARNING—WARNING— Required Java Platform: Standard
+    Edition 7.0: known under Eclipse as JavaSE-1.7
+
+- Build with source/target levels 8
+
-- updated to 4.0:
-  See the bug list in issue tracker for all the bugs fixed in this release.
-    JJTree and JavaCC both now support 1.5 syntax.
-    We now support accessing token fields in the grammar like: s=<ID>.image
-    Convenient constructors for passing encoding directly to the grammar
-    Tabsetting is now customizable.
-    SimpleNode can now extend a class using the NODE_EXTENDS option.
-    JAVACODE and BNF productions take optional access modifiers.
-
-- set source=1.4 for java
-
-- converted neededforbuild to BuildRequires
-
javacc-maven-plugin
+- Build with java source and target levels 8
+
javaewah
+- Build with java source and target levels 8
+
javamail
+- Add alias to com.sun.mail:jakarta.mail needed by ant-javamail
+
+- Remove all parents, since this package is not built with maven
+- Assure that every dependency has a version, or at least "any"
+  * fixes use with gradle
+
+- Build against the standalone JavaEE modules unconditionally
+
+- Build with source/target levels 8
+
+- Add glassfish-activation-api dependency for relevant distribution
+  versions to make buildable with JDK that does not contain the
+  JavaEE modules
+
javapackages-meta
+- Fix requires not to have to redo the package on each
+  javapackages-tools update
+
javapackages-tools
+- Added patches:
+  * 0001-Let-maven_depmap.py-generate-metadata-with-dependenc.patch
+  * 0002-Do-not-try-to-construct-POM-from-maven-coordinate-st.patch
+  * 0003-Fix-tests-after-the-recent-maven_depmap.py-changes.patch
+    + Let maven_depmap.py generate metadata with dependencies under
+    certain circumstances
+
+- Fix typo in suse-use-libdir.patch:
+  %{_libdir}/jvm-commmon -> %{_libdir}/jvm-common
+
+- Do not run tests on SLE12, since python3-test is not accessible
+
+- Can't assume non-existence of python38 macros in Leap.
+  gh#openSUSE/python-rpm-macros#107
+  Test for suse_version instead. Only Tumbleweed has and needs the
+  python_subpackage_only support.
+
+- Fix typo in spec file sitearch -> sitelib
+
+- Fix the python subpackage generation
+  gh#openSUSE/python-rpm-macros#79
+
+- Support python subpackages for each flavor
+  gh#openSUSE/python-rpm-macros#66
+- Replace old nose with pytest gh#fedora-java/javapackages#86
+
+- when building extra flavor, BuildRequire javapackages-filesystem:
+  /etc/java is being cleaned out of the filesystems package.
+
+- Upgrade to version 5.3.1
+- Modified patch:
+  * suse-use-libdir.patch
+    + rediff to changed context
+- Define _rpmmacrodir for distributions that don't have it
+
+- Use %{_rpmmacrodir} instead of %{_libexecdir}/rpm/macros.d: this
+  just happens to overlap in some distros.
+
javaparser
+- Upgrade to upstream version 2.24.2
+  * Fixes:
+    + Adding constructor descriptor
+    + Fix issue #3491  Method has a multidimensional arrays argument
+    in jar file. when call the method throw
+    UnsolvedSymbolException
+    + Fix issue #3218 GetSourceRoots() does not return all source
+    roots
+    + Bug in ArrayCreationExpr constructors
+    + Fix issue 3440 Removing a node with LexicalPreservingPrinter
+    causes UnsupportedOperationException
+    + Improve unit test for BlockStmtContextResolutionTest
+    + Improve Conditional Operator resolution [JLS 15.25]
+    + Fix issue #3526 Variable or FieldDeclaration is not resolved
+    correctly when another variable with the same name is
+    declared in the same block
+
+- Upgrade to the latest version 3.24.0
+  * A long list of fixes is to be found at https://github.com/
+    /javaparser/javaparser/blob/master/changelog.md
+  * Upgrade needed to be able to upgrade jctools and make them
+    not depend hard on Java 8
+
javassist
+- Requires java >= 1.8
+- Rebased patches:
+  * javassist-osgi.patch
+- Version update to 3.29.0:
+  * removes an unused import declaration as PR 384 mentions.
+  * Merge pull request #382 from tim-hoffman/PR_RemoveStringBuffer
+  * Merge pull request #383 from tim-hoffman/PR_ArrayCopyPerformance
+  * uncomments test code suggested by PR405
+  * cancels PR#391, which does not pass all the tests
+  * fixes a wrong indentation
+  * Merge pull request #391 from derklaro/fix-method-naming-syntax
+  * does refactoring
+  * fixes a bug in SignatureAttribute.renameClass().
+  * fixs a compilation problem although one test still fails.
+  * Merge pull request #299 from pietrobraione/master
+  * Merge branch 'master' into master
+  * Merge pull request #278 from ximsfei/master
+  * Merge pull request #390 from derklaro/master
+  * changes test code because package
+    java.rmi.activation.ActivationGroupDesc does not exist any
+    longer.
+  * deletes src/test/test2/*.class
+  * Merge pull request #399 from carldea/master
+  * Merge pull request #409 from aschleck/patch-1
+  * Remove redundant type check
+  * Using TCK Tested JDK builds of OpenJDK
+  * Merge pull request #395 from aburaksahin/master
+  * Fix for NullPointerException on detach()
+  * Only wrap the method name if the method doesn't come from the
+    same decl class
+  * Lower requirement for an extra type in constructor to Java 7-
+  * Replace array copy loop with System.arraycopy
+  * Replace remaining StringBuffer uses with StringBuilder
+  * Replace StringBuffer with StringBuilder and other minor String
+    optimizations
+  * fixes GitHub Issue 378 (wrong link for apache license)
+  * updates javassist.Loader to exclude jdk.internal.
+  * Fixes to support the full syntax of possible signatures
+  * Fix renaming of classes in presence of generic signatures and
+    nested classes.
+  * add unit test
+  * fixes a bug of ClassFile#renameClass(), some imports could not
+    be successfully renamed
+
+- Rebased osgi patch: javassist-osgi.patch
+- Rebased java8 compat patch: javassist-java8-compat.patch
+- Requires Java API >= 1.7
+
+- Added patch:
+  * javassist-osgi.patch
+    + Add OSGi manifest to the javassist.jar
+
-- fix group entries for subpackages
-
-- sanitize release line in specfile
-
jboss-interceptors-1
+- Build with java source and target levels 8
+
jboss-websocket-1
+- Build with java source and target levels 8
+
jcifs
+- Build with java source and target levels 8
+
jcsp
+- Build with source and target levels 8
+
jctools
+- Build with java source and target levels 8
+
+- Upgrade to 3.3.0
+  * API Changes:
+    + Removed MpscLinkedQueue7 and MpscLinkedQueue8 and consolidated
+    into parent. This removes the need for the builder method on
+    MpscLinkedQueue.
+    + Deprecated QueueFactory and spec package classes. These are
+    not used by any users AFAICT and are only used for testing
+    internally.
+    + Removed some internal classes and reduced visibility of
+    internal utilities where practical. The @InternalAPI
+    tagging annotation is also used more extensively to discourage
+    dependency.
+    + #226: XADD unbounded mpsc/mpmc queue: highly scalable linked
+    array queues
+    + New blocking consumer MPSC
+  * Bug fixes:
+    + #334 NBHMLong iterators do not remove NO_KEY
+    + #335 NBHM/Long/Identity iterators only removes keys if values
+    have not changed. Now follow JDK convention.
+    + #336 MpscBlockingConsumerArrayQueue: fix race writing to
+    blocked field
+    + #339 'fill' wakeup call can spin forever (or until a consumer
+    is blocked again) on MpscBlockingConsumerArrayQueue
+    + #319 Relying on test cases provided by #328 we apply the fix
+    used for #205 to 'NonBlockingHashMapLong' and
+    'NonBlockingIdentityHashMap' to provide 'getAndSet' like
+    semantics for put and remove.
+    + #330 Fix a 'NonBlockingIdentityHashMap' 'replace' bug. During
+    this fix some further work was done to bring the code closer
+    in line to the current state of 'NonBlockingHashMap'
+    + Use byte fields for padding (avoid upcoming false sharing
+    problem in JDK 15+ where field ordering has changed)
+    + #289 Add Automatic-Module-Name header to MANIFEST.MF
+    + #292 Fix inconsistent isEmpty/poll/peek/offer dynamics for
+    SpscLinkedQueue
+    + Fixed potential for negative queue size for indexed queues and
+    similar issue with isEmpty
+    + #296 Fix peek/relaxedPeek race with poll/offer in MC queues
+    + #297 Fix inconsistent size of FF based queues causing
+    potential size() > capacity()
+    + #316 Fix MpscBlockingConsumerArrayQueue::poll(TimeUnit,timeout)
+    + #310 Fix MpmcUnboundedXaddArrayQueue::peek/relaxedPeek
+    can load "future" elements
+    + #209: On Arm7, non-volatile long can have unaligned address
+    leading to error
+    + #216: Size of SpscGrowableArrayQueue can exceeds max capacity
+    + #241: Protect the producer index in case of OutOfMemoryError
+    + #244: Long NBHM AssertionError when replacing missing key
+    + Fix argument checks on fill/drain methods
+    + Fix LGTM warning, potential int overflow bug
+  * Enhancements:
+    + #326 Xadd queues consumers can help producers
+    + #323 Update to latest JCStress (thanks @shipilev )
+  * Improvements:
+    + Don't mark generated linked atomic queues as final
+    + #211: Implement batching methods on MpmcArrayQueue
+    + #228: Iterator for MpscArrayQueue and MpscUnboundedArrayQueue
+    + Iterator support also available for the *ArrayQueue classes
+    + #208: MpscLinkedAtomicQueue can be made not final
+    + #237: Add scale to exception message to help debug
+    netty/netty#8916
+  * New features:
+    + #340 MpscBlockingConsumerArrayQueue
+    + After long incubation and following a user request (see #321),
+    we move counters into core
+    + Merging some experimental utils and a #264 we add a
+    'PaddedAtomicLong'
+    + #314 MpscBlockingConsumerArrayQueue::offerIfBelowThreshold is
+    added
+- Added patch:
+  * imports.patch
+    + Fix bug in adding of imports that broke build with
+    javaparser >= 2.15.0
+
jdepend
+- Specify the source/target levels 8 on ant invocation
+- Removed patch:
+  * jdepend-target16.patch
+    + not needed with the source/target levels being specified on
+    command-line
+
+- Update to 2.10:
+  * Official release that includes support for Java 8 constants
+- Updated license from BSD-3 Clause to MIT (as per LICENSE.md file).
+- Fix installed files permissions (were too broad).
+- Fix LICENSE, CHANGES and README permissions.
+- Fix demo permissions (were too broad).
+- Rebased patches:
+  * jdepend-target16.patch
+
-- Adjustments in the spec file.
-
-- Current version 2.6 from JPackage.org
-
jdependency
+- Build with source and target levels 8
+
jdom
+- Security fix: [bsc#1187446, CVE-2021-33813]
+  * XXE issue in SAXBuilder can cause a denial of service via
+    a crafted HTTP request
+- Add jdom-CVE-2021-33813.patch
+- Remove unneeded dependency on glassfish-jaxb-api.
+
+- Build against the standalone JavaEE modules unconditionally
+
+- Modified patch:
+  * jdom-1.1-build.xml.patch
+    + Build with source/target levels 8
+
+- Build against standalone jaxb-api on distributions that have
+  JDK without the JavaEE modules
+
+- Alias the xom artifact to the new com.io7m.xom groupId
+
+- Update jaxen to version 1.1.6
+  * Bug fixes
+
+- Increase java stack size to avoid overflow
+
jdom2
+- Upgrade to 2.0.6.1
+  * Upstream release to fix CVE-2021-33813
+- Removed patch:
+  * jdom2-CVE-2021-33813.patch
+    + integrated upstream
+- Modified patch:
+  * 0001-Adapt-build.patch
+    + rebase to changed context
+
jeos-firstboot
+- Update to version 1.2.0.5:
+  * Support /usr/lib/os-release (#102)
+
+- Don't require wicked nor NetworkManager. Both are optional
+
+- Update to version 1.2.0.4:
+  * Rewrite license code
+
+- Update to version 1.2.0.3:
+  * Don't ask for licence confirmation if not needed
+  * Deduplicate wifi list
+
+- Update to version 1.2.0:
+  * Make use of SPDX identifiers
+  * Read dialog output into a variable directly
+  * Drop broken error handling for dialog
+  * Fix dialog asking about wicked network reconfiguration
+  * Start nmtui in jeos-firstboot if no active connection could be detected
+  * Load network modules dynamically
+  * Only list applicable modules in jeos-config
+  * Convert network configuration to a module
+  * Fix size of the "No root password set" dialog
+
+- Update to version 1.1.1.1:
+  * Quick'n'dirty NetworkManager support
+- Switch git URL to https
+- Require NetworkManager or wicked
+
jettison
+- Upgrade to version 1.5.3
+  * Fixes:
+    + Backslash escaping. Throw syntax exception on invalid json
+    sooner
+    + Adding another test for backslashes
+    + Introducing new static methods to set the recursion depth
+    limit
+    + Incorrect recursion depth check in JSONTokener
+    + Fixing StackOverflow error (bsc#1206400, CVE-2022-45685,
+    bsc#1206401, CVE-2022-45693)
+
+- Upgrade to version 1.5.1
+  * Fixes:
+    + Stack Overflow fix on malformed JSON
+    (bsc#1203515, CVE-2022-40149)
+    + Prevent infinite loop when a /* comment is not terminated
+    (bsc#1203516, CVE-2022-40150)
+- Removed patches:
+  * jettison-1.3.7-jdk10plus.patch
+  * jettison-update-woodstox-version.patch
+    + not needed with current version
+
+- Build with source and target levels 8
+
jetty-minimal
+- Upgrade to version 9.4.48.v20220622
+  * Fixes
+    + #8184 - All suffix globs except first fail to match if path
+    has "." character in prefix section
+    + #8145 - RegexPathSpec backport of optional group name/info
+    lookup if regex fails
+    + #8088 - Add option to configure exitVm on ShutdownMonitor from
+    System properties
+    + #8067 - Wall time usage in DoSFilter RateTracker results in
+    false positive alert
+    + #8014 - Review HttpRequest URI construction (Resolves
+    CVE-2022-2047, bsc#1201317)
+    + #7976 - Add TRANSFER_ENCODING violation for MultiPart RFC7578
+    parser
+    + #7947 - Improved PathSpec handling for servletName & pathInfo
+    + #7935 - Review HTTP/2 error handling (Resolves CVE-2022-2048,
+    bsc#1201316)
+    + #7918 - PathMappings.asPathSpec does not allow root
+    ServletPathSpec
+    + #7863 - Default servlet drops first accept-encoding header if
+    there is more than one.
+    + #7858 - GZipHandler does not play nice with other handlers in
+    HandlerCollection
+    + #7837 - Fix StatisticsHandler in the case a Handler throws
+    exception
+    + #7809 - Jetty 9.4.x 7801 duplicate set session cookies
+    + #7748 - Allow overriding of url-pattern mapping in
+    ServletContextHandler to allow for regex or uri-template
+    matching
+
+- Upgrade to version 9.4.46.v20220328
+  * Changes
+    + Option --write-module-graph produces wrong .dot file
+    + ArrayTrie getBest fails to match the empty string entry in
+    certain cases
+    + Interrupt flag is not always cleared in between requests
+    + Gzip compression not working for multipart/form-data when
+    added to the allowed list using addIncludedMimeTypes.
+    + Miconfigured headerCacheSize in can result in
+    IllegalArgumentException
+    + HttpServletResponse.encodeURL not working for URLs starting
+    with ../
+
+- Build with java source and target levels 8
+- Fix javadoc generation on JDK >= 13
+
+- Make importing of package sun.misc optional since not all jdk
+  versions export it
+
jetty-websocket
+- Upgrade to version 9.4.48.v20220622
+  * Fixes
+    + #8184 - All suffix globs except first fail to match if path
+    has "." character in prefix section
+    + #8145 - RegexPathSpec backport of optional group name/info
+    lookup if regex fails
+    + #8088 - Add option to configure exitVm on ShutdownMonitor from
+    System properties
+    + #8067 - Wall time usage in DoSFilter RateTracker results in
+    false positive alert
+    + #8014 - Review HttpRequest URI construction (Resolves
+    CVE-2022-2047, bsc#1201317)
+    + #7976 - Add TRANSFER_ENCODING violation for MultiPart RFC7578
+    parser
+    + #7947 - Improved PathSpec handling for servletName & pathInfo
+    + #7935 - Review HTTP/2 error handling (Resolves CVE-2022-2048,
+    bsc#1201316)
+    + #7918 - PathMappings.asPathSpec does not allow root
+    ServletPathSpec
+    + #7863 - Default servlet drops first accept-encoding header if
+    there is more than one.
+    + #7858 - GZipHandler does not play nice with other handlers in
+    HandlerCollection
+    + #7837 - Fix StatisticsHandler in the case a Handler throws
+    exception
+    + #7809 - Jetty 9.4.x 7801 duplicate set session cookies
+    + #7748 - Allow overriding of url-pattern mapping in
+    ServletContextHandler to allow for regex or uri-template
+    matching
+
+- Upgrade to version 9.4.46.v20220328
+  * Changes
+    + Option --write-module-graph produces wrong .dot file
+    + ArrayTrie getBest fails to match the empty string entry in
+    certain cases
+    + Interrupt flag is not always cleared in between requests
+    + Gzip compression not working for multipart/form-data when
+    added to the allowed list using addIncludedMimeTypes.
+    + Miconfigured headerCacheSize in can result in
+    IllegalArgumentException
+    + HttpServletResponse.encodeURL not working for URLs starting
+    with ../
+
+- Build with java source and target levels 8
+- Fix javadoc generation on JDK >= 13
+
+- Make importing of package sun.misc optional since not all jdk
+  versions export it
+
jeuclid
+- Build with source and target levels 8
+
+- Updated/rebased patches:
+  - jeuclid-core-FreeHep.patch (updated to use services file)
+  - jeuclid-batik_1_10.patch (rebased)
+  - jeuclid-service-providers.patch (added to prevent wrong
+    typecasting)
+- Update to 3.1.9:
+  - Workaround for NPE in TextLayout()
+  - Support Content Math without namespace
+  - Added Italian Translation
+  - Improved Documentation
+- Update to 3.1.8:
+  - Operator streching now honors symmetric
+  - New extension for horizontal / vertical stretch
+  - Stretchy behaviour is reworked again
+- Update to 3.1.7:
+  - Reworked Token elements to support mglyhp in all cases.
+  - Reworked Stretchy operators.
+  - Fixed an error in mmultiscript containing whitespace.
+  - MathML 3.0 Testsuite is now available on the website.
+  - MathML 3.0 Testsuite can now be run internally.
+  - Basic SWT Widget is now implemented.
+  - Restored functionality to get null value for attributes. Fixes
+    mfence
+  - Better support for foreign elements in JEuclid DOM Tree.
+- Update to 3.1.6:
+  - JEuclidView: add method to get bounds of layouted object.
+  - Provide Win32 MathViewer executable.
+  - Moved Resources from root namespace into net/sf/jeuclid.
+  - Internal DOM Tree is now in the MathML Namespace.
+  - jeuclid-core JAR file is now OSGi compatible.
+  - MathViewer: Add simple editor.
+  - MathViewer: PropertyPage: use optionName rather than toString
+    for consistency with command line App.
+  - Changed internal JEuclid attributes to use optionName rather
+    than toString for consistency with command line App.
+  - FOP: Added support for ImageConverter needed by newer fop.
+- Update to 3.1.5:
+  - Fixed NPE if mo has no parent.
+  - Font-Cache: repaired support for euler fonts.
+  - MathViewer: Add source view.
+  - jeuclid-core: Mouse position detection (presentation mathml).
+  - jeuclid-fop: Workaround for NPE if an image does not exist.
+- Update to 3.1.4:
+  - Added Regression tests for testsuite.
+  - Removed possible NPE in MGlyph handling.
+  - Better support for font styles.
+  - Added support for float sized fonts.
+  - Font-Caching and loading is now all done using lower case.
+  - Declared current branch as stable.
+
-- Cleanup with spec-cleaner a bit.
-- Try to sort out some dependencies to work on SLE11
-
-- Spec file cleanups
-- Mention use of LGPL-2.1 licensing for the FreeHEP component;
-  also package the LICENSE.FreeHEP from the source tarball.
-
jffi
+- Update to v1.3.10
+
+- Update to v1.3.9
+- Update patch jffi-fix-system-ffi.patch
+- Remove obsolete %pom_xpath_remove
+- Remove "case FFI_BAD_ARGTYPE:" from jni/jffi/CallContext.c because
+  FFI_BAD_ARGTYPE constant is not defined in /usr/include/ffi.h
+
+- Fix build with maven-antrun-plugin >= 3.0.0
+
+- Update to v1.3.4
+- Remove obsolete patch jffi-1.2.12-no_javah.patch
+- Disable patch jffi-fix-compilation-flags.patch due to test
+  errors during %check phase
+- Wipe obsolete stuff out from the spec file
+
jflex
+- Build against the standalone JavaEE modules unconditionally
+
+- Build against standalone glassfish-annotation-api for relevant
+  distribution versions that have JDK that does not contain the
+  JavaEE modules
+
+- Upgrade to version 1.8.2
+  * fix build with recent java-cup
+- Build the bootstrap package using ant with a generated build.xml
+- Build the non-bootstrap package using maven, since its dependency
+  auto is already built with maven
+- Added patch:
+  * jflex-1.8.2-no-auto-value.patch
+    + do not process auto-value-annotations in bootstrap build
+    + the generated file is pre-generated outside build for this
+    variant
+- Removed patches:
+  * jflex-byaccj-utl.patch
+  * jflex-classpath.patch
+  * jflex-javac-no-target.patch
+  * jflex-junit4.patch
+  * jflex-no-cup-no-jflex.patch
+    + not needed in this version
+
-- fix build with antlr-bootstrap
-
-- Removed a jflex-lex-scan.patch
-
-- Update to 1.4.3 (bugfix release)
-- Build using java-1_5_0-gcj to allow openjdk bootstrap
-- Recreated jflex-lex-scan.patch
-
-- Initial packaging of jflex-bootstrap 1.4.2 in SUSE (from jpp5)
-
jformatstring
+- Build with source and target levels 8
+
-- initial package
-
jgroups
+- Build with java source and target levels 8
+
+- Do not build against the log4j12 packages, use the new reload4j
+
-- Move from jpackage-utils to javapackage-tools
-
-- fixed bnc#509439: used svn snapshot of documentation under CC license
-
jhighlight
+- Build with java source and target levels 8
+
jing-trang
+- Added patch:
+  * old-saxon.patch
+    + Avoid building old saxon validator in order to avoid
+    dependency on old saxon6
+
+- Do not use xmvn-tools, since this is a ring package
+- Added patch:
+  * no-tests.patch
+    + avoid unnecessary dependency on testng
+
+- Update to v20181222
+- Package maven metadata
+- Use testng in build process
+- Remove unneeded patches:
+  * jing-trang-20091111-datatype-sample.patch
+  * jing-trang-20151127-notestng.patch
+- Modified patch:
+  * 0001-Various-build-fixes.patch -> 0000-Various-build-fixes.patch
+
-- used saxon9 for build and as a dependency (bnc#780666)
-
-- Improved jing script: use now jpackage-utils, added
-  xml-commons-resolver to better support catalogs
-- Adapted requires and buildrequires in spec file
-- Updated documentation
-  * explained -C and -s options, removed obsolete -f
-  * updated version
-
-- updated to 20091111
-  * add -C option to specify the catalog
-  * fix schematron test suite schema
-  * provide a resolver that implements OASIS XML catalogs
-  * take advantage of Java 5 features
-
jitterentropy
+- jitterentropy-with-debug.patch: build with debuginfo (bsc#1207789)
+
jline
+  * jline-jansi2.patch
+    + fix jline build against jansi 2.4.x
+- Remove dependency on jansi-native and hawtjni-runtime
+
+- Build with source and target levels 8
+
+- Added patch:
-- use new add_maven_depmap from javapackages-utils
-
-- add findutils dependency (bnc#816314)
-
jline1
+- Build with source/target levels 8
+
-- Build using gcj - needed by rhino 1.7R2 - bnc#554532
-
jna
+- Build with java source/target levels 8
+
+- %{suffix} is an rpm internal macro that extracts a suffix
+  (extension) from a filename. With RPM 4.16, it verifies that a
+  filename is passed (e.g. %{suffix:filename.spec}); earlier
+  versions returned "", meaning we can just strip it from the
+  install command, as we rely on an empty return value.
+
+- Upgrade to 5.5.0
+  * Features
+    + Add CoreFoundation, IOKit, and DiskArbitration mappings in
+    c.s.j.p.mac.
+    + c.s.j.p.mac.SystemB now extends c.s.j.p.unix.LibCAPI.
+    + Add additional OSGi headers for the JNA bundle to support
+    32bit ARM (hardfloat)
+    + Include Win32 COM utils (c.s.j.p.win32.com.util and
+    c.s.j.p.win32.com.annotation) in OSGI bundle
+  * Bug Fixes
+    + Fix signature for c.s.j.p.win32.Kernel32#CreateRemoteThread
+    and bind VirtualAllocEx, VirtualFreeEx, GetExitCodeThread in
+    c.s.j.p.win32.Kernel32
+    + Windows needs a wide string in
+    c.s.j.p.win32.COM.IShellFolder#ParseDisplayName
+    + KEY_ALL_ACCESS value is incorrect in c.s.j.p.win32.WinNT.java
+    + Ensure JARs created from the build system don't contain
+    invalid Info-ZIP Unicode Path extra info
+    + Read correct member of
+    WinBase.SYSTEM_INFO.processorArchitecture union
+    + Fix passing unions containing integer and floating point
+    members as parameters by value
+- Modified patch:
+  * jna-build.patch
+    + rediff to the changed context
+    + disable warnings as errors
+    + fix build on ppc64 and s390x
+
joda-convert
+- Build with java source and target levels 8
+
+- Do not use the legacy guava20 any more
+
joda-time
+- Build with java source and target levels 8
+
-- New upstream version (1.6).
-
jsch
+- Modified patch:
+  * jsch-0.1.54-sourcetarget.patch
+    + build with source/target levels 8
+
-- Move from jpackage-utils to javapackage-tools
-
jsch-agent-proxy
+- Build with source and target levels 1.8
+
json-c
+- Add patch bsc1171479.patch
+  + fix integer overflow and out-of-bounds write (CVE-2020-12762, bsc#1171479)
+
+- json-c 0.13
+  + Deprecated and removed features:
+  * Internal use of bits.h has been eliminated.
+  * lh_abort() is deprecated
+  + Behavior changes:
+  * Tighten the number parsing algorithm to raise errors instead
+    of truncating the results.  For example 12.3.4 or 2015-01-15,
+    which now return null.
+  * Use size_t for array length and size. Platforms where
+    sizeof(size_t) != sizeof(int) may not be backwards compatible
+  * Check for failue when allocating memory, returning NULL and
+    errno=ENOMEM.
+  * Change json_object_object_add() return type from void to int,
+    and will return -1 on failures, instead of exiting. (Note:
+    this is not an ABI change)
+  + New features:
+  * Aiming to follow RFC 7159 now.
+  * Support for JSON pointer, RFC 6901 (see json_pointer.h)
+  * Add a couple of additional option to json_object_to_json_string_ext:
+  JSON_C_TO_STRING_PRETTY_TAB
+  JSON_C_TO_STRING_NOSLASHESCAPE
+  * json_object_object_add_ex() - better perf when certain
+    constraints are known to be true
+  * Serialization format of doubles now configurable
+  * New functions
+  - json_object_equal() - utility function for comparing
+    json_objects
+  - json_object_deep_copy() - a way to copy entire object
+    trees
+  - json_object_set_<type>() - modify the value of
+    existing json_object's without the need to recreate them.
+  Also add a json_object_int_inc function to adjust an int's'
+  value.
+  - json_util_get_last_err() - retrieve the string describing
+    the cause of errors, instead of printing to stderr.
+  - perllike hash function for strings
+  * json_global_set_string_hash()
+  * json_c_visit() - a way to iterate over a tree of json-c
+    objects.
+  + Notable bug fixes and other improvements:
+  * Make reference increment and decrement atomic to allow
+    passing json objects between threads.
+  * Fix json_object_object_foreach to avoid uninitialized
+    variable warnings.
+  * Improve performance by removing unneeded data items from
+    hashtable code and reducing duplicate hash computation.
+  * Performance: store small strings inside json_object
+  * Performance: of json_object_to_json_string by removing
+    variadic printf
+  * Fix parsing of "-Infinity", and avoid needlessly copying the
+    input when doing so.
+  * Fix stack buffer overflow in json_object_double_to_json_string_format()
+  * Fix various potential null ptr deref and int32 overflows
+  * Fix a long-standing bug in array_list_put_idx() where it
+    would attempt to free previously free'd entries due to not
+    checking the current array length.
+  * use uselocale() instead of setlocale() in json_tokener to
+    behave better in threaded environments.
+  * Fix out of bounds read when handling unicode surrogate pairs.
+  * Ensure doubles that happen to be a whole number are emitted
+    with ".0"
+  * Visual Studio: use a snprintf/vsnprintf wrapper that ensures
+    the string is terminated.
+  * Fix double to int cast overflow in json_object_get_int64.
+  * Clamp double to int32 when narrowing in json_object_get_int.
+  * Use strtoll() to parse ints - instead of sscanf
+  * usual code linting
+  + Build changes:
+  * Add Appveyor and Travis build support
+  * Support for MacOS and Windows through CMake
+  * Silent build by default
+  * Link against libm when needed
+  * Add support for building with AddressSanitizer
+  * Add support for building with Clang
+  * Add a --enable-threading configure option, and only use the
+    (slower) __sync_add_and_fetch()/__sync_sub_and_fetch()
+    function when it is specified.
+- cleanup with spec-cleaner
+- remove fix-set-but-not-used.patch
+  + fixed: https://github.com/json-c/json-c/issues/240
+- remove gcc7-fix.patch
+  + fixed in 014924ba899f659917bb64392bbff7d3c803afc2
+
+- Added gcc7-fix.patch
+
+- Update to upstream release 0.12.1
+- Removed upstream fixed json-c-0.12-unused_variable_size.patch
+- Added fix-set-but-not-used.patch
+
+- json-c 0.12
+  Fixes for security issues contained in this release have been
+  previously patched into this package, but listed for completeness:
+  * Address security issues:
+  * CVE-2013-6371: hash collision denial of service
+  * CVE-2013-6370: buffer overflow if size_t is larger than int
+- Further changes:
+  * Avoid potential overflow in json_object_get_double
+  * Eliminate the mc_abort() function and MC_ABORT macro.
+  * Make the json_tokener_errors array local.  It has been deprecated for
+    a while, and json_tokener_error_desc() should be used instead.
+  * change the floating point output format to %.17g so values with
+    more than 6 digits show up in the output.
+  * Remove the old libjson.so name compatibility support.  The library is
+    only created as libjson-c.so now and headers are only installed
+    into the ${prefix}/json-c directory.
+  * When supported by the linker, add the -Bsymbolic-functions flag.
+  * Make strict mode more strict:
+  * number must not start with 0
+  * no single-quote strings
+  * no comments
+  * trailing char not allowed
+  * only allow lowercase literals
+  * Added a json_object_new_double_s() convenience function to allow
+    an exact string representation of a double to be specified when
+    creating the object and use it in json_tokener_parse_ex() so
+    a re-serialized object more exactly matches the input.
+  * Add support NaN and Infinity
+- packaging changes:
+  * json-c-hash-dos-and-overflow-random-seed-4e.patch is upstream
+  * Move from json-c-lfs.patch which removed warning errors and
+    autoconf call to json-c-0.12-unused_variable_size.patch from
+    upstream which fixes the warning
+  * except for SLE 11 where autoreconf call is required
+  * add licence file to main package
+
+- Add json-c-hash-dos-and-overflow-random-seed-4e.patch to fix
+  CVE-2013-6370 and CVE-2013-6371 (bnc#870147)
+
+- Update metadata (description, RPM groups), and remove .la file
+  in %install, not %check.
+
+- Upgrade to 0.11 version:
+  - SONAME change.
+  - Fix provides and obsoletes accordingly
+  - symlink the .pc file to the oldname for software that needs it
+- Remove json-c-fix-headers.patch integrated upstream
+
+- add json-c-fix-headers.patch from master branch to fix compilation
+  of apps using the lib
+
+- Update to 0.10 version :
+  * Add a json_object_to_json_string_ext() function to allow output
+  to be formatted in a more human readable form.
+  * Add json_object_object_get_ex(), a NULL-safe get object method,
+  to be able to distinguish between a key not present and the value
+  being NULL.
+  * Add an alternative iterator implementation, see json_object_iterator.h
+  * Make json_object_iter public to enable external use of the
+    json_object_object_foreachC macro.
+  * Add a printbuf_memset() function to provide an effecient way to set and
+    append things like whitespace indentation.
+  * Adjust json_object_is_type and json_object_get_type so they return
+    json_type_null for NULL objects and handle NULL passed to
+    json_objct_object_get().
+  * Rename boolean type to json_bool.
+  * Fix various compile issues for Visual Studio and MinGW.
+  * Allow json_tokener_parse_ex() to be re-used to parse multiple object.
+    Also, fix some parsing issues with capitalized hexadecimal numbers and
+    number in E notation.
+  * Add json_tokener_get_error() and json_tokener_error_desc() to better
+    encapsulate the process of retrieving errors while parsing.
+  * Various improvements to the documentation of many functions.
+  * Add new json_object_array_sort() function.
+  * Fix a bug in json_object_get_int(), which would incorrectly return 0
+    when called on a string type object.
+    Eric Haszlakiewicz
+  * Add a json_type_to_name() function.
+    Eric Haszlakiewicz
+  * Add a json_tokener_parse_verbose() function.
+    Jehiah Czebotar
+  * Improve support for null bytes within JSON strings.
+    Jehiah Czebotar
+  * Fix file descriptor leak if memory allocation fails in json_util
+    Zachary Blair, zack_blair at hotmail dot com
+  * Add int64 support. Two new functions json_object_net_int64 and
+    json_object_get_int64. Binary compatibility preserved.
+    Eric Haszlakiewicz, EHASZLA at transunion com
+    Rui Miguel Silva Seabra, rms at 1407 dot org
+  * Fix subtle bug in linkhash where lookup could hang after all slots
+    were filled then successively freed.
+    Spotted by Jean-Marc Naud, j dash m at newtraxtech dot com
+  * Make json_object_from_file take const char *filename
+    Spotted by Vikram Raj V, vsagar at attinteractive dot com
+  * Add handling of surrogate pairs (json_tokener.c, test4.c, Makefile.am)
+    Brent Miller, bdmiller at yahoo dash inc dot com
+  * Correction to comment describing printbuf_memappend in printbuf.h
+    Brent Miller, bdmiller at yahoo dash inc dot com
+- Packaging :
+  * upgrade upstream location https://gitub.com/json-c/json-c/wiki
+  * cleanup old patches included now upstream
+  . json-c-0.9-linkhash.patch
+  . json-c-0.9-json_tokener.patch
+  . json-c-0.9-json_object_from_file.patch
+  . json-c-0.9-base.patch
+  * Redone lfs patch against new 0.10 release
+  * Removed empty NEWS file
+
json-lib
+- Modified patch:
+  * json-lib-2.4-antrun-plugin.patch
+    + specify source and target levels 8 for maven-antrun-plugin
+    and for groovyc ant task
+- Add opens of java.lang from java.base module to all unnamed
+  * fixes build with jdk17
+
+- Do not depend on the old asm3
+- Build with source and target levels 8
+
+- Do not build against the log4j12 packages
+
jsonp
+- Build with java source and target levels 8
+
+- Build against standalone annotation api
+
jsr-311
+- Build with java source and target levels 8
+
jtidy
+- Build with java source and target levels 8
+- Rewamp and simplify the build system
+
juk
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * CI: Use modern CI tooling
+  * Port service menu to new install location
+  * Remove bogus kitemmodels dependency
+  * Port deprecated use of KLineEdit for password to KPasswordLineEdit.
+  * Remove unneeded use of deprecated KDirList auto-error handling.
+
junit
+- Build with source/target levels 8
+
+- update to 4.13.2:
+  * Mark ThreadGroups created by FailOnTimeout as daemon groups
+  * Only create ThreadGroups if FailOnTimeout.lookForStuckThread is true.
+  * Fix NotSerializableException with AssumptionViolatedException
+  * Security fix: TemporaryFolder now limits access to temporary folders on
+    Java 1.7 or later (CVE-2020-1945, bsc#1171696)
+  * Make FrameworkField constructor public
+
+- Upgrade to 4.13
+- Removed patches:
+  * junit-jdk10.patch
+  * junit-jdk11.patch
+    + not needed with this version
+
junit5
+- Update to upstream version 5.8.2
+  * Fixes:
+    + Text blocks in @CsvSource are treated like CSV files
+    + CSV headers in display names for @CsvSource and
+    @CsvFileSource
+    + Custom quote character support in @CsvSource and
+    @CsvFileSource
+    + Support for text blocks in @CsvSource
+    + Java 18 support in the JRE enum
+    + Access to the ExecutionMode in the ExtensionContext
+    + Declarative test suites via @Suite classes
+    + LauncherSession and accompanying listener
+    + New UniqueIdTrackingListener
+    + More fine-grained Java Flight Recorder events
+    + Java Flight Recorder support on Java 8 Update 262 or
+    higher
+    + Test class ordering
+    + @TempDir can be used to create multiple temporary
+    directories
+    + Extension registration via @ExtendWith on fields and
+    parameters
+    + Auto-close support for arguments in @ParameterizedTest
+    methods
+- Fix the classpath of console application so that it actually
+  works
+
+- Package also the bill-of-materials pom
+
jzlib
+- Build with java source and target levels 8
+
-- fixed bnc#536215: remove share/jzlib ghost symlink to allow
-  smooth transition from older Packman package
-
k3b
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Drop patch. Fixed upstream:
+  * 0001-remove-unnecessary-and-incorrect-version-check.patch
+
+- Add patch to fix knewstuff install location:
+  * 0001-remove-unnecessary-and-incorrect-version-check.patch
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Remove ffmpeg decoder plugin
+  * Eliminate duplication of character replacement in k3bpatternparser
+  * Fix path traversal in Album Artist field for CD ripping
+  * Add CI
+  * Replace GHNS button with KNS3 class
+  * Define X-KDE-ConfigModule for KCMs
+
kaccounts-integration
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Port to ecm_add_qml_module
+  * Use the executable for intltool once it is found.
+  * Add form factors to embedded json metadata
+  * Add compile_commands.json to gitignore
+  * Fix BUG 407048 add a specific preferences icon which
+    contain KCM icons (kde#407048)
+
kaccounts-providers
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Set input method hint for URL text fields
+  * Add GitLab CI
+
kactivities-stats
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+  * Clean up unneeded Q_COMPILER_INITIALIZER_LISTS checks
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Bump deprecation KF version in ecm_set_disabled_deprecation_versions
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * port to standard C++ smart pointers where possible
+  * Fix clazy warnings, add missing Q_EMIT, add std::move for terms
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Make replace to not block because of missing item removal
+  * Add ResultModel::forgetResources method
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- No code change since 5.92.0
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Move Boost dependency to BUILD_TESTING block
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add Linux Qt6 CI
+  * Utilize ECMDeprecationSettings to manage deprecate Qt/KF API
+  * reduce boost
+
kactivities5
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Disable tests that require X11 on non X11 platforms
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Port away from deprecated KWindowSystem API
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Utilize std::optional instead of custom impl
+  * Remove debug message for Consumer destructor
+  * Do not enable debug output for debug QT builds
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Bump deprecation KF version in ecm_set_disabled_deprecation_versions
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * removed unused include
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- No code change since 5.92.0
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Check executables exist in PATH before passing them to QProcess
+  * Port to ecm_add_qml_module
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Use uppercase includes
+  * Unharcode Qt major version
+  * Add CI qt6 support
+  * Utilize ECMDeprecationSettings to manage deprecate Qt/KF API
+
kactivitymanagerd
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * Not use forward and includes
+  * Use ecm_set_disabled_deprecation_versions
+  * Port away from deprecated KWindowSystem API
+  * Remove unused includes
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- No code changes since 5.25.90
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Add FreeBSD Qt6 CI support
+  * Add missing license file
+  * Remove service type definition
+  * Defer session startup until KAMD is up
+  * virtualdesktopswitch improve readability
+  * Remove KAMD_EXPORT_PLUGIN macro in favor of K_PLUGIN_CLASS_WITH_JSON
+  * Request passing unit tests on Linux and BSD
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- No code changes since 5.24.90
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Changes since 5.24.5:
+  * Remove dependency on Boost.Container
+  * Add unistd.h include for sleep()
+  * Fix XML parser porting regression
+  * Add Qt6 CI
+  * Don't advertise debug stream operator publicly if we don't export it
+  * Port to KApplicationTrader
+  * Port to QXmlStreamReader
+  * Fix some compile errors against qt6
+  * Fix DBus service name registration
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
kaddressbook
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Const'ify pointer
+  * const'ify more pointer
+  * const'ify pointer
+  * It compiles fine without deprecated method
+  * Fix AkonadiSearch include path
+  * Use KDE_INSTALL_KSERVICESDIR
+  * Use QListIterator in qt6
+  * Use new akonadi calendar install include
+  * It's removed in qt6
+  * Fix includes
+  * Adapt build system for building against qt6
+  * Use SingleMainWindow=true
+  * Mark as single-instance using X-GNOME-SingleWindow key
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
kaffeine
+- Spec cleanup
+
kajongg
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes to list here.
+
kalarm
+- Add %ldconfig_scriptlets macro
+
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * Fix deletion of events with reminders after the main event (kde#440200)
+  * Fix events with reminder alarms not triggering (kde#440200)
+
+- Replace %_libdir/libexec with %_libexecdir (boo#1174075)
+
kalgebra
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Prepare to build against qt6
+  * Use Q_EMIT
+  * Add content rating tag
+  * Add Linux/FreeBSD CI
+
kalzium
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Remove uncompiled plasmoid and qml files
+  * Fix warnings when opening the isotope viewer
+  * Improve the Isotope Table (kde#415736)
+  * const'ify + don't use const'ref for int
+  * Use not deprecated enum
+  * Use for(...:...) + const
+  * Port to for(...:...) + use nullptr
+  * Fix indent
+  * Add parent
+  * Const'ify method
+  * It's enabled by default in qt6
+  * Add CMakePreset support
+  * It's unused
+  * Remove commented line
+  * Remove unused pointer
+  * Use more debug categories
+  * Add debug categories
+  * Use Q_SLOTS
+  * Show headers in qt6
+  * Use Q_EMIT
+  * Use c++17
+  * add freebsd CI
+
kamera
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * build: Pass release service version to project()
+  * Use new macro ecm_set_disabled_deprecation_versions
+  * Modernize code
+  * Use forward declaration
+  * exec key is not usefull now
+  * install kio plugin in kf<version>
+  * Make it compile against qt6
+  * Make doctool as optional
+  * remove unused flag
+  * Convert KCM Desktop files to JSON & install KCM in new namespace
+  * Add GitLab CI
+
kamoso
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * icon: Add 128x128px icon
+  * appdata: Add content rating (OARS)
+  * Add CI
+  * update objectIdFromProperties, fallback to device.path
+    when object.id is empty str
+
kanagram
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Allow to compile against qt6
+  * Fix libkeduvocdocument entry in .kde-ci.yml
+  * Replace GHNS button with KNS3 instance
+  * Remove not necessary I18N_NOOP
+
kapidox
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * add -u to ensure all variables are defined when used
+  * update dependencies and add a script to automate this.
+  * upgrade dependencies
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Update CMakeLists.txt - The majority of frameworks use KF_VERSION to indicate current version.
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * remove link to Other KDE Software
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- No code change since 5.97.0
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Improve getting started docs
+- Add patch to fix installation:
+  * 0001-Fix-broken-installation.patch
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * only bootstrap when explicitly asked for
+  * General code style cleanup
+  * Add a dummy install part to cmake
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * add cmake file for standardised build
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * modify kapidox for docker deployment
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- No code change since 5.90.0
+
kapman
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Port to QStringView when we build against qt6
+  * Adapt build system for allowing to build against qt6
+  * Migration code will be removed in qt6 + AA_UseHighDpiPixmaps
+    is enabled by default in qt6
+  * If you want git blame to ignore formatting revisions,
+    run: git config blame.ignoreRevsFile .git-blame-ignore-revs
+
kapptemplate
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
karchive
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * Limit size of file to be added by what the tar header supports
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kate
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+- Drop patch, merged upstream:
+  * 0001-Fix-settings-saving-regression-in-CTags-plugin.patch
+
+- Add patch to fix the save button in the ctags configuration
+  (kde#463993, boo#1206984):
+  * 0001-Fix-settings-saving-regression-in-CTags-plugin.patch
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+- Rebase 0001-Defuse-root-block.patch
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * show documents as loaded from config (kde#353373)
+  * ensure some proper initial size (kde#450686)
+  * make config dialog scrollable (kde#445541)
+  * Handle SIGINT/SIGTERM to prevent accidental data loss (kde#445016)
+  * Fix crash when closing multiple tabs if limited number of tabs is enabled (kde#450873)
+  * Sort by url instead of comparing strings (kde#435334)
+  * Fix tab jumping with unlimited tabs (kde#440585, kde#435780)
+  * Fix LRU tab behaviour (kde#434062)
+  * S&R: Fix Look-ahead & behind highlighting & replace (kde#449545)
+  * Fix stashing not working when Kate is quit using Ctrl+Q (kde#449229)
+  * lspclient: also support some alternative WorkspaceEdit replies (kde#447640)
+  * Allow DND of tabs among viewspaces (kde#426768)
+  * Dont bring kate to front when files externally modified (kde#353712)
+  * Fix the check to also handle 0 doc views (kde#448847)
+  * Improve views closing in split view behaviour (kde#344374)
+  * Fix terminal focus action text when focusing/defocusing (kde#409813)
+  * step down warning level when LSP not found (kde#448549)
+  * filetree: Fix folders collapse after opening new file (kde#410143)
+  * Clear highlights if text field becomes empty (kde#436674)
+  * lspclient: only allow symbol view header toggle sort when applicable (kde#447653)
+  * Search: Utilize context lengths more efficiently (kde#438094)
+  * Fix search for unsaved files (kde#434287)
+  * Ignore rename if newName == oldName (kde#447951)
+  * SemanticTokens: Use size_t as argument for type (kde#447553)
+  * GDB: Use debug-run theme icon in stead of custom icon (kde#444670)
+  * do nothing if use canceled project open (kde#447194)
+  * fix sessions segfault because of invalid iterator (kde#446863)
+  * enable/disable project actions (kde#445494)
+- Use GCC 10 for building kate on Leap 15.
+
katomic
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Revert
+  * Adapt build system for building against qt6
+  * Remove duplicate lib
+  * Make doctool as optional
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+  * Compile fine without deprecated methods
+
kauth
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * Fix polkit-qt-1 CI dep
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Fix polkit package name in CMake config (kde#463402)
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kbackup
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add qt6 CI support
+  * It's enabled by default in qt6
+  * Adapt build system for building against qt6
+  * Fix compile error against qt6
+  * It seems that in qt6 connect signal/slot doesn't work correctly
+  * Remove unused includes
+  * Add GitLab CI
+
kblackbox
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Kdelibs4ConfigMigrator was removed in qt6
+  * Adapt build system for building against qt6
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+  * Add missing override
+
kblocks
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Use new KDE_INSTALL_KXMLGUIDIR
+  * Fix some qt6 compile error
+  * Adapt build system for building against qt6. Need to adapt code
+    as it still uses against kdegame private api
+  * Migration code will be removed in qt6 + AA_UseHighDpiPixmaps
+    is enabled by default in qt6
+  * It's already defined in ecm
+
kbookmarks
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kbounce
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Kdelibs4ConfigMigrator was removed in qt6
+  * Adapt build system for building against qt6
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+
kbreakout
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add content rating
+  * Kdelibs4ConfigMigrator was removed in qt6
+  * Adapt build system for building against qt6
+  * Migration code will be removed in qt6
+    + AA_UseHighDpiPixmaps is enabled by default in qt6
+
kbruch
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * It will be removed in qt6
+  * Add missing find package for coreaddons
+  * Fix qt6 support
+  * IT's enabled by default in qt6
+  * Make DocTool as optional
+
kcachegrind
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Make qcgmain.cpp use the KDE org instead
+  * Fix QCG Mac bundle ID in qmake project
+  * Add CI
+  * Fix hang in line-break algorithm (kde#428917)
+
kcalc
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * Workaround for minimum size not being kept when
+    deactivating constants (kde#448760)
+  * Implemented button text scaling on resize (kde#441986)
+
kcalendarcore
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * Add Qt6 windows CI support
+  * .gitlab-ci.yml: enable static builds
+  * Use dtStart as the default for dtRecurrence
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Ensure that status values are valid
+  * Fix building with deprecated API disabled
+  * Add FreeBSD Qt6 CI support
+  * Fix nesting of update()/updated() calls
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Deprecate deletion tracking support in CalFormat::fromString
+  * Add plugin loader for KCalendarCore::CalendarPlugin
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Don't drop custom properties with non-text value types
+  * Add calendar loading state property
+  * Fix UTC offset timezone loading with latest Qt 5.15.x
+  * Change the xCalFormat classes to use a hierarchical dptr
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * Make the Calendar::accessMode property actually accessible from QML
+  * Don't heap allocate ICalFormatImpl in ICalFormat::Private
+  * Remove unnecessary and largely unused d pointers in the Compat* classes
+  * Remove ICalFormatImpl d pointer and vtable
+  * Don't remove the hasGeo property for Qt6, just make it read-only
+  * Change Calendar::sortX() methods to work in-place
+  * Initialize all fields in a default constructed Attendee object
+  * Add Duration <-> iCal string conversion methods to ICalFormat
+  * Deprecate largely unused rawEventsForDate overload
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Create UIDs if necessary (kde#339726)
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Notify on notebook change for exceptions.
+  * Note use of low-level libical function
+  * Print more information about errors when loading vCalendars
+  * Implement notebook association when parsing iCal data.
+  * Correct a comment
+  * Fix storing of times with UTC offsets
+  * Second attempt to make testTodoCompletedOnce work all year
+  * Revert "Don't use the current date for recurring todo completion test"
+  * Compare QDateTime times, timespecs, and timezones
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Compare timeSpecs when comparing incidences for equality
+  * Add Qt6 Android CI
+  * Preserve timeSpec of all-day event's dtEnd
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Don't use the current date for recurring todo completion test
+  * Revert "Honour STATUS:CANCELLED"
+  * Serialize container sizes as 32bit integers
+  * Compare timeSpec() for the due date/time, too
+  * Set the local timezone in testevent
+  * Fix geo coordinate unit test without deprecated API
+  * Fix generate pkg file
+  * Add CI qt6 support
+  * Remove FreeBusyPrivate::q
+  * Remove TodoPrivate::q
+  * T12270: create an inheritance hierarchy of private types
+
kcalutils
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Don't hardcode the grantlee short version.
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+- Drop 0001-Fix-Bug-452480-Kmail-doesn-t-display-calendar-invite.patch.
+  Merged upstream.
+
+- Add upstream change to fix calendar invitations (kde#452480):
+  * 0001-Fix-Bug-452480-Kmail-doesn-t-display-calendar-invite.patch
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix compile without deprecated method
+  * Port to QRegularExpression
+  * Use QRegularExpression
+  * Port to KTextTemplate
+  * Prepare to use KTextTemplate
+  * Fix install in upper case directory name
+  * Install *_version.h in KF5/<module>
+  * Adapt build system for building against qt6
+  * Correct prefix to other PIM repositories in .kde-ci.yml
+
kcharselect
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI qt6 support
+  * Make it compile against qt6
+  * It will be unused in qt6
+  * Use nullptr here
+  * Remove unused includes
+
kcm_sddm
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * Add missing break statement to switch-case
+  * Smooth wallpaper preview image
+  * Re-add drop shadow to wallpaper image
+  * Remove unnecessary multiplication by Screen.devicePixelRatio
+  * Use ecm_set_disabled_deprecation_versions
+  * Install po folder
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * Install po folder
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Remove unnecessary property that's now only used once
+  * Cache the DropShadow for better responsiveness
+  * Move preview image's DropShadow into a layer effect
+  * Fix preview image sizing
+  * Add FreeBSD Qt6 CI support
+  * Remove no longer needed ifdefs
+  * Fix currentIndex for auto-login user and session comboboxes (kde#454528)
+  * Remove unneeded KAboutData
+  * Clarify enable or disable Apply button on save (kde#437423)
+  * Avoid install prefix in config path lookup (kde#440564)
+  * Mark error messages for translation
+  * Fix translating error messages from helper (kde#441726)
+  * Remove obsolete PKGBUILD file
+  * KMessageBox::sorry is deprecated in kf5.97
+  * Port to KCM desktop file generation method from kcmutils
+  * Request passing unit tests on Linux and BSD
+  * Only show delete button for themes that were manually or through KNS installed (kde#454874)
+  * Fix broken connect in NewStuff.Action QML component usage (kde#454884)
+  * Clear cache when syncing (kde#440957)
+  * Re-enable apply button on save failure (kde#429348)
+  * Avoid empty error box (kde#413032)
+- Refresh 0001-Support-default.session-symlink.patch
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- Changes since 5.25.0:
+  * Only show delete button for themes that were manually or through KNS installed (kde#454874)
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- Changes since 5.24.90:
+  * Fix broken connect in NewStuff.Action QML component usage (kde#454884)
+  * Clear cache when syncing (kde#440957)
+  * Re-enable apply button on save failure (kde#429348)
+  * Avoid empty error box (kde#413032)
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Changes since 5.24.5:
+  * Make the Halt and Reboot Commands' text fields editable
+  * Add Qt6 CI support
+  * Add support for new kauth includes
+  * Allow to build against qt6
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
kcmutils
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Remove unused KPluginInfo includes
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add Qt6 windows CI support
+  * Remove space
+  * Fix typo
+  * Kauth doesn't build on windows
+  * KCModuleQML: Make sizeHint() check more robust
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * Fix missing kcmutils_proxy_model export in static builds (kde#459123)
+  * Launch KCMs that are not part of systemsettings in kcmshell5 (kde#458975)
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+  * Use a CMake option() for the TOOLS_ONLY flag
+  * KPluginSelector: Remove unnecessary background rect in About sheet (kde#457648)
+  * Set Type=Application for generated KCM desktop file (kde#457673)
+  * kcmoduleqml: don't unnecessarily set setContentsMargins twice
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * follow symlinks for search of .desktop files
+  * tools/kcmmetadatagenerator: Print out critical warning if file could not be opened
+  * Make CMake import target of kcmdesktopfilegenerator relocatable
+  * Add utility cmake method to generate KCM metadata desktop files
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Remove duplicate header between cpp/h files
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * KPluginDelegate: reserve space for subtitle
+  * KPluginSelector: animate placeholder appearance
+  * KPluginSelector: Don't show placeholder message immediately upon load
+  * KPluginSelector: fix placeholder location
+  * Add debug output to print KCM location
+  * AboutPlugin.qml: Do not use translation function when we only have one value
+  * [kcmultidialog] Fix crash in clear()
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Fix filtering of plugin in KPluginWidget
+  * Check executables exist in PATH before passing them to QProcess
+  * KPluginModel: Add method to get KPluginMetaData config object for given plugin id
+  * Add missing includes
+  * Add SPDX headers for KPluginProxyModel files
+  * Download missing licenses
+  * Add docs for QML components
+  * KPluginDelegate: Add configTriggered signal
+  * Refactor QML components of MPluginSelector to have less dependencies and have better layout
+  * KPluginModel: Add isSaveNeededChanged signal
+  * Import AboutPlugin dialog from QML
+  * Expose proxy sort model as private QML API
+  * Create QML version of KPluginSelector
+  * Allow consumers to get sort proxy model
+  * Export the KPluginModel class & make it usable from QML
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Require unittests to pass for CI pipelines to pass
+  * Fix KPluginSelector KCMs missing their metadata on plugin
+    loading (kde#444378)
+  * Mark Windows and macOS as supported
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add KPluginWidget::load()
+  * Remove assertion for KPluginMetaData param in KCModuleLoader::loadModule
+  * KCModuleProxy: Use std::optional to check if we have a KPluginMetaData object
+  * Add CI qt6 support
+  * Utilize ECMDeprecationSettings to manage deprecate Qt/KF API
+  * KCModuleProxy: Replace space with underscore when registering DBus service
+  * Switch header style to ToolBar for system settings
+  * kpluginmodel: Also copy plugin Id from KService to json object
+  * KCMUtils can be built on Windows too
+
kcodecs
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * Remove winsami2 from codecs list
+  * Replace jis7 with ISO-2022-JP in offered codecs
+  * Fix name for CP 949 in KCharsets::encodingsByScript
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Add missing license header
+  * Port away from own deprecated API
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Fix KCharset::codecForName deprecation version
+  * deprecate QTextCodec public api
+
kcolorchooser
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add content rating tag in appdata
+  * Add qt6 CI support
+  * Make it compile against qt6
+  * It's enabled by default in qt6
+  * Not neccessary to use I18N_NOOP here
+
kcompletion
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kconfig
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * kconf_update: use standard exit status code
+  * kconf_update: use CMAKE_INSTALL_FULL_LIBDIR
+  * KCoreConfigSkeleton::ItemEnum::Choice2: add deprecation warning markup
+  * KCoreConfigSkeleton::ItemEnum::choices2(): add deprecation markup
+  * Android: Fix a bug where new file wouldn't be created
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * fix safety issue of multiple threads use KConfig in the same process
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Apply existing  QScreen::name() workaround for Windows to new code (kde#429943)
+  * Fix parser treating empty IntList default as a list of single zero element: [0]
+  * Add test for empty default IntList config entry
+
kconfigwidgets
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * Port away from deprecated KCoreConfigSkeleton::ItemEnum::Choice2 typedef
+  * [kcodecaction] Deprecate QTextCodec and mib-based API (kde#463421)
+  * [kcodecaction] Add name-based trigger signal
+  * kcommandbar: Fix positioning when no mainwindow parent
+  * kcommandbar: Fix no central widget crashes app (kde#463251)
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * .kde-ci.yml: enable static CI builds
+  * [kcommandbar] Save last used items in state config
+  * [kcodecaction] Deprecate KEncodingProper-based API
+- Drop patch, now upstream:
+  * 0001-Copy-kf5_entry.desktop-to-their-respective-locale.patch
+
+- Add patch to add missing kf5_entry.desktop files (kde#413123):
+  * 0001-Copy-kf5_entry.desktop-to-their-respective-locale.patch
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * KHamburgerMenu: Reset when menu bar contents change
+  * [KRecentFilesAction] Fix broken recent files list (kde#461448)
+
kcontacts
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Make test failures fatal on Linux and FreeBSD CI
+  * Fix bug 395683 Entry for security-aware messengers (kde#395683)
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add setAddresses
+  * Add Windows Qt 6 CI
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * Make QtQuick trully optional
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * Bump deprecation KF version in ecm_set_disabled_deprecation_versions
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * Re-enable vCard CATEGORIES export
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Addressee: make birthday writable from QML (kde#446665)
+  * Fix bug 451962:  append Instant Messaging service list (kde#451962)
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Add Qt6 Android CI
+  * Split internal and external API into different files
+  * Also install the address format API header
+  * Improve output for incomplete addresses and formats with 3+ fields per line
+  * Rewrite the address formatter
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add CI qt6 support
+  * Utilize ECMDeprecationSettings to manage deprecate Qt/KF API
+  * Add .git-blame-ignore-revs file
+
kcoreaddons
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * don't needlessly copy urls while iterating
+  * KSandbox: Warn when running without flatpak-spawn privileges
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Config.cmake.in: workaround Inotify static issue
+  * Better Pluralize 'n minutes ago' (kde#462261)
+  * Fix portal urls cache on X11 (kde#460314)
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * [KJobTrackerInterface] qRegisterMetatype KJob::Unit
+  * Remove unused variable
+  * Perform initialization in initialization list
+
kcrash
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Remove dead code for startup id handling
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kcron
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Write into crontab instead of replacing the file
+  * Use new kauth includes
+  * This doesn't need Auth, AuthCore is enough
+  * It compiles fine against qt6
+  * Make doctool as optional
+- Drop patch, now upstream:
+  * 0001-Write-into-crontab-instead-of-replacing-the-file.patch
+
+- Replace %_libdir/libexec with %_libexecdir (boo#1174075)
+
kdav
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add Qt6 windows CI support
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * Remove unused includes
+  * Show all headers in qtc6
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Stabilize multi-fetch test
+  * Use a struct instead of QPair
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * port to standard C++ smart pointers where possible
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * autotests: fix \r\n problem on Windows
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Add Qt6 Android CI
+  * Fix the Qt6 Android build
+  * Add iCloud info to README
+  * Fix variable name typo
+  * Replace absolute URIs with relative ones in calendar-multiget request
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add CI qt6 support
+  * Fix header installation path to include module prefix
+  * Use uppercase "KDAV" name as qmake identifier, to be match KF standards
+  * Fix pri file to also note KCoreAddons dependency
+  * Fix non-existing include path set in pri file
+
kdbusaddons
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
kde-cli-tools5
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- No code changes since 5.27.1
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- No code changes since 5.27.0
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- No code changes since 5.26.90
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * kdeinhibit: Add ability to inhibit notifications
+  * In kf6 we use kservices6
+  * Not use forward and includes
+  * Find CoreAddons
+  * kdesu remove DCOP
+  * Add a clang-format commit to ignore file
+  * Remove code that has been commented out for two decades
+  * [kstart] Remove dead code
+  * [keditfiletype] Properly load parts in KF6
+  * Fix typo in dependency name
+  * Install translated documentation from po/ too
+  * kcmshell: Fix log formatting (x2)
+  * kcmshell: Fix log formatting
+  * [kdesu] Port away from KDEsuClient::isServerSGID
+  * Port away from deprecated KSycoca::databaseChanged
+  * Add Qt6 CI
+  * Remove unnecessary find
+  * Use KRuntimePlatform
+  * Address comments
+  * plasma-open-settings: Prefer plasma-settings if on mobile
+  * Make ksvgtopng a QGuiApplication
+  * Install po folder
+  * Set bugReportURL for filetypes KCM
+  * Remove unused includes
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- Changes since 5.26.3:
+  * Install translated documentation from po/ too
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * Install po folder
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Add missing license files and remove unused one
+  * Port away from deprecated KIO code
+  * We depend against qt5.15.2
+  * kstart: Don't print pid of spawned job
+  * Utilize kcmutils_generate_desktop_file cmake method
+  * KMessageBox::sorry is deprecated in kf5.97
+  * Fix DBus name for KPluginMetaData based KCMs (kde#455943)
+  * Request passing unit tests on Linux and BSD
+  * Use cmakedefine01
+  * Add missing include
+- Refresh kdesu-add-some-i18n-love.patch
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- Changes since 5.25.2:
+  * Fix DBus name for KPluginMetaData based KCMs (kde#455943)
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- No code changes since 5.24.90
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Changes since 5.24.5:
+  * Disable more deprecated fallback code paths
+  * Wrap deprecated API usage KCMShell in deprecation wrappers
+  * Qt::AA_UseHighDpiPixmaps is enabled by default in qt6
+  * Remaining bits to build with Qt6
+  * Remove ktraderclient for 6
+  * Port from KMimeTypeTrader to KParts::PartLoader
+  * Start to adapt build system for building against qt6
+  * kioclient: improve the format of the usage/help message
+  * plasma-open-settings: Support passing args as the path of the URL
+  * Remove explicit QuickSettings init method call
+  * plasma-open-settings: systemsettings5 is now systemsettings
+  * [keditfiletype] Set proper name in desktop file
+  * Convert KCM desktop file to JSON
+  * kcmshell: List KCMs that are queried without KServiceTypeTrader (kde#448396)
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
kde-dev-utils
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
kde-gtk-config5
+- Update to 5.27.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.2
+- Changes since 5.27.1:
+  * Avoid creating gtkrc-2.0 if it does not exist (kde#415770,kde#417534)
+
+- Update to 5.27.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.1
+- Changes since 5.27.0:
+  * xsettings: restrict `pidof` to own processes
+  * Add support for XWayland client scaling (kde#465733)
+  * Remove unnecessary `canConvert` check
+  * Unset `Gdk/UnscaledDPI` and `Gdk/WindowScalingFactor` on Wayland (kde#465733)
+
+- Update to 5.27.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.27.0
+- Changes since 5.26.90:
+  * Set DPI scaling settings for GTK on Plasma/X11 sessions (kde#442901)
+
+- Update to 5.26.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.90
+- Changes since 5.26.5:
+  * Provide implementation for DecoratedClient::windowClass()
+  * refactor: split config editor into smaller editors
+  * kded: properly delete factory to fix file descriptor leak (kde#458430,kde#458817)
+
+- Update to 5.26.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.5
+- No code changes since 5.26.4
+
+- Update to 5.26.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.4
+- No code changes since 5.26.3
+
+- Update to 5.26.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.3
+- No code changes since 5.26.2
+
+- Update to 5.26.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.2
+- No code changes since 5.26.1
+
+- Require gsettings-desktop-schemas otherwise the kded module
+  throws a fatal error in glib
+
+- Update to 5.26.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.1
+- No code changes since 5.26.0
+
+- Update to 5.26.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.26.0
+- Changes since 5.25.90:
+  * kded: properly delete factory to fix file descriptor leak (kde#458430,kde#458817)
+
+- Update to 5.25.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.90
+- Changes since 5.25.5:
+  * Also write CSS and assets to xdg-config/gtk-4.0 (kde#448675)
+  * Add FreeBSD Qt6 CI support
+  * Add missing license file
+  * Add Qt6 Linux CI
+  * Port away from deprecated KPluginLoader
+  * Adapt build system for supporting Qt6 as well
+  * Remove ServiceType from KDED metadata
+  * Request passing unit tests on Linux and BSD
+
+- Update to 5.25.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.5
+- No code changes since 5.25.4
+
+- Update to 5.25.4
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.4
+- No code changes since 5.25.3
+
+- Update to 5.25.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.3
+- No code changes since 5.25.2
+
+- Update to 5.25.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.2
+- No code changes since 5.25.1
+
+- Update to 5.25.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.1
+- No code changes since 5.25.0
+
+- Update to 5.25.0
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.25.0
+- No code changes since 5.24.90
+
+- Update to 5.24.90
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.90
+- Changes since 5.24.5:
+  * Prepare build system for building against qt6
+  * Port deprecated method
+  * Use the right data type for globalAnimationEntryValue
+  * Use Header palette if exists
+
+- Update to 5.24.5
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/plasma/5/5.24.5
+- No code changes since 5.24.4
+
kde-print-manager
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Don't require a not yet existing ECM version
+  * Port to PlasmaExtras version of Highlight
+  * applet: improve scrollview implementation
+  * Drop custom elide fading (kde#419916)
+  * [applet]: Fix scrolling in ScrollViews
+  * Port from ScrollArea to ScrollView
+  * enable the smb browse button (kde#368305)
+  * Use Q_EMIT
+  * Install KCMs in new namespaces
+  * Add CI
+
kdebugsettings
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix show headers in qtc6
+  * Use directly Qt::
+  * Use ecm_set_disabled_deprecation_versions
+  * Use new reuse-lint
+  * Add support for debug categories in qt6
+  * Use SingleMainWindow=true
+  * Add unity build support
+  * Try to activate qt6 CI support
+  * We need 5.90 for building against qt6
+  * Mark as single-instance using X-GNOME-SingleWindow key
+  * Allow to compile against qt6
+  * Add asan support
+  * Fix some licenses problem
+  * Fix typo
+
kdeclarative
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * draganddrop replace QList::first() with constFirst()
+  * calendarevents: add new alternate date ready signal and deprecate the old one
+  * Support modifierOnlyAllowed in KeySequenceItem
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Deprecate unused parts of KWindowSystem import
+  * tests: add test for multiple KeySequenceItems
+  * Fixed KF 5.100 compilation
+  * SimpleKCM: Account for flickable's margins when deciding to show separators
+  * SimpleKCM: Clean up a bit
+  * Fix build
+  * Deprecate QIconItem
+  * Use const/let for JS variables as appropriate
+  * Sync header and footer separator code to SimpleKCM (kde#461435)
+  * AbstractKCM: remove KF6 TODO
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Make QQmlContext's contextObject outlive the QQmlContext
+  * Completely deprecate KDeclarative class
+  * Port manual test app away from deprecated KDeclarative API
+  * Add Qt6 windows CI support
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * KeySequenceItem: Restore the previous value when it fails
+  * Remove project() calls from subdirs
+  * KeySequenceItem: Allow detecting when the key sequence is cleared (kde#458799)
+  * KeySequenceItem: Use the helper's shortcut instead of duplicating them
+  * KeySequenceItem: Disable clear button when there's no key sequence (kde#458798)
+  * KeySequenceItem: Cancel sequence recording when pressing the button
+  * KeySequenceItem: Remove workaround, it was addressed upstream
+  * KeySequenceItem: Show a cancel button when recording (kde#458796)
+  * GridDelegate: show tooltip when `toolTip` is empty and title/caption is elided
+  * AbstractKCM: make footer top padding optional
+  * [kquickaddons/configmodule] Make getters const
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * KQuickAddons::ConfigModule: Call QmlObject constructor with shared pointer directly
+  * KDeclarative::setupEngine: Use KQuickIconProvider
+  * Deprecate KDeclarative::setupEngine
+  * Do not build kpackagelauncherqml when building without deprecations
+  * Deprecate KPackage related methods in QmlObject
+  * Add FreeBSD Qt6 CI support
+  * fallbacktaphandler remove duplicate parentheses
+  * Deprecate KDeclarative::setupQmlJsDebugger
+  * KDeclarative::setupEngine: Wrap code that uses deprecated method in deprecation wrappers
+  * Deprecate KDeclarative::runtimePlatform and related methods
+  * Port tests away from QQC1
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * GridDelegate: Improve accessibility for inline buttons
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- Changes since 5.95.0:
+  * kquickcontrols: give main button a description
+  * kquickcontrols: give Clear button a tooltip
+  * Don't duplicate headers between cpp/.h files
+  * qmlcontrols: make `isPlatformX11` and `isPlatformWayland` constant
+  * qmlcontrols: add `isPlatformX11` and `isPlatformWayland` in `KWindowSystemProxy`
+  * qmlcontrols: add `Pad` fill mode in `QImageItem` (kde#389623)
+  * [KeySequenceItem] Replace attached object ToolTip with an instance
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- Changes since 5.94.0:
+  * qmlcontrols: bump `QtQuick` import version to 2.15 for GridViewInternal
+  * port to standard C++ smart pointers where possible
+  * Use the correct engine variable
+  * Remove KDeclarative instance from QmlObject
+  * QmlObject: Use std::shared_ptr to properly track the lifetime of QQmlEngine (kde#451790)
+  * Move type registrations to the plugin initialization
+  * calendareventsplugin: Add label property
+  * calendareventsplugin: Add support for alternate dates and sub-labels
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add PlaceholderMessage to GridView KCMs
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Deprecate KQuickAddons::QtQuickSettings::init
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Fix double deleting of NetworkAccessManagerFactory (kde#450507)
+  * Delete networkAccessManagerFactory when we delete the engine
+  * Improve Open[app]() functions (kde#443984)
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * proper position for top separator
+  * [KeySequenceItem] Make keySequence «non-null», «non-undefined» and «non-""»
+  * [KeySequenceItem] Fix code style and bump QML imports
+  * Make QML code depend less on the `kcm` context property
+  * Fix QT_NO_OPENGL build after 66c5bb0efa
+  * kquickcontrols: Improve accessibility in ColorButton.qml (kde#449282)
+  * GridDelegate: Focus on the delegate after a menu is closed
+  * GridDelegate: Open menu when Menu key is pressed
+  * Add CI qt6 support
+  * Exclude epoxy in qt6 => exclude plotter class
+  * Fix some compile error against qt6
+  * Deprecate KDeclarative::ConfigPropertyMap in favor of KConfigPropertyMap
+  * Apply fix from Volker
+  * Prepare build system for building against qt6
+  * fix autotests, avoid clash with bin/data on Windows
+  * Don't use KGlobalAccel on Windows
+
kdeconnect-kde
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * [Connectivity Report] Fixed crash if signalStrengths is
+    empty. (kde#449276)
+  * [SMS App] Prevent crash if a conversation doesn't have
+    any messages (kde#449719)
+  * Change tray icon so it is the right color on MacOS (kde#430226)
+  * Raise configuration window (MacOS bug) (kde#416050)
+  * plasmoid: Don't show redundant configure button in
+    placeholder message (kde#448457)
+  * Always show notification when receiving files (kde#417823)
+
+- Replace %_libdir/libexec with %_libexecdir (boo#1174075)
+
kded
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- Changes since 5.102.0:
+  * Only recreate icons if an icon dir changed (kde#463353)
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Watch for icons directory changes from KDED (kde#455702)
+
kdeedu-data
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
kdegraphics-thumbnailers
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * cmake: Make the mobipocket lib mandatory unless disabled
+  * Import the mobipocket thubmnailer from kdegraphics-mobipocket
+  * Add CI
+
kdelibs4support
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Fix dependency name
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add CMake option to build WITH_X11
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- No code change since 5.97.0
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- Changes since 5.96.0:
+  * Remove unused X-KDE-ModuleType
+  * Convert file to UTF-8
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- No code change since 5.93.0
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * autotests: adapt kmimetypetest after *.doc removal from kcoreaddons
+  * Use KDE_INSTALL_FULL_* variables where needed
+  * Don't assume libexec is a LIB_INSTALL_DIR subfolder
+- Drop patches, now upstream:
+  * 0001-Don-t-assume-libexec-is-a-LIB_INSTALL_DIR-subfolder.patch
+  * 0001-Use-KDE_INSTALL_FULL_-variables-where-needed.patch
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+- Add patch:
+  * 0001-Don-t-assume-libexec-is-a-LIB_INSTALL_DIR-subfolder.patch
+
+- Add patch to fix installation:
+  * 0001-Use-KDE_INSTALL_FULL_-variables-where-needed.patch
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Link against KF5::Auth
+  * Also add the KAuth dependency in the CI metadata
+  * find kf5auth
+
kdenetwork-filesharing
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Remove arcconfig file
+  * Add GitLab CI
+
+- Replace %_libdir/libexec with %_libexecdir (boo#1174075)
+
kdenlive
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+- Drop patch, merged upstream:
+  * 0001-Fix-designer-plugin-crash.patch
+
+- Add patch to prevent a designer-qt5 crash (boo#1206680):
+  * 0001-Fix-designer-plugin-crash.patch
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Recommend installation of the mediainfo executable (boo#1202848)
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * [Render Widget] Refactoring and feature extension (kde#415610)
+  * "Add Marker/Guide quickly" allow shortcut * only on keypad
+    (otherwise * is ambigous with Shift++) (kde#434411)
+  * Fix action name: "Save Timeline Zone to Bin" is not what it does (kde#436386)
+  * Try to improve alpha render quality (kde#436879)
+  * Fix alpha render and add utvideo (kde#448010)
+  * [OTIO] Differentiate between read and write adapters (kde#448318)
+  * Add python interface (kde#423083)
+  * Don't attempt to create audio thumbs if thumbs are disabled. (kde#448304)
+  * Use a SPDX standard license identifier in Appstream data (kde#448134)
+  * Make it possible to enable/disable track with a shortcut (kde#440181)
+- Drop obsolete patch:
+  * 0001-Handle-the-melt-package-rename-nicely.patch
+
kdepim-addons
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * Fix build import/export plugins. (kde#432228)
+
kdepim-runtime
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes to list here.
+
kdesdk-kioslaves
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add GitLab CI
+
kdesdk-scripts
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Silence two valgrind warnings in libdl and forkfd
+  * cmakelists_install_vars.pl: handle also recently
+    added SYSTEMD_* vars
+  * Add apollozhu to relicensecheck.pl
+  * Add CI
+
kdesdk-thumbnailers
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add GitLab CI
+
kdesignerplugin
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Fix localization files install path
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * add win ci, for kdelibs4support
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- No code change since 5.97.0
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- No code change since 5.93.0
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- No code change since 5.92.0
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- No code change since 5.90.0
+
kdesu
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- Changes since 5.100.0:
+  * Include sys/prctl.h only on Linux
+
+- Drop fpie.patch, works as expected without
+
+- Drop setgid bit on kdesud, no longer needed since 5.99.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Add missing deprecation wrapper for KDEsuClient::isServerSGID impl
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * Cleanups for the preceding commit
+  * Drop setgid in favor of disabling process tracability explicitly
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Remove dead code
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- No code change since 5.93.0
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- Changes since 5.91.0:
+  * Drop obsolete KF5Service and add KF5Config dependency
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Check executables exist in PATH before passing them to QProcess
+  * Fix build on glibc < 2.34 (kde#449114)
+  * Port from KToolInvocation::kdeinitExecWait (deprecated) to QProcess
+  * kdesud: close all file descriptors > 3 on exec()
+  * Use includes that also work with Qt6
+
kdesvn
+- Spec cleanup
+
kdevelop5
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+- Update build constraints
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Too many changes since 21.12.3, only listing bugfixes:
+  * makebuilder: Change default number of jobs from 2 to 1 (kde#448251)
+  * Fix a crash when renaming a variable (in executeRenameAction) (kde#444567)
+  * Fix meson executable (kde#412477)
+  * DocumentParsePlan: don't cache often-invalidated cend() (kde#445699)
+  * Add some of the missing KTextEditor interface methods (kde#441908)
+
kdevelop5-plugin-php
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
kdevelop5-plugin-python3
+- Add patch that fixes build with python < 3.9 as in SLE/Backports:
+  * fix-for-python3.6.patch
+
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Build for Python 3.9 instead of Python3.10
+  * https://invent.kde.org/kdevelop/kdev-python/-/issues/4
+  * bpo#40939
+  * rh#1898116
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add CI
+
kdf
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Fix ki18n_install(po) being removed without reason
+  * USe ecm_set_disabled_deprecation_versions
+  * Update settings panel for Flatpak
+  * Simplify condition checks
+  * Add feature to use system default file manager to open drive (kde#448764)
+  * Add content rating
+  * It's enabled by default in qt6
+  * Remove unused include
+  * Adapt build system for building against qt6
+  * Port deprecated method + make doctool as optional
+  * Show warning
+  * Not neccessary to use I18N_NOOP here
+
kdialog
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * We depend against qt5.15
+  * We already use "dlg.setOption(QFileDialog::ShowDirsOnly, true);"
+  * appstream: Remove duplicated release info
+
kdiamond
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Kdelibs4ConfigMigrator was removed in qt6
+  * Increase required KF5
+  * Adapt build system for building against qt6
+  * Make doctool as optional
+
kdnssd
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * Add GitLab CI
+
kdnssd-framework
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- Changes since 5.99.0:
+  * Fix the translation folder name
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- Changes since 5.98.0:
+  * .gitlab-ci.yml: enable static builds
+  * Add Qt6 windows CI support
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- Changes since 5.97.0:
+  * Add FreeBSD Qt6 CI support
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- Changes since 5.92.0:
+  * Require unittests to pass for CI jobs to pass
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- Changes since 5.90.0:
+  * Add CI qt6 support
+
kdoctools
+- Update to 5.103.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.103.0
+- No code change since 5.102.0
+
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- Changes since 5.101.0:
+  * Adding myself to the contributor list
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
keditbookmarks
+- Update to 22.12.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.3/
+
+- Update to 22.12.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.2/
+
+- Update to 22.12.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.1/
+
+- Update to 22.12.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.12.0/
+
+- Update to 22.11.90
+  * New feature release
+
+- Update to 22.11.80
+  * New feature release
+
+- Update to 22.08.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.3/
+
+- Update to 22.08.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.2/
+
+- Update to 22.08.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.1/
+
+- Update to 22.08.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.08.0/
+
+- Update to 22.07.90
+  * New feature release
+
+- Update to 22.07.80
+  * New feature release
+
+- Update to 22.04.3
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.3/
+
+- Update to 22.04.2
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.2/
+
+- Update to 22.04.1
+  * New bugfix release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.1/
+
+- Update to 22.04.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/gear/22.04.0/
+
+- Update to 22.03.90
+  * New feature release
+
+- Update to 22.03.80
+  * New feature release
+- Changes since 21.12.3:
+  * It's removed in qt6
+  * Adapt build system for building against qt6
+  * Fix compile against qt6
+  * Make doctool as optional
+  * We depend agains 5.85.
+
kemoticons
+- Update to 5.102.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.102.0
+- No code change since 5.101.0
+
+- Update to 5.101.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.101.0
+- No code change since 5.100.0
+
+- Update to 5.100.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.100.0
+- No code change since 5.99.0
+
+- Update to 5.99.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.99.0
+- No code change since 5.98.0
+
+- Update to 5.98.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.98.0
+- No code change since 5.97.0
+
+- Update to 5.97.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.97.0
+- No code change since 5.96.0
+
+- Update to 5.96.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.96.0
+- No code change since 5.95.0
+
+- Update to 5.95.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.95.0
+- No code change since 5.94.0
+
+- Update to 5.94.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.94.0
+- Changes since 5.93.0:
+  * Add windows CI
+
+- Update to 5.93.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.93.0
+- No code change since 5.92.0
+
+- Update to 5.92.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.92.0
+- No code change since 5.91.0
+
+- Update to 5.91.0
+  * New feature release
+  * For more details please see:
+  * https://kde.org/announcements/frameworks/5/5.91.0
+- No code change since 5.90.0
+
kernel-64kb
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-azure
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- powerpc/64s: Make POWER10 and later use pause_short in cpu_relax
+  loops (bsc#1208376 ltc#201076).
+- powerpc: add ISA v3.0 / v3.1 wait opcode macro (bsc#1208376
+  ltc#201076).
+- commit 2a06230
+
+- ibmvnic: Assign XPS map to correct queue index (bsc#1208757
+  ltc#201720 jsc#PED-2322 git-fixes).
+- commit be76316
+
+- Update
+  patches.suse/usb-dwc3-dwc3-qcom-Add-missing-platform_device_put-i.patch
+  (bsc#1208741 CVE-2023-22995).
+  Added CVE reference for fix already present
+- commit 80a158a
+
+- loop: fix ioctl calls using compat_loop_info (bsc#1207333).
+- commit 11a60da
+
+- Add missing s390 vfio patch hunk (bsc#1208565 ltc#201535).
+- Refresh patches.suse/vfio-simplify-iommu-group-allocation-for-mediated-devices.
+- Refresh patches.suse/s390-vfio-ap-prepare-for-dynamic-update-of-guest-s-APCB-on-queue.
+- Refresh patches.suse/s390-vfio-ap-rename-matrix_dev-lock-mutex-to-matrix_dev-mdevs_lo.
+- commit 43ce0be
+
+- Update kabi files.
+  Based on PublicBeta-202302 ISO, kernel 5.14.21-150500.40.1
+- commit 2b36ed6
+
+- Update
+  patches.suse/usb-rndis_host-Secure-rndis_query-check-against-int-.patch
+  (CVE-2023-23559 bsc#1207051).
+  Added CVE reference to existing fix
+- commit af8ad62
+
kernel-debug
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-default
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-docs
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-kvmsmall
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-obs-build
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX path (bsc#1209079).
+- bnxt_en: Simplify bnxt_xdp_buff_init() (bsc#1209079).
+- commit 776d314
+
+- netlink: prevent potential spectre v1 gadgets (bsc#1209547
+  CVE-2017-5753).
+- commit 82fdaab
+
+- ppc64le: HWPOISON_INJECT=m (bsc#1209572).
+- commit 3d2007b
+
+- Update references in
+  patches.suse/media-dvb-usb-az6027-fix-null-ptr-deref-in-az6027_i2.patch
+  (git-fixes bsc#1209291 CVE-2023-28328).
+- commit eeabf0f
+
+- s390/kexec: fix ipl report address for kdump (bsc#1207529).
+- commit a28d6d2
+
+- rds: rds_rm_zerocopy_callback() correct order for
+  list_add_tail() (CVE-2023-1078 bsc#1208601).
+- rds: rds_rm_zerocopy_callback() use list_first_entry()
+  (CVE-2023-1078 bsc#1208601).
+- commit 590edab
+
+- kABI workaround for struct fb_deferred_io changes (bsc#1208266).
+- commit 4c272e6
+
+- fbdev: Fix incorrect page mapping clearance at
+  fb_deferred_io_release() (bsc#1208266).
+- commit a4b869b
+
+- Move upstreamed fbdev fix into sorted section
+- commit 322351e
+
+- rpm/group-source-files.pl: Deal with {pre,post}fixed / in location
+  When the source file location provided with -L is either prefixed or
+  postfixed with forward slash, the script get stuck in a infinite loop
+  inside calc_dirs() where $path is an empty string.
+  user@localhost:/tmp> perl "$HOME/group-source-files.pl" -D devel.files -N nondevel.files -L /usr/src/linux-5.14.21-150500.41/
+  ...
+  path = /usr/src/linux-5.14.21-150500.41/Documentation/Kconfig
+  path = /usr/src/linux-5.14.21-150500.41/Documentation
+  path = /usr/src/linux-5.14.21-150500.41
+  path = /usr/src
+  path = /usr
+  path =
+  path =
+  path =
+  ... # Stuck in an infinite loop
+  This workarounds the issue by breaking out the loop once path is an
+  empty string. For a proper fix we'd want something that
+  filesystem-aware, but this workaround should be enough for the rare
+  occation that this script is ran manually.
+  Link: http://mailman.suse.de/mlarch/SuSE/kernel/2023/kernel.2023.03/msg00024.html
+- commit 6d65136
+
+- kernel-module-subpackage: Fix expansion with -b parameter (bsc#1208179).
+  When -b is specified the script is prefixed with KMP_NEEDS_MKINITRD=1
+  which sets the variable for a simple command.
+  However, the script is no longer a simple command. Export the variable
+  instead.
+- commit 152a069
+
+- Refresh
+  patches.suse/ice-Do-not-skip-not-enabled-queues-in-ice_vc_dis_qs_.patch.
+- Refresh
+  patches.suse/ice-clear-stale-Tx-queue-settings-before-configuring.patch.
+  Fix bug introduced by broken backport (bsc#1208628).
+- commit d43449e
+
+- Move upstreamed ipmi patches into sorted section
+- commit 6815ed5
+
+- xfs: get root inode correctly at bulkstat (git-fixes bsc#1207501
+  ltc#201370).
+- commit cc3c733
+
+- Update config files to enable CONFIG_IMA_DISABLE_HTABLE (bsc#1207301)
+- ppc64le/default, arm64/default, armv7hl/default,s390x/default,
+  x86_64/default
+- commit c4d15e7
+
+- qlcnic: prevent ->dcb use-after-free on qlcnic_dcb_enable()
+  failure (jsc#PED-1523).
+- commit d6be7f9
+
+- qlcnic: Clean up some inconsistent indenting (jsc#PED-1523).
+- commit 721c552
+
+- drivers: net: qlcnic: Fix potential memory leak in
+  qlcnic_sriov_init() (jsc#PED-1523).
+- commit 821568b
+
kernel-obs-qa
+- bnxt_en: Avoid order-5 memory allocation for TPA data
+  (bsc#1209079).
+- bnxt_en: Fix mqprio and XDP ring checking logic (bsc#1209079).
+- bnxt: Do not read past the end of test names (bsc#1209079).
+- bnxt: make sure we return pages to the pool (bsc#1209079).
+- bnxt_en: Fix HDS and jumbo thresholds for RX packets
+  (bsc#1209079).
+- bnxt_en: Fix first buffer size calculations for XDP multi-buffer
+  (bsc#1209079).
+- bnxt_en: Fix XDP RX